From 45615b7f4b7b50df29dc14bcb74fd13850bb7633 Mon Sep 17 00:00:00 2001 From: Patrick Mackinlay Date: Thu, 28 May 2020 20:24:40 +0700 Subject: asmjit: new 3rdparty library --- 3rdparty/README.md | 2 + 3rdparty/asmjit/.editorconfig | 10 + 3rdparty/asmjit/.gitignore | 6 + 3rdparty/asmjit/.travis.yml | 303 + 3rdparty/asmjit/CMakeLists.txt | 496 ++ 3rdparty/asmjit/LICENSE.md | 17 + 3rdparty/asmjit/README.md | 1954 +++++++ 3rdparty/asmjit/src/asmjit.natvis | 83 + 3rdparty/asmjit/src/asmjit/asmjit.h | 58 + 3rdparty/asmjit/src/asmjit/core.h | 102 + 3rdparty/asmjit/src/asmjit/core/api-build_p.h | 77 + 3rdparty/asmjit/src/asmjit/core/api-config.h | 533 ++ 3rdparty/asmjit/src/asmjit/core/arch.cpp | 176 + 3rdparty/asmjit/src/asmjit/core/arch.h | 204 + 3rdparty/asmjit/src/asmjit/core/assembler.cpp | 514 ++ 3rdparty/asmjit/src/asmjit/core/assembler.h | 176 + 3rdparty/asmjit/src/asmjit/core/builder.cpp | 1004 ++++ 3rdparty/asmjit/src/asmjit/core/builder.h | 1305 +++++ 3rdparty/asmjit/src/asmjit/core/callconv.cpp | 59 + 3rdparty/asmjit/src/asmjit/core/callconv.h | 411 ++ .../asmjit/src/asmjit/core/codebufferwriter_p.h | 188 + 3rdparty/asmjit/src/asmjit/core/codeholder.cpp | 1125 ++++ 3rdparty/asmjit/src/asmjit/core/codeholder.h | 930 +++ 3rdparty/asmjit/src/asmjit/core/compiler.cpp | 669 +++ 3rdparty/asmjit/src/asmjit/core/compiler.h | 674 +++ 3rdparty/asmjit/src/asmjit/core/constpool.cpp | 375 ++ 3rdparty/asmjit/src/asmjit/core/constpool.h | 257 + 3rdparty/asmjit/src/asmjit/core/cpuinfo.cpp | 97 + 3rdparty/asmjit/src/asmjit/core/cpuinfo.h | 152 + 3rdparty/asmjit/src/asmjit/core/datatypes.h | 1073 ++++ 3rdparty/asmjit/src/asmjit/core/emitter.cpp | 272 + 3rdparty/asmjit/src/asmjit/core/emitter.h | 554 ++ 3rdparty/asmjit/src/asmjit/core/features.h | 162 + 3rdparty/asmjit/src/asmjit/core/func.cpp | 144 + 3rdparty/asmjit/src/asmjit/core/func.h | 966 ++++ 3rdparty/asmjit/src/asmjit/core/globals.cpp | 131 + 3rdparty/asmjit/src/asmjit/core/globals.h | 425 ++ 3rdparty/asmjit/src/asmjit/core/inst.cpp | 139 + 3rdparty/asmjit/src/asmjit/core/inst.h | 469 ++ 3rdparty/asmjit/src/asmjit/core/jitallocator.cpp | 1152 ++++ 3rdparty/asmjit/src/asmjit/core/jitallocator.h | 278 + 3rdparty/asmjit/src/asmjit/core/jitruntime.cpp | 156 + 3rdparty/asmjit/src/asmjit/core/jitruntime.h | 126 + 3rdparty/asmjit/src/asmjit/core/logging.cpp | 535 ++ 3rdparty/asmjit/src/asmjit/core/logging.h | 355 ++ 3rdparty/asmjit/src/asmjit/core/misc_p.h | 49 + 3rdparty/asmjit/src/asmjit/core/operand.cpp | 136 + 3rdparty/asmjit/src/asmjit/core/operand.h | 1337 +++++ 3rdparty/asmjit/src/asmjit/core/osutils.cpp | 106 + 3rdparty/asmjit/src/asmjit/core/osutils.h | 139 + 3rdparty/asmjit/src/asmjit/core/raassignment_p.h | 399 ++ 3rdparty/asmjit/src/asmjit/core/rabuilders_p.h | 632 ++ 3rdparty/asmjit/src/asmjit/core/radefs_p.h | 1094 ++++ 3rdparty/asmjit/src/asmjit/core/ralocal.cpp | 1041 ++++ 3rdparty/asmjit/src/asmjit/core/ralocal_p.h | 281 + 3rdparty/asmjit/src/asmjit/core/rapass.cpp | 1994 +++++++ 3rdparty/asmjit/src/asmjit/core/rapass_p.h | 1189 ++++ 3rdparty/asmjit/src/asmjit/core/rastack.cpp | 207 + 3rdparty/asmjit/src/asmjit/core/rastack_p.h | 183 + 3rdparty/asmjit/src/asmjit/core/string.cpp | 545 ++ 3rdparty/asmjit/src/asmjit/core/string.h | 352 ++ 3rdparty/asmjit/src/asmjit/core/support.cpp | 499 ++ 3rdparty/asmjit/src/asmjit/core/support.h | 1411 +++++ 3rdparty/asmjit/src/asmjit/core/target.cpp | 38 + 3rdparty/asmjit/src/asmjit/core/target.h | 210 + 3rdparty/asmjit/src/asmjit/core/type.cpp | 44 + 3rdparty/asmjit/src/asmjit/core/type.h | 398 ++ 3rdparty/asmjit/src/asmjit/core/virtmem.cpp | 589 ++ 3rdparty/asmjit/src/asmjit/core/virtmem.h | 145 + 3rdparty/asmjit/src/asmjit/core/zone.cpp | 382 ++ 3rdparty/asmjit/src/asmjit/core/zone.h | 642 +++ 3rdparty/asmjit/src/asmjit/core/zonehash.cpp | 331 ++ 3rdparty/asmjit/src/asmjit/core/zonehash.h | 217 + 3rdparty/asmjit/src/asmjit/core/zonelist.cpp | 182 + 3rdparty/asmjit/src/asmjit/core/zonelist.h | 203 + 3rdparty/asmjit/src/asmjit/core/zonestack.cpp | 197 + 3rdparty/asmjit/src/asmjit/core/zonestack.h | 234 + 3rdparty/asmjit/src/asmjit/core/zonestring.h | 125 + 3rdparty/asmjit/src/asmjit/core/zonetree.cpp | 118 + 3rdparty/asmjit/src/asmjit/core/zonetree.h | 385 ++ 3rdparty/asmjit/src/asmjit/core/zonevector.cpp | 375 ++ 3rdparty/asmjit/src/asmjit/core/zonevector.h | 699 +++ 3rdparty/asmjit/src/asmjit/x86.h | 42 + 3rdparty/asmjit/src/asmjit/x86/x86assembler.cpp | 4747 +++++++++++++++ 3rdparty/asmjit/src/asmjit/x86/x86assembler.h | 102 + 3rdparty/asmjit/src/asmjit/x86/x86builder.cpp | 69 + 3rdparty/asmjit/src/asmjit/x86/x86builder.h | 79 + 3rdparty/asmjit/src/asmjit/x86/x86callconv.cpp | 163 + 3rdparty/asmjit/src/asmjit/x86/x86callconv_p.h | 50 + 3rdparty/asmjit/src/asmjit/x86/x86compiler.cpp | 76 + 3rdparty/asmjit/src/asmjit/x86/x86compiler.h | 288 + 3rdparty/asmjit/src/asmjit/x86/x86emitter.h | 5566 ++++++++++++++++++ 3rdparty/asmjit/src/asmjit/x86/x86features.cpp | 393 ++ 3rdparty/asmjit/src/asmjit/x86/x86features.h | 286 + 3rdparty/asmjit/src/asmjit/x86/x86globals.h | 2039 +++++++ 3rdparty/asmjit/src/asmjit/x86/x86instapi.cpp | 1543 +++++ 3rdparty/asmjit/src/asmjit/x86/x86instapi_p.h | 59 + 3rdparty/asmjit/src/asmjit/x86/x86instdb.cpp | 3983 +++++++++++++ 3rdparty/asmjit/src/asmjit/x86/x86instdb.h | 471 ++ 3rdparty/asmjit/src/asmjit/x86/x86instdb_p.h | 318 + 3rdparty/asmjit/src/asmjit/x86/x86internal.cpp | 1633 ++++++ 3rdparty/asmjit/src/asmjit/x86/x86internal_p.h | 87 + 3rdparty/asmjit/src/asmjit/x86/x86logging.cpp | 781 +++ 3rdparty/asmjit/src/asmjit/x86/x86logging_p.h | 72 + 3rdparty/asmjit/src/asmjit/x86/x86opcode_p.h | 452 ++ 3rdparty/asmjit/src/asmjit/x86/x86operand.cpp | 271 + 3rdparty/asmjit/src/asmjit/x86/x86operand.h | 1060 ++++ 3rdparty/asmjit/src/asmjit/x86/x86rapass.cpp | 1172 ++++ 3rdparty/asmjit/src/asmjit/x86/x86rapass_p.h | 118 + 3rdparty/asmjit/test/asmjit_bench_x86.cpp | 168 + 3rdparty/asmjit/test/asmjit_test_misc.h | 186 + 3rdparty/asmjit/test/asmjit_test_opcode.cpp | 108 + 3rdparty/asmjit/test/asmjit_test_opcode.h | 6060 ++++++++++++++++++++ 3rdparty/asmjit/test/asmjit_test_unit.cpp | 332 ++ 3rdparty/asmjit/test/asmjit_test_x86_asm.cpp | 195 + 3rdparty/asmjit/test/asmjit_test_x86_cc.cpp | 4167 ++++++++++++++ 3rdparty/asmjit/test/asmjit_test_x86_sections.cpp | 176 + 3rdparty/asmjit/test/broken.cpp | 312 + 3rdparty/asmjit/test/broken.h | 148 + 3rdparty/asmjit/tools/configure-makefiles.sh | 17 + 3rdparty/asmjit/tools/configure-ninja.sh | 17 + 3rdparty/asmjit/tools/configure-sanitizers.sh | 17 + 3rdparty/asmjit/tools/configure-vs-x64.bat | 9 + 3rdparty/asmjit/tools/configure-vs-x86.bat | 9 + 3rdparty/asmjit/tools/configure-xcode.sh | 9 + 3rdparty/asmjit/tools/tablegen-x86.js | 2430 ++++++++ 3rdparty/asmjit/tools/tablegen.js | 934 +++ 3rdparty/asmjit/tools/tablegen.sh | 3 + 128 files changed, 77219 insertions(+) create mode 100644 3rdparty/asmjit/.editorconfig create mode 100644 3rdparty/asmjit/.gitignore create mode 100644 3rdparty/asmjit/.travis.yml create mode 100644 3rdparty/asmjit/CMakeLists.txt create mode 100644 3rdparty/asmjit/LICENSE.md create mode 100644 3rdparty/asmjit/README.md create mode 100644 3rdparty/asmjit/src/asmjit.natvis create mode 100644 3rdparty/asmjit/src/asmjit/asmjit.h create mode 100644 3rdparty/asmjit/src/asmjit/core.h create mode 100644 3rdparty/asmjit/src/asmjit/core/api-build_p.h create mode 100644 3rdparty/asmjit/src/asmjit/core/api-config.h create mode 100644 3rdparty/asmjit/src/asmjit/core/arch.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/arch.h create mode 100644 3rdparty/asmjit/src/asmjit/core/assembler.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/assembler.h create mode 100644 3rdparty/asmjit/src/asmjit/core/builder.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/builder.h create mode 100644 3rdparty/asmjit/src/asmjit/core/callconv.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/callconv.h create mode 100644 3rdparty/asmjit/src/asmjit/core/codebufferwriter_p.h create mode 100644 3rdparty/asmjit/src/asmjit/core/codeholder.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/codeholder.h create mode 100644 3rdparty/asmjit/src/asmjit/core/compiler.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/compiler.h create mode 100644 3rdparty/asmjit/src/asmjit/core/constpool.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/constpool.h create mode 100644 3rdparty/asmjit/src/asmjit/core/cpuinfo.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/cpuinfo.h create mode 100644 3rdparty/asmjit/src/asmjit/core/datatypes.h create mode 100644 3rdparty/asmjit/src/asmjit/core/emitter.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/emitter.h create mode 100644 3rdparty/asmjit/src/asmjit/core/features.h create mode 100644 3rdparty/asmjit/src/asmjit/core/func.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/func.h create mode 100644 3rdparty/asmjit/src/asmjit/core/globals.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/globals.h create mode 100644 3rdparty/asmjit/src/asmjit/core/inst.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/inst.h create mode 100644 3rdparty/asmjit/src/asmjit/core/jitallocator.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/jitallocator.h create mode 100644 3rdparty/asmjit/src/asmjit/core/jitruntime.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/jitruntime.h create mode 100644 3rdparty/asmjit/src/asmjit/core/logging.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/logging.h create mode 100644 3rdparty/asmjit/src/asmjit/core/misc_p.h create mode 100644 3rdparty/asmjit/src/asmjit/core/operand.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/operand.h create mode 100644 3rdparty/asmjit/src/asmjit/core/osutils.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/osutils.h create mode 100644 3rdparty/asmjit/src/asmjit/core/raassignment_p.h create mode 100644 3rdparty/asmjit/src/asmjit/core/rabuilders_p.h create mode 100644 3rdparty/asmjit/src/asmjit/core/radefs_p.h create mode 100644 3rdparty/asmjit/src/asmjit/core/ralocal.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/ralocal_p.h create mode 100644 3rdparty/asmjit/src/asmjit/core/rapass.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/rapass_p.h create mode 100644 3rdparty/asmjit/src/asmjit/core/rastack.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/rastack_p.h create mode 100644 3rdparty/asmjit/src/asmjit/core/string.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/string.h create mode 100644 3rdparty/asmjit/src/asmjit/core/support.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/support.h create mode 100644 3rdparty/asmjit/src/asmjit/core/target.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/target.h create mode 100644 3rdparty/asmjit/src/asmjit/core/type.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/type.h create mode 100644 3rdparty/asmjit/src/asmjit/core/virtmem.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/virtmem.h create mode 100644 3rdparty/asmjit/src/asmjit/core/zone.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/zone.h create mode 100644 3rdparty/asmjit/src/asmjit/core/zonehash.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/zonehash.h create mode 100644 3rdparty/asmjit/src/asmjit/core/zonelist.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/zonelist.h create mode 100644 3rdparty/asmjit/src/asmjit/core/zonestack.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/zonestack.h create mode 100644 3rdparty/asmjit/src/asmjit/core/zonestring.h create mode 100644 3rdparty/asmjit/src/asmjit/core/zonetree.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/zonetree.h create mode 100644 3rdparty/asmjit/src/asmjit/core/zonevector.cpp create mode 100644 3rdparty/asmjit/src/asmjit/core/zonevector.h create mode 100644 3rdparty/asmjit/src/asmjit/x86.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86assembler.cpp create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86assembler.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86builder.cpp create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86builder.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86callconv.cpp create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86callconv_p.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86compiler.cpp create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86compiler.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86emitter.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86features.cpp create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86features.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86globals.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86instapi.cpp create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86instapi_p.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86instdb.cpp create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86instdb.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86instdb_p.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86internal.cpp create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86internal_p.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86logging.cpp create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86logging_p.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86opcode_p.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86operand.cpp create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86operand.h create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86rapass.cpp create mode 100644 3rdparty/asmjit/src/asmjit/x86/x86rapass_p.h create mode 100644 3rdparty/asmjit/test/asmjit_bench_x86.cpp create mode 100644 3rdparty/asmjit/test/asmjit_test_misc.h create mode 100644 3rdparty/asmjit/test/asmjit_test_opcode.cpp create mode 100644 3rdparty/asmjit/test/asmjit_test_opcode.h create mode 100644 3rdparty/asmjit/test/asmjit_test_unit.cpp create mode 100644 3rdparty/asmjit/test/asmjit_test_x86_asm.cpp create mode 100644 3rdparty/asmjit/test/asmjit_test_x86_cc.cpp create mode 100644 3rdparty/asmjit/test/asmjit_test_x86_sections.cpp create mode 100644 3rdparty/asmjit/test/broken.cpp create mode 100644 3rdparty/asmjit/test/broken.h create mode 100644 3rdparty/asmjit/tools/configure-makefiles.sh create mode 100644 3rdparty/asmjit/tools/configure-ninja.sh create mode 100644 3rdparty/asmjit/tools/configure-sanitizers.sh create mode 100644 3rdparty/asmjit/tools/configure-vs-x64.bat create mode 100644 3rdparty/asmjit/tools/configure-vs-x86.bat create mode 100644 3rdparty/asmjit/tools/configure-xcode.sh create mode 100644 3rdparty/asmjit/tools/tablegen-x86.js create mode 100644 3rdparty/asmjit/tools/tablegen.js create mode 100644 3rdparty/asmjit/tools/tablegen.sh (limited to '3rdparty') diff --git a/3rdparty/README.md b/3rdparty/README.md index ca16f13b7b1..e152a8a7e12 100644 --- a/3rdparty/README.md +++ b/3rdparty/README.md @@ -2,6 +2,8 @@ asio - [Boost Software License](http://www.boost.org/LICENSE_1_0.txt) +asmjit - [zlib license](http://opensource.org/licenses/Zlib) + benchmark - [Apache License, Version 2.0](http://opensource.org/licenses/Apache-2.0) (used only for testing, not part of distribution) bgfx - [The BSD 2-Clause License](http://opensource.org/licenses/BSD-2-Clause) diff --git a/3rdparty/asmjit/.editorconfig b/3rdparty/asmjit/.editorconfig new file mode 100644 index 00000000000..5a3a48d31f3 --- /dev/null +++ b/3rdparty/asmjit/.editorconfig @@ -0,0 +1,10 @@ +# Editor configuration, see https://editorconfig.org for more details. +root = true + +[*.{cpp,h,natvis}] +charset = utf-8 +end_of_line = lf +indent_style = space +indent_size = 2 +insert_final_newline = true +trim_trailing_whitespace = true diff --git a/3rdparty/asmjit/.gitignore b/3rdparty/asmjit/.gitignore new file mode 100644 index 00000000000..34bbad2b75f --- /dev/null +++ b/3rdparty/asmjit/.gitignore @@ -0,0 +1,6 @@ +.vscode +.kdev4 +*.kdev4 +build +build_* +tools/asmdb diff --git a/3rdparty/asmjit/.travis.yml b/3rdparty/asmjit/.travis.yml new file mode 100644 index 00000000000..b64f9eb3a86 --- /dev/null +++ b/3rdparty/asmjit/.travis.yml @@ -0,0 +1,303 @@ +language: cpp + +git: + depth: false + +env: + global: + - BUILD_TOOLCHAIN="Unix Makefiles" + - MAKEFLAGS="-j2" + +dist: bionic + +matrix: + include: + - name: "Linux Clang Default [64-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=clang-9 && CXX=clang++-9" + os: linux + addons: + apt: + sources: + - sourceline: "ppa:ubuntu-toolchain-r/test" + packages: [clang++-9] + + - name: "Linux Clang Default [64-bit] [REL]" + env: BUILD_MATRIX="BUILD_TYPE=Release && CC=clang-9 && CXX=clang++-9" + os: linux + addons: + apt: + sources: + - sourceline: "ppa:ubuntu-toolchain-r/test" + packages: [clang++-9] + + - name: "Linux Clang Default [64-bit] [REL] [Valgrind]" + env: BUILD_MATRIX="BUILD_TYPE=Release && CC=clang-9 && CXX=clang++-9" USE_VALGRIND=1 + os: linux + addons: + apt: + sources: + - sourceline: "ppa:ubuntu-toolchain-r/test" + packages: [clang++-9, valgrind] + + - name: "Linux Clang Default [64-bit] [REL] [Sanitize=Address]" + env: BUILD_MATRIX="BUILD_TYPE=Release && CC=clang-9 && CXX=clang++-9" EXTRA_OPTIONS="-DASMJIT_SANITIZE=address" + os: linux + addons: + apt: + sources: + - sourceline: "ppa:ubuntu-toolchain-r/test" + packages: [clang++-9] + + - name: "Linux Clang Default [64-bit] [REL] [Sanitize=Undefined]" + env: BUILD_MATRIX="BUILD_TYPE=Release && CC=clang-9 && CXX=clang++-9" EXTRA_OPTIONS="-DASMJIT_SANITIZE=undefined" + os: linux + addons: + apt: + sources: + - sourceline: "ppa:ubuntu-toolchain-r/test" + packages: [clang++-9] + + - name: "Linux Clang Default [64-bit] [REL] [NoBuilder]" + env: BUILD_MATRIX="BUILD_TYPE=Release && CC=clang-9 && CXX=clang++-9" EXTRA_OPTIONS="-DASMJIT_NO_BUILDER=1" + os: linux + addons: + apt: + sources: + - sourceline: "ppa:ubuntu-toolchain-r/test" + packages: [clang++-9] + + - name: "Linux Clang Default [64-bit] [REL] [NoCompiler]" + env: BUILD_MATRIX="BUILD_TYPE=Release && CC=clang-9 && CXX=clang++-9" EXTRA_OPTIONS="-DASMJIT_NO_COMPILER=1" + os: linux + addons: + apt: + sources: + - sourceline: "ppa:ubuntu-toolchain-r/test" + packages: [clang++-9] + + - name: "Linux Clang Default [64-bit] [REL] [NoLogging]" + env: BUILD_MATRIX="BUILD_TYPE=Release && CC=clang-9 && CXX=clang++-9" EXTRA_OPTIONS="-DASMJIT_NO_LOGGING=1" + os: linux + addons: + apt: + sources: + - sourceline: "ppa:ubuntu-toolchain-r/test" + packages: [clang++-9] + + - name: "Linux GCC 4.8 [32-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=gcc-4.8 && CXX=g++-4.8" CXXFLAGS=-m32 LDFLAGS=-m32 + os: linux + addons: + apt: + packages: [g++-4.8, g++-4.8-multilib, "linux-libc-dev:i386"] + + - name: "Linux GCC 4.8 [64-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=gcc-4.8 && CXX=g++-4.8" + os: linux + addons: + apt: + packages: [g++-4.8] + + - name: "Linux GCC 5 [32-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=gcc-5 && CXX=g++-5" CXXFLAGS=-m32 LDFLAGS=-m32 + os: linux + addons: + apt: + packages: [g++-5, g++-5-multilib, "linux-libc-dev:i386"] + + - name: "Linux GCC 5 [64-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=gcc-5 && CXX=g++-5" + os: linux + addons: + apt: + packages: [g++-5] + + - name: "Linux GCC 6 [32-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=gcc-6 && CXX=g++-6" CXXFLAGS=-m32 LDFLAGS=-m32 + os: linux + addons: + apt: + packages: [g++-6, g++-6-multilib, "linux-libc-dev:i386"] + + - name: "Linux GCC 6 [64-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=gcc-6 && CXX=g++-6" + os: linux + addons: + apt: + packages: [g++-6] + + - name: "Linux GCC 7 [32-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=gcc-7 && CXX=g++-7" CXXFLAGS=-m32 LDFLAGS=-m32 + os: linux + addons: + apt: + packages: [g++-7, g++-7-multilib, "linux-libc-dev:i386"] + + - name: "Linux GCC 7 [64-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=gcc-7 && CXX=g++-7" + os: linux + addons: + apt: + packages: [g++-7] + + - name: "Linux GCC 8 [32-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=gcc-8 && CXX=g++-8" CXXFLAGS=-m32 LDFLAGS=-m32 + os: linux + addons: + apt: + packages: [g++-8, g++-8-multilib, "linux-libc-dev:i386"] + + - name: "Linux GCC 8 [64-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=gcc-8 && CXX=g++-8" + os: linux + addons: + apt: + packages: [g++-8] + + - name: "Linux GCC 9 [32-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=gcc-9 && CXX=g++-9" CXXFLAGS=-m32 LDFLAGS=-m32 + os: linux + addons: + apt: + sources: + - sourceline: "ppa:ubuntu-toolchain-r/test" + packages: [g++-9, g++-9-multilib, "linux-libc-dev:i386"] + + - name: "Linux GCC 9 [64-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=gcc-9 && CXX=g++-9" + os: linux + addons: + apt: + sources: + - sourceline: "ppa:ubuntu-toolchain-r/test" + packages: [g++-9] + + - name: "Linux GCC 10 [32-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=gcc-10 && CXX=g++-10" CXXFLAGS=-m32 LDFLAGS=-m32 + os: linux + addons: + apt: + sources: + - sourceline: "ppa:ubuntu-toolchain-r/test" + packages: [g++-10, g++-10-multilib, "linux-libc-dev:i386"] + + - name: "Linux GCC 10 [32-bit] [REL]" + env: BUILD_MATRIX="BUILD_TYPE=Release && CC=gcc-10 && CXX=g++-10" CXXFLAGS=-m32 LDFLAGS=-m32 + os: linux + addons: + apt: + sources: + - sourceline: "ppa:ubuntu-toolchain-r/test" + packages: [g++-10, g++-10-multilib, "linux-libc-dev:i386"] + + - name: "Linux GCC 10 [64-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug && CC=gcc-10 && CXX=g++-10" + os: linux + addons: + apt: + sources: + - sourceline: "ppa:ubuntu-toolchain-r/test" + packages: [g++-10] + + - name: "Linux GCC 10 [64-bit] [REL]" + env: BUILD_MATRIX="BUILD_TYPE=Release && CC=gcc-10 && CXX=g++-10" + os: linux + addons: + apt: + sources: + - sourceline: "ppa:ubuntu-toolchain-r/test" + packages: [g++-10] + + - name: "OSX Clang XCode 9.4 [32-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug" CXXFLAGS=-m32 LDFLAGS=-m32 + os: osx + osx_image: xcode9.4 + + - name: "OSX Clang XCode 9.4 [32-bit] [REL]" + env: BUILD_MATRIX="BUILD_TYPE=Release" CXXFLAGS=-m32 LDFLAGS=-m32 + os: osx + osx_image: xcode9.4 + + - name: "OSX Clang XCode 9.4 [64-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug" + os: osx + osx_image: xcode9.4 + + - name: "OSX Clang XCode 9.4 [64-bit] [REL]" + env: BUILD_MATRIX="BUILD_TYPE=Release" + os: osx + osx_image: xcode9.4 + + - name: "OSX Clang XCode 10.2 [64-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug" + os: osx + osx_image: xcode10.2 + + - name: "OSX Clang XCode 10.2 [64-bit] [REL]" + env: BUILD_MATRIX="BUILD_TYPE=Release" + os: osx + osx_image: xcode10.2 + + - name: "OSX Clang XCode 11 [64-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug" + os: osx + osx_image: xcode11 + + - name: "OSX Clang XCode 11 [64-bit] [REL]" + env: BUILD_MATRIX="BUILD_TYPE=Release" + os: osx + osx_image: xcode11 + + - name: "Windows VS2017 [32-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug" BUILD_TOOLCHAIN="Visual Studio 15 2017" + os: windows + + - name: "Windows VS2017 [32-bit] [REL]" + env: BUILD_MATRIX="BUILD_TYPE=Release" BUILD_TOOLCHAIN="Visual Studio 15 2017" + os: windows + + - name: "Windows VS2017 [64-bit] [DBG]" + env: BUILD_MATRIX="BUILD_TYPE=Debug" BUILD_TOOLCHAIN="Visual Studio 15 2017 Win64" + os: windows + + - name: "Windows VS2017 [64-bit] [REL]" + env: BUILD_MATRIX="BUILD_TYPE=Release" BUILD_TOOLCHAIN="Visual Studio 15 2017 Win64" + os: windows + +before_install: + - eval "$BUILD_MATRIX" + +before_script: + - mkdir build + - cd build + - | + if [[ "$BUILD_TOOLCHAIN" =~ ^Visual\ Studio ]]; then + cmake .. -G"${BUILD_TOOLCHAIN}" -DASMJIT_TEST=1 ${EXTRA_OPTIONS} + else + cmake .. -G"${BUILD_TOOLCHAIN}" -DASMJIT_TEST=1 ${EXTRA_OPTIONS} -DCMAKE_PREFIX_PATH="${MINGW_PATH}" -DCMAKE_BUILD_TYPE="${BUILD_TYPE}" + fi + - cd .. + +script: + - cd build + - | + if [[ "$BUILD_TOOLCHAIN" =~ ^Visual\ Studio ]]; then + cmake --build . --config ${BUILD_TYPE} -- -nologo -v:minimal + cd ${BUILD_TYPE} + else + cmake --build . + fi + + - | + if [ "$USE_VALGRIND" = "1" ]; then + RUN_CMD="valgrind --leak-check=full --show-reachable=yes --track-origins=yes" + fi + + - eval "$RUN_CMD ./asmjit_test_unit --quick" + - eval "$RUN_CMD ./asmjit_test_opcode > /dev/null" + - eval "$RUN_CMD ./asmjit_test_x86_asm" + - eval "$RUN_CMD ./asmjit_test_x86_sections" + - | + if [ -f ./asmjit_test_x86_cc ]; then + eval "$RUN_CMD ./asmjit_test_x86_cc" + fi diff --git a/3rdparty/asmjit/CMakeLists.txt b/3rdparty/asmjit/CMakeLists.txt new file mode 100644 index 00000000000..7b6c90b7179 --- /dev/null +++ b/3rdparty/asmjit/CMakeLists.txt @@ -0,0 +1,496 @@ +cmake_minimum_required(VERSION 3.5 FATAL_ERROR) + +cmake_policy(PUSH) +cmake_policy(SET CMP0063 NEW) # Honor visibility properties. + +include(CheckCXXCompilerFlag) + +# Don't create a project if it was already created by another CMakeLists.txt. +# This allows one library to embed another library without making a collision. +if (NOT CMAKE_PROJECT_NAME OR "${CMAKE_PROJECT_NAME}" STREQUAL "asmjit") + project(asmjit CXX) +endif() + +# ============================================================================= +# [AsmJit - Deprecated] +# ============================================================================= + +if (DEFINED ASMJIT_BUILD_EMBED) + message(DEPRECATION "ASMJIT_BUILD_EMBED is deprecated, use ASMJIT_EMBED") + set(ASMJIT_EMBED "${ASMJIT_BUILD_EMBED}") +endif() + +if (DEFINED ASMJIT_BUILD_STATIC) + message(DEPRECATION "ASMJIT_BUILD_STATIC is deprecated, use ASMJIT_STATIC") + set(ASMJIT_STATIC "${ASMJIT_BUILD_STATIC}") +endif() + +# ============================================================================= +# [AsmJit - Configuration] +# ============================================================================= + +if (NOT DEFINED ASMJIT_EMBED) + set(ASMJIT_EMBED FALSE) +endif() + +if (NOT DEFINED ASMJIT_STATIC) + set(ASMJIT_STATIC ${ASMJIT_EMBED}) +endif() + +if (NOT DEFINED ASMJIT_BUILD_ARM) + set(ASMJIT_BUILD_ARM FALSE) +endif() + +if (NOT DEFINED ASMJIT_BUILD_X86) + set(ASMJIT_BUILD_X86 FALSE) +endif() + +if (NOT DEFINED ASMJIT_TEST) + set(ASMJIT_TEST FALSE) +endif() + +if (NOT DEFINED ASMJIT_NO_NATVIS) + set(ASMJIT_NO_NATVIS FALSE) +endif() + +# EMBED implies STATIC. +if (ASMJIT_EMBED AND NOT ASMJIT_STATIC) + set(ASMJIT_STATIC TRUE) +endif() + +set(ASMJIT_DIR "${CMAKE_CURRENT_LIST_DIR}" CACHE PATH "Location of 'asmjit'") +set(ASMJIT_TEST ${ASMJIT_TEST} CACHE BOOL "Build 'asmjit' test applications") +set(ASMJIT_EMBED ${ASMJIT_EMBED} CACHE BOOL "Embed 'asmjit' library (no targets)") +set(ASMJIT_STATIC ${ASMJIT_STATIC} CACHE BOOL "Build 'asmjit' library as static") +set(ASMJIT_SANITIZE ${ASMJIT_SANITIZE} CACHE BOOL "Build with C/C++ sanitizers enabled") +set(ASMJIT_BUILD_X86 ${ASMJIT_BUILD_X86} CACHE BOOL "Build X86 backends (X86 and X86_64)") +set(ASMJIT_BUILD_ARM ${ASMJIT_BUILD_ARM} CACHE BOOL "Build ARM backends") + +# ============================================================================= +# [AsmJit - Project] +# ============================================================================= + +set(ASMJIT_INCLUDE_DIRS "${ASMJIT_DIR}/src") # Include directory is the same as source dir. +set(ASMJIT_DEPS "") # AsmJit dependencies (libraries) for the linker. +set(ASMJIT_LIBS "") # Dependencies of libs/apps that want to use AsmJit. +set(ASMJIT_CFLAGS "") # Public compiler flags. +set(ASMJIT_PRIVATE_CFLAGS "") # Private compiler flags independent of build type. +set(ASMJIT_PRIVATE_CFLAGS_DBG "") # Private compiler flags used by debug builds. +set(ASMJIT_PRIVATE_CFLAGS_REL "") # Private compiler flags used by release builds. +set(ASMJIT_SANITIZE_CFLAGS "") # Compiler flags required by currently enabled sanitizers. +set(ASMJIT_SANITIZE_LFLAGS "") # Linker flags required by currently enabled sanitizers. + +# ============================================================================= +# [AsmJit - Utilities] +# ============================================================================= + +function(asmjit_detect_cflags out) + set(out_array ${${out}}) + foreach(flag ${ARGN}) + string(REGEX REPLACE "[+]" "x" flag_signature "${flag}") + string(REGEX REPLACE "[-=:;/.\]" "_" flag_signature "${flag_signature}") + check_cxx_compiler_flag(${flag} "__CxxFlag_${flag_signature}") + if (${__CxxFlag_${flag_signature}}) + list(APPEND out_array "${flag}") + endif() + endforeach() + set(${out} "${out_array}" PARENT_SCOPE) +endfunction() + +# Support for various sanitizers provided by C/C++ compilers. +function(asmjit_detect_sanitizers out) + set(_out_array ${${out}}) + set(_flags "") + + foreach(_arg ${ARGN}) + string(REPLACE "," ";" _arg "${_arg}") + list(APPEND _flags ${_arg}) + endforeach() + + foreach(_flag ${_flags}) + if (NOT "${_flag}" MATCHES "^-fsanitize=") + SET(_flag "-fsanitize=${_flag}") + endif() + + # Sanitizers also require link flags, see CMAKE_REQUIRED_FLAGS. + set(CMAKE_REQUIRED_FLAGS "${_flag}") + asmjit_detect_cflags(_out_array ${_flag}) + unset(CMAKE_REQUIRED_FLAGS) + endforeach() + + set(${out} "${_out_array}" PARENT_SCOPE) +endfunction() + +function(asmjit_add_target target target_type) + set(single_val "") + set(multi_val SOURCES LIBRARIES CFLAGS CFLAGS_DBG CFLAGS_REL) + cmake_parse_arguments("X" "" "${single_val}" "${multi_val}" ${ARGN}) + + if ("${target_type}" MATCHES "^(EXECUTABLE|TEST)$") + add_executable(${target} ${X_SOURCES}) + else() + add_library(${target} ${target_type} ${X_SOURCES}) + endif() + + target_link_libraries(${target} PRIVATE ${X_LIBRARIES}) + + # target_link_options was added in cmake v3.13, don't use it for now... + foreach(link_flag ${ASMJIT_SANITIZE_LFLAGS}) + set_property(TARGET ${target} APPEND_STRING PROPERTY LINK_FLAGS " ${link_flag}") + endforeach() + + if (${CMAKE_VERSION} VERSION_LESS "3.8.0") + set_property(TARGET ${target} PROPERTY CXX_STANDARD 11) + else() + target_compile_features(${target} PUBLIC cxx_std_11) + endif() + set_property(TARGET ${target} PROPERTY CXX_EXTENSIONS NO) + set_property(TARGET ${target} PROPERTY CXX_VISIBILITY_PRESET hidden) + target_compile_options(${target} PRIVATE ${X_CFLAGS} ${ASMJIT_SANITIZE_CFLAGS} $<$:${X_CFLAGS_DBG}> $<$>:${X_CFLAGS_REL}>) + + if ("${target_type}" STREQUAL "TEST") + add_test(NAME ${target} COMMAND ${target}) + endif() +endfunction() + +# ============================================================================= +# [AsmJit - Compiler Support] +# ============================================================================= + +set(ASMJIT_INCLUDE_DIRS "${ASMJIT_DIR}/src") # Include directory is the same as source dir. +set(ASMJIT_DEPS "") # AsmJit dependencies (libraries) for the linker. +set(ASMJIT_LIBS "") # Dependencies of libs/apps that want to use AsmJit. +set(ASMJIT_CFLAGS "") # Public compiler flags. +set(ASMJIT_PRIVATE_CFLAGS "") # Private compiler flags independent of build type. +set(ASMJIT_PRIVATE_CFLAGS_DBG "") # Private compiler flags used by debug builds. +set(ASMJIT_PRIVATE_CFLAGS_REL "") # Private compiler flags used by release builds. +set(ASMJIT_SANITIZE_CFLAGS "") # Compiler flags required by currently enabled sanitizers. +set(ASMJIT_SANITIZE_LFLAGS "") # Linker flags required by currently enabled sanitizers. + +# TODO: Backward compatibility. +set(ASMJIT_INCLUDE_DIR "${ASMJIT_INCLUDE_DIRS}") + +if (NOT ASMJIT_NO_CUSTOM_FLAGS) + if ("${CMAKE_CXX_COMPILER_ID}" STREQUAL "MSVC" OR "x${CMAKE_CXX_SIMULATE_ID}" STREQUAL "xMSVC") + list(APPEND ASMJIT_PRIVATE_CFLAGS + -MP # [+] Multi-Process Compilation. + -GR- # [-] Runtime type information. + -GF # [+] Eliminate duplicate strings. + -Zc:inline # [+] Remove unreferenced COMDAT. + -Zc:strictStrings # [+] Strict const qualification of string literals. + -Zc:threadSafeInit- # [-] Thread-safe statics. + -W4) # [+] Warning level 4. + + list(APPEND ASMJIT_PRIVATE_CFLAGS_DBG + -GS) # [+] Buffer security-check. + + list(APPEND ASMJIT_PRIVATE_CFLAGS_REL + -GS- # [-] Buffer security-check. + -O2 # [+] Favor speed over size. + -Oi) # [+] Generate intrinsic functions. + elseif ("${CMAKE_CXX_COMPILER_ID}" MATCHES "^(GNU|Clang|AppleClang)$") + list(APPEND ASMJIT_PRIVATE_CFLAGS -Wall -Wextra) + list(APPEND ASMJIT_PRIVATE_CFLAGS -fno-math-errno) + list(APPEND ASMJIT_PRIVATE_CFLAGS_REL -O2) + + asmjit_detect_cflags(ASMJIT_PRIVATE_CFLAGS + -fno-threadsafe-statics + -fno-semantic-interposition) + + asmjit_detect_cflags(ASMJIT_PRIVATE_CFLAGS_REL + -fmerge-all-constants) + endif() +endif() + +# Support for sanitizers. +if (ASMJIT_SANITIZE) + ASMJIT_detect_sanitizers(ASMJIT_SANITIZE_CFLAGS ${ASMJIT_SANITIZE}) + if (ASMJIT_SANITIZE_CFLAGS) + message("-- Enabling sanitizers: '${ASMJIT_SANITIZE_CFLAGS}'") + + # Linker must receive the same flags as the compiler when it comes to sanitizers. + set(ASMJIT_SANITIZE_LFLAGS ${ASMJIT_SANITIZE_CFLAGS}) + + # Don't omit frame pointer if sanitizers are enabled. + if ("${CMAKE_CXX_COMPILER_ID}" STREQUAL "MSVC" OR "x${CMAKE_CXX_SIMULATE_ID}" STREQUAL "xMSVC") + list(APPEND ASMJIT_SANITIZE_CFLAGS -Oy-) + else() + list(APPEND ASMJIT_SANITIZE_CFLAGS -fno-omit-frame-pointer -g) + endif() + + list(APPEND ASMJIT_PRIVATE_CFLAGS ${ASMJIT_SANITIZE_CFLAGS}) + list(APPEND ASMJIT_PRIVATE_LFLAGS ${ASMJIT_SANITIZE_LFLAGS}) + endif() +endif() + +if (NOT WIN32) + list(APPEND ASMJIT_DEPS pthread) +endif() + +if ("${CMAKE_SYSTEM_NAME}" MATCHES "Linux") + list(APPEND ASMJIT_DEPS rt) +endif() + +set(ASMJIT_LIBS ${ASMJIT_DEPS}) +if (NOT ASMJIT_EMBED) + list(INSERT ASMJIT_LIBS 0 asmjit) +endif() + +if (ASMJIT_EMBED) + set(ASMJIT_TARGET_TYPE "EMBED") +elseif (ASMJIT_STATIC) + set(ASMJIT_TARGET_TYPE "STATIC") +else() + set(ASMJIT_TARGET_TYPE "SHARED") +endif() + +foreach(build_option ASMJIT_STATIC + ASMJIT_BUILD_X86 + #ASMJIT_BUILD_ARM + ASMJIT_BUILD_A64 + ASMJIT_NO_JIT + ASMJIT_NO_LOGGING + ASMJIT_NO_BUILDER + ASMJIT_NO_COMPILER + ASMJIT_NO_TEXT + ASMJIT_NO_VALIDATION + ASMJIT_NO_INTROSPECTION) + if (${build_option}) + List(APPEND ASMJIT_CFLAGS "-D${build_option}") + List(APPEND ASMJIT_PRIVATE_CFLAGS "-D${build_option}") + endif() +endforeach() + +# ============================================================================= +# [AsmJit - Linker Support] +# ============================================================================= + +if (WIN32) + if(CMAKE_LINKER MATCHES "link\\.exe" OR CMAKE_LINKER MATCHES "lld-link\\.exe") + set(ASMJIT_LINKER_SUPPORTS_NATVIS TRUE) + endif() +endif() + +# ============================================================================= +# [AsmJit - Source] +# ============================================================================= + +set(ASMJIT_SRC_LIST + asmjit/asmjit.h + + asmjit/core.h + asmjit/core/api-build_p.h + asmjit/core/api-config.h + asmjit/core/arch.cpp + asmjit/core/arch.h + asmjit/core/assembler.cpp + asmjit/core/assembler.h + asmjit/core/builder.cpp + asmjit/core/builder.h + asmjit/core/callconv.cpp + asmjit/core/callconv.h + asmjit/core/codebufferwriter_p.h + asmjit/core/codeholder.cpp + asmjit/core/codeholder.h + asmjit/core/compiler.cpp + asmjit/core/compiler.h + asmjit/core/constpool.cpp + asmjit/core/constpool.h + asmjit/core/cpuinfo.cpp + asmjit/core/cpuinfo.h + asmjit/core/datatypes.h + asmjit/core/emitter.cpp + asmjit/core/emitter.h + asmjit/core/features.h + asmjit/core/func.cpp + asmjit/core/func.h + asmjit/core/globals.cpp + asmjit/core/globals.h + asmjit/core/inst.cpp + asmjit/core/inst.h + asmjit/core/jitallocator.cpp + asmjit/core/jitallocator.h + asmjit/core/jitruntime.cpp + asmjit/core/jitruntime.h + asmjit/core/logging.cpp + asmjit/core/logging.h + asmjit/core/misc_p.h + asmjit/core/operand.cpp + asmjit/core/operand.h + asmjit/core/osutils.cpp + asmjit/core/osutils.h + asmjit/core/raassignment_p.h + asmjit/core/rabuilders_p.h + asmjit/core/radefs_p.h + asmjit/core/ralocal.cpp + asmjit/core/ralocal_p.h + asmjit/core/rapass.cpp + asmjit/core/rapass_p.h + asmjit/core/rastack.cpp + asmjit/core/rastack_p.h + asmjit/core/string.cpp + asmjit/core/string.h + asmjit/core/support.cpp + asmjit/core/support.h + asmjit/core/target.cpp + asmjit/core/target.h + asmjit/core/type.cpp + asmjit/core/type.h + asmjit/core/virtmem.cpp + asmjit/core/virtmem.h + asmjit/core/zone.cpp + asmjit/core/zone.h + asmjit/core/zonehash.cpp + asmjit/core/zonehash.h + asmjit/core/zonelist.cpp + asmjit/core/zonelist.h + asmjit/core/zonestack.cpp + asmjit/core/zonestack.h + asmjit/core/zonestring.h + asmjit/core/zonetree.cpp + asmjit/core/zonetree.h + asmjit/core/zonevector.cpp + asmjit/core/zonevector.h + + asmjit/x86.h + asmjit/x86/x86assembler.cpp + asmjit/x86/x86assembler.h + asmjit/x86/x86builder.cpp + asmjit/x86/x86builder.h + asmjit/x86/x86callconv.cpp + asmjit/x86/x86callconv_p.h + asmjit/x86/x86compiler.cpp + asmjit/x86/x86compiler.h + asmjit/x86/x86emitter.h + asmjit/x86/x86features.cpp + asmjit/x86/x86features.h + asmjit/x86/x86globals.h + asmjit/x86/x86internal.cpp + asmjit/x86/x86internal_p.h + asmjit/x86/x86instdb.cpp + asmjit/x86/x86instdb.h + asmjit/x86/x86instdb_p.h + asmjit/x86/x86instapi.cpp + asmjit/x86/x86instapi_p.h + asmjit/x86/x86logging.cpp + asmjit/x86/x86logging_p.h + asmjit/x86/x86operand.cpp + asmjit/x86/x86operand.h + asmjit/x86/x86rapass.cpp + asmjit/x86/x86rapass_p.h +) + +if (MSVC AND NOT ASMJIT_NO_NATVIS) + list(APPEND ASMJIT_SRC_LIST asmjit.natvis) +endif() + +set(ASMJIT_SRC "") +foreach(src_file ${ASMJIT_SRC_LIST}) + set(src_file "${ASMJIT_DIR}/src/${src_file}") + list(APPEND ASMJIT_SRC ${src_file}) + + if ("${src_file}" MATCHES "\\.natvis") + if (ASMJIT_LINKER_SUPPORTS_NATVIS) + list(APPEND ASMJIT_PRIVATE_LFLAGS "-natvis:${src_file}") + endif() + endif() +endforeach() + +if (NOT ${CMAKE_VERSION} VERSION_LESS "3.8.0") + source_group(TREE "${ASMJIT_DIR}" FILES ${ASMJIT_SRC}) +endif() + +# ============================================================================= +# [AsmJit - Summary] +# ============================================================================= + +message("** AsmJit Summary **") +message(" ASMJIT_DIR=${ASMJIT_DIR}") +message(" ASMJIT_TEST=${ASMJIT_TEST}") +message(" ASMJIT_TARGET_TYPE=${ASMJIT_TARGET_TYPE}") +message(" ASMJIT_DEPS=${ASMJIT_DEPS}") +message(" ASMJIT_LIBS=${ASMJIT_LIBS}") +message(" ASMJIT_CFLAGS=${ASMJIT_CFLAGS}") +message(" ASMJIT_PRIVATE_CFLAGS=${ASMJIT_PRIVATE_CFLAGS}") +message(" ASMJIT_PRIVATE_CFLAGS_DBG=${ASMJIT_PRIVATE_CFLAGS_DBG}") +message(" ASMJIT_PRIVATE_CFLAGS_REL=${ASMJIT_PRIVATE_CFLAGS_REL}") + +# ============================================================================= +# [AsmJit - Targets] +# ============================================================================= + +if (NOT ASMJIT_EMBED) + # Add AsmJit target. + asmjit_add_target(asmjit "${ASMJIT_TARGET_TYPE}" + SOURCES ${ASMJIT_SRC} + LIBRARIES ${ASMJIT_DEPS} + CFLAGS ${ASMJIT_PRIVATE_CFLAGS} + CFLAGS_DBG ${ASMJIT_PRIVATE_CFLAGS_DBG} + CFLAGS_REL ${ASMJIT_PRIVATE_CFLAGS_REL}) + target_include_directories(asmjit BEFORE INTERFACE ${ASMJIT_INCLUDE_DIRS}) + target_compile_options(asmjit INTERFACE ${ASMJIT_CFLAGS}) + add_library(AsmJit::AsmJit ALIAS asmjit) + + # Add AsmJit install instructions (library and public headers). + if (NOT ASMJIT_NO_INSTALL) + install(TARGETS asmjit RUNTIME DESTINATION "bin" + LIBRARY DESTINATION "lib${LIB_SUFFIX}" + ARCHIVE DESTINATION "lib${LIB_SUFFIX}") + foreach(_src_file ${ASMJIT_SRC_LIST}) + if ("${_src_file}" MATCHES "\\.h$" AND NOT "${_src_file}" MATCHES "_p\\.h$") + get_filename_component(_src_dir ${_src_file} PATH) + install(FILES "${ASMJIT_DIR}/src/${_src_file}" DESTINATION "include/${_src_dir}") + endif() + endforeach() + endif() + + # Add AsmJit tests. + if (ASMJIT_TEST) + enable_testing() + + # Special target that always uses embedded AsmJit. + asmjit_add_target(asmjit_test_unit TEST + SOURCES ${ASMJIT_SRC} + test/asmjit_test_unit.cpp + test/broken.cpp + test/broken.h + LIBRARIES ${ASMJIT_DEPS} + CFLAGS ${ASMJIT_PRIVATE_CFLAGS} + -DASMJIT_TEST + -DASMJIT_STATIC + CFLAGS_DBG ${ASMJIT_PRIVATE_CFLAGS_DBG} + CFLAGS_REL ${ASMJIT_PRIVATE_CFLAGS_REL}) + target_include_directories(asmjit_test_unit BEFORE PRIVATE ${ASMJIT_INCLUDE_DIRS}) + + foreach(_target asmjit_test_opcode + asmjit_test_x86_asm + asmjit_test_x86_sections) + asmjit_add_target(${_target} TEST + SOURCES test/${_target}.cpp + LIBRARIES AsmJit::AsmJit + CFLAGS ${ASMJIT_PRIVATE_CFLAGS} + CFLAGS_DBG ${ASMJIT_PRIVATE_CFLAGS_DBG} + CFLAGS_REL ${ASMJIT_PRIVATE_CFLAGS_REL}) + endforeach() + + if (NOT (ASMJIT_NO_BUILDER OR ASMJIT_NO_COMPILER)) + asmjit_add_target(asmjit_test_x86_cc TEST + SOURCES test/asmjit_test_x86_cc.cpp + LIBRARIES AsmJit::AsmJit + CFLAGS ${ASMJIT_PRIVATE_CFLAGS} + CFLAGS_DBG ${ASMJIT_PRIVATE_CFLAGS_DBG} + CFLAGS_REL ${ASMJIT_PRIVATE_CFLAGS_REL}) + endif() + + foreach(_target asmjit_bench_x86) + asmjit_add_target(${_target} EXECUTABLE + SOURCES test/${_target}.cpp + LIBRARIES AsmJit::AsmJit + CFLAGS ${ASMJIT_PRIVATE_CFLAGS} + CFLAGS_DBG ${ASMJIT_PRIVATE_CFLAGS_DBG} + CFLAGS_REL ${ASMJIT_PRIVATE_CFLAGS_REL}) + endforeach() + endif() +endif() + +cmake_policy(POP) diff --git a/3rdparty/asmjit/LICENSE.md b/3rdparty/asmjit/LICENSE.md new file mode 100644 index 00000000000..020a569dbde --- /dev/null +++ b/3rdparty/asmjit/LICENSE.md @@ -0,0 +1,17 @@ +Copyright (c) 2008-2020 The AsmJit Authors + +This software is provided 'as-is', without any express or implied +warranty. In no event will the authors be held liable for any damages +arising from the use of this software. + +Permission is granted to anyone to use this software for any purpose, +including commercial applications, and to alter it and redistribute it +freely, subject to the following restrictions: + +1. The origin of this software must not be misrepresented; you must not + claim that you wrote the original software. If you use this software + in a product, an acknowledgment in the product documentation would be + appreciated but is not required. +2. Altered source versions must be plainly marked as such, and must not be + misrepresented as being the original software. +3. This notice may not be removed or altered from any source distribution. diff --git a/3rdparty/asmjit/README.md b/3rdparty/asmjit/README.md new file mode 100644 index 00000000000..24c726bd30a --- /dev/null +++ b/3rdparty/asmjit/README.md @@ -0,0 +1,1954 @@ +AsmJit +------ + +Machine code generation for C++. + + * [Official Repository (asmjit/asmjit)](https://github.com/asmjit/asmjit) + * [Official Blog (asmbits)](https://asmbits.blogspot.com/ncr) + * [Official Chat (gitter)](https://gitter.im/asmjit/asmjit) + * [Permissive ZLIB license](./LICENSE.md) + + +Introduction +------------ + +AsmJit is a complete JIT and AOT assembler for C++ language. It can generate native code for x86 and x64 architectures and supports the whole x86/x64 instruction set - from legacy MMX to the newest AVX512. It has a type-safe API that allows C++ compiler to do semantic checks at compile-time even before the assembled code is generated and/or executed. + +AsmJit, as the name implies, started as a project that provided JIT code-generation and execution. However, AsmJit evolved and it now contains features that are far beyond the scope of a simple JIT compilation. To keep the library small and lightweight the functionality not strictly related to JIT is provided by a sister project called [asmtk](https://github.com/asmjit/asmtk). + + +Minimal Example +--------------- + +```c++ +#include +#include + +using namespace asmjit; + +// Signature of the generated function. +typedef int (*Func)(void); + +int main(int argc, char* argv[]) { + JitRuntime rt; // Runtime specialized for JIT code execution. + + CodeHolder code; // Holds code and relocation information. + code.init(rt.codeInfo()); // Initialize to the same arch as JIT runtime. + + x86::Assembler a(&code); // Create and attach x86::Assembler to `code`. + a.mov(x86::eax, 1); // Move one to 'eax' register. + a.ret(); // Return from function. + // ----> x86::Assembler is no longer needed from here and can be destroyed <---- + + Func fn; + Error err = rt.add(&fn, &code); // Add the generated code to the runtime. + if (err) return 1; // Handle a possible error returned by AsmJit. + // ----> CodeHolder is no longer needed from here and can be destroyed <---- + + int result = fn(); // Execute the generated code. + printf("%d\n", result); // Print the resulting "1". + + // All classes use RAII, all resources will be released before `main()` returns, + // the generated function can be, however, released explicitly if you intend to + // reuse or keep the runtime alive, which you should in a production-ready code. + rt.release(fn); + + return 0; +} +``` + + +AsmJit Summary +-------------- + + * Complete x86/x64 instruction set - MMX, SSE+, BMI+, ADX, TBM, XOP, AVX+, FMA+, and AVX512+. + * Different emitters providing various abstraction levels (Assembler, Builder, Compiler). + * Support for sections for separating code and data. + * Built-in CPU vendor and features detection. + * Advanced logging, formatting, and error handling. + * JIT memory allocator - interface similar to malloc/free for JIT code-generation and execution. + * Lightweight and easily embeddable - ~300kB compiled with all built-in features. + * Modular design - unneeded features can be disabled at compile-time to make the library smaller. + * Zero dependencies - no external libraries, no STL/RTTI - easy to embed and/or link statically. + * Doesn't use exceptions internally, but allows to attach a "throwable" error handler of your choice. + + +Advanced Features +----------------- + + * AsmJit contains a highly compressed instruction database: + * Instruction names - allows to convert instruction id to its name and vice versa. + * Instruction metadata - access (read|write) of all operand combinations of all instructions. + * Instruction signatures - allows to strictly validate if an instruction (with all its operands) is valid. + * AsmJit allows to precisely control how instructions are encoded if there are multiple variations. + * AsmJit is highly dynamic, constructing operands at runtime is a common practice. + * Multiple emitters with the same interface - emit machine code directly or to a representation that can be post-processed. + + +Important +--------- + +Breaking the official API is sometimes inevitable, what to do? + * See asmjit tests, they always compile and provide an implementation of a lot of use-cases: + * [asmjit_test_x86_asm.cpp](./test/asmjit_test_x86_asm.cpp) - Tests that demonstrate the purpose of emitters. + * [asmjit_test_x86_cc.cpp](./test/asmjit_test_x86_cc.cpp) - A lot of tests targeting Compiler infrastructure. + * [asmjit_test_x86_sections.cpp](./test/asmjit_test_x86_sections.cpp) - Multiple sections test. + * Visit our [Official Chat](https://gitter.im/asmjit/asmjit) if you need a quick help. + + +TODO +---- + + * [ ] Add support for user external buffers in CodeHolder. + + +Supported Environments +---------------------- + +### C++ Compilers: + + * Requirements: + * AsmJit won't build without C++11 enabled. If you use older GCC or Clang you would have to enable at least c++11 through compiler flags. + * Tested: + * **Clang** - tested by Travis-CI - Clang 3.9+ (with C++11 enabled) is officially supported (older Clang versions having C++11 support are probably fine, but are not regularly tested). + * **GNU** - tested by Travis-CI - GCC 4.8+ (with C++11 enabled) is officially supported. + * **MINGW** - tested by Travis-CI - Use the latest version, if possible. + * **MSVC** - tested by Travis-CI - VS2017+ is officially supported, VS2015 is reported to work. + * Untested: + * **Intel** - no maintainers and no CI environment to regularly test this compiler. + * Other c++ compilers would require basic support in [core/build.h](./src/asmjit/core/build.h). + +### Operating Systems: + + * Tested: + * **Linux** - tested by Travis-CI - any distribution is generally supported. + * **OSX** - tested by Travis-CI - any version is supported. + * **Windows** - tested by Travis-CI - Windows 7+ is officially supported. + * Untested: + * **BSDs** - no maintainers, no CI environment to regularly test these OSes. + * **Haiku** - not regularly tested, but reported to work. + * Other operating systems would require some testing and support in [core/build.h](./src/asmjit/core/build.h), [core/osutils.cpp](./src/asmjit/core/osutils.cpp), and [core/virtmem.cpp](./src/asmjit/core/virtmem.cpp). + +### Backends: + + * **X86** - tested by both Travis-CI - both 32-bit and 64-bit backends are fully functional. + * **ARM** - work-in-progress (not public at the moment). + + +Project Organization +-------------------- + + * **`/`** - Project root. + * **src** - Source code. + * **asmjit** - Source code and headers (always point include path in here). + * **core** - Core API, backend independent except relocations. + * **arm** - ARM specific API, used only by ARM and AArch64 backends. + * **x86** - X86 specific API, used only by X86 and X64 backends. + * **test** - Unit and integration tests (don't embed in your project). + * **tools** - Tools used for configuring, documenting and generating data files. + + +Configuring & Feature Selection +------------------------------- + +AsmJit is designed to be easy embeddable in any project. However, it depends on some compile-time macros that can be used to build a specific version of AsmJit that includes or excludes certain features. A typical way of building AsmJit is to use [cmake](https://www.cmake.org), but it's also possible to just include AsmJit source code in your project and just build it. The easiest way to include AsmJit in your project is to just include **src** directory in your project and to define `ASMJIT_STATIC`. AsmJit can be just updated from time to time without any changes to this integration process. Do not embed AsmJit's [/test](./test) files in such case as these are used for testing. + +### Build Type: + + * `ASMJIT_BUILD_DEBUG` - Define to always turn debugging on (regardless of compile-time options detected). + * `ASMJIT_BUILD_RELEASE` - Define to always turn debugging off (regardless of compile-time options detected). + +By default none of these is defined, AsmJit detects build-type based on compile-time macros and supports most IDE and compiler settings out of box. By default AsmJit switches to release mode when `NDEBUG` is defined. + +### Build Mode: + + * `ASMJIT_STATIC` - Define to build AsmJit statically - either as a static library or as a part of another project. No symbols are exported in such case. + +By default AsmJit build is configured to be built as a shared library, this means `ASMJIT_STATIC` must be explicitly enabled if you want to compile AsmJit statically. + +### Build Backends: + + * `ASMJIT_BUILD_ARM` - Build ARM backends (not ready, work-in-progress). + * `ASMJIT_BUILD_X86` - Build X86 backends (X86 and X86_64). + * `ASMJIT_BUILD_HOST` - Build only the host backend (default). + +If none of `ASMJIT_BUILD_...` is defined AsmJit bails to `ASMJIT_BUILD_HOST`, which will detect the target architecture at compile-time. Each backend automatically supports 32-bit and 64-bit targets, so for example AsmJit with X86 support can generate both 32-bit and 64-bit code. + +### Disabling Features: + + * `ASMJIT_NO_BUILDER` - Disables both `Builder` and `Compiler` emitters (only `Assembler` will be available). Ideal for users that don't use `Builder` concept and want to have AsmJit a bit smaller. + * `ASMJIT_NO_COMPILER` - Disables `Compiler` emitter. For users that use `Builder`, but not `Compiler`. + * `ASMJIT_NO_JIT` - Disables JIT execution engine, which includes `JitUtils`, `JitAllocator`, and `JitRuntime`. + * `ASMJIT_NO_LOGGING` - Disables logging (`Logger` and all classes that inherit it) and instruction formatting. + * `ASMJIT_NO_TEXT` - Disables everything that uses text-representation and that causes certain strings to be stored in the resulting binary. For example when this flag is set all instruction and error names (and related APIs) will not be available. This flag has to be disabled together with `ASMJIT_NO_LOGGING`. This option is suitable for deployment builds or builds that don't want to reveal the use of AsmJit. + * `ASMJIT_NO_INST_API` - Disables instruction query features, strict validation, read/write information, and all additional data and APIs that can output information about instructions. + +NOTE: Please don't disable any features if you plan to build AsmJit as a shared library that will be used by multiple projects that you don't control (for example asmjit in a Linux distribution). The possibility to disable certain features exists mainly for customized builds of AsmJit. + + +Using AsmJit +------------ + +AsmJit library uses one global namespace called `asmjit` that provides the whole functionality. Architecture specific code is prefixed by the architecture name and architecture specific registers and operand builders have their own namespace. For example API targeting both X86 and X64 architectures is prefixed with `X86` and registers & operand builders are accessible through `x86` namespace. This design is very different from the initial version of AsmJit and it seems now as the most convenient one. + +### CodeHolder & Emitters + +AsmJit provides two classes that are used together for code generation: + + * `CodeHolder` - Provides functionality to hold generated code and stores all necessary information about code sections, labels, symbols, and possible relocations. + * `BaseEmitter` - Provides functionality to emit code into `CodeHolder`. `BaseEmitter` is abstract and provides just basic building blocks that are then implemented by `BaseAssembler`, `BaseBuilder`, `BaseCompiler`, and their architecture-specific implementations like `x86::Assembler`, `x86::Builder`, and `x86::Compiler`. + +Code emitters: + + * `[Base]Assembler` - Emitter designed to emit machine code directly into a `CodeBuffer` held by `CodeHolder`. + * `[Base]Builder` - Emitter designed to emit code into a representation that can be processed afterwards. It stores the whole code in a double linked list consisting of nodes (`BaseNode` and all derived classes). There are nodes that represent instructions (`InstNode`), labels (`LabelNode`), and other building blocks (`AlignNode`, `DataNode`, ...). Some nodes are used as markers (`SentinelNode` and comments (`CommentNode`). + * `[Base]Compiler` - High-level code emitter that uses virtual registers and contains high-level function building features. Compiler extends `[Base]Builder` functionality and introduces new nodes like `FuncNode`, `FuncRetNode`, and `FuncCallNode`. Compiler is the simplest way to start with AsmJit as it abstracts lots of details required to generate a function that can be called from a C/C++ language. + +### Targets and JitRuntime + +AsmJit's `Target` class is an interface that provides basic target abstraction. At the moment only one implementation called `JitRuntime` is provided, which as the name suggests provides JIT code target and execution runtime. `JitRuntime` provides all the necessary functionality to implement a simple JIT functionality with basic memory management. It only provides `add()` and `release()` functions that are used to either add code to the runtime or release it. The `JitRuntime` doesn't do any decisions on when the code should be released. Once you add new code into it you must decide when that code is no longer needed and should be released. + +### Instructions & Operands + +Instructions specify operations performed by the CPU, and operands specify the operation's input(s) and output(s). Each AsmJit's instruction has it's own unique id (`Inst::Id` for example) and platform specific code emitters always provide a type safe intrinsic (or multiple overloads) to emit such instruction. There are two ways of emitting an instruction: + + * Using `BaseEmitter::inst(operands...)` - A type-safe way provided by platform specific emitters - for example `x86::Assembler` provides `x86::Assembler::mov(x86::Gp, x86::Gp)`. + * Using `BaseEmitter::emit(instId, operands...)` - Allows to emit an instruction in a dynamic way - you just need to know instruction's id and provide its operands. + +AsmJit's operands all inherit from a base class called `Operand` and then specialize its type to: + + * **None** (not used or uninitialized operand). + * **Register** (`BaseReg`) - Describes either physical or virtual register. Physical registers have id that matches the target's machine id directly whereas virtual registers must be allocated into physical registers by a register allocator pass. Register operand provides: + * **Register Type** - Unique id that describes each possible register provided by the target architecture - for example X86 backend provides `x86::Reg::RegType`, which defines all variations of general purpose registers (GPB-LO, GPB-HI, GPW, GPD, and GPQ) and all types of other registers like K, MM, BND, XMM, YMM, and ZMM. + * **Register Group** - Groups multiple register types under a single group - for example all general-purpose registers (of all sizes) on X86 are `x86::Reg::kGroupGp`, all SIMD registers (XMM, YMM, ZMM) are `x86::Reg::kGroupVec`, etc. + * **Register Size** - Contains the size of the register in bytes. If the size depends on the mode (32-bit vs 64-bit) then generally the higher size is used (for example RIP register has size 8 by default). + * **Register ID** - Contains physical or virtual id of the register. + * Each architecture provides its own register that adds a architecture-specific API to `BaseReg`. + * **Memory Address** (`BaseMem`) - Used to reference a memory location. Memory operand provides: + * **Base Register** - A base register type and id (physical or virtual). + * **Index Register** - An index register type and id (physical or virtual). + * **Offset** - Displacement or absolute address to be referenced (32-bit if base register is used and 64-bit if base register is not used). + * **Flags** that can describe various architecture dependent information (like scale and segment-override on X86). + * Each architecture provides its own register that adds a architecture-specific API to `BaseMem`. + * **Immediate Value** (`Imm`) - Immediate values are usually part of instructions (encoded within the instruction itself) or data. + * **Label** - used to reference a location in code or data. Labels must be created by the `BaseEmitter` or by `CodeHolder`. Each label has its unique id per `CodeHolder` instance. + +AsmJit allows to construct operands dynamically, to store them, and to query a complete information about them at run-time. Operands are small (always 16 bytes per `Operand`) and should be always copied (by value) if you intend to store them (don't create operands by using `new` keyword, it's not recommended). Operands are safe to be `memcpy()`ed and `memset()`ed if you need to work with arrays of operands. + +Small example of manipulating and using operands: + +```c++ +#include + +using namespace asmjit; + +x86::Gp dstRegByValue() { return x86::ecx; } + +void usingOperandsExample(x86::Assembler& a) { + // Create some operands. + x86::Gp dst = dstRegByValue(); // Get `ecx` register returned by a function. + x86::Gp src = x86::rax; // Get `rax` register directly from the provided `x86` namespace. + x86::Gp idx = x86::gpq(10); // Construct `r10` dynamically. + x86::Mem m = x86::ptr(src, idx); // Construct [src + idx] memory address - referencing [rax + r10]. + + // Examine `m`: + m.indexType(); // Returns `x86::Reg::kTypeGpq`. + m.indexId(); // Returns 10 (`r10`). + + // Reconstruct `idx` stored in mem: + x86::Gp idx_2 = x86::Gp::fromTypeAndId(m.indexType(), m.indexId()); + idx == idx_2; // True, `idx` and idx_2` are identical. + + Operand op = m; // Possible. + op.isMem(); // True (can be casted to BaseMem or architecture-specific Mem). + + m == op; // True, `op` is just a copy of `m`. + static_cast(op).addOffset(1); // Static cast is fine and valid here. + op.as().addOffset(1); // However, using `as()` to cast to a derived type is preferred. + m == op; // False, `op` now points to [rax + r10 + 1], which is not [rax + r10]. + + // Emitting 'mov' + a.mov(dst, m); // Type-safe way. + a.mov(dst, op); // Not possible, `mov` doesn't provide `mov(x86::Gp, Operand)` overload. + + a.emit(x86::Inst::kIdMov, dst, m); // Type-unsafe, but possible. + a.emit(x86::Inst::kIdMov, dst, op); // Also possible, `emit()` is typeless and can be used with raw `Operand`s. +} +``` + +Some operands have to be created explicitly by `BaseEmitter`. For example labels must be created by `newLabel()` before they are used. + +### Assembler Example + +`x86::Assembler` is a code emitter that emits machine code into a CodeBuffer directly. It's capable of targeting both 32-bit and 64-bit instruction sets and it's possible to target both instruction sets within the same code-base. The following example shows how to generate a function that works in both 32-bit and 64-bit modes, and how to use JitRuntime, `CodeHolder`, and `x86::Assembler` together. + +The example handles 3 calling conventions manually just to show how it could be done, however, AsmJit contains utilities that can be used to create function prologs and epilogs automatically, but these concepts will be explained later. + +```c++ +#include +#include + +using namespace asmjit; + +// Signature of the generated function. +typedef int (*SumFunc)(const int* arr, size_t count); + +int main(int argc, char* argv[]) { + JitRuntime jit; // Create a runtime specialized for JIT. + CodeHolder code; // Create a CodeHolder. + + code.init(jit.codeInfo()); // Initialize it to be compatible with `jit`. + x86::Assembler a(&code); // Create and attach x86::Assembler to `code`. + + // Decide between 32-bit CDECL, WIN64, and SysV64 calling conventions: + // 32-BIT - passed all arguments by stack. + // WIN64 - passes first 4 arguments by RCX, RDX, R8, and R9. + // UNIX64 - passes first 6 arguments by RDI, RSI, RCX, RDX, R8, and R9. + x86::Gp arr, cnt; + x86::Gp sum = x86::eax; // Use EAX as 'sum' as it's a return register. + + if (ASMJIT_ARCH_BITS == 64) { + #if defined(_WIN32) + arr = x86::rcx; // First argument (array ptr). + cnt = x86::rdx; // Second argument (number of elements) + #else + arr = x86::rdi; // First argument (array ptr). + cnt = x86::rsi; // Second argument (number of elements) + #endif + } + else { + arr = x86::edx; // Use EDX to hold the array pointer. + cnt = x86::ecx; // Use ECX to hold the counter. + a.mov(arr, x86::ptr(x86::esp, 4)); // Fetch first argument from [ESP + 4]. + a.mov(cnt, x86::ptr(x86::esp, 8)); // Fetch second argument from [ESP + 8]. + } + + Label Loop = a.newLabel(); // To construct the loop, we need some labels. + Label Exit = a.newLabel(); + + a.xor_(sum, sum); // Clear 'sum' register (shorter than 'mov'). + a.test(cnt, cnt); // Border case: + a.jz(Exit); // If 'cnt' is zero jump to 'Exit' now. + + a.bind(Loop); // Start of a loop iteration. + a.add(sum, x86::dword_ptr(arr)); // Add int at [arr] to 'sum'. + a.add(arr, 4); // Increment 'arr' pointer. + a.dec(cnt); // Decrease 'cnt'. + a.jnz(Loop); // If not zero jump to 'Loop'. + + a.bind(Exit); // Exit to handle the border case. + a.ret(); // Return from function ('sum' == 'eax'). + // ----> x86::Assembler is no longer needed from here and can be destroyed <---- + + SumFunc fn; + Error err = jit.add(&fn, &code); // Add the generated code to the runtime. + + if (err) return 1; // Handle a possible error returned by AsmJit. + // ----> CodeHolder is no longer needed from here and can be destroyed <---- + + static const int array[6] = { 4, 8, 15, 16, 23, 42 }; + + int result = fn(array, 6); // Execute the generated code. + printf("%d\n", result); // Print sum of array (108). + + jit.release(fn); // Remove the function from the runtime. + return 0; +} +``` + +The example should be self-explanatory. It shows how to work with labels, how to use operands, and how to emit instructions that can use different registers based on runtime selection. It implements 32-bit CDECL, WIN64, and SysV64 caling conventions and will work on most X86 environments. + +### More About Memory Addresses + +X86 provides a complex memory addressing model that allows to encode addresses having a BASE register, INDEX register with a possible scale (left shift), and displacement (called offset in AsmJit). Memory address can also specify memory segment (segment-override in X86 terminology) and some instructions (gather / scatter) require INDEX to be a VECTOR register instead of a general-purpose register. AsmJit allows to encode and work with all forms of addresses mentioned and implemented by X86. It also allows to construct a 64-bit memory address, which is only allowed in one form of 'mov' instruction. + +```c++ +#include + +// Memory operand construction is provided by x86 namespace. +using namespace asmjit; +using namespace asmjit::x86; // Easier to access x86 regs. + +// BASE + OFFSET. +x86::Mem a = ptr(rax); // a = [rax] +x86::Mem b = ptr(rax, 15) // b = [rax + 15] + +// BASE + INDEX << SHIFT - Shift is in BITS as used by X86! +x86::Mem c = ptr(rax, rbx) // c = [rax + rbx] +x86::Mem d = ptr(rax, rbx, 2) // d = [rax + rbx << 2] +x86::Mem e = ptr(rax, rbx, 2, 15) // e = [rax + rbx << 2 + 15] + +// BASE + VM (Vector Index) (encoded as MOD+VSIB). +x86::Mem f = ptr(rax, xmm1) // f = [rax + xmm1] +x86::Mem g = ptr(rax, xmm1, 2) // g = [rax + xmm1 << 2] +x86::Mem h = ptr(rax, xmm1, 2, 15) // h = [rax + xmm1 << 2 + 15] + +// WITHOUT BASE: +uint64_t ADDR = (uint64_t)0x1234; +x86::Mem i = ptr(ADDR); // i = [0x1234] +x86::Mem j = ptr(ADDR, rbx); // j = [0x1234 + rbx] +x86::Mem k = ptr(ADDR, rbx, 2); // k = [0x1234 + rbx << 2] + +// LABEL - Will be encoded as RIP (64-bit) or absolute address (32-bit). +Label L = ...; +x86::Mem m = ptr(L); // m = [L] +x86::Mem n = ptr(L, rbx); // n = [L + rbx] +x86::Mem o = ptr(L, rbx, 2); // o = [L + rbx << 2] +x86::Mem p = ptr(L, rbx, 2, 15); // p = [L + rbx << 2 + 15] + +// RIP - 64-bit only (RIP can't use INDEX). +x86::Mem q = ptr(rip, 24); // q = [rip + 24] +``` + +Memory operands can optionally contain memory size. This is required by instructions where the memory size cannot be deduced from other operands, like `inc` and `dec`: + +```c++ +x86::Mem a = x86::dword_ptr(rax, rbx); // dword ptr [rax + rbx]. +x86::Mem b = x86::qword_ptr(rdx, rsi, 0, 1); // qword ptr [rdx + rsi << 0 + 1]. +``` + +Memory operands provide API that can be used to work with them: + +```c++ +x86::Mem mem = x86::dword_ptr(rax, 12); // dword ptr [rax + 12]. + +mem.hasBase(); // true. +mem.hasIndex(); // false. +mem.size(); // 4. +mem.offset(); // 12. + +mem.setSize(0); // Sets the size to 0 (makes it sizeless). +mem.addOffset(-1); // Adds -1 to the offset and makes it 11. +mem.setOffset(0); // Sets the offset to 0. +mem.setBase(rcx); // Changes BASE to RCX. +mem.setIndex(rax); // Changes INDEX to RAX. +mem.hasIndex(); // true. + +// ... +``` + +Making changes to memory operand is very comfortable when emitting loads and stores: + +```c++ +#include + +using namespace asmjit; + +x86::Assembler a(...); // Your initialized x86::Assembler. +x86::Mem m = x86::ptr(eax); // Construct [eax] memory operand. + +// One way of emitting bunch of loads is to use `mem.adjusted()`. It returns +// a new memory operand and keeps the source operand unchanged. +a.movaps(x86::xmm0, m); // No adjustment needed to load [eax]. +a.movaps(x86::xmm1, m.adjusted(16)); // Loads from [eax + 16]. +a.movaps(x86::xmm2, m.adjusted(32)); // Loads from [eax + 32]. +a.movaps(x86::xmm3, m.adjusted(48)); // Loads from [eax + 48]. + +// ... do something with xmm0-3 ... + +// Another way of adjusting memory is to change the operand in-place. If you +// want to keep the original operand you can simply clone it. +x86::Mem mx = m.clone(); +a.movaps(mx, x86::xmm0); mx.addOffset(16);// Stores to [eax] (and adds 16 to mx). +a.movaps(mx, x86::xmm1); mx.addOffset(16);// Stores to [eax + 16] (and adds 16 to mx). +a.movaps(mx, x86::xmm2); mx.addOffset(16);// Stores to [eax + 32] (and adds 16 to mx). +a.movaps(mx, x86::xmm3); // Stores to [eax + 48]. +``` + +You can explore the possibilities by taking a look at: + + * [core/operand.h](./src/asmjit/core/operand.h) + * [x86/x86operand.h](./src/asmjit/x86/x86operand.h). + +### More About CodeInfo + +In the first complete example the `CodeInfo` is retrieved from `JitRuntime`. It's logical as `JitRuntime` will always return a `CodeInfo` that is compatible with the runtime environment. For example if your application runs in 64-bit mode the `CodeInfo` will use `ArchInfo::kIdX64` architecture in contrast to `ArchInfo::kIdX86`, which will be used in 32-bit mode. AsmJit also allows to setup `CodeInfo` manually, and to select a different architecture when needed. So let's do something else this time, let's always generate a 32-bit code and print it's binary representation. To do that, we create our own `CodeInfo` and initialize it to `ArchInfo::kIdX86` architecture. CodeInfo will populate all basic fields just based on the architecture we provide, so it's super-easy: + +```c++ +#include +#include + +using namespace asmjit; + +int main(int argc, char* argv[]) { + using namespace asmjit::x86; // Easier access to x86/x64 registers. + + CodeHolder code; // Create a CodeHolder. + code.init(CodeInfo(ArchInfo::kIdX86));// Initialize it for a 32-bit X86 target. + + // Generate a 32-bit function that sums 4 floats and looks like: + // void func(float* dst, const float* a, const float* b) + x86::Assembler a(&code); // Create and attach x86::Assembler to `code`. + + a.mov(eax, dword_ptr(esp, 4)); // Load the destination pointer. + a.mov(ecx, dword_ptr(esp, 8)); // Load the first source pointer. + a.mov(edx, dword_ptr(esp, 12)); // Load the second source pointer. + + a.movups(xmm0, ptr(ecx)); // Load 4 floats from [ecx] to XMM0. + a.movups(xmm1, ptr(edx)); // Load 4 floats from [edx] to XMM1. + a.addps(xmm0, xmm1); // Add 4 floats in XMM1 to XMM0. + a.movups(ptr(eax), xmm0); // Store the result to [eax]. + a.ret(); // Return from function. + + // We have no Runtime this time, it's on us what we do with the code. + // CodeHolder stores code in `Section`, which provides some basic properties + // and CodeBuffer structure. We are interested in section's CodeBuffer only. + // + // NOTE: The first section is always '.text', so it's safe to just use 0 index. + // Get it by using either `code.sectionById(0)` or `code.textSection()`. + CodeBuffer& buffer = code.sectionById(0)->buffer(); + + // Print the machine-code generated or do something more interesting with it? + // 8B4424048B4C24048B5424040F28010F58010F2900C3 + for (size_t i = 0; i < buffer.length; i++) + printf("%02X", buffer.data[i]); + + return 0; +} +``` + +### Explicit Code Relocation + +CodeInfo contains much more information than just the target architecture. It can be configured to specify a base-address (or a virtual base-address in a linker terminology), which could be static (useful when you know the location of the target's machine code) or dynamic. AsmJit assumes dynamic base-address by default and relocates the code held by `CodeHolder` to a user-provided address on-demand. To be able to relocate to a user-provided address it needs to store some information about relocations, which is represented by `RelocEntry`. Relocation entries are only required if you call external functions from the generated code that cannot be encoded by using a 32-bit displacement (X64 architecture doesn't provide an encodable 64-bit displacement). + +There is also a concept called `LabelLink` - label links are lightweight structs that don't have any identifier and are stored per label in a single-linked list. Label links represent either unbound yet used labels (that are valid in cases in which label was not bound but was already referenced by an instruction) and links that cross-sections (only relevant to code that uses multiple sections). Since crossing sections is something that cannot be resolved immediately these links persist until offsets of these sections are assigned and `CodeHolder::resolveUnresolvedLinks()` is called. It's an error if you end up with code that has unresolved label links after flattening. You can verify it by calling `CodeHolder::hasUnresolvedLinks()` and `CodeHolder::unresolvedLinkCount()`. + +AsmJit can flatten code that uses multiple sections by assigning each section an incrementing offset that respects its alignment. Use `CodeHolder::flatten()` to do that. After the sections are flattened their offsets and virtual-sizes were adjusted to respect section's buffer size and alignment. You must call `CodeHolder::resolveUnresolvedLinks()` before relocating the code held by it. You can also flatten your code manually by iterating over all sections and calculating their offsets (relative to base) by your own algorithm. In that case you don't have to call `CodeHolder::flatten()`, but you must still call `CodeHolder::resolveUnresolvedLinks()`. + +Next example shows how to use a built-in virtual memory allocator `JitAllocator` instead of using `JitRuntime` (just in case you want to use your own memory management) and how to relocate the generated code into your own memory block - you can use your own virtual memory allocator if you prefer that, but that's OS specific and it's already provided by AsmJit, so we will use what AsmJit offers instead of going deep into OS specific APIs. + +The following code is similar to the previous one, but implements a function working in both 32-bit and 64-bit environments: + +```c++ +#include +#include + +using namespace asmjit; + +typedef void (*SumIntsFunc)(int* dst, const int* a, const int* b); + +int main(int argc, char* argv[]) { + CodeHolder code; // Create a CodeHolder. + code.init(CodeInfo(ArchInfo::kIdHost)); // Initialize it for the host architecture. + + x86::Assembler a(&code); // Create and attach x86::Assembler to `code`. + + // Generate a function runnable in both 32-bit and 64-bit architectures: + bool isX86 = ASMJIT_ARCH_X86 == 32; + + // Signature: 'void func(int* dst, const int* a, const int* b)'. + x86::Gp dst; + x86::Gp src_a; + x86::Gp src_b; + + // Handle the difference between 32-bit and 64-bit calling convention. + // (arguments passed through stack vs. arguments passed by registers). + if (isX86) { + dst = x86::eax; + src_a = x86::ecx; + src_b = x86::edx; + a.mov(dst , x86::dword_ptr(x86::esp, 4)); // Load the destination pointer. + a.mov(src_a, x86::dword_ptr(x86::esp, 8)); // Load the first source pointer. + a.mov(src_b, x86::dword_ptr(x86::esp, 12)); // Load the second source pointer. + } + else { + #if defined(_WIN32) + dst = x86::rcx; // First argument (destination pointer). + src_a = x86::rdx; // Second argument (source 'a' pointer). + src_b = x86::r8; // Third argument (source 'b' pointer). + #else + dst = x86::rdi; // First argument (destination pointer). + src_a = x86::rsi; // Second argument (source 'a' pointer). + src_b = x86::rdx; // Third argument (source 'b' pointer). + #endif + } + + a.movdqu(x86::xmm0, x86::ptr(src_a)); // Load 4 ints from [src_a] to XMM0. + a.movdqu(x86::xmm1, x86::ptr(src_b)); // Load 4 ints from [src_b] to XMM1. + a.paddd(x86::xmm0, x86::xmm1); // Add 4 ints in XMM1 to XMM0. + a.movdqu(x86::ptr(dst), x86::xmm0); // Store the result to [dst]. + a.ret(); // Return from function. + + // Even when we didn't use multiple sections AsmJit could insert one section + // called '.addrtab' (address table section), which would be filled by data + // required by relocations (absolute jumps and calls). You can omit this code + // if you are 100% sure your code doesn't contain multiple sections and + // such relocations. You can use `CodeHolder::hasAddressTable()` to verify + // whether the address table section does exist. + code.flatten(); + code.resolveUnresolvedLinks(); + + // After the code was generated it can be relocated manually to any memory + // location, however, we need to know it's size before we perform memory + // allocation. `CodeHolder::codeSize()` returns the worst estimated code + // size in case that relocations are not possible without trampolines (in + // that case some extra code at the end of the current code buffer is + // generated during relocation). + size_t estimatedSize = code.codeSize(); + + // Instead of rolling up our own memory allocator we can use the one AsmJit + // provides. It's decoupled so you don't need to use `JitRuntime` for that. + JitAllocator allocator; + + // Allocate an executable virtual memory and handle a possible failure. + void* p = allocator.alloc(estimatedSize); + if (!p) return 0; + + // Now relocate the code to the address provided by the memory allocator. + // Please note that this DOESN'T COPY anything to `p`. This function will + // store the address in CodeInfo and use relocation entries to patch the + // existing code in all sections to respect the base address provided. + code.relocateToBase((uint64_t)p); + + // This is purely optional. There are cases in which the relocation can + // omit unneeded data, which would shrink the size of address table. If + // that happened the `codeSize` returned after `relocateToBase()` would + // be smaller than the originally `estimatedSize`. + size_t codeSize = code.codeSize(); + + // This will copy code from all sections to `p`. Iterating over all + // sections and calling `memcpy()` would work as well, however, this + // function supports additional options that can be used to also zero + // pad sections' virtual size, etc. + // + // With some additional features, copyFlattenData() does roughly this: + // for (Section* section : code.sections()) + // memcpy((uint8_t*)p + section->offset(), + // section->data(), + // section->bufferSize()); + code.copyFlattenedData(p, codeSize, CodeHolder::kCopyWithPadding); + + // Execute the generated function. + int inA[4] = { 4, 3, 2, 1 }; + int inB[4] = { 1, 5, 2, 8 }; + int out[4]; + + // This code uses AsmJit's ptr_as_func<> to cast between void* and SumIntsFunc. + ptr_as_func(p)(out, inA, inB); + + // Prints {5 8 4 9} + printf("{%d %d %d %d}\n", out[0], out[1], out[2], out[3]); + + // Release 'p' is it's no longer needed. It will be destroyed with 'vm' + // instance anyway, but it's a good practice to release it explicitly + // when you know that the function will not be needed anymore. + allocator.release(p); + + return 0; +} +``` + +If you know your base-address in advance (before code generation) you can use `CodeInfo::setBaseAddress()` to setup its initial value. In that case Assembler will know the absolute position of each instruction and would be able to use it during instruction encoding and prevent relocations in case the instruction is encodable. The following example shows how to configure the base address: + +```c++ +// Configure CodeInfo with base address. +CodeInfo ci(...); +ci.setBaseAddress(uint64_t(0x1234)); + +// Then initialize CodeHolder with it. +CodeHolder code; +code.init(ci); +``` + +### Using Native Registers - zax, zbx, zcx, ... + +AsmJit's X86 code emitters always provide functions to construct machine-size registers depending on the target. This feature is for people that want to write code targeting both 32-bit and 64-bit at the same time. In AsmJit terminology these registers are named **zax**, **zcx**, **zdx**, **zbx**, **zsp**, **zbp**, **zsi**, and **zdi** (they are defined in this exact order by X86). They are accessible through `x86::Assembler`, `x86::Builder`, and `x86::Compiler`. The following example illustrates how to use this feature: + +```c++ +#include +#include + +using namespace asmjit; + +typedef int (*Func)(void); + +int main(int argc, char* argv[]) { + JitRuntime jit; // Create a runtime specialized for JIT. + CodeHolder code; // Create a CodeHolder. + + code.init(jit.codeInfo()); // Initialize it to be compatible with `jit`. + x86::Assembler a(&code); // Create and attach x86::Assembler to `code`. + + // Let's get these registers from x86::Assembler. + x86::Gp zbp = a.zbp(); + x86::Gp zsp = a.zsp(); + + int stackSize = 32; + + // Function prolog. + a.push(zbp); + a.mov(zbp, zsp); + a.sub(zsp, stackSize); + + // ... emit some code (this just sets return value to zero) ... + a.xor_(x86::eax, x86::eax); + + // Function epilog and return. + a.mov(zsp, zbp); + a.pop(zbp); + a.ret(); + + // To make the example complete let's call it. + Func fn; + Error err = jit.add(&fn, &code); // Add the generated code to the runtime. + if (err) return 1; // Handle a possible error returned by AsmJit. + + int result = fn(); // Execute the generated code. + printf("%d\n", result); // Print the resulting "0". + + jit.release(fn); // Remove the function from the runtime. + return 0; +} +``` + +The example just returns `0`, but the function generated contains a standard prolog and epilog sequence and the function itself reserves 32 bytes of local stack. The advantage is clear - a single code-base can handle multiple targets easily. If you want to create a register of native size dynamically by specifying its id it's also possible: + +```c++ +void example(x86::Assembler& a) { + x86::Gp zax = a.gpz(x86::Gp::kIdAx); + x86::Gp zbx = a.gpz(x86::Gp::kIdBx); + x86::Gp zcx = a.gpz(x86::Gp::kIdCx); + x86::Gp zdx = a.gpz(x86::Gp::kIdDx); + + // You can also change register's id easily. + x86::Gp zsp = zax; + zsp.setId(4); // or x86::Gp::kIdSp. +} +``` + +Cloning existing registers and chaning their IDs is fine in AsmJit; and this technique is used internally in many places. + +### Using Assembler as Code-Patcher + +This is an advanced topic that is sometimes unavoidable. AsmJit by default appends machine-code it generates into a `CodeBuffer`, however, it also allows to set the offset in `CodeBuffer` explicitly and to overwrite its content. This technique is extremely dangerous for asm beginners as X86 instructions have variable length (see below), so you should in general only patch code to change instruction's offset or some basic other details you didn't know about the first time you emitted it. A typical scenario that requires code-patching is when you start emitting function and you don't know how much stack you want to reserve for it. + +Before we go further it's important to introduce instruction options, because they can help with code-patching (and not only patching, but that will be explained in AVX-512 section): + + * Many general-purpose instructions (especially arithmetic ones) on X86 have multiple encodings - in AsmJit this is usually called 'short form' and 'long form'. + * AsmJit always tries to use 'short form' as it makes the resulting machine-code smaller, which is always good - this decision is used by majority of assemblers out there. + * AsmJit allows to override the default decision by using `short_()` and `long_()` instruction options to force short or long form, respectively. The most useful is `long_()` as it basically forces AsmJit to always emit the long form. The `short_()` is not that useful as it's automatic (except jumps to non-bound labels). Note the underscore after each function name as it avoids collision with built-in C++ types. + +To illustrate what short form and long form means in binary let's assume we want to emit `add esp, 16` instruction, which has two possible binary encodings: + + * `83C410` - This is a short form aka `short add esp, 16` - You can see opcode byte (0x8C), MOD/RM byte (0xC4) and an 8-bit immediate value representing `16`. + * `81C410000000` - This is a long form aka `long add esp, 16` - You can see a different opcode byte (0x81), the same Mod/RM byte (0xC4) and a 32-bit immediate in little-endian representing `16`. + +If you generate an instruction in a short form and then patch it in a long form or vice-versa then something really bad will happen when you try to execute such code. The following example illustrates how to patch the code properly (it just extends the previous example): + +```c++ +#include +#include + +using namespace asmjit; + +typedef int (*Func)(void); + +int main(int argc, char* argv[]) { + JitRuntime jit; // Create a runtime specialized for JIT. + CodeHolder code; // Create a CodeHolder. + + code.init(jit.codeInfo()); // Initialize it to be compatible with `jit`. + x86::Assembler a(&code); // Create and attach x86::Assembler to `code`. + + // Let's get these registers from x86::Assembler. + x86::Gp zbp = a.zbp(); + x86::Gp zsp = a.zsp(); + + // Function prolog. + a.push(zbp); + a.mov(zbp, zsp); + + // This is where we are gonna patch the code later, so let's get the offset + // (the current location) from the beginning of the code-buffer. + size_t patchOffset = a.offset(); + // Let's just emit 'sub zsp, 0' for now, but don't forget to use LONG form. + a.long_().sub(zsp, 0); + + // ... emit some code (this just sets return value to zero) ... + a.xor_(x86::eax, x86::eax); + + // Function epilog and return. + a.mov(zsp, zbp); + a.pop(zbp); + a.ret(); + + // Now we know how much stack size we want to reserve. I have chosen 128 + // bytes on purpose as it's encodable only in long form that we have used. + + int stackSize = 128; // Number of bytes to reserve on the stack. + a.setOffset(patchOffset); // Move the current cursor to `patchOffset`. + a.long_().sub(zsp, stackSize); // Patch the code; don't forget to use LONG form. + + // Now the code is ready to be called + Func fn; + Error err = jit.add(&fn, &code); // Add the generated code to the runtime. + if (err) return 1; // Handle a possible error returned by AsmJit. + + int result = fn(); // Execute the generated code. + printf("%d\n", result); // Print the resulting "0". + + jit.release(fn); // Remove the function from the runtime. + return 0; +} +``` + +If you run the example it would just work. As an experiment you can try removing `long_()` form to see what happens when wrong code is generated. + +### Code Patching and REX Prefix + +In 64-bit mode there is one more thing to worry about when patching code - REX prefix. It's a single byte prefix designed to address registers with ids from 9 to 15 and to override the default width of operation from 32 to 64 bits. AsmJit, like other assemblers, only emits REX prefix when it's necessary. If the patched code only changes the immediate value as shown in the previous example then there is nothing to worry about as it doesn't change the logic behind emitting REX prefix, however, if the patched code changes register id or overrides the operation width then it's important to take care of REX prefix as well. + +AsmJit contains another instruction option that controls (forces) REX prefix - `rex()`. If you use it the instruction emitted will always use REX prefix even when it's encodable without it. The following list contains some instructions and their binary representations to illustrate when it's emitted: + + * `__83C410` - `add esp, 16` - 32-bit operation in 64-bit mode doesn't require REX prefix. + * `4083C410` - `rex add esp, 16` - 32-bit operation in 64-bit mode with forced REX prefix (0x40). + * `4883C410` - `add rsp, 16` - 64-bit operation in 64-bit mode requires REX prefix (0x48). + * `4183C410` - `add r12d, 16` - 32-bit operation in 64-bit mode using R12D requires REX prefix (0x41). + * `4983C410` - `add r12, 16` - 64-bit operation in 64-bit mode using R12 requires REX prefix (0x49). + +### Generic Function API + +So far all examples shown above handled creating function prologs and epilogs manually. While it's possible to do it that way it's much better to automate such process as function calling conventions vary across architectures and also across operating systems. + +AsmJit contains a functionality that can be used to define function signatures and to calculate automatically optimal function frame that can be used directly by a prolog and epilog inserter. This feature was exclusive to AsmJit's Compiler for a very long time, but was abstracted out and is now available for all users regardless of BaseEmitter they use. The design of handling functions prologs and epilogs allows generally two use cases: + + * Calculate function frame before the function is generated - this is the only way if you use pure `Assembler` emitter and shown in the next example. + * Calculate function frame after the function is generated - this way is generally used by `Builder` and `Compiler` emitters(will be described together with `x86::Compiler`). + +The following concepts are used to describe and create functions in AsmJit: + + * `Type` - Type is an 8-bit value that describes a platform independent type as we know from C/C++. It provides abstractions for most common types like `int8_t`, `uint32_t`, `uintptr_t`, `float`, `double`, and all possible vector types to match ISAs up to AVX512. `Type::Id` was introduced originally to be used with the Compiler infrastucture, but is now used by `FuncSignature` as well. + + * `CallConv` - Describes a calling convention - this class contains instructions to assign registers and stack addresses to function arguments and return value(s), but doesn't specify any function signature. Calling conventions are architecture and OS dependent. + + * `FuncSignature` - Describes a function signature, for example `int func(int, int)`. `FuncSignature` contains a function calling convention id, return value type, and function arguments. The signature itself is platform independent and uses `Type::Id` to describe types of function arguments and its return value(s). + + * `FuncDetail` - Architecture and ABI dependent information that describes `CallConv` and expanded `FuncSignature`. Each function argument and return value is represented as `FuncValue` that contains the original `Type::Id` enriched by additional information that specifies if the value is passed/returned by register (and which register) or by stack. Each value also contains some other metadata that provide additional information required to handle it properly (for example if a vector value is passed indirectly by a pointer as required by WIN64 calling convention, etc...). + + * `FuncFrame` - Contains information about the function frame that can be used by prolog/epilog inserter (PEI). Holds call stack size size and alignment, local stack size and alignment, and various attributes that describe how prolog and epilog should be constructed. `FuncFrame` doesn't know anything about function's arguments or return values, it hold only information necessary to create a valid and ABI conforming function prologs and epilogs. + + * `FuncArgsAssignment` - A helper class that can be used to reassign function arguments into user specified registers. It's architecture and ABI dependent mapping from function arguments described by CallConv and FuncDetail into registers specified by the user. + +It's a lot of concepts where each represents one step in the function frame calculation. In addition, the whole machinery can also be used to create function calls, instead of function prologs and epilogs. The next example shows how AsmJit can be used to create functions for both 32-bit and 64-bit targets and various calling conventions: + +```c++ +#include +#include + +using namespace asmjit; + +typedef void (*SumIntsFunc)(int* dst, const int* a, const int* b); + +int main(int argc, char* argv[]) { + JitRuntime jit; // Create JIT Runtime. + CodeHolder code; // Create a CodeHolder. + + code.init(jit.codeInfo()); // Initialize it to match `jit`. + x86::Assembler a(&code); // Create and attach x86::Assembler to `code`. + + // Decide which registers will be mapped to function arguments. Try changing + // registers of `dst`, `src_a`, and `src_b` and see what happens in function's + // prolog and epilog. + x86::Gp dst = a.zax(); + x86::Gp src_a = a.zcx(); + x86::Gp src_b = a.zdx(); + + X86::Xmm vec0 = x86::xmm0; + X86::Xmm vec1 = x86::xmm1; + + // Create and initialize `FuncDetail` and `FuncFrame`. + FuncDetail func; + func.init(FuncSignatureT(CallConv::kIdHost)); + + FuncFrame frame; + frame.init(func); + + // Make XMM0 and XMM1 dirty; `kGroupVec` describes XMM|YMM|ZMM registers. + frame.setDirtyRegs(x86::Reg::kGroupVec, IntUtils::mask(0, 1)); + + // Alternatively, if you don't want to use register masks you can pass `BaseReg` + // to `addDirtyRegs()`. The following code would add both `xmm0` and `xmm1`. + frame.addDirtyRegs(x86::xmm0, x86::xmm1); + + FuncArgsAssignment args(&func); // Create arguments assignment context. + args.assignAll(dst, src_a, src_b); // Assign our registers to arguments. + args.updateFrameInfo(frame); // Reflect our args in FuncFrame. + frame.finalize(); // Finalize the FuncFrame (updates it). + + a.emitProlog(frame); // Emit function prolog. + a.emitArgsAssignment(frame, args); // Assign arguments to registers. + a.movdqu(vec0, x86::ptr(src_a)); // Load 4 ints from [src_a] to XMM0. + a.movdqu(vec1, x86::ptr(src_b)); // Load 4 ints from [src_b] to XMM1. + a.paddd(vec0, vec1); // Add 4 ints in XMM1 to XMM0. + a.movdqu(x86::ptr(dst), vec0); // Store the result to [dst]. + a.emitEpilog(frame); // Emit function epilog and return. + + SumIntsFunc fn; + Error err = jit.add(&fn, &code); // Add the generated code to the runtime. + if (err) return 1; // Handle a possible error case. + + // Execute the generated function. + int inA[4] = { 4, 3, 2, 1 }; + int inB[4] = { 1, 5, 2, 8 }; + int out[4]; + fn(out, inA, inB); + + // Prints {5 8 4 9} + printf("{%d %d %d %d}\n", out[0], out[1], out[2], out[3]); + + jit.release(fn); // Remove the function from the runtime. + return 0; +} +``` + + +Builder Interface +----------------- + +Both `Builder` and `Compiler` are emitters that emit everything to a representation that allows further processing. The code stored in such representation is completely safe to be patched, simplified, reordered, obfuscated, removed, injected, analyzed, and 'think-of-anything-else'. Each instruction, label, directive, etc... is stored in `BaseNode` (or derived class like `InstNode` or `LabelNode`) and contains all the information required to pass it later to the `Assembler`. + +There is a huge difference between `Builder` and `Compiler`: + + * `Builder` (low-level): + * Maximum compatibility with `Assembler`, easy to switch from `Assembler` to `Builder` and vice versa. + * Doesn't generate machine code directly, allows to serialize to `Assembler` when the whole code is ready to be encoded. + + * `Compiler` (high-level): + * Virtual registers - allows to use unlimited number of virtual registers which are allocated into physical registers by a built-in register allocator. + * Function nodes - allows to create functions by specifying their signatures and assigning virtual registers to function arguments and return value(s). + * Function calls - allows to call other functions within the generated code by using the same interface that is used to create functions. + +There are multiple node types used by both `Builder` and `Compiler`: + + * Basic nodes: + * `BaseNode` - Base class for all nodes. + * `InstNode` - Instruction node. + * `AlignNode` - Alignment directive (.align). + * `LabelNode` - Label (location where to bound it). + + * Data nodes: + * `DataNode` - Data embedded into the code. + * `ConstPoolNode` - Constant pool data. + * `LabelDataNode` - Label address embedded as data. + + * Informative nodes: + * `CommentNode` - Contains a comment string, doesn't affect code generation. + * `SentinelNode` - A marker that can be used to remember certain position, doesn't affect code generation. + + * Compiler-only nodes: + * `FuncNode` - Start of a function. + * `FuncRetNode` - Return from a function. + * `FuncCallNode` - Function call. + +### Using Builder + +The Builder interface was designed to be used as an `Assembler` replacement in case that post-processing of the generated code is required. The code can be modified during or after code generation. The post processing can be done manually or through `Pass` (Code-Builder Pass) object. Builder stores the emitted code as a double-linked list, which allows O(1) insertion and removal. + +The code representation used by `Builder` is compatible with everything AsmJit provides. Each instruction is stored as `InstNode`, which contains instruction id, options, and operands. Each instruction emitted will create a new `InstNode` instance and add it to the current cursor in the double-linked list of nodes. Since the instruction stream used by `Builder` can be manipulated, we can rewrite the **SumInts** example into the following: + +```c++ +#include +#include + +using namespace asmjit; + +typedef void (*SumIntsFunc)(int* dst, const int* a, const int* b); + +// Small helper function to print the current content of `cb`. +static void dumpCode(BaseBuilder& cb, const char* phase) { + StringBuilder sb; + cb.dump(sb); + printf("%s:\n%s\n", phase, sb.data()); +} + +int main(int argc, char* argv[]) { + JitRuntime jit; // Create JIT Runtime. + CodeHolder code; // Create a CodeHolder. + + code.init(jit.codeInfo()); // Initialize it to match `jit`. + x86::Builder cb(&code); // Create and attach x86::Builder to `code`. + + // Decide which registers will be mapped to function arguments. Try changing + // registers of `dst`, `src_a`, and `src_b` and see what happens in function's + // prolog and epilog. + x86::Gp dst = cb.zax(); + x86::Gp src_a = cb.zcx(); + x86::Gp src_b = cb.zdx(); + + X86::Xmm vec0 = x86::xmm0; + X86::Xmm vec1 = x86::xmm1; + + // Create and initialize `FuncDetail`. + FuncDetail func; + func.init(FuncSignatureT(CallConv::kIdHost)); + + // Remember prolog insertion point. + BaseNode* prologInsertionPoint = cb.cursor(); + + // Emit function body: + cb.movdqu(vec0, x86::ptr(src_a)); // Load 4 ints from [src_a] to XMM0. + cb.movdqu(vec1, x86::ptr(src_b)); // Load 4 ints from [src_b] to XMM1. + cb.paddd(vec0, vec1); // Add 4 ints in XMM1 to XMM0. + cb.movdqu(x86::ptr(dst), vec0); // Store the result to [dst]. + + // Remember epilog insertion point. + BaseNode* epilogInsertionPoint = cb.cursor(); + + // Let's see what we have now. + dumpCode(cb, "Raw Function"); + + // Now, after we emitted the function body, we can insert the prolog, arguments + // allocation, and epilog. This is not possible with using pure x86::Assembler. + FuncFrame frame; + frame.init(func); + + // Make XMM0 and XMM1 dirty; `kGroupVec` describes XMM|YMM|ZMM registers. + frame.setDirtyRegs(x86::Reg::kGroupVec, IntUtils::mask(0, 1)); + + FuncArgsAssignment args(&func); // Create arguments assignment context. + args.assignAll(dst, src_a, src_b); // Assign our registers to arguments. + args.updateFrame(frame); // Reflect our args in FuncFrame. + frame.finalize(); // Finalize the FuncFrame (updates it). + + // Insert function prolog and allocate arguments to registers. + cb.setCursor(prologInsertionPoint); + cb.emitProlog(frame); + cb.emitArgsAssignment(frame, args); + + // Insert function epilog. + cb.setCursor(epilogInsertionPoint); + cb.emitEpilog(frame); + + // Let's see how the function's prolog and epilog looks. + dumpCode(cb, "Prolog & Epilog"); + + // IMPORTANT: Builder requires `finalize()` to be called to serialize the code + // to the Assembler (it automatically creates one if not attached). + cb.finalize(); + + SumIntsFunc fn; + Error err = jit.add(&fn, &code); // Add the generated code to the runtime. + if (err) return 1; // Handle a possible error case. + + // Execute the generated function. + int inA[4] = { 4, 3, 2, 1 }; + int inB[4] = { 1, 5, 2, 8 }; + int out[4]; + fn(out, inA, inB); + + // Prints {5 8 4 9} + printf("{%d %d %d %d}\n", out[0], out[1], out[2], out[3]); + + jit.release(fn); // Remove the function from the runtime. + return 0; +} +``` + +When the example is executed it should output the following (this one using AMD64-SystemV ABI): + +``` +Raw Function: +movdqu xmm0, [rcx] +movdqu xmm1, [rdx] +paddd xmm0, xmm1 +movdqu [rax], xmm0 + +Prolog & Epilog: +mov rax, rdi +mov rcx, rsi +movdqu xmm0, [rcx] +movdqu xmm1, [rdx] +paddd xmm0, xmm1 +movdqu [rax], xmm0 +ret + +{5 8 4 9} +``` + +The number of use-cases of **x86::Builder** is not limited and highly depends on your creativity and experience. The previous example can be easily improved to collect all dirty registers inside the function programmatically and to pass them to `frame.setDirtyRegs()`: + +```c++ +#include + +using namespace asmjit; + +// NOTE: This function doesn't cover all possible constructs. It ignores +// instructions that write to implicit registers that are not part of the +// operand list. It also counts read-only registers. Real implementation +// would be a bit more complicated, but still relatively easy to implement. +static void collectDirtyRegs(const BaseNode* first, const BaseNode* last, uint32_t regMask[BaseReg::kGroupVirt]) { + const BaseNode* node = first; + while (node) { + if (node->actsAsInst()) { + const InstNode* inst = node->as(); + const Operand* opArray = inst->operands(); + + for (uint32_t i = 0, opCount = inst->opCount(); i < opCount; i++) { + const Operand& op = opArray[i]; + if (op.isReg()) { + const x86::Reg& reg = op.as(); + if (reg.group() < BaseReg::kGroupVirt) + regMask[reg.group()] |= 1u << reg.id(); + } + } + } + + if (node == last) break; + node = node->next(); + n} + +static void setDirtyRegsOfFuncFrame(const x86::Builder& cb, FuncFrame& frame) { + uint32_t regMask[BaseReg::kGroupVirt] = { 0 }; + collectDirtyRegs(cb.firstNode(), cb.lastNode(), regMask); + + // X86/X64 ABIs only require to save GP/XMM registers: + frame.setDirtyRegs(x86::Reg::kGroupGp , regMask[x86::Reg::kGroupGp ]); + frame.setDirtyRegs(x86::Reg::kGroupVec, regMask[x86::Reg::kGroupVec]); +} +``` + +### Using x86::Assembler or x86::Builder through X86::Emitter + +Even when **Assembler** and **Builder** provide the same interface as defined by **BaseEmitter** their platform dependent variants (**x86::Assembler** and **x86::Builder**, respective) cannot be interchanged or casted to each other by using C++'s `static_cast<>`. The main reason is the inheritance graph of these classes is different and cast-incompatible, as illustrated in the following graph: + +``` + +--------------+ +=========================+ + +----------------------->| x86::Emitter |<--+--# x86::EmitterImplicitT<> #<--+ + | +--------------+ | +=========================+ | + | (abstract) | (mixin) | + | +--------------+ +~~~~~~~~~~~~~~+ | | + +-->| BaseAssembler|---->|x86::Assembler|<--+ | + | +--------------+ +~~~~~~~~~~~~~~+ | | + | (abstract) (final) | | ++===============+ | +--------------+ +~~~~~~~~~~~~~~+ | | +# BaseEmitter #--+-->| BaseBuilder |--+->| x86::Builder |<--+ | ++===============+ +--------------+ | +~~~~~~~~~~~~~~+ | + (abstract) (abstract) | (final) | + +---------------------+ | + | | + | +--------------+ +~~~~~~~~~~~~~~+ +=========================+ | + +-->| BaseCompiler |---->| x86::Compiler|<-----# x86::EmitterExplicitT<> #---+ + +--------------+ +~~~~~~~~~~~~~~+ +=========================+ + (abstract) (final) (mixin) +``` + +The graph basically shows that it's not possible to cast `x86::Assembler` to `x86::Builder` and vice versa. However, since both `x86::Assembler` and `x86::Builder` share the same interface defined by both `BaseEmitter` and `x86::EmmiterImplicitT` a class called `x86::Emitter` was introduced to make it possible to write a function that can emit to both `x86::Assembler` and `x86::Builder`. Note that `x86::Emitter` cannot be created, it's abstract and has private constructors and destructors; it was only designed to be casted to and used as an interface. + +Each X86 emitter implements a member function called `as()`, which casts the instance to the `x86::Emitter`, as illustrated on the next example: + +```c++ +#include + +using namespace asmjit; + +static void emitSomething(x86::Emitter* e) { + e->mov(x86::eax, x86::ebx); +} + +static void assemble(CodeHolder& code, bool useAsm) { + if (useAsm) { + x86::Assembler a(&code); + emitSomething(a.as()); + } + else { + x86::Builder cb(&code); + emitSomething(cb.as()); + + // IMPORTANT: Builder requires `finalize()` to be called to serialize the + // code to the Assembler (it automatically creates one if not attached). + cb.finalize(); + } +} +``` + +The example above shows how to create a function that can emit code to either **x86::Assembler** or **x86::Builder** through **x86::Emitter**, which provides emitter-neutral functionality. **x86::Emitter**, however, doesn't provide any emitter **x86::Assembler** or **x86::Builder** specific functionality like **setCursor()**. + + +Compiler Interface +------------------ + +**Compiler** is a high-level code emitter that provides virtual registers and automatically handles function calling conventions. It's still architecture dependent, but makes the code generation much easier by offering a built-in register allocator and function builder. Functions are essential; the first-step to generate some code is to define the signature of the function you want to generate (before generating the function body). Function arguments and return value(s) are handled by assigning virtual registers to them. Similarly, function calls are handled the same way. + +**Compiler** also makes the use of passes (introduced by **Builder**) and automatically adds an architecture-dependent register allocator pass to the list of passes when attached to **CodeHolder**. + +### Compiler Basics + +The first **Compiler** example shows how to generate a function that simply returns an integer value. It's an analogy to the very first example: + +```c++ +#include +#include + +using namespace asmjit; + +// Signature of the generated function. +typedef int (*Func)(void); + +int main(int argc, char* argv[]) { + JitRuntime jit; // Runtime specialized for JIT code execution. + CodeHolder code; // Holds code and relocation information. + + code.init(jit.codeInfo()); // Initialize to the same arch as JIT runtime. + x86::Compiler cc(&code); // Create and attach x86::Compiler to `code`. + + cc.addFunc(FuncSignatureT()); // Begin a function of `int fn(void)` signature. + + x86::Gp vReg = cc.newGpd(); // Create a 32-bit general purpose register. + cc.mov(vReg, 1); // Move one to our virtual register `vReg`. + cc.ret(vReg); // Return `vReg` from the function. + + cc.endFunc(); // End of the function body. + cc.finalize(); // Translate and assemble the whole `cc` content. + // ----> x86::Compiler is no longer needed from here and can be destroyed <---- + + Func fn; + Error err = jit.add(&fn, &code); // Add the generated code to the runtime. + if (err) return 1; // Handle a possible error returned by AsmJit. + // ----> CodeHolder is no longer needed from here and can be destroyed <---- + + int result = fn(); // Execute the generated code. + printf("%d\n", result); // Print the resulting "1". + + jit.release(fn); // RAII, but let's make it explicit. + return 0; +} +``` + +The **addFunc()** and **endFunc()** methods define the body of the function. Both functions must be called per function, but the body doesn't have to be generated in sequence. An example of generating two functions will be shown later. The next example shows more complicated code that contain a loop and generates a **memcpy32()** function: + +```c++ +#include +#include + +using namespace asmjit; + +// Signature of the generated function. +typedef void (*MemCpy32)(uint32_t* dst, const uint32_t* src, size_t count); + +int main(int argc, char* argv[]) { + JitRuntime jit; // Runtime specialized for JIT code execution. + CodeHolder code; // Holds code and relocation information. + + code.init(jit.codeInfo()); // Initialize to the same arch as JIT runtime. + x86::Compiler cc(&code); // Create and attach x86::Compiler to `code`. + + cc.addFunc( // Begin the function of the following signature: + FuncSignatureT()); // 3rd argument - size_t (machine reg-size). + + Label L_Loop = cc.newLabel(); // Start of the loop. + Label L_Exit = cc.newLabel(); // Used to exit early. + + x86::Gp dst = cc.newIntPtr("dst"); // Create `dst` register (destination pointer). + x86::Gp src = cc.newIntPtr("src"); // Create `src` register (source pointer). + x86::Gp cnt = cc.newUIntPtr("cnt"); // Create `cnt` register (loop counter). + + cc.setArg(0, dst); // Assign `dst` argument. + cc.setArg(1, src); // Assign `src` argument. + cc.setArg(2, cnt); // Assign `cnt` argument. + + cc.test(cnt, cnt); // Early exit if length is zero. + cc.jz(L_Exit); + + cc.bind(L_Loop); // Bind the beginning of the loop here. + + x86::Gp tmp = cc.newInt32("tmp"); // Copy a single dword (4 bytes). + cc.mov(tmp, x86::dword_ptr(src)); // Load DWORD from [src] address. + cc.mov(x86::dword_ptr(dst), tmp); // Store DWORD to [dst] address. + + cc.add(src, 4); // Increment `src`. + cc.add(dst, 4); // Increment `dst`. + + cc.dec(cnt); // Loop until `cnt` is non-zero. + cc.jnz(L_Loop); + + cc.bind(L_Exit); // Label used by early exit. + cc.endFunc(); // End of the function body. + + cc.finalize(); // Translate and assemble the whole `cc` content. + // ----> x86::Compiler is no longer needed from here and can be destroyed <---- + + MemCpy32 memcpy32; + Error err = jit.add(&memcpy32, &code); // Add the generated code to the runtime. + if (err) return 1; // Handle a possible error returned by AsmJit. + // ----> CodeHolder is no longer needed from here and can be destroyed <---- + + // Test the generated code. + uint32_t input[6] = { 1, 2, 3, 5, 8, 13 }; + uint32_t output[6]; + memcpy32(output, input, 6); + + for (uint32_t i = 0; i < 6; i++) + printf("%d\n", output[i]); + + jit.release(memcpy32); // RAII, but let's make it explicit. + return 0; +} +``` + +### Recursive Functions + +It's possible to create more functions by using the same `x86::Compiler` instance and make links between them. In such case it's important to keep the pointer to the `FuncNode` node. The first example creates a simple Fibonacci function that calls itself recursively: + +```c++ +#include +#include + +using namespace asmjit; + +// Signature of the generated function. +typedef uint32_t (*Fibonacci)(uint32_t x); + +int main(int argc, char* argv[]) { + JitRuntime jit; // Runtime specialized for JIT code execution. + CodeHolder code; // Holds code and relocation information. + + code.init(jit.codeInfo()); // Initialize to the same arch as JIT runtime. + x86::Compiler cc(&code); // Create and attach x86::Compiler to `code`. + + FuncNode* func = cc.addFunc( // Begin of the Fibonacci function, `addFunc()` + FuncSignatureT()); // Returns a pointer to the `FuncNode` node. + + Label L_Exit = cc.newLabel() // Exit label. + x86::Gp x = cc.newU32(); // Function `x` argument. + x86::Gp y = cc.newU32(); // Temporary. + + cc.setArg(0, x); + + cc.cmp(x, 3); // Return `x` if less than 3. + cc.jb(L_Exit); + + cc.mov(y, x); // Make copy of the original `x`. + cc.dec(x); // Decrease `x`. + + FuncCallNode* call = cc.call( // Function call: + func->label(), // Function address or Label. + FuncSignatureT()); // Function signature. + + call->setArg(0, x); // Assign `x` as the first argument and + call->setRet(0, x); // assign `x` as a return value as well. + + cc.add(x, y); // Combine the return value with `y`. + + cc.bind(L_Exit); + cc.ret(x); // Return `x`. + cc.endFunc(); // End of the function body. + + cc.finalize(); // Translate and assemble the whole `cc` content. + // ----> x86::Compiler is no longer needed from here and can be destroyed <---- + + Fibonacci fib; + Error err = jit.add(&fib, &code); // Add the generated code to the runtime. + if (err) return 1; // Handle a possible error returned by AsmJit. + // ----> CodeHolder is no longer needed from here and can be destroyed <---- + + printf("Fib(%u) -> %u\n", 8, fib(8)); // Test the generated code. + + jit.release(fib); // RAII, but let's make it explicit. + return 0; +} +``` + +### Stack Management + +**Compiler** manages function's stack-frame, which is used by the register allocator to spill virtual registers. It also provides an interface to allocate user-defined block of the stack, which can be used as a temporary storage by the generated function. In the following example a stack of 256 bytes size is allocated, filled by bytes starting from 0 to 255 and then iterated again to sum all the values. + +```c++ +#include +#include + +using namespace asmjit; + +// Signature of the generated function. +typedef int (*Func)(void); + +int main(int argc, char* argv[]) { + JitRuntime jit; // Runtime specialized for JIT code execution. + CodeHolder code; // Holds code and relocation information. + + code.init(jit.codeInfo()); // Initialize to the same arch as JIT runtime. + x86::Compiler cc(&code); // Create and attach x86::Compiler to `code`. + + cc.addFunc(FuncSignatureT()); // Create a function that returns 'int'. + + x86::Gp p = cc.newIntPtr("p"); + x86::Gp i = cc.newIntPtr("i"); + + x86::Mem stack = cc.newStack(256, 4); // Allocate 256 bytes on the stack aligned to 4 bytes. + x86::Mem stackIdx(stack); // Copy of `stack` with `i` added. + stackIdx.setIndex(i); // stackIdx <- stack[i]. + stackIdx.setSize(1); // stackIdx <- byte ptr stack[i]. + + // Load a stack address to `p`. This step is purely optional and shows + // that `lea` is useful to load a memory operands address (even absolute) + // to a general purpose register. + cc.lea(p, stack); + + // Clear `i` (`xor` as it's C++ keyword, hence `xor_` is used instead). + cc.xor_(i, i); + + Label L1 = cc.newLabel(); + Label L2 = cc.newLabel(); + + cc.bind(L1); // First loop, fill the stack. + cc.mov(stackIdx, i.r8()); // stack[i] = uint8_t(i). + + cc.inc(i); // i++; + cc.cmp(i, 256); // if (i < 256) + cc.jb(L1); // goto L1; + + // Second loop, sum all bytes stored in `stack`. + x86::Gp sum = cc.newI32("sum"); + x86::Gp val = cc.newI32("val"); + + cc.xor_(i, i); + cc.xor_(sum, sum); + + cc.bind(L2); + + cc.movzx(val, stackIdx); // val = uint32_t(stack[i]); + cc.add(sum, val); // sum += val; + + cc.inc(i); // i++; + cc.cmp(i, 256); // if (i < 256) + cc.jb(L2); // goto L2; + + cc.ret(sum); // Return the `sum` of all values. + cc.endFunc(); // End of the function body. + + cc.finalize(); // Translate and assemble the whole `cc` content. + // ----> x86::Compiler is no longer needed from here and can be destroyed <---- + + Func func; + Error err = jit.add(&func, &code); // Add the generated code to the runtime. + if (err) return 1; // Handle a possible error returned by AsmJit. + // ----> CodeHolder is no longer needed from here and can be destroyed <---- + + printf("Func() -> %d\n", func()); // Test the generated code. + + jit.release(func); // RAII, but let's make it explicit. + return 0; +} +``` + +### Constant Pool + +**Compiler** provides two constant pools for a general purpose code generation - local and global. Local constant pool is related to a single **FuncNode** node and is generally flushed after the function body, and global constant pool is flushed at the end of the generated code by **Compiler::finalize()**. + +```c++ +#include + +using namespace asmjit; + +static void exampleUseOfConstPool(x86::Compiler& cc) { + cc.addFunc(FuncSignatureT()); + + x86::Gp v0 = cc.newGpd("v0"); + x86::Gp v1 = cc.newGpd("v1"); + + x86::Mem c0 = cc.newInt32Const(ConstPool::kScopeLocal, 200); + x86::Mem c1 = cc.newInt32Const(ConstPool::kScopeLocal, 33); + + cc.mov(v0, c0); + cc.mov(v1, c1); + cc.add(v0, v1); + + cc.ret(v0); + cc.endFunc(); +} +``` + +### Jump Tables + +**Compiler** supports `jmp` instruction with reg/mem operand, which is a commonly used pattern to implement indirect jumps within a function, for example to implement `switch()` statement in a programming languages. By default AsmJit assumes that every basic block can be a possible jump target as it's unable to deduce targets from instruction's operands. This is a very pessimistic default that should be avoided if possible as it's costly and very unfriendly to liveness analysis and register allocation. So instead of relying on such pessimistic default, use **JumpAnnotation** to annotate indirect jumps: + +```c++ +#include + +using namespace asmjit; + +static void exampleUseOfIndirectJump(x86::Compiler& cc) { + cc.addFunc(FuncSignatureT(CallConv::kIdHost)); + + // Function arguments + x86::Xmm a = cc.newXmmSs("a"); + x86::Xmm b = cc.newXmmSs("b"); + x86::Gp op = cc.newUInt32("op"); + + x86::Gp target = cc.newIntPtr("target"); + x86::Gp offset = cc.newIntPtr("offset"); + + Label L_Table = cc.newLabel(); + Label L_Add = cc.newLabel(); + Label L_Sub = cc.newLabel(); + Label L_Mul = cc.newLabel(); + Label L_Div = cc.newLabel(); + Label L_End = cc.newLabel(); + + cc.setArg(0, a); + cc.setArg(1, b); + cc.setArg(2, op); + + // Jump annotation is a building block that allows to annotate all + // possible targets where `jmp()` can jump. It then drives the CFG + // contruction and liveness analysis, which impacts register allocation. + JumpAnnotation* annotation = cc.newJumpAnnotation(); + annotation->addLabel(L_Add); + annotation->addLabel(L_Sub); + annotation->addLabel(L_Mul); + annotation->addLabel(L_Div); + + // Most likely not the common indirect jump approach, but it + // doesn't really matter how final address is calculated. The + // most important path using JumpAnnotation with `jmp()`. + cc.lea(offset, x86::ptr(L_Table)); + if (cc.is64Bit()) + cc.movsxd(target, x86::dword_ptr(offset, op.cloneAs(offset), 2)); + else + cc.mov(target, x86::dword_ptr(offset, op.cloneAs(offset), 2)); + cc.add(target, offset); + cc.jmp(target, annotation); + + // Acts like a switch() statement in C. + cc.bind(L_Add); + cc.addss(a, b); + cc.jmp(L_End); + + cc.bind(L_Sub); + cc.subss(a, b); + cc.jmp(L_End); + + cc.bind(L_Mul); + cc.mulss(a, b); + cc.jmp(L_End); + + cc.bind(L_Div); + cc.divss(a, b); + + cc.bind(L_End); + cc.ret(a); + + cc.endFunc(); + + // Relative int32_t offsets of `L_XXX - L_Table`. + cc.bind(L_Table); + cc.embedLabelDelta(L_Add, L_Table, 4); + cc.embedLabelDelta(L_Sub, L_Table, 4); + cc.embedLabelDelta(L_Mul, L_Table, 4); + cc.embedLabelDelta(L_Div, L_Table, 4); +} +``` + + +Advanced Features +----------------- + +### Logging + +The initial phase of any project that generates machine code is not always smooth. Failure cases are common especially at the beginning of the project and AsmJit provides a logging functionality to address this issue. AsmJit does already a good job with function overloading to prevent from emitting semantically incorrect instructions, but it can't prevent from emitting machine code that is semantically correct, but doesn't work when it's executed. Logging has always been an important part of AsmJit's infrastructure and looking at logs can sometimes reveal code generation issues quickly. + +AsmJit provides API for logging and formatting: + * `Logger` - A logger that you can pass to `CodeHolder` and all emitters that inherit `BaseEmitter`. + * `FormatOptions` - Formatting options that can change how instructions and operands are formatted. + +AsmJit's `Logger` serves the following purposes: + * Provides a basic foundation for logging. + * Abstract class leaving the implementation (destination) on users. Two backends are built-in for simplicity: + * `FileLogger` implements logging into a standard `std::FILE` stream. + * `StringLogger` stores the logged text in `StringBuilder` instance. + +AsmJit's `FormatOptions` provides the following to customize the formatting of instructions and operands: + * Flags: + * `FormatOptions::kFlagMachineCode` - Show a machine code of each encoded instruction. + * `FormatOptions::kFlagExplainConsts` - Show a text explanation of some immediate values that are used as predicates. + * `FormatOptions::kFlagHexImms` - Use hexadecimal notation to output immediates. + * `FormatOptions::kFlagHexOffsets` - Use hexadecimal notation to output offsets. + * `FormatOptions::kFlagRegCasts` - Show casts between various register types (compiler). + * `FormatOptions::kFlagPositions` - Show positions associated with nodes (compiler). + * Indentation: + * `FormatOptions::kIndentationCode` - Indentation of instructions and directives. + * `FormatOptions::kIndentationLabel` - Indentation of labels. + * `FormatOptions::kIndentationComment` - Indentation of whole-line comments. + +**Logger** is typically attached to **CodeHolder** and all attached code emitters automatically use it: + +```c++ +#include +#include + +using namespace asmjit; + +int main(int argc, char* argv[]) { + JitRuntime jit; // Runtime specialized for JIT code execution. + FileLogger logger(stdout); // Logger should always survive the CodeHolder. + + CodeHolder code; // Holds code and relocation information. + code.init(jit.codeInfo()); // Initialize to the same arch as JIT runtime. + code.setLogger(&logger); // Attach the `logger` to `code` holder. + + // ... code as usual, everything you emit will be logged to `stdout` ... + + return 0; +} +``` + +### Error Handling + +AsmJit uses error codes to represent and return errors. Every function where error can occur returns **Error**. Exceptions are never thrown by AsmJit even in extreme conditions like out-of-memory. Errors should never be ignored, however, checking errors after each asmjit API call would simply overcomplicate the whole code generation experience. To make life simpler AsmJit provides **ErrorHandler**, which provides **handleError()** function: + + `virtual bool handleError(Error err, const char* message, BaseEmitter* origin) = 0;` + +That can be overridden by AsmJit users and do the following: + + * 1. Record the error and continue (the way how the error is user-implemented). + * 2. Throw an exception. AsmJit doesn't use exceptions and is completely exception-safe, but it's perfectly legal to throw an exception from the error handler. + * 3. Use plain old C's `setjmp()` and `longjmp()`. Asmjit always puts `Assembler` and `Compiler` to a consistent state before calling the `handleError()` so `longjmp()` can be used without issues to cancel the code-generation if an error occurred. This method can be used if exception handling in your project is turned off and you still want some comfort. In most cases it should be safe as AsmJit uses Zone memory and the ownership of memory it allocates always ends with the instance that allocated it. If using this approach please never jump outside the life-time of **CodeHolder** and **BaseEmitter**. + +**ErrorHandler** can be attached to **CodeHolder** and/or **BaseEmitter** (which has a priority). The first example uses error handler that just prints the error, but lets AsmJit continue: + +```c++ +// Error handling #1: +#include + +#include + +// Error handler that just prints the error and lets AsmJit ignore it. +class SimpleErrorHandler : public asmjit::ErrorHandler { +public: + inline SimpleErrorHandler() : lastError(kErrorOk) {} + + void handleError(asmjit::Error err, const char* message, asmjit::BaseEmitter* origin) override { + this->err = err; + fprintf(stderr, "ERROR: %s\n", message); + } + + Error err; +}; + +int main(int argc, char* argv[]) { + using namespace asmjit; + + JitRuntime jit; + SimpleErrorHandler eh; + + CodeHolder code; + code.init(jit.codeInfo()); + code.setErrorHandler(&eh); + + // Try to emit instruction that doesn't exist. + x86::Assembler a(&code); + a.emit(x86::Inst::kIdMov, x86::xmm0, x86::xmm1); + + if (eh.err) { + // Assembler failed! + } + + return 0; +} +``` + +If error happens during instruction emitting / encoding the assembler behaves transactionally - the output buffer won't advance if encoding failed, thus either a fully encoded instruction or nothing is emitted. The error handling shown above is useful, but it's still not the best way of dealing with errors in AsmJit. The following example shows how to use exception handling to handle errors in a more C++ way: + +```c++ +// Error handling #2: +#include + +#include +#include +#include + +// Error handler that throws a user-defined `AsmJitException`. +class AsmJitException : public std::exception { +public: + AsmJitException(asmjit::Error err, const char* message) noexcept + : err(err), + message(message) {} + + const char* what() const noexcept override { return message.c_str(); } + + asmjit::Error err; + std::string message; +}; + +class ThrowableErrorHandler : public asmjit::ErrorHandler { +public: + // Throw is possible, functions that use ErrorHandler are never 'noexcept'. + void handleError(asmjit::Error err, const char* message, asmjit::BaseEmitter* origin) override { + throw AsmJitException(err, message); + } +}; + +int main(int argc, char* argv[]) { + using namespace asmjit; + + JitRuntime jit; + ThrowableErrorHandler eh; + + CodeHolder code; + code.init(jit.codeInfo()); + code.setErrorHandler(&eh); + + x86::Assembler a(&code); + + // Try to emit instruction that doesn't exist. + try { + a.emit(x86::Inst::kIdMov, x86::xmm0, x86::xmm1); + } + catch (const AsmJitException& ex) { + printf("EXCEPTION THROWN: %s\n", ex.what()); + } + + return 0; +} +``` + +If C++ exceptions are not what you like or your project turns off them completely there is still a way of reducing the error handling to a minimum by using a standard `setjmp/longjmp` approach. AsmJit is exception-safe and cleans up everything before calling the **ErrorHandler**, so any approach is safe. You can simply jump from the error handler without causing any side-effects or memory leaks. The following example demonstrates how it could be done: + +```c++ +// Error handling #3: +#include + +#include +#include + +class LongJmpErrorHandler : public asmjit::ErrorHandler { +public: + inline LongJmpErrorHandler() : err(asmjit::kErrorOk) {} + + void handleError(asmjit::Error err, const char* message, asmjit::BaseEmitter* origin) override { + this->err = err; + longjmp(state, 1); + } + + jmp_buf state; + asmjit::Error err; +}; + +int main(int argc, char* argv[]) { + using namespace asmjit; + + JitRuntime jit; + LongJmpErrorHandler eh; + + CodeHolder code; + code.init(jit.codeInfo()); + code.setErrorHandler(&eh); + + x86::Assembler a(&code); + + if (!setjmp(eh.state)) { + // Try to emit instruction that doesn't exist. + a.emit(x86::Inst::kIdMov, x86::xmm0, x86::xmm1); + } + else { + Error err = eh.err; + printf("ASMJIT ERROR: 0x%08X [%s]\n", err, DebugUtils::errorAsString(err)); + } + + return 0; +} +``` + +### Code Injection + +Both `Builder` and `Compiler` emitters store their nodes in a double-linked list, which makes it easy to manipulate that list during the code generation or after. Each node is always emitted next to the current `cursor` and the cursor is changed to that newly emitted node. The cursor can be explicitly retrieved and changed by `cursor()` and `setCursor()`, respectively. + +The following example shows how to inject code at the beginning of the function by implementing an `XmmConstInjector` helper class. + +```c++ +``` + +### TODO + +...More documentation... + + + +Other Topics +------------ + +This section provides quick answers to some recurring questions and topics. + +### Instruction Validation + +AsmJit by default prefers performance when it comes to instruction encoding. The Assembler implementation would only validate operands that must be validated to select a proper encoding of the instruction. This means that by default it would accept instructions that do not really exist like `mov rax, ebx`. This is great in release mode as it makes the assembler faster, however, it's not that great for development as it allows to silently pass even when the instruction's operands are incorrect. To fix this Asmjit contains a feature called **Strict Validation**, which allows to validate each instruction before the Assembler tries to encode it. This feature can also be used without an Assembler instance through `BaseInst::validate()` API. + +Emitter options are configured through CodeHolder: + +```c++ +CodeHolder code; + +// Enables strict instruction validation for all emitters attached to `code`. +code.addEmitterOptions(BaseEmitter::kOptionStrictValidation); + +// Use either ErrorHandler attached to CodeHolder or Error code returned by +// the Assembler. +x86::Assembler a(&code); +Error err = a.emit(x86::Inst::kIdMov, x86::eax, x86::al); +if (err) { /* failed */ } +``` + +### Label Offsets and Links + +When you use a label that is not yet bound the Assembler would create a `LabelLink`, which is then added to CodeHolder's `LabelEntry`. These links are also created for labels that are bound but reference some location in a different section. Firstly, here are some functions that can be used to check some basics: + +```c++ +CodeHolder code = ...; +Label L = ...; + +// Returns whether the Label `L` is bound. +bool bound = code.isLabelBound(L or L.id()); + +// Returns true if the code contains either referenced, but unbound labels, +// or cross-section label links that are not resolved yet. +bool value = code.hasUnresolvedLinks(); // Boolean answer. +size_t count = code.unresolvedLinkCount(); // Count of links. +``` + +Please note that there is not API to return a count of unbound labels as this is completely unimportant from CodeHolder's perspective. If a label is not used then it doesn't matter whether it's bound or not, only used labels matter. After a Label is bound you can query it's offset relative to the start of the section where it was bound: + +```c++ +CodeHolder code = ...; +Label L = ...; + +// After you are done you can check the offset. The offset provided +// is relative to the start of the section, see below for alternative. +// If the given label is not bound then the offset returned will be zero. +uint64_t offset = code.labelOffset(L or L.id()); + +// If you use multiple sections and want the offset relative to the base. +// NOTE: This function expects that the section has already an offset and +// the label-link was resolved (if this is not true you will still get an +// offset relative to the start of the section). +uint64_t offset = code.labelOffsetFromBase(L or L.id()); +``` + +### Sections + +Sections is a relatively new feature that allows to create multiple sections. It's supported by Assembler, Builder, and Compiler. Please note that using multiple sections is advanced and requires more understanding about how AsmJit works. There is a test-case [asmjit_test_x86_sections.cpp](./test/asmjit_test_x86_sections.cpp) that shows how sections can be used. + +```c++ +CodeHolder code = ...; + +// Text section is always provided as the first section. +Section* text = code.textSection(); // or code.sectionById(0); + +// To create another section use `code.newSection()`. +Section* data; +Error err = code.newSection(&data, + ".data", // Section name + SIZE_MAX, // Name length if the name is not null terminated (or SIZE_MAX). + 0, // Section flags, see Section::Flags. + 8); // Section alignment, must be power of 2. + +// When you switch sections in Assembler, Builder, or Compiler the cursor +// will always move to the end of that section. When you create an Assembler +// the cursor would be placed at the end of the first (.text) section, which +// is initially empty. +x86::Assembler a(&code); +Label L_Data = a.newLabel(); + +a.mov(x86::eax, x86::ebx); // Emits in .text section. + +a.section(data); // Switches to the end of .data section. +a.bind(L_Data); // Binds label in this .data section +a.db(0x01); // Emits byte in .data section. + +a.section(text); // Switches to the end of .text section. +a.add(x86::ebx, x86::eax); // Emits in .text section. + +// References a label bound in .data section in .text section. This +// would create a LabelLink even when the L_Data is already bound, +// because the reference crosses sections. See below... +a.lea(x86::rsi, x86::ptr(L_Data)); +``` + +The last line in the example above shows that a LabelLink would be created even for bound labels that cross sections. In this case a referenced label was bound in another section, which means that the link couldn't be resolved at that moment. If your code uses sections, but you wish AsmJit to flatten these sections (you don't plan to flatten them manually) then there is an API for that. + +```c++ +// ... (continuing the previous example) ... +CodeHolder code = ...; + +// Suppose we have some code that contains multiple sections and +// we would like to flatten them by using AsmJit's built-in API: +Error err = code.flatten(); +if (err) { /* Error handling is necessary. */ } + +// After flattening all sections would contain assigned offsets +// relative to base. Offsets are 64-bit unsigned integers so we +// cast them to `size_t` for simplicity. On 32-bit targets it's +// guaranteed that the offset cannot be greater than `2^32 - 1`. +printf("Data section offset %zu", size_t(data->offset())); + +// The flattening doesn't resolve unresolved label links, this +// has to be done manually as flattening can be done separately. +err = code.resolveUnresolvedLinks(); +if (err) { /* Error handling is necessary. */ } + +if (code.hasUnresolvedLinks()) { + // This would mean either unbound label or some other issue. + printf("FAILED: UnresoledLinkCount=%zu\n", code.unresovedLinkCount()); +} +``` + +### Using AsmJit Data Structures + +AsmJit stores its data in data structures allocated by `ZoneAllocator`. It's a fast allocator that allows AsmJit to allocate a lot of small data structures fast and without `malloc()` overhead. The most common data structure that you will probably inspect is `ZoneVector`. It's like C++'s `std::vector`. but the implementation doesn't use exceptions and uses the mentioned `ZoneAllocator` for performance reasons. You don't have to worry about allocations as you should not need to add items to data structures that are managed by `CodeHolder` or advanced emitters like Builder/Compiler. + +APIs that return `ZoneVector`: + +```c++ +CodeHolder code = ...; + +// Contains all emitters attached to CodeHolder. +const ZoneVector& emitters = code.emitters(); + +// Contains all sections managed by CodeHolder. +const ZoneVector& sections = code.sections(); + +// Contains all LabelEntry records associated with created Labels. +const ZoneVector& labelEntries = code.labelEntries(); + +// Contains all RelocEntry records that describe relocations. +const ZoneVector& relocEntries = code.relocEntries(); +``` + +AsmJit's `ZoneVector` has overloaded array access operator to make it possible accessing its elements through operator[]. Some standard functions like `empty()`, `size()`, and `data()` are provided as well. Vectors are also iterable through range-based for loop: + +```c++ +CodeHolder code = ...; + +for (LabelEntry* le : code.labelEntries()) { + printf("Label #%u {Bound=%s Offset=%llu}", + le->id(), + le->isBound() ? "true" : "false", + (unsigned long long)le->offset()); +} +``` + + +Support +------- + +AsmJit is an open-source library released under a permissive ZLIB license, which makes it possible to use it freely in any open-source or commercial product. Free support is available through issues and gitter channel, which is very active. Commercial support is currently individual and can be negotiated on demand. It includes consultation, priority bug fixing, review of code that uses AsmJit, porting code to the latest AsmJit, and implementation of new AsmJit features. + +If you use AsmJit in a non-commercial project and would like to appreciate the library in the form of a donation you are welcome to support us. Donations are anonymous unless the donor lets us know otherwise. The order and format of listed donors is not guaranteed and may change in the future. Additionally, donations should be considered as an appreciation of past work and not used to gain special privileges in terms of future development. AsmJit authors reserve the right to remove a donor from the list in extreme cases of disruptive behavior against other community members. Diversity of opinions and constructive criticism will always be welcome in the AsmJit community. + +Donation Addresses: + + * BTC: 14dEp5h8jYSxgXB9vcjE8eh78uweD76o7W + * ETH: 0xd4f0b9424cF31DF5a5359D029CF3A65c500a581E + * Please contact us if you would like to donate through a different channel or to use a different crypto-currency. Wire transfers and SEPA payments are both possible. + +Donors: + + * [ZehMatt](https://github.com/ZehMatt) + + + +Authors & Maintainers +--------------------- + + * Petr Kobalicek diff --git a/3rdparty/asmjit/src/asmjit.natvis b/3rdparty/asmjit/src/asmjit.natvis new file mode 100644 index 00000000000..18a083c6c12 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit.natvis @@ -0,0 +1,83 @@ + + + + + + + + {_small.data, s8} + {_large.data, s8} + + + Small + Large + External + + (int)_small.type, d + _large.size, d + asmjit::String::kSSOCapacity, d + _large.capacity, d + _small.data, s8 + _large.data, s8 + + + + + {{ [size={_size, d} capacity={_capacity, d}] }} + + _size, d + _capacity, d + + _size + (($T1*)_data) + + + + + + + + + + + + + + + + + + + + + + + + + + [None] + [Reg] {{ id={_baseId, d} group={regGroup(), d} type={regType(), d} size={opSize(), d} }} + [Mem] {{ baseId={memBaseId(), d} indexId={memIndexId(), d} offset={(__int64)memOffset(), d} }} + [Imm] {{ val={immValue(), d} hex={immValue(), X} }} + [Label] {{ id={_baseId} }} + [Unknown] + + _signature, X + (asmjit::Operand_::OpType)opType() + opSize(), d + (asmjit::BaseReg::RegType)regType() + (asmjit::BaseReg::RegGroup)regGroup() + (asmjit::BaseReg::RegType)memBaseType() + (asmjit::BaseReg::RegType)memIndexType() + (asmjit::BaseMem::AddrType)memAddrType() + (bool)memRegHome() + _baseId + _data[0] + _data[1] + _data[0] + _data[1] + _data[0] + _data[1] + + + diff --git a/3rdparty/asmjit/src/asmjit/asmjit.h b/3rdparty/asmjit/src/asmjit/asmjit.h new file mode 100644 index 00000000000..e543a633d04 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/asmjit.h @@ -0,0 +1,58 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_ASMJIT_H_INCLUDED +#define ASMJIT_ASMJIT_H_INCLUDED + +//! \mainpage API Reference +//! +//! AsmJit C++ API reference documentation generated by Doxygen. +//! +//! Introduction provided by the project page at https://github.com/asmjit/asmjit. +//! +//! \section main_groups Groups +//! +//! The documentation is split into the following groups: +//! +//! $$DOCS_GROUP_OVERVIEW$$ +//! +//! \section main_other Other Pages +//! +//! - Class List - List of classes sorted alphabetically +//! - AsmJit Namespace - List of symbols provided by `asmjit` namespace + +//! \namespace asmjit +//! +//! Root namespace used by AsmJit. + +#include "./core.h" + +#ifdef ASMJIT_BUILD_X86 + #include "./x86.h" +#endif + +#ifdef ASMJIT_BUILD_ARM + #include "./arm.h" +#endif + +#endif // ASMJIT_ASMJIT_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core.h b/3rdparty/asmjit/src/asmjit/core.h new file mode 100644 index 00000000000..f9a56fc51fb --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core.h @@ -0,0 +1,102 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_H_INCLUDED +#define ASMJIT_CORE_H_INCLUDED + +//! \defgroup asmjit_core Core +//! \brief Core API. +//! +//! API that provides classes and functions not specific to any architecture. + +//! \defgroup asmjit_builder Builder +//! \brief Builder API. +//! +//! Both Builder and Compiler are emitters that emit everything to a representation +//! that allows further processing. The code stored in such representation is +//! completely safe to be patched, simplified, reordered, obfuscated, removed, +//! injected, analyzed, or processed some other way. Each instruction, label, +//! directive, or other building block is stored as \ref BaseNode (or derived +//! class like \ref InstNode or \ref LabelNode) and contains all the information +//! necessary to pass that node later to the Assembler. + +//! \defgroup asmjit_compiler Compiler +//! \brief Compiler API. +//! +//! Compiler tool is built on top of a \ref asmjit_builder API and adds register +//! allocation and support for defining and calling functions into it. At the +//! moment it's the easiest way to generate some code as most architecture and +//! OS specific stuff is properly abstracted, however, abstractions also mean +//! that not everything is possible with the Compiler. + +//! \defgroup asmjit_func Function +//! \brief Function API. + +//! \defgroup asmjit_jit JIT +//! \brief JIT API and Virtual Memory Management. + +//! \defgroup asmjit_zone Zone +//! \brief Zone allocator and zone allocated containers. + +//! \defgroup asmjit_support Support +//! \brief Support API. + +//! \cond INTERNAL +//! \defgroup asmjit_ra RA +//! \brief Register allocator internals. +//! \endcond + +#include "./core/globals.h" + +#include "./core/arch.h" +#include "./core/assembler.h" +#include "./core/builder.h" +#include "./core/callconv.h" +#include "./core/codeholder.h" +#include "./core/compiler.h" +#include "./core/constpool.h" +#include "./core/cpuinfo.h" +#include "./core/datatypes.h" +#include "./core/emitter.h" +#include "./core/features.h" +#include "./core/func.h" +#include "./core/inst.h" +#include "./core/jitallocator.h" +#include "./core/jitruntime.h" +#include "./core/logging.h" +#include "./core/operand.h" +#include "./core/osutils.h" +#include "./core/string.h" +#include "./core/support.h" +#include "./core/target.h" +#include "./core/type.h" +#include "./core/virtmem.h" +#include "./core/zone.h" +#include "./core/zonehash.h" +#include "./core/zonelist.h" +#include "./core/zonetree.h" +#include "./core/zonestack.h" +#include "./core/zonestring.h" +#include "./core/zonevector.h" + +#endif // ASMJIT_CORE_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/api-build_p.h b/3rdparty/asmjit/src/asmjit/core/api-build_p.h new file mode 100644 index 00000000000..714107c204d --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/api-build_p.h @@ -0,0 +1,77 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_API_BUILD_P_H_INCLUDED +#define ASMJIT_CORE_API_BUILD_P_H_INCLUDED + +#define ASMJIT_EXPORTS + +// Only turn-off these warnings when building asmjit itself. +#ifdef _MSC_VER + #ifndef _CRT_SECURE_NO_DEPRECATE + #define _CRT_SECURE_NO_DEPRECATE + #endif + #ifndef _CRT_SECURE_NO_WARNINGS + #define _CRT_SECURE_NO_WARNINGS + #endif +#endif + +// Dependencies only required for asmjit build, but never exposed through public headers. +#ifdef _WIN32 + #ifndef WIN32_LEAN_AND_MEAN + #define WIN32_LEAN_AND_MEAN + #endif + #ifndef NOMINMAX + #define NOMINMAX + #endif + #include +#endif + +// ============================================================================ +// [asmjit::Build - Globals - Build-Only] +// ============================================================================ + +#include "./api-config.h" + +#if !defined(ASMJIT_BUILD_DEBUG) && ASMJIT_CXX_GNU >= ASMJIT_CXX_MAKE_VER(4, 4, 0) + #define ASMJIT_FAVOR_SIZE __attribute__((__optimize__("Os"))) + #define ASMJIT_FAVOR_SPEED __attribute__((__optimize__("O3"))) +#elif ASMJIT_CXX_HAS_ATTRIBUTE(__minsize__, 0) + #define ASMJIT_FAVOR_SIZE __attribute__((__minsize__)) + #define ASMJIT_FAVOR_SPEED +#else + #define ASMJIT_FAVOR_SIZE + #define ASMJIT_FAVOR_SPEED +#endif + +// Make sure '#ifdef'ed unit tests are properly highlighted in IDE. +#if !defined(ASMJIT_TEST) && defined(__INTELLISENSE__) + #define ASMJIT_TEST +#endif + +// Include a unit testing package if this is a `asmjit_test_unit` build. +#if defined(ASMJIT_TEST) + #include "../../../test/broken.h" +#endif + +#endif // ASMJIT_CORE_API_BUILD_P_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/api-config.h b/3rdparty/asmjit/src/asmjit/core/api-config.h new file mode 100644 index 00000000000..16199a9f41e --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/api-config.h @@ -0,0 +1,533 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_API_CONFIG_H_INCLUDED +#define ASMJIT_CORE_API_CONFIG_H_INCLUDED + +// ============================================================================ +// [asmjit::Version] +// ============================================================================ + +#define ASMJIT_LIBRARY_VERSION 0x010200 /* 1.2.0 */ + +// ============================================================================ +// [asmjit::Options] +// ============================================================================ + +// AsmJit Static Builds and Embedding +// ---------------------------------- +// +// These definitions can be used to enable static library build. Embed is used +// when AsmJit's source code is embedded directly in another project, implies +// static build as well. +// +// #define ASMJIT_EMBED // Asmjit is embedded (implies ASMJIT_BUILD_STATIC). +#define ASMJIT_STATIC // Enable static-library build. + +// AsmJit Build Mode +// ----------------- +// +// These definitions control the build mode and tracing support. The build mode +// should be auto-detected at compile time, but it's possible to override it in +// case that the auto-detection fails. +// +// Tracing is a feature that is never compiled by default and it's only used to +// debug AsmJit itself. +// +// #define ASMJIT_BUILD_DEBUG // Always use debug-mode (ASMJIT_ASSERT enabled). +// #define ASMJIT_BUILD_RELEASE // Always use release-mode (ASMJIT_ASSERT disabled). + +// AsmJit Build Backends +// --------------------- +// +// These definitions control which backends to compile. If none of these is +// defined AsmJit will use host architecture by default (for JIT code generation). +// +// #define ASMJIT_BUILD_X86 // Enable X86 targets (X86 and X86_64). +// #define ASMJIT_BUILD_ARM // Enable ARM targets (ARM and AArch64). +// #define ASMJIT_BUILD_HOST // Enable targets based on target arch (default). + +// AsmJit Build Options +// -------------------- +// +// Flags can be defined to disable standard features. These are handy especially +// when building AsmJit statically and some features are not needed or unwanted +// (like BaseCompiler). +// +// AsmJit features are enabled by default. +// #define ASMJIT_NO_BUILDER // Disable Builder (completely). +// #define ASMJIT_NO_COMPILER // Disable Compiler (completely). +// #define ASMJIT_NO_JIT // Disable JIT memory manager and JitRuntime. +// #define ASMJIT_NO_LOGGING // Disable logging and formatting (completely). +// #define ASMJIT_NO_TEXT // Disable everything that contains text +// // representation (instructions, errors, ...). +// #define ASMJIT_NO_VALIDATION // Disable validation API and options. +// #define ASMJIT_NO_INTROSPECTION // Disable API related to instruction database. +// // (validation, cpu features, rw-info, etc). + +// ASMJIT_NO_BUILDER implies ASMJIT_NO_COMPILER. +#if defined(ASMJIT_NO_BUILDER) && !defined(ASMJIT_NO_COMPILER) + #define ASMJIT_NO_COMPILER +#endif + +// Prevent compile-time errors caused by misconfiguration. +#if defined(ASMJIT_NO_TEXT) && !defined(ASMJIT_NO_LOGGING) + #pragma "ASMJIT_NO_TEXT can only be defined when ASMJIT_NO_LOGGING is defined." + #undef ASMJIT_NO_TEXT +#endif + +#if defined(ASMJIT_NO_INTROSPECTION) && !defined(ASMJIT_NO_COMPILER) + #pragma message("ASMJIT_NO_INTROSPECTION can only be defined when ASMJIT_NO_COMPILER is defined") + #undef ASMJIT_NO_INTROSPECTION +#endif + +// ============================================================================ +// [asmjit::Dependencies] +// ============================================================================ + +// We really want std-types as globals. +#include +#include +#include +#include +#include +#include + +#include +#include +#include +#include + +#if !defined(_WIN32) && !defined(__EMSCRIPTEN__) + #include +#endif + +// ============================================================================ +// [asmjit::Build - Globals - Deprecated] +// ============================================================================ + +// DEPRECATED: Will be removed in the future. +#if defined(ASMJIT_BUILD_EMBED) || defined(ASMJIT_BUILD_STATIC) + #if defined(ASMJIT_BUILD_EMBED) + #pragma message("'ASMJIT_BUILD_EMBED' is deprecated, use 'ASMJIT_STATIC'") + #endif + #if defined(ASMJIT_BUILD_STATIC) + #pragma message("'ASMJIT_BUILD_STATIC' is deprecated, use 'ASMJIT_STATIC'") + #endif + + #if !defined(ASMJIT_STATIC) + #define ASMJIT_STATIC + #endif +#endif + +// ============================================================================ +// [asmjit::Build - Globals - Build Mode] +// ============================================================================ + +// Detect ASMJIT_BUILD_DEBUG and ASMJIT_BUILD_RELEASE if not defined. +#if !defined(ASMJIT_BUILD_DEBUG) && !defined(ASMJIT_BUILD_RELEASE) + #if !defined(NDEBUG) + #define ASMJIT_BUILD_DEBUG + #else + #define ASMJIT_BUILD_RELEASE + #endif +#endif + +// ============================================================================ +// [asmjit::Build - Globals - Target Architecture] +// ============================================================================ + +#if defined(_M_X64) || defined(__x86_64__) + #define ASMJIT_ARCH_X86 64 +#elif defined(_M_IX86) || defined(__X86__) || defined(__i386__) + #define ASMJIT_ARCH_X86 32 +#else + #define ASMJIT_ARCH_X86 0 +#endif + +#if defined(__arm64__) || defined(__aarch64__) +# define ASMJIT_ARCH_ARM 64 +#elif defined(_M_ARM) || defined(_M_ARMT) || defined(__arm__) || defined(__thumb__) || defined(__thumb2__) + #define ASMJIT_ARCH_ARM 32 +#else + #define ASMJIT_ARCH_ARM 0 +#endif + +#if defined(_MIPS_ARCH_MIPS64) || defined(__mips64) + #define ASMJIT_ARCH_MIPS 64 +#elif defined(_MIPS_ARCH_MIPS32) || defined(_M_MRX000) || defined(__mips__) + #define ASMJIT_ARCH_MIPS 32 +#else + #define ASMJIT_ARCH_MIPS 0 +#endif + +#define ASMJIT_ARCH_BITS (ASMJIT_ARCH_X86 | ASMJIT_ARCH_ARM | ASMJIT_ARCH_MIPS) +#if ASMJIT_ARCH_BITS == 0 + #undef ASMJIT_ARCH_BITS + #if defined (__LP64__) || defined(_LP64) + #define ASMJIT_ARCH_BITS 64 + #else + #define ASMJIT_ARCH_BITS 32 + #endif +#endif + +#if (defined(__ARMEB__)) || \ + (defined(__MIPSEB__)) || \ + (defined(__BYTE_ORDER__) && (__BYTE_ORDER__ == __ORDER_BIG_ENDIAN__)) + #define ASMJIT_ARCH_LE 0 + #define ASMJIT_ARCH_BE 1 +#else + #define ASMJIT_ARCH_LE 1 + #define ASMJIT_ARCH_BE 0 +#endif + +// Build host architecture if no architecture is selected. +#if !defined(ASMJIT_BUILD_HOST) && \ + !defined(ASMJIT_BUILD_X86) && \ + !defined(ASMJIT_BUILD_ARM) + #define ASMJIT_BUILD_HOST +#endif + +// Detect host architecture if building only for host. +#if ASMJIT_ARCH_X86 && defined(ASMJIT_BUILD_HOST) && !defined(ASMJIT_BUILD_X86) + #define ASMJIT_BUILD_X86 +#endif + +#if ASMJIT_ARCH_ARM && defined(ASMJIT_BUILD_HOST) && !defined(ASMJIT_BUILD_ARM) + #define ASMJIT_BUILD_ARM +#endif + +// ============================================================================ +// [asmjit::Build - Globals - C++ Compiler and Features Detection] +// ============================================================================ + +#define ASMJIT_CXX_CLANG 0 +#define ASMJIT_CXX_GNU 0 +#define ASMJIT_CXX_INTEL 0 +#define ASMJIT_CXX_MSC 0 +#define ASMJIT_CXX_MAKE_VER(MAJOR, MINOR, PATCH) ((MAJOR) * 10000000 + (MINOR) * 100000 + (PATCH)) + +// Intel Compiler [pretends to be GNU or MSC, so it must be checked first]: +// - https://software.intel.com/en-us/articles/c0x-features-supported-by-intel-c-compiler +// - https://software.intel.com/en-us/articles/c14-features-supported-by-intel-c-compiler +// - https://software.intel.com/en-us/articles/c17-features-supported-by-intel-c-compiler +#if defined(__INTEL_COMPILER) + + #undef ASMJIT_CXX_INTEL + #define ASMJIT_CXX_INTEL ASMJIT_CXX_MAKE_VER(__INTEL_COMPILER / 100, (__INTEL_COMPILER / 10) % 10, __INTEL_COMPILER % 10) + +// MSC Compiler: +// - https://msdn.microsoft.com/en-us/library/hh567368.aspx +// +// Version List: +// - 16.00.0 == VS2010 +// - 17.00.0 == VS2012 +// - 18.00.0 == VS2013 +// - 19.00.0 == VS2015 +// - 19.10.0 == VS2017 +#elif defined(_MSC_VER) && defined(_MSC_FULL_VER) + + #undef ASMJIT_CXX_MSC + #if _MSC_VER == _MSC_FULL_VER / 10000 + #define ASMJIT_CXX_MSC ASMJIT_CXX_MAKE_VER(_MSC_VER / 100, _MSC_VER % 100, _MSC_FULL_VER % 10000) + #else + #define ASMJIT_CXX_MSC ASMJIT_CXX_MAKE_VER(_MSC_VER / 100, (_MSC_FULL_VER / 100000) % 100, _MSC_FULL_VER % 100000) + #endif + +// Clang Compiler [Pretends to be GNU, so it must be checked before]: +// - https://clang.llvm.org/cxx_status.html +#elif defined(__clang_major__) && defined(__clang_minor__) && defined(__clang_patchlevel__) + + #undef ASMJIT_CXX_CLANG + #define ASMJIT_CXX_CLANG ASMJIT_CXX_MAKE_VER(__clang_major__, __clang_minor__, __clang_patchlevel__) + +// GNU Compiler: +// - https://gcc.gnu.org/projects/cxx-status.html +#elif defined(__GNUC__) && defined(__GNUC_MINOR__) && defined(__GNUC_PATCHLEVEL__) + + #undef ASMJIT_CXX_GNU + #define ASMJIT_CXX_GNU ASMJIT_CXX_MAKE_VER(__GNUC__, __GNUC_MINOR__, __GNUC_PATCHLEVEL__) + +#endif + +// Compiler features detection macros. +#if ASMJIT_CXX_CLANG && defined(__has_builtin) + #define ASMJIT_CXX_HAS_BUILTIN(NAME, CHECK) (__has_builtin(NAME)) +#else + #define ASMJIT_CXX_HAS_BUILTIN(NAME, CHECK) (!(!(CHECK))) +#endif + +#if ASMJIT_CXX_CLANG && defined(__has_extension) + #define ASMJIT_CXX_HAS_FEATURE(NAME, CHECK) (__has_extension(NAME)) +#elif ASMJIT_CXX_CLANG && defined(__has_feature) + #define ASMJIT_CXX_HAS_FEATURE(NAME, CHECK) (__has_feature(NAME)) +#else + #define ASMJIT_CXX_HAS_FEATURE(NAME, CHECK) (!(!(CHECK))) +#endif + +#if ASMJIT_CXX_CLANG && defined(__has_attribute) + #define ASMJIT_CXX_HAS_ATTRIBUTE(NAME, CHECK) (__has_attribute(NAME)) +#else + #define ASMJIT_CXX_HAS_ATTRIBUTE(NAME, CHECK) (!(!(CHECK))) +#endif + +#if ASMJIT_CXX_CLANG && defined(__has_cpp_attribute) + #define ASMJIT_CXX_HAS_CPP_ATTRIBUTE(NAME, CHECK) (__has_cpp_attribute(NAME)) +#else + #define ASMJIT_CXX_HAS_CPP_ATTRIBUTE(NAME, CHECK) (!(!(CHECK))) +#endif + +// Compiler features by vendor. +#if defined(_MSC_VER) && !defined(_NATIVE_WCHAR_T_DEFINED) + #define ASMJIT_CXX_HAS_NATIVE_WCHAR_T 0 +#else + #define ASMJIT_CXX_HAS_NATIVE_WCHAR_T 1 +#endif + +#if ASMJIT_CXX_HAS_FEATURE(cxx_unicode_literals, ( \ + (ASMJIT_CXX_INTEL >= ASMJIT_CXX_MAKE_VER(14, 0, 0)) || \ + (ASMJIT_CXX_MSC >= ASMJIT_CXX_MAKE_VER(19, 0, 0)) || \ + (ASMJIT_CXX_GNU >= ASMJIT_CXX_MAKE_VER(4 , 5, 0) && __cplusplus >= 201103L) )) + #define ASMJIT_CXX_HAS_UNICODE_LITERALS 1 +#else + #define ASMJIT_CXX_HAS_UNICODE_LITERALS 0 +#endif + +// ============================================================================ +// [asmjit::Build - Globals - API Decorators & Language Extensions] +// ============================================================================ + +// API (Export / Import). +#if !defined(ASMJIT_STATIC) + #if defined(_WIN32) && (defined(_MSC_VER) || defined(__MINGW32__)) + #ifdef ASMJIT_EXPORTS + #define ASMJIT_API __declspec(dllexport) + #else + #define ASMJIT_API __declspec(dllimport) + #endif + #elif defined(_WIN32) && defined(__GNUC__) + #ifdef ASMJIT_EXPORTS + #define ASMJIT_API __attribute__((__dllexport__)) + #else + #define ASMJIT_API __attribute__((__dllimport__)) + #endif + #elif defined(__GNUC__) + #define ASMJIT_API __attribute__((__visibility__("default"))) + #endif +#endif + +#if !defined(ASMJIT_API) + #define ASMJIT_API +#endif + +#if !defined(ASMJIT_VARAPI) + #define ASMJIT_VARAPI extern ASMJIT_API +#endif + +// This is basically a workaround. When using MSVC and marking class as DLL +// export everything gets exported, which is unwanted in most projects. MSVC +// automatically exports typeinfo and vtable if at least one symbol of the +// class is exported. However, GCC has some strange behavior that even if +// one or more symbol is exported it doesn't export typeinfo unless the +// class itself is decorated with "visibility(default)" (i.e. ASMJIT_API). +#if !defined(_WIN32) && defined(__GNUC__) + #define ASMJIT_VIRTAPI ASMJIT_API +#else + #define ASMJIT_VIRTAPI +#endif + +// Function attributes. +#if !defined(ASMJIT_BUILD_DEBUG) && defined(__GNUC__) + #define ASMJIT_INLINE inline __attribute__((__always_inline__)) +#elif !defined(ASMJIT_BUILD_DEBUG) && defined(_MSC_VER) + #define ASMJIT_INLINE __forceinline +#else + #define ASMJIT_INLINE inline +#endif + +#if defined(__GNUC__) + #define ASMJIT_NOINLINE __attribute__((__noinline__)) + #define ASMJIT_NORETURN __attribute__((__noreturn__)) +#elif defined(_MSC_VER) + #define ASMJIT_NOINLINE __declspec(noinline) + #define ASMJIT_NORETURN __declspec(noreturn) +#else + #define ASMJIT_NOINLINE + #define ASMJIT_NORETURN +#endif + +// Calling conventions. +#if ASMJIT_ARCH_X86 == 32 && defined(__GNUC__) + #define ASMJIT_CDECL __attribute__((__cdecl__)) + #define ASMJIT_STDCALL __attribute__((__stdcall__)) + #define ASMJIT_FASTCALL __attribute__((__fastcall__)) + #define ASMJIT_REGPARM(N) __attribute__((__regparm__(N))) +#elif ASMJIT_ARCH_X86 == 32 && defined(_MSC_VER) + #define ASMJIT_CDECL __cdecl + #define ASMJIT_STDCALL __stdcall + #define ASMJIT_FASTCALL __fastcall + #define ASMJIT_REGPARM(N) +#else + #define ASMJIT_CDECL + #define ASMJIT_STDCALL + #define ASMJIT_FASTCALL + #define ASMJIT_REGPARM(N) +#endif + +// Type alignment (not allowed by C++11 'alignas' keyword). +#if defined(__GNUC__) + #define ASMJIT_ALIGN_TYPE(TYPE, N) __attribute__((__aligned__(N))) TYPE +#elif defined(_MSC_VER) + #define ASMJIT_ALIGN_TYPE(TYPE, N) __declspec(align(N)) TYPE +#else + #define ASMJIT_ALIGN_TYPE(TYPE, N) TYPE +#endif + +#if defined(__GNUC__) + #define ASMJIT_MAY_ALIAS __attribute__((__may_alias__)) +#else + #define ASMJIT_MAY_ALIAS +#endif + +// Annotations. +#if defined(__GNUC__) + #define ASMJIT_LIKELY(...) __builtin_expect(!!(__VA_ARGS__), 1) + #define ASMJIT_UNLIKELY(...) __builtin_expect(!!(__VA_ARGS__), 0) +#else + #define ASMJIT_LIKELY(...) (__VA_ARGS__) + #define ASMJIT_UNLIKELY(...) (__VA_ARGS__) +#endif + +#if defined(__clang__) && __cplusplus >= 201103L + #define ASMJIT_FALLTHROUGH [[clang::fallthrough]] +#elif ASMJIT_CXX_GNU >= ASMJIT_CXX_MAKE_VER(7, 0, 0) + #define ASMJIT_FALLTHROUGH __attribute__((__fallthrough__)) +#else + #define ASMJIT_FALLTHROUGH ((void)0) /* fallthrough */ +#endif + +// Utilities. +#define ASMJIT_OFFSET_OF(STRUCT, MEMBER) ((int)(intptr_t)((const char*)&((const STRUCT*)0x100)->MEMBER) - 0x100) +#define ASMJIT_ARRAY_SIZE(X) uint32_t(sizeof(X) / sizeof(X[0])) + +#if ASMJIT_CXX_HAS_ATTRIBUTE(attribute_deprecated_with_message, ASMJIT_CXX_GNU >= ASMJIT_CXX_MAKE_VER(4, 5, 0)) + #define ASMJIT_DEPRECATED(DECL, MESSAGE) DECL __attribute__((__deprecated__(MESSAGE))) +#elif ASMJIT_MSC + #define ASMJIT_DEPRECATED(DECL, MESSAGE) __declspec(deprecated(MESSAGE)) DECL +#else + #define ASMJIT_DEPRECATED(DECL, MESSAGE) DECL +#endif + +#if ASMJIT_CXX_HAS_ATTRIBUTE(no_sanitize, 0) + #define ASMJIT_ATTRIBUTE_NO_SANITIZE_UNDEF __attribute__((__no_sanitize__("undefined"))) +#elif ASMJIT_CXX_GNU >= ASMJIT_CXX_MAKE_VER(4, 9, 0) + #define ASMJIT_ATTRIBUTE_NO_SANITIZE_UNDEF __attribute__((__no_sanitize_undefined__)) +#else + #define ASMJIT_ATTRIBUTE_NO_SANITIZE_UNDEF +#endif + +// ============================================================================ +// [asmjit::Build - Globals - Begin-Namespace / End-Namespace] +// ============================================================================ + +#if defined(__clang__) + #define ASMJIT_BEGIN_NAMESPACE \ + namespace asmjit { \ + _Pragma("clang diagnostic push") \ + _Pragma("clang diagnostic ignored \"-Wconstant-logical-operand\"") \ + _Pragma("clang diagnostic ignored \"-Wunnamed-type-template-args\"") + #define ASMJIT_END_NAMESPACE \ + _Pragma("clang diagnostic pop") \ + } +#elif ASMJIT_CXX_GNU >= ASMJIT_CXX_MAKE_VER(4, 0, 0) && \ + ASMJIT_CXX_GNU < ASMJIT_CXX_MAKE_VER(5, 0, 0) + #define ASMJIT_BEGIN_NAMESPACE \ + namespace asmjit { \ + _Pragma("GCC diagnostic push") \ + _Pragma("GCC diagnostic ignored \"-Wmissing-field-initializers\"") + #define ASMJIT_END_NAMESPACE \ + _Pragma("GCC diagnostic pop") \ + } +#elif ASMJIT_CXX_GNU >= ASMJIT_CXX_MAKE_VER(8, 0, 0) + #define ASMJIT_BEGIN_NAMESPACE \ + namespace asmjit { \ + _Pragma("GCC diagnostic push") \ + _Pragma("GCC diagnostic ignored \"-Wclass-memaccess\"") + #define ASMJIT_END_NAMESPACE \ + _Pragma("GCC diagnostic pop") \ + } +#elif defined(_MSC_VER) && !defined(__INTEL_COMPILER) + #define ASMJIT_BEGIN_NAMESPACE \ + namespace asmjit { \ + __pragma(warning(push)) \ + __pragma(warning(disable: 4127)) /* conditional expression is constant*/\ + __pragma(warning(disable: 4201)) /* nameless struct/union */ + #define ASMJIT_END_NAMESPACE \ + __pragma(warning(pop)) \ + } +#endif + +#if !defined(ASMJIT_BEGIN_NAMESPACE) && !defined(ASMJIT_END_NAMESPACE) + #define ASMJIT_BEGIN_NAMESPACE namespace asmjit { + #define ASMJIT_END_NAMESPACE } +#endif + +#define ASMJIT_BEGIN_SUB_NAMESPACE(NAMESPACE) \ + ASMJIT_BEGIN_NAMESPACE \ + namespace NAMESPACE { + +#define ASMJIT_END_SUB_NAMESPACE \ + } \ + ASMJIT_END_NAMESPACE + +// ============================================================================ +// [asmjit::Build - Globals - Utilities] +// ============================================================================ + +#define ASMJIT_NONCOPYABLE(...) \ + private: \ + __VA_ARGS__(const __VA_ARGS__& other) = delete; \ + __VA_ARGS__& operator=(const __VA_ARGS__& other) = delete; \ + public: + +#define ASMJIT_NONCONSTRUCTIBLE(...) \ + private: \ + __VA_ARGS__() = delete; \ + __VA_ARGS__(const __VA_ARGS__& other) = delete; \ + __VA_ARGS__& operator=(const __VA_ARGS__& other) = delete; \ + public: + +// ============================================================================ +// [asmjit::Build - Globals - Cleanup] +// ============================================================================ + +// Try to cleanup things not used in other public headers. +#ifndef ASMJIT_EXPORTS + #undef ASMJIT_CXX_CLANG + #undef ASMJIT_CXX_GNU + #undef ASMJIT_CXX_INTEL + #undef ASMJIT_CXX_MSC + #undef ASMJIT_CXX_MAKE_VER +#endif + +#endif // ASMJIT_CORE_API_CONFIG_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/arch.cpp b/3rdparty/asmjit/src/asmjit/core/arch.cpp new file mode 100644 index 00000000000..97fca9d5c47 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/arch.cpp @@ -0,0 +1,176 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#include "../core/arch.h" +#include "../core/support.h" +#include "../core/type.h" + +#ifdef ASMJIT_BUILD_X86 + #include "../x86/x86operand.h" +#endif + +#ifdef ASMJIT_BUILD_ARM + #include "../arm/armoperand.h" +#endif + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::ArchInfo] +// ============================================================================ + +// NOTE: Keep `const constexpr` otherwise MSC would not compile this code correctly. +static const constexpr uint32_t archInfoTable[] = { + // <--------------------+---------------------+-------------------+-------+ + // | Type | SubType | GPInfo| + // <--------------------+---------------------+-------------------+-------+ + Support::bytepack32_4x8(ArchInfo::kIdNone , ArchInfo::kSubIdNone, 0, 0), + Support::bytepack32_4x8(ArchInfo::kIdX86 , ArchInfo::kSubIdNone, 4, 8), + Support::bytepack32_4x8(ArchInfo::kIdX64 , ArchInfo::kSubIdNone, 8, 16), + Support::bytepack32_4x8(ArchInfo::kIdA32 , ArchInfo::kSubIdNone, 4, 16), + Support::bytepack32_4x8(ArchInfo::kIdA64 , ArchInfo::kSubIdNone, 8, 32) +}; + +ASMJIT_FAVOR_SIZE void ArchInfo::init(uint32_t id, uint32_t subId) noexcept { + uint32_t index = id < ASMJIT_ARRAY_SIZE(archInfoTable) ? id : uint32_t(0); + + // Make sure the `archInfoTable` array is correctly indexed. + _signature = archInfoTable[index]; + ASMJIT_ASSERT(_id == index); + + // Even if the architecture is not known we setup its id and sub-id, + // however, such architecture is not really useful. + _id = uint8_t(id); + _subId = uint8_t(subId); +} + +// ============================================================================ +// [asmjit::ArchUtils] +// ============================================================================ + +ASMJIT_FAVOR_SIZE Error ArchUtils::typeIdToRegInfo(uint32_t archId, uint32_t& typeIdInOut, RegInfo& regInfo) noexcept { + uint32_t typeId = typeIdInOut; + + // Zero the signature so it's clear in case that typeId is not invalid. + regInfo._signature = 0; + + // TODO: Move to X86 backend. +#ifdef ASMJIT_BUILD_X86 + if (ArchInfo::isX86Family(archId)) { + // Passed RegType instead of TypeId? + if (typeId <= BaseReg::kTypeMax) + typeId = x86::opData.archRegs.regTypeToTypeId[typeId]; + + if (ASMJIT_UNLIKELY(!Type::isValid(typeId))) + return DebugUtils::errored(kErrorInvalidTypeId); + + // First normalize architecture dependent types. + if (Type::isAbstract(typeId)) { + if (typeId == Type::kIdIntPtr) + typeId = (archId == ArchInfo::kIdX86) ? Type::kIdI32 : Type::kIdI64; + else + typeId = (archId == ArchInfo::kIdX86) ? Type::kIdU32 : Type::kIdU64; + } + + // Type size helps to construct all groupss of registers. If the size is zero + // then the TypeId is invalid. + uint32_t size = Type::sizeOf(typeId); + if (ASMJIT_UNLIKELY(!size)) + return DebugUtils::errored(kErrorInvalidTypeId); + + if (ASMJIT_UNLIKELY(typeId == Type::kIdF80)) + return DebugUtils::errored(kErrorInvalidUseOfF80); + + uint32_t regType = 0; + + switch (typeId) { + case Type::kIdI8: + case Type::kIdU8: + regType = x86::Reg::kTypeGpbLo; + break; + + case Type::kIdI16: + case Type::kIdU16: + regType = x86::Reg::kTypeGpw; + break; + + case Type::kIdI32: + case Type::kIdU32: + regType = x86::Reg::kTypeGpd; + break; + + case Type::kIdI64: + case Type::kIdU64: + if (archId == ArchInfo::kIdX86) + return DebugUtils::errored(kErrorInvalidUseOfGpq); + + regType = x86::Reg::kTypeGpq; + break; + + // F32 and F64 are always promoted to use vector registers. + case Type::kIdF32: + typeId = Type::kIdF32x1; + regType = x86::Reg::kTypeXmm; + break; + + case Type::kIdF64: + typeId = Type::kIdF64x1; + regType = x86::Reg::kTypeXmm; + break; + + // Mask registers {k}. + case Type::kIdMask8: + case Type::kIdMask16: + case Type::kIdMask32: + case Type::kIdMask64: + regType = x86::Reg::kTypeKReg; + break; + + // MMX registers. + case Type::kIdMmx32: + case Type::kIdMmx64: + regType = x86::Reg::kTypeMm; + break; + + // XMM|YMM|ZMM registers. + default: + if (size <= 16) + regType = x86::Reg::kTypeXmm; + else if (size == 32) + regType = x86::Reg::kTypeYmm; + else + regType = x86::Reg::kTypeZmm; + break; + } + + typeIdInOut = typeId; + regInfo._signature = x86::opData.archRegs.regInfo[regType].signature(); + return kErrorOk; + } +#endif + + return DebugUtils::errored(kErrorInvalidArch); +} + +ASMJIT_END_NAMESPACE diff --git a/3rdparty/asmjit/src/asmjit/core/arch.h b/3rdparty/asmjit/src/asmjit/core/arch.h new file mode 100644 index 00000000000..b0a27fd9cd5 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/arch.h @@ -0,0 +1,204 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_ARCH_H_INCLUDED +#define ASMJIT_CORE_ARCH_H_INCLUDED + +#include "../core/globals.h" +#include "../core/operand.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_core +//! \{ + +// ============================================================================ +// [asmjit::ArchInfo] +// ============================================================================ + +class ArchInfo { +public: + union { + struct { + //! Architecture id. + uint8_t _id; + //! Architecture sub-id. + uint8_t _subId; + //! Default size of a general purpose register. + uint8_t _gpSize; + //! Count of all general purpose registers. + uint8_t _gpCount; + }; + //! Architecture signature (32-bit int). + uint32_t _signature; + }; + + //! Architecture id. + enum Id : uint32_t { + kIdNone = 0, //!< No/Unknown architecture. + + // X86 architectures. + kIdX86 = 1, //!< X86 architecture (32-bit). + kIdX64 = 2, //!< X64 architecture (64-bit) (AMD64). + + // ARM architectures. + kIdA32 = 3, //!< ARM 32-bit architecture (AArch32/ARM/THUMB). + kIdA64 = 4, //!< ARM 64-bit architecture (AArch64). + + //! Architecture detected at compile-time (architecture of the host). + kIdHost = ASMJIT_ARCH_X86 == 32 ? kIdX86 : + ASMJIT_ARCH_X86 == 64 ? kIdX64 : + ASMJIT_ARCH_ARM == 32 ? kIdA32 : + ASMJIT_ARCH_ARM == 64 ? kIdA64 : kIdNone + }; + + //! Architecture sub-type or execution mode. + enum SubType : uint32_t { + kSubIdNone = 0, //!< Default mode (or no specific mode). + + // X86 sub-types. + kSubIdX86_AVX = 1, //!< Code generation uses AVX by default (VEC instructions). + kSubIdX86_AVX2 = 2, //!< Code generation uses AVX2 by default (VEC instructions). + kSubIdX86_AVX512 = 3, //!< Code generation uses AVX-512F by default (+32 vector regs). + kSubIdX86_AVX512VL = 4, //!< Code generation uses AVX-512F-VL by default (+VL extensions). + + // ARM sub-types. + kSubIdA32_Thumb = 8, //!< THUMB|THUMBv2 sub-type (only ARM in 32-bit mode). + +#if (ASMJIT_ARCH_X86) && defined(__AVX512VL__) + kSubIdHost = kSubIdX86_AVX512VL +#elif (ASMJIT_ARCH_X86) && defined(__AVX512F__) + kSubIdHost = kSubIdX86_AVX512 +#elif (ASMJIT_ARCH_X86) && defined(__AVX2__) + kSubIdHost = kSubIdX86_AVX2 +#elif (ASMJIT_ARCH_X86) && defined(__AVX__) + kSubIdHost = kSubIdX86_AVX +#elif (ASMJIT_ARCH_ARM == 32) && (defined(_M_ARMT) || defined(__thumb__) || defined(__thumb2__)) + kSubIdHost = kSubIdA32_Thumb +#else + kSubIdHost = 0 +#endif + }; + + //! \name Construction & Destruction + //! \{ + + inline ArchInfo() noexcept : _signature(0) {} + inline ArchInfo(const ArchInfo& other) noexcept : _signature(other._signature) {} + inline explicit ArchInfo(uint32_t type, uint32_t subType = kSubIdNone) noexcept { init(type, subType); } + inline explicit ArchInfo(Globals::NoInit_) noexcept {} + + inline static ArchInfo host() noexcept { return ArchInfo(kIdHost, kSubIdHost); } + + inline bool isInitialized() const noexcept { return _id != kIdNone; } + + ASMJIT_API void init(uint32_t type, uint32_t subType = kSubIdNone) noexcept; + inline void reset() noexcept { _signature = 0; } + + //! \} + + //! \name Overloaded Operators + //! \{ + + inline ArchInfo& operator=(const ArchInfo& other) noexcept = default; + + inline bool operator==(const ArchInfo& other) const noexcept { return _signature == other._signature; } + inline bool operator!=(const ArchInfo& other) const noexcept { return _signature != other._signature; } + + //! \} + + //! \name Accessors + //! \{ + + //! Returns the architecture id, see `Id`. + inline uint32_t archId() const noexcept { return _id; } + + //! Returns the architecture sub-id, see `SubType`. + //! + //! X86 & X64 + //! --------- + //! + //! Architecture subtype describe the highest instruction-set level that can + //! be used. + //! + //! A32 & A64 + //! --------- + //! + //! Architecture mode means the instruction encoding to be used when generating + //! machine code, thus mode can be used to force generation of THUMB and THUMBv2 + //! encoding or regular ARM encoding. + inline uint32_t archSubId() const noexcept { return _subId; } + + //! Tests whether this architecture is 32-bit. + inline bool is32Bit() const noexcept { return _gpSize == 4; } + //! Tests whether this architecture is 64-bit. + inline bool is64Bit() const noexcept { return _gpSize == 8; } + + //! Tests whether this architecture is X86, X64. + inline bool isX86Family() const noexcept { return isX86Family(_id); } + //! Tests whether this architecture is ARM32 or ARM64. + inline bool isArmFamily() const noexcept { return isArmFamily(_id); } + + //! Returns the native size of a general-purpose register. + inline uint32_t gpSize() const noexcept { return _gpSize; } + //! Returns number of general-purpose registers. + inline uint32_t gpCount() const noexcept { return _gpCount; } + + //! \} + + //! \name Static Functions + //! \{ + + static inline bool isX86Family(uint32_t archId) noexcept { return archId >= kIdX86 && archId <= kIdX64; } + static inline bool isArmFamily(uint32_t archId) noexcept { return archId >= kIdA32 && archId <= kIdA64; } + + //! \} +}; + +// ============================================================================ +// [asmjit::ArchRegs] +// ============================================================================ + +//! Information about all architecture registers. +struct ArchRegs { + //! Register information and signatures indexed by `BaseReg::RegType`. + RegInfo regInfo[BaseReg::kTypeMax + 1]; + //! Count (maximum) of registers per `BaseReg::RegType`. + uint8_t regCount[BaseReg::kTypeMax + 1]; + //! Converts RegType to TypeId, see `Type::Id`. + uint8_t regTypeToTypeId[BaseReg::kTypeMax + 1]; +}; + +// ============================================================================ +// [asmjit::ArchUtils] +// ============================================================================ + +struct ArchUtils { + ASMJIT_API static Error typeIdToRegInfo(uint32_t archId, uint32_t& typeIdInOut, RegInfo& regInfo) noexcept; +}; + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_ARCH_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/assembler.cpp b/3rdparty/asmjit/src/asmjit/core/assembler.cpp new file mode 100644 index 00000000000..35c39ab6089 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/assembler.cpp @@ -0,0 +1,514 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#include "../core/assembler.h" +#include "../core/codebufferwriter_p.h" +#include "../core/constpool.h" +#include "../core/logging.h" +#include "../core/support.h" + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::BaseAssembler - Construction / Destruction] +// ============================================================================ + +BaseAssembler::BaseAssembler() noexcept + : BaseEmitter(kTypeAssembler), + _section(nullptr), + _bufferData(nullptr), + _bufferEnd(nullptr), + _bufferPtr(nullptr), + _op4(), + _op5() {} +BaseAssembler::~BaseAssembler() noexcept {} + +// ============================================================================ +// [asmjit::BaseAssembler - Buffer Management] +// ============================================================================ + +Error BaseAssembler::setOffset(size_t offset) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + size_t size = Support::max(_section->bufferSize(), this->offset()); + if (ASMJIT_UNLIKELY(offset > size)) + return reportError(DebugUtils::errored(kErrorInvalidArgument)); + + _bufferPtr = _bufferData + offset; + return kErrorOk; +} + +// ============================================================================ +// [asmjit::BaseAssembler - Logging] +// ============================================================================ + +#ifndef ASMJIT_NO_LOGGING +static void BaseAssembler_logLabel(BaseAssembler* self, const Label& label) noexcept { + Logger* logger = self->_code->_logger; + + StringTmp<512> sb; + size_t binSize = logger->hasFlag(FormatOptions::kFlagMachineCode) ? size_t(0) : std::numeric_limits::max(); + + sb.appendChars(' ', logger->indentation(FormatOptions::kIndentationLabel)); + Logging::formatLabel(sb, logger->flags(), self, label.id()); + sb.appendChar(':'); + Logging::formatLine(sb, nullptr, binSize, 0, 0, self->_inlineComment); + logger->log(sb.data(), sb.size()); +} +#endif + +// ============================================================================ +// [asmjit::BaseAssembler - Section Management] +// ============================================================================ + +static void BaseAssembler_initSection(BaseAssembler* self, Section* section) noexcept { + uint8_t* p = section->_buffer._data; + + self->_section = section; + self->_bufferData = p; + self->_bufferPtr = p + section->_buffer._size; + self->_bufferEnd = p + section->_buffer._capacity; +} + +Error BaseAssembler::section(Section* section) { + if (ASMJIT_UNLIKELY(!_code)) + return reportError(DebugUtils::errored(kErrorNotInitialized)); + + if (!_code->isSectionValid(section->id()) || _code->_sections[section->id()] != section) + return reportError(DebugUtils::errored(kErrorInvalidSection)); + +#ifndef ASMJIT_NO_LOGGING + if (hasEmitterOption(kOptionLoggingEnabled)) + _code->_logger->logf(".section %s {#%u}\n", section->name(), section->id()); +#endif + + BaseAssembler_initSection(this, section); + return kErrorOk; +} + +// ============================================================================ +// [asmjit::BaseAssembler - Label Management] +// ============================================================================ + +Label BaseAssembler::newLabel() { + uint32_t labelId = Globals::kInvalidId; + if (ASMJIT_LIKELY(_code)) { + LabelEntry* le; + Error err = _code->newLabelEntry(&le); + if (ASMJIT_UNLIKELY(err)) + reportError(err); + labelId = le->id(); + } + return Label(labelId); +} + +Label BaseAssembler::newNamedLabel(const char* name, size_t nameSize, uint32_t type, uint32_t parentId) { + uint32_t labelId = Globals::kInvalidId; + if (ASMJIT_LIKELY(_code)) { + LabelEntry* le; + Error err = _code->newNamedLabelEntry(&le, name, nameSize, type, parentId); + if (ASMJIT_UNLIKELY(err)) + reportError(err); + labelId = le->id(); + } + return Label(labelId); +} + +Error BaseAssembler::bind(const Label& label) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + Error err = _code->bindLabel(label, _section->id(), offset()); + +#ifndef ASMJIT_NO_LOGGING + if (hasEmitterOption(kOptionLoggingEnabled)) + BaseAssembler_logLabel(this, label); +#endif + + resetInlineComment(); + if (err) + return reportError(err); + + return kErrorOk; +} + +// ============================================================================ +// [asmjit::BaseAssembler - Emit (Low-Level)] +// ============================================================================ + +Error BaseAssembler::_emit(uint32_t instId, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3, const Operand_& o4, const Operand_& o5) { + _op4 = o4; + _op5 = o5; + _instOptions |= BaseInst::kOptionOp4Op5Used; + return _emit(instId, o0, o1, o2, o3); +} + +Error BaseAssembler::_emitOpArray(uint32_t instId, const Operand_* operands, size_t count) { + const Operand_* o0 = &operands[0]; + const Operand_* o1 = &operands[1]; + const Operand_* o2 = &operands[2]; + const Operand_* o3 = &operands[3]; + + switch (count) { + case 0: o0 = &Globals::none; ASMJIT_FALLTHROUGH; + case 1: o1 = &Globals::none; ASMJIT_FALLTHROUGH; + case 2: o2 = &Globals::none; ASMJIT_FALLTHROUGH; + case 3: o3 = &Globals::none; ASMJIT_FALLTHROUGH; + case 4: + return _emit(instId, *o0, *o1, *o2, *o3); + + case 5: + _op4 = operands[4]; + _op5.reset(); + _instOptions |= BaseInst::kOptionOp4Op5Used; + return _emit(instId, *o0, *o1, *o2, *o3); + + case 6: + _op4 = operands[4]; + _op5 = operands[5]; + _instOptions |= BaseInst::kOptionOp4Op5Used; + return _emit(instId, *o0, *o1, *o2, *o3); + + default: + return DebugUtils::errored(kErrorInvalidArgument); + } +} + +#ifndef ASMJIT_NO_LOGGING +void BaseAssembler::_emitLog( + uint32_t instId, uint32_t options, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3, + uint32_t relSize, uint32_t immSize, uint8_t* afterCursor) { + + Logger* logger = _code->logger(); + ASMJIT_ASSERT(logger != nullptr); + ASMJIT_ASSERT(options & BaseEmitter::kOptionLoggingEnabled); + + StringTmp<256> sb; + uint32_t flags = logger->flags(); + + uint8_t* beforeCursor = _bufferPtr; + intptr_t emittedSize = (intptr_t)(afterCursor - beforeCursor); + + Operand_ operands[Globals::kMaxOpCount]; + operands[0].copyFrom(o0); + operands[1].copyFrom(o1); + operands[2].copyFrom(o2); + operands[3].copyFrom(o3); + + if (options & BaseInst::kOptionOp4Op5Used) { + operands[4].copyFrom(_op4); + operands[5].copyFrom(_op5); + } + else { + operands[4].reset(); + operands[5].reset(); + } + + sb.appendChars(' ', logger->indentation(FormatOptions::kIndentationCode)); + Logging::formatInstruction(sb, flags, this, archId(), BaseInst(instId, options, _extraReg), operands, Globals::kMaxOpCount); + + if ((flags & FormatOptions::kFlagMachineCode) != 0) + Logging::formatLine(sb, _bufferPtr, size_t(emittedSize), relSize, immSize, inlineComment()); + else + Logging::formatLine(sb, nullptr, std::numeric_limits::max(), 0, 0, inlineComment()); + logger->log(sb); +} + +Error BaseAssembler::_emitFailed( + Error err, + uint32_t instId, uint32_t options, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3) { + + StringTmp<256> sb; + sb.appendString(DebugUtils::errorAsString(err)); + sb.appendString(": "); + + Operand_ operands[Globals::kMaxOpCount]; + operands[0].copyFrom(o0); + operands[1].copyFrom(o1); + operands[2].copyFrom(o2); + operands[3].copyFrom(o3); + + if (options & BaseInst::kOptionOp4Op5Used) { + operands[4].copyFrom(_op4); + operands[5].copyFrom(_op5); + } + else { + operands[4].reset(); + operands[5].reset(); + } + + Logging::formatInstruction(sb, 0, this, archId(), BaseInst(instId, options, _extraReg), operands, Globals::kMaxOpCount); + + if (inlineComment()) { + sb.appendString(" ; "); + sb.appendString(inlineComment()); + } + + resetInstOptions(); + resetExtraReg(); + resetInlineComment(); + return reportError(err, sb.data()); +} +#endif + +// ============================================================================ +// [asmjit::BaseAssembler - Embed] +// ============================================================================ + +#ifndef ASMJIT_NO_LOGGING +struct DataSizeByPower { + char str[4]; +}; + +static const DataSizeByPower dataSizeByPowerTable[] = { + { "db" }, + { "dw" }, + { "dd" }, + { "dq" } +}; +#endif + +Error BaseAssembler::embed(const void* data, uint32_t dataSize) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + if (dataSize == 0) + return DebugUtils::errored(kErrorInvalidArgument); + + CodeBufferWriter writer(this); + ASMJIT_PROPAGATE(writer.ensureSpace(this, dataSize)); + + writer.emitData(data, dataSize); + +#ifndef ASMJIT_NO_LOGGING + if (ASMJIT_UNLIKELY(hasEmitterOption(kOptionLoggingEnabled))) + _code->_logger->logBinary(data, dataSize); +#endif + + writer.done(this); + return kErrorOk; +} + +Error BaseAssembler::embedLabel(const Label& label) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + ASMJIT_ASSERT(_code != nullptr); + RelocEntry* re; + LabelEntry* le = _code->labelEntry(label); + + if (ASMJIT_UNLIKELY(!le)) + return reportError(DebugUtils::errored(kErrorInvalidLabel)); + + uint32_t dataSize = gpSize(); + ASMJIT_ASSERT(dataSize <= 8); + + CodeBufferWriter writer(this); + ASMJIT_PROPAGATE(writer.ensureSpace(this, dataSize)); + +#ifndef ASMJIT_NO_LOGGING + if (ASMJIT_UNLIKELY(hasEmitterOption(kOptionLoggingEnabled))) { + StringTmp<256> sb; + sb.appendFormat(".%s ", dataSizeByPowerTable[Support::ctz(dataSize)].str); + Logging::formatLabel(sb, 0, this, label.id()); + sb.appendChar('\n'); + _code->_logger->log(sb); + } +#endif + + // TODO: Does it make sense to calculate the address here if everything is known? + /* + if (_code->hasBaseAddress() && currentSection() == _code->textSection() && le->isBound()) { + uint64_t addr = _code->baseAddress() + _code->textSection()->offset() + le->offset(); + writer.emitValueLE(addr, dataSize); + } + */ + + Error err = _code->newRelocEntry(&re, RelocEntry::kTypeRelToAbs, dataSize); + if (ASMJIT_UNLIKELY(err)) + return reportError(err); + + re->_sourceSectionId = _section->id(); + re->_sourceOffset = offset(); + + if (le->isBound()) { + re->_targetSectionId = le->section()->id(); + re->_payload = le->offset(); + } + else { + LabelLink* link = _code->newLabelLink(le, _section->id(), offset(), 0); + if (ASMJIT_UNLIKELY(!link)) + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + link->relocId = re->id(); + } + + // Emit dummy DWORD/QWORD depending on the data size. + writer.emitZeros(dataSize); + writer.done(this); + + return kErrorOk; +} + +Error BaseAssembler::embedLabelDelta(const Label& label, const Label& base, uint32_t dataSize) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + LabelEntry* labelEntry = _code->labelEntry(label); + LabelEntry* baseEntry = _code->labelEntry(base); + + if (ASMJIT_UNLIKELY(!labelEntry || !baseEntry)) + return reportError(DebugUtils::errored(kErrorInvalidLabel)); + + if (dataSize == 0) + dataSize = gpSize(); + + if (ASMJIT_UNLIKELY(!Support::isPowerOf2(dataSize) || dataSize > 8)) + return reportError(DebugUtils::errored(kErrorInvalidOperandSize)); + + CodeBufferWriter writer(this); + ASMJIT_PROPAGATE(writer.ensureSpace(this, dataSize)); + +#ifndef ASMJIT_NO_LOGGING + if (ASMJIT_UNLIKELY(hasEmitterOption(kOptionLoggingEnabled))) { + StringTmp<256> sb; + sb.appendFormat(".%s (", dataSizeByPowerTable[Support::ctz(dataSize)].str); + Logging::formatLabel(sb, 0, this, label.id()); + sb.appendString(" - "); + Logging::formatLabel(sb, 0, this, base.id()); + sb.appendString(")\n"); + _code->_logger->log(sb); + } +#endif + + // If both labels are bound within the same section it means the delta can be calculated now. + if (labelEntry->isBound() && baseEntry->isBound() && labelEntry->section() == baseEntry->section()) { + uint64_t delta = labelEntry->offset() - baseEntry->offset(); + writer.emitValueLE(delta, dataSize); + } + else { + RelocEntry* re; + Error err = _code->newRelocEntry(&re, RelocEntry::kTypeExpression, dataSize); + if (ASMJIT_UNLIKELY(err)) + return reportError(err); + + Expression* exp = _code->_zone.newT(); + if (ASMJIT_UNLIKELY(!exp)) + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + + exp->reset(); + exp->opType = Expression::kOpSub; + exp->setValueAsLabel(0, labelEntry); + exp->setValueAsLabel(1, baseEntry); + + re->_sourceSectionId = _section->id(); + re->_sourceOffset = offset(); + re->_payload = (uint64_t)(uintptr_t)exp; + + writer.emitZeros(dataSize); + } + + writer.done(this); + return kErrorOk; +} + +Error BaseAssembler::embedConstPool(const Label& label, const ConstPool& pool) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + if (ASMJIT_UNLIKELY(!isLabelValid(label))) + return DebugUtils::errored(kErrorInvalidLabel); + + ASMJIT_PROPAGATE(align(kAlignData, uint32_t(pool.alignment()))); + ASMJIT_PROPAGATE(bind(label)); + + size_t size = pool.size(); + CodeBufferWriter writer(this); + ASMJIT_PROPAGATE(writer.ensureSpace(this, size)); + + pool.fill(writer.cursor()); + +#ifndef ASMJIT_NO_LOGGING + if (ASMJIT_UNLIKELY(hasEmitterOption(kOptionLoggingEnabled))) + _code->_logger->logBinary(writer.cursor(), size); +#endif + + writer.advance(size); + writer.done(this); + + return kErrorOk; +} + +// ============================================================================ +// [asmjit::BaseAssembler - Comment] +// ============================================================================ + +Error BaseAssembler::comment(const char* data, size_t size) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + +#ifndef ASMJIT_NO_LOGGING + if (hasEmitterOption(kOptionLoggingEnabled)) { + Logger* logger = _code->logger(); + logger->log(data, size); + logger->log("\n", 1); + return kErrorOk; + } +#else + DebugUtils::unused(data, size); +#endif + + return kErrorOk; +} + +// ============================================================================ +// [asmjit::BaseAssembler - Events] +// ============================================================================ + +Error BaseAssembler::onAttach(CodeHolder* code) noexcept { + ASMJIT_PROPAGATE(Base::onAttach(code)); + + // Attach to the end of the .text section. + BaseAssembler_initSection(this, code->_sections[0]); + + // And reset everything that is used temporarily. + _op4.reset(); + _op5.reset(); + + return kErrorOk; +} + +Error BaseAssembler::onDetach(CodeHolder* code) noexcept { + _section = nullptr; + _bufferData = nullptr; + _bufferEnd = nullptr; + _bufferPtr = nullptr; + + _op4.reset(); + _op5.reset(); + + return Base::onDetach(code); +} + +ASMJIT_END_NAMESPACE diff --git a/3rdparty/asmjit/src/asmjit/core/assembler.h b/3rdparty/asmjit/src/asmjit/core/assembler.h new file mode 100644 index 00000000000..fd2c1c33c28 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/assembler.h @@ -0,0 +1,176 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_ASSEMBLER_H_INCLUDED +#define ASMJIT_CORE_ASSEMBLER_H_INCLUDED + +#include "../core/codeholder.h" +#include "../core/datatypes.h" +#include "../core/emitter.h" +#include "../core/operand.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_core +//! \{ + +// ============================================================================ +// [asmjit::BaseAssembler] +// ============================================================================ + +//! Base encoder (assembler). +class ASMJIT_VIRTAPI BaseAssembler : public BaseEmitter { +public: + ASMJIT_NONCOPYABLE(BaseAssembler) + typedef BaseEmitter Base; + + //! Current section where the assembling happens. + Section* _section; + //! Start of the CodeBuffer of the current section. + uint8_t* _bufferData; + //! End (first invalid byte) of the current section. + uint8_t* _bufferEnd; + //! Pointer in the CodeBuffer of the current section. + uint8_t* _bufferPtr; + //! 5th operand data, used only temporarily. + Operand_ _op4; + //! 6th operand data, used only temporarily. + Operand_ _op5; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `BaseAssembler` instance. + ASMJIT_API BaseAssembler() noexcept; + //! Destroys the `BaseAssembler` instance. + ASMJIT_API virtual ~BaseAssembler() noexcept; + + //! \} + + //! \name Code-Buffer Management + //! \{ + + //! Returns the capacity of the current CodeBuffer. + inline size_t bufferCapacity() const noexcept { return (size_t)(_bufferEnd - _bufferData); } + //! Returns the number of remaining bytes in the current CodeBuffer. + inline size_t remainingSpace() const noexcept { return (size_t)(_bufferEnd - _bufferPtr); } + + //! Returns the current position in the CodeBuffer. + inline size_t offset() const noexcept { return (size_t)(_bufferPtr - _bufferData); } + //! Sets the current position in the CodeBuffer to `offset`. + //! + //! \note The `offset` cannot be outside of the buffer size (even if it's + //! within buffer's capacity). + ASMJIT_API Error setOffset(size_t offset); + + //! Returns the start of the CodeBuffer in the current section. + inline uint8_t* bufferData() const noexcept { return _bufferData; } + //! Returns the end (first invalid byte) in the current section. + inline uint8_t* bufferEnd() const noexcept { return _bufferEnd; } + //! Returns the current pointer in the CodeBuffer in the current section. + inline uint8_t* bufferPtr() const noexcept { return _bufferPtr; } + + //! \} + + //! \name Section Management + //! \{ + + inline Section* currentSection() const noexcept { return _section; } + + ASMJIT_API Error section(Section* section) override; + + //! \} + + //! \name Label Management + //! \{ + + ASMJIT_API Label newLabel() override; + ASMJIT_API Label newNamedLabel(const char* name, size_t nameSize = SIZE_MAX, uint32_t type = Label::kTypeGlobal, uint32_t parentId = Globals::kInvalidId) override; + ASMJIT_API Error bind(const Label& label) override; + + //! \} + + //! \cond INTERNAL + //! \name Emit + //! \{ + + using BaseEmitter::_emit; + + ASMJIT_API Error _emit(uint32_t instId, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3, const Operand_& o4, const Operand_& o5) override; + ASMJIT_API Error _emitOpArray(uint32_t instId, const Operand_* operands, size_t count) override; + +protected: +#ifndef ASMJIT_NO_LOGGING + void _emitLog( + uint32_t instId, uint32_t options, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3, + uint32_t relSize, uint32_t immSize, uint8_t* afterCursor); + + Error _emitFailed( + Error err, + uint32_t instId, uint32_t options, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3); +#else + inline Error _emitFailed( + uint32_t err, + uint32_t instId, uint32_t options, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3) { + + DebugUtils::unused(instId, options, o0, o1, o2, o3); + resetInstOptions(); + resetInlineComment(); + return reportError(err); + } +#endif +public: + //! \} + //! \endcond + + //! \name Embed + //! \{ + + ASMJIT_API Error embed(const void* data, uint32_t dataSize) override; + ASMJIT_API Error embedLabel(const Label& label) override; + ASMJIT_API Error embedLabelDelta(const Label& label, const Label& base, uint32_t dataSize) override; + ASMJIT_API Error embedConstPool(const Label& label, const ConstPool& pool) override; + + //! \} + + //! \name Comment + //! \{ + + ASMJIT_API Error comment(const char* data, size_t size = SIZE_MAX) override; + + //! \} + + //! \name Events + //! \{ + + ASMJIT_API Error onAttach(CodeHolder* code) noexcept override; + ASMJIT_API Error onDetach(CodeHolder* code) noexcept override; + + //! \} +}; + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_ASSEMBLER_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/builder.cpp b/3rdparty/asmjit/src/asmjit/core/builder.cpp new file mode 100644 index 00000000000..35d7127481c --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/builder.cpp @@ -0,0 +1,1004 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#ifndef ASMJIT_NO_BUILDER + +#include "../core/builder.h" +#include "../core/logging.h" +#include "../core/support.h" + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::PostponedErrorHandler (Internal)] +// ============================================================================ + +//! Postponed error handler that never throws. Used as a temporal error handler +//! to run passes. If error occurs, the caller is notified and will call the +//! real error handler, that can throw. +class PostponedErrorHandler : public ErrorHandler { +public: + void handleError(Error err, const char* message, BaseEmitter* origin) override { + DebugUtils::unused(err, origin); + _message.assignString(message); + } + + StringTmp<128> _message; +}; + +// ============================================================================ +// [asmjit::BaseBuilder - Construction / Destruction] +// ============================================================================ + +BaseBuilder::BaseBuilder() noexcept + : BaseEmitter(kTypeBuilder), + _codeZone(32768 - Zone::kBlockOverhead), + _dataZone(16384 - Zone::kBlockOverhead), + _passZone(65536 - Zone::kBlockOverhead), + _allocator(&_codeZone), + _passes(), + _labelNodes(), + _cursor(nullptr), + _firstNode(nullptr), + _lastNode(nullptr), + _nodeFlags(0) {} +BaseBuilder::~BaseBuilder() noexcept {} + +// ============================================================================ +// [asmjit::BaseBuilder - Node Management] +// ============================================================================ + +LabelNode* BaseBuilder::newLabelNode() noexcept { + LabelNode* node = newNodeT(); + if (!node || registerLabelNode(node) != kErrorOk) + return nullptr; + return node; +} + +AlignNode* BaseBuilder::newAlignNode(uint32_t alignMode, uint32_t alignment) noexcept { + return newNodeT(alignMode, alignment); +} + +EmbedDataNode* BaseBuilder::newEmbedDataNode(const void* data, uint32_t size) noexcept { + if (size > EmbedDataNode::kInlineBufferSize) { + void* cloned = _dataZone.alloc(size); + if (ASMJIT_UNLIKELY(!cloned)) + return nullptr; + + if (data) + memcpy(cloned, data, size); + data = cloned; + } + + return newNodeT(const_cast(data), size); +} + +ConstPoolNode* BaseBuilder::newConstPoolNode() noexcept { + ConstPoolNode* node = newNodeT(); + if (!node || registerLabelNode(node) != kErrorOk) + return nullptr; + return node; +} + +CommentNode* BaseBuilder::newCommentNode(const char* data, size_t size) noexcept { + if (data) { + if (size == SIZE_MAX) + size = strlen(data); + + if (size > 0) { + data = static_cast(_dataZone.dup(data, size, true)); + if (!data) return nullptr; + } + } + + return newNodeT(data); +} + +InstNode* BaseBuilder::newInstNode(uint32_t instId, uint32_t instOptions, const Operand_& o0) noexcept { + uint32_t opCount = 1; + uint32_t opCapacity = InstNode::capacityOfOpCount(opCount); + ASMJIT_ASSERT(opCapacity >= 4); + + InstNode* node = _allocator.allocT(InstNode::nodeSizeOfOpCapacity(opCapacity)); + if (ASMJIT_UNLIKELY(!node)) + return nullptr; + + node = new(node) InstNode(this, instId, instOptions, opCount, opCapacity); + node->setOp(0, o0); + node->resetOps(opCount, opCapacity); + return node; +} + +InstNode* BaseBuilder::newInstNode(uint32_t instId, uint32_t instOptions, const Operand_& o0, const Operand_& o1) noexcept { + uint32_t opCount = 2; + uint32_t opCapacity = InstNode::capacityOfOpCount(opCount); + ASMJIT_ASSERT(opCapacity >= 4); + + InstNode* node = _allocator.allocT(InstNode::nodeSizeOfOpCapacity(opCapacity)); + if (ASMJIT_UNLIKELY(!node)) + return nullptr; + + node = new(node) InstNode(this, instId, instOptions, opCount, opCapacity); + node->setOp(0, o0); + node->setOp(1, o1); + node->resetOps(opCount, opCapacity); + return node; +} + +InstNode* BaseBuilder::newInstNode(uint32_t instId, uint32_t instOptions, const Operand_& o0, const Operand_& o1, const Operand_& o2) noexcept { + uint32_t opCount = 3; + uint32_t opCapacity = InstNode::capacityOfOpCount(opCount); + ASMJIT_ASSERT(opCapacity >= 4); + + InstNode* node = _allocator.allocT(InstNode::nodeSizeOfOpCapacity(opCapacity)); + if (ASMJIT_UNLIKELY(!node)) + return nullptr; + + node = new(node) InstNode(this, instId, instOptions, opCount, opCapacity); + node->setOp(0, o0); + node->setOp(1, o1); + node->setOp(2, o2); + node->resetOps(opCount, opCapacity); + return node; +} + +InstNode* BaseBuilder::newInstNode(uint32_t instId, uint32_t instOptions, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3) noexcept { + uint32_t opCount = 4; + uint32_t opCapacity = InstNode::capacityOfOpCount(opCount); + ASMJIT_ASSERT(opCapacity >= 4); + + InstNode* node = _allocator.allocT(InstNode::nodeSizeOfOpCapacity(opCapacity)); + if (ASMJIT_UNLIKELY(!node)) + return nullptr; + + node = new(node) InstNode(this, instId, instOptions, opCount, opCapacity); + node->setOp(0, o0); + node->setOp(1, o1); + node->setOp(2, o2); + node->setOp(3, o3); + node->resetOps(opCount, opCapacity); + return node; +} + +InstNode* BaseBuilder::newInstNodeRaw(uint32_t instId, uint32_t instOptions, uint32_t opCount) noexcept { + uint32_t opCapacity = InstNode::capacityOfOpCount(opCount); + ASMJIT_ASSERT(opCapacity >= 4); + + InstNode* node = _allocator.allocT(InstNode::nodeSizeOfOpCapacity(opCapacity)); + if (ASMJIT_UNLIKELY(!node)) + return nullptr; + return new(node) InstNode(this, instId, instOptions, opCount, opCapacity); +} + +BaseNode* BaseBuilder::addNode(BaseNode* node) noexcept { + ASMJIT_ASSERT(node); + ASMJIT_ASSERT(!node->_prev); + ASMJIT_ASSERT(!node->_next); + ASMJIT_ASSERT(!node->isActive()); + + if (!_cursor) { + if (!_firstNode) { + _firstNode = node; + _lastNode = node; + } + else { + node->_next = _firstNode; + _firstNode->_prev = node; + _firstNode = node; + } + } + else { + BaseNode* prev = _cursor; + BaseNode* next = _cursor->next(); + + node->_prev = prev; + node->_next = next; + + prev->_next = node; + if (next) + next->_prev = node; + else + _lastNode = node; + } + + node->addFlags(BaseNode::kFlagIsActive); + if (node->isSection()) + _dirtySectionLinks = true; + + _cursor = node; + return node; +} + +BaseNode* BaseBuilder::addAfter(BaseNode* node, BaseNode* ref) noexcept { + ASMJIT_ASSERT(node); + ASMJIT_ASSERT(ref); + + ASMJIT_ASSERT(!node->_prev); + ASMJIT_ASSERT(!node->_next); + + BaseNode* prev = ref; + BaseNode* next = ref->next(); + + node->_prev = prev; + node->_next = next; + + node->addFlags(BaseNode::kFlagIsActive); + if (node->isSection()) + _dirtySectionLinks = true; + + prev->_next = node; + if (next) + next->_prev = node; + else + _lastNode = node; + + return node; +} + +BaseNode* BaseBuilder::addBefore(BaseNode* node, BaseNode* ref) noexcept { + ASMJIT_ASSERT(node != nullptr); + ASMJIT_ASSERT(!node->_prev); + ASMJIT_ASSERT(!node->_next); + ASMJIT_ASSERT(!node->isActive()); + ASMJIT_ASSERT(ref != nullptr); + ASMJIT_ASSERT(ref->isActive()); + + BaseNode* prev = ref->prev(); + BaseNode* next = ref; + + node->_prev = prev; + node->_next = next; + + node->addFlags(BaseNode::kFlagIsActive); + if (node->isSection()) + _dirtySectionLinks = true; + + next->_prev = node; + if (prev) + prev->_next = node; + else + _firstNode = node; + + return node; +} + +BaseNode* BaseBuilder::removeNode(BaseNode* node) noexcept { + if (!node->isActive()) + return node; + + BaseNode* prev = node->prev(); + BaseNode* next = node->next(); + + if (_firstNode == node) + _firstNode = next; + else + prev->_next = next; + + if (_lastNode == node) + _lastNode = prev; + else + next->_prev = prev; + + node->_prev = nullptr; + node->_next = nullptr; + node->clearFlags(BaseNode::kFlagIsActive); + if (node->isSection()) + _dirtySectionLinks = true; + + if (_cursor == node) + _cursor = prev; + + return node; +} + +void BaseBuilder::removeNodes(BaseNode* first, BaseNode* last) noexcept { + if (first == last) { + removeNode(first); + return; + } + + if (!first->isActive()) + return; + + BaseNode* prev = first->prev(); + BaseNode* next = last->next(); + + if (_firstNode == first) + _firstNode = next; + else + prev->_next = next; + + if (_lastNode == last) + _lastNode = prev; + else + next->_prev = prev; + + BaseNode* node = first; + uint32_t didRemoveSection = false; + + for (;;) { + next = node->next(); + ASMJIT_ASSERT(next != nullptr); + + node->_prev = nullptr; + node->_next = nullptr; + node->clearFlags(BaseNode::kFlagIsActive); + didRemoveSection |= uint32_t(node->isSection()); + + if (_cursor == node) + _cursor = prev; + + if (node == last) + break; + node = next; + } + + if (didRemoveSection) + _dirtySectionLinks = true; +} + +BaseNode* BaseBuilder::setCursor(BaseNode* node) noexcept { + BaseNode* old = _cursor; + _cursor = node; + return old; +} + +// ============================================================================ +// [asmjit::BaseBuilder - Section] +// ============================================================================ + +Error BaseBuilder::sectionNodeOf(SectionNode** pOut, uint32_t sectionId) noexcept { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + if (ASMJIT_UNLIKELY(!_code->isSectionValid(sectionId))) + return DebugUtils::errored(kErrorInvalidSection); + + if (sectionId >= _sectionNodes.size()) + ASMJIT_PROPAGATE(_sectionNodes.resize(&_allocator, sectionId + 1)); + + SectionNode* node = _sectionNodes[sectionId]; + if (!node) { + node = newNodeT(sectionId); + if (ASMJIT_UNLIKELY(!node)) + return DebugUtils::errored(kErrorOutOfMemory); + _sectionNodes[sectionId] = node; + } + + *pOut = node; + return kErrorOk; +} + +Error BaseBuilder::section(Section* section) { + SectionNode* node; + Error err = sectionNodeOf(&node, section->id()); + + if (ASMJIT_UNLIKELY(err)) + return reportError(err); + + if (!node->isActive()) { + // Insert the section at the end if it was not part of the code. + addAfter(node, lastNode()); + _cursor = node; + } + else { + // This is a bit tricky. We cache section links to make sure that + // switching sections doesn't involve traversal in linked-list unless + // the position of the section has changed. + if (hasDirtySectionLinks()) + updateSectionLinks(); + + if (node->_nextSection) + _cursor = node->_nextSection->_prev; + else + _cursor = _lastNode; + } + + return kErrorOk; +} + +void BaseBuilder::updateSectionLinks() noexcept { + if (!_dirtySectionLinks) + return; + + BaseNode* node_ = _firstNode; + SectionNode* currentSection = nullptr; + + while (node_) { + if (node_->isSection()) { + if (currentSection) + currentSection->_nextSection = node_->as(); + currentSection = node_->as(); + } + node_ = node_->next(); + } + + if (currentSection) + currentSection->_nextSection = nullptr; + + _dirtySectionLinks = false; +} + +// ============================================================================ +// [asmjit::BaseBuilder - Labels] +// ============================================================================ + +Error BaseBuilder::labelNodeOf(LabelNode** pOut, uint32_t labelId) noexcept { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + uint32_t index = labelId; + if (ASMJIT_UNLIKELY(index >= _code->labelCount())) + return DebugUtils::errored(kErrorInvalidLabel); + + if (index >= _labelNodes.size()) + ASMJIT_PROPAGATE(_labelNodes.resize(&_allocator, index + 1)); + + LabelNode* node = _labelNodes[index]; + if (!node) { + node = newNodeT(labelId); + if (ASMJIT_UNLIKELY(!node)) + return DebugUtils::errored(kErrorOutOfMemory); + _labelNodes[index] = node; + } + + *pOut = node; + return kErrorOk; +} + +Error BaseBuilder::registerLabelNode(LabelNode* node) noexcept { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + // Don't call `reportError()` from here, we are noexcept and we are called + // by `newLabelNode()` and `newFuncNode()`, which are noexcept as well. + LabelEntry* le; + ASMJIT_PROPAGATE(_code->newLabelEntry(&le)); + uint32_t labelId = le->id(); + + // We just added one label so it must be true. + ASMJIT_ASSERT(_labelNodes.size() < labelId + 1); + ASMJIT_PROPAGATE(_labelNodes.resize(&_allocator, labelId + 1)); + + _labelNodes[labelId] = node; + node->_id = labelId; + + return kErrorOk; +} + +static Error BaseBuilder_newLabelInternal(BaseBuilder* self, uint32_t labelId) noexcept { + ASMJIT_ASSERT(self->_labelNodes.size() < labelId + 1); + LabelNode* node = self->newNodeT(labelId); + + if (ASMJIT_UNLIKELY(!node)) + return DebugUtils::errored(kErrorOutOfMemory); + + ASMJIT_PROPAGATE(self->_labelNodes.resize(&self->_allocator, labelId + 1)); + self->_labelNodes[labelId] = node; + node->_id = labelId; + return kErrorOk; +} + +Label BaseBuilder::newLabel() { + uint32_t labelId = Globals::kInvalidId; + if (_code) { + LabelEntry* le; + Error err = _code->newLabelEntry(&le); + if (ASMJIT_UNLIKELY(err)) { + reportError(err); + } + else { + err = BaseBuilder_newLabelInternal(this, le->id()); + if (ASMJIT_UNLIKELY(err)) + reportError(err); + else + labelId = le->id(); + } + } + return Label(labelId); +} + +Label BaseBuilder::newNamedLabel(const char* name, size_t nameSize, uint32_t type, uint32_t parentId) { + uint32_t labelId = Globals::kInvalidId; + if (_code) { + LabelEntry* le; + Error err = _code->newNamedLabelEntry(&le, name, nameSize, type, parentId); + if (ASMJIT_UNLIKELY(err)) { + reportError(err); + } + else { + err = BaseBuilder_newLabelInternal(this, le->id()); + if (ASMJIT_UNLIKELY(err)) + reportError(err); + else + labelId = le->id(); + } + } + return Label(labelId); +} + +Error BaseBuilder::bind(const Label& label) { + LabelNode* node; + Error err = labelNodeOf(&node, label); + + if (ASMJIT_UNLIKELY(err)) + return reportError(err); + + addNode(node); + return kErrorOk; +} + +// ============================================================================ +// [asmjit::BaseBuilder - Passes] +// ============================================================================ + +ASMJIT_FAVOR_SIZE Pass* BaseBuilder::passByName(const char* name) const noexcept { + for (Pass* pass : _passes) + if (strcmp(pass->name(), name) == 0) + return pass; + return nullptr; +} + +ASMJIT_FAVOR_SIZE Error BaseBuilder::addPass(Pass* pass) noexcept { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + if (ASMJIT_UNLIKELY(pass == nullptr)) { + // Since this is directly called by `addPassT()` we treat `null` argument + // as out-of-memory condition. Otherwise it would be API misuse. + return DebugUtils::errored(kErrorOutOfMemory); + } + else if (ASMJIT_UNLIKELY(pass->_cb)) { + // Kinda weird, but okay... + if (pass->_cb == this) + return kErrorOk; + return DebugUtils::errored(kErrorInvalidState); + } + + ASMJIT_PROPAGATE(_passes.append(&_allocator, pass)); + pass->_cb = this; + return kErrorOk; +} + +ASMJIT_FAVOR_SIZE Error BaseBuilder::deletePass(Pass* pass) noexcept { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + if (ASMJIT_UNLIKELY(pass == nullptr)) + return DebugUtils::errored(kErrorInvalidArgument); + + if (pass->_cb != nullptr) { + if (pass->_cb != this) + return DebugUtils::errored(kErrorInvalidState); + + uint32_t index = _passes.indexOf(pass); + ASMJIT_ASSERT(index != Globals::kNotFound); + + pass->_cb = nullptr; + _passes.removeAt(index); + } + + pass->~Pass(); + return kErrorOk; +} + +Error BaseBuilder::runPasses() { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + if (_passes.empty()) + return kErrorOk; + + Logger* logger = code()->logger(); + ErrorHandler* prev = errorHandler(); + PostponedErrorHandler postponed; + + Error err = kErrorOk; + setErrorHandler(&postponed); + + for (Pass* pass : _passes) { + _passZone.reset(); + err = pass->run(&_passZone, logger); + if (err) break; + } + _passZone.reset(); + setErrorHandler(prev); + + if (ASMJIT_UNLIKELY(err)) + return reportError(err, !postponed._message.empty() ? postponed._message.data() : nullptr); + + return kErrorOk; +} + +// ============================================================================ +// [asmjit::BaseBuilder - Emit] +// ============================================================================ + +Error BaseBuilder::_emit(uint32_t instId, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3) { + uint32_t opCount = 4; + + if (o3.isNone()) { + opCount = 3; + if (o2.isNone()) { + opCount = 2; + if (o1.isNone()) { + opCount = 1; + if (o0.isNone()) + opCount = 0; + } + } + } + + uint32_t options = instOptions() | globalInstOptions(); + if (options & BaseInst::kOptionReserved) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + +#ifndef ASMJIT_NO_VALIDATION + // Strict validation. + if (hasEmitterOption(kOptionStrictValidation)) { + Operand_ opArray[4]; + opArray[0].copyFrom(o0); + opArray[1].copyFrom(o1); + opArray[2].copyFrom(o2); + opArray[3].copyFrom(o3); + + Error err = InstAPI::validate(archId(), BaseInst(instId, options, _extraReg), opArray, opCount); + if (ASMJIT_UNLIKELY(err)) { + resetInstOptions(); + resetExtraReg(); + resetInlineComment(); + return reportError(err); + } + } +#endif + + // Clear options that should never be part of `InstNode`. + options &= ~BaseInst::kOptionReserved; + } + + uint32_t opCapacity = InstNode::capacityOfOpCount(opCount); + ASMJIT_ASSERT(opCapacity >= 4); + + InstNode* node = _allocator.allocT(InstNode::nodeSizeOfOpCapacity(opCapacity)); + const char* comment = inlineComment(); + + resetInstOptions(); + resetInlineComment(); + + if (ASMJIT_UNLIKELY(!node)) { + resetExtraReg(); + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + } + + node = new(node) InstNode(this, instId, options, opCount, opCapacity); + node->setExtraReg(extraReg()); + node->setOp(0, o0); + node->setOp(1, o1); + node->setOp(2, o2); + node->setOp(3, o3); + node->resetOps(4, opCapacity); + + if (comment) + node->setInlineComment(static_cast(_dataZone.dup(comment, strlen(comment), true))); + + addNode(node); + resetExtraReg(); + return kErrorOk; +} + +Error BaseBuilder::_emit(uint32_t instId, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3, const Operand_& o4, const Operand_& o5) { + uint32_t opCount = Globals::kMaxOpCount; + if (o5.isNone()) { + opCount = 5; + if (o4.isNone()) + return _emit(instId, o0, o1, o2, o3); + } + + uint32_t options = instOptions() | globalInstOptions(); + if (ASMJIT_UNLIKELY(options & BaseInst::kOptionReserved)) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + +#ifndef ASMJIT_NO_VALIDATION + // Strict validation. + if (hasEmitterOption(kOptionStrictValidation)) { + Operand_ opArray[Globals::kMaxOpCount]; + opArray[0].copyFrom(o0); + opArray[1].copyFrom(o1); + opArray[2].copyFrom(o2); + opArray[3].copyFrom(o3); + opArray[4].copyFrom(o4); + opArray[5].copyFrom(o5); + + Error err = InstAPI::validate(archId(), BaseInst(instId, options, _extraReg), opArray, opCount); + if (ASMJIT_UNLIKELY(err)) { + resetInstOptions(); + resetExtraReg(); + resetInlineComment(); + return reportError(err); + } + } +#endif + + // Clear options that should never be part of `InstNode`. + options &= ~BaseInst::kOptionReserved; + } + + uint32_t opCapacity = InstNode::capacityOfOpCount(opCount); + ASMJIT_ASSERT(opCapacity >= opCount); + + InstNode* node = _allocator.allocT(InstNode::nodeSizeOfOpCapacity(opCapacity)); + const char* comment = inlineComment(); + + resetInstOptions(); + resetInlineComment(); + + if (ASMJIT_UNLIKELY(!node)) { + resetExtraReg(); + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + } + + node = new(node) InstNode(this, instId, options, opCount, opCapacity); + node->setExtraReg(extraReg()); + node->setOp(0, o0); + node->setOp(1, o1); + node->setOp(2, o2); + node->setOp(3, o3); + node->setOp(4, o4); + + if (opCapacity > 5) + node->setOp(5, o5); + + if (comment) + node->setInlineComment(static_cast(_dataZone.dup(comment, strlen(comment), true))); + + addNode(node); + resetExtraReg(); + return kErrorOk; +} + +// ============================================================================ +// [asmjit::BaseBuilder - Align] +// ============================================================================ + +Error BaseBuilder::align(uint32_t alignMode, uint32_t alignment) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + AlignNode* node = newAlignNode(alignMode, alignment); + if (ASMJIT_UNLIKELY(!node)) + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + + addNode(node); + return kErrorOk; +} + +// ============================================================================ +// [asmjit::BaseBuilder - Embed] +// ============================================================================ + +Error BaseBuilder::embed(const void* data, uint32_t dataSize) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + EmbedDataNode* node = newEmbedDataNode(data, dataSize); + if (ASMJIT_UNLIKELY(!node)) + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + + addNode(node); + return kErrorOk; +} + +Error BaseBuilder::embedLabel(const Label& label) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + EmbedLabelNode* node = newNodeT(label.id()); + if (ASMJIT_UNLIKELY(!node)) + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + + addNode(node); + return kErrorOk; +} + +Error BaseBuilder::embedLabelDelta(const Label& label, const Label& base, uint32_t dataSize) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + EmbedLabelDeltaNode* node = newNodeT(label.id(), base.id(), dataSize); + if (ASMJIT_UNLIKELY(!node)) + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + + addNode(node); + return kErrorOk; +} + +Error BaseBuilder::embedConstPool(const Label& label, const ConstPool& pool) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + if (!isLabelValid(label)) + return reportError(DebugUtils::errored(kErrorInvalidLabel)); + + ASMJIT_PROPAGATE(align(kAlignData, uint32_t(pool.alignment()))); + ASMJIT_PROPAGATE(bind(label)); + + EmbedDataNode* node = newEmbedDataNode(nullptr, uint32_t(pool.size())); + if (ASMJIT_UNLIKELY(!node)) + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + + pool.fill(node->data()); + addNode(node); + return kErrorOk; +} + +// ============================================================================ +// [asmjit::BaseBuilder - Comment] +// ============================================================================ + +Error BaseBuilder::comment(const char* data, size_t size) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + + CommentNode* node = newCommentNode(data, size); + if (ASMJIT_UNLIKELY(!node)) + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + + addNode(node); + return kErrorOk; +} + +// ============================================================================ +// [asmjit::BaseBuilder - Serialize] +// ============================================================================ + +Error BaseBuilder::serialize(BaseEmitter* dst) { + Error err = kErrorOk; + BaseNode* node_ = _firstNode; + + do { + dst->setInlineComment(node_->inlineComment()); + + if (node_->isInst()) { + InstNode* node = node_->as(); + err = dst->emitInst(node->baseInst(), node->operands(), node->opCount()); + } + else if (node_->isLabel()) { + if (node_->isConstPool()) { + ConstPoolNode* node = node_->as(); + err = dst->embedConstPool(node->label(), node->constPool()); + } + else { + LabelNode* node = node_->as(); + err = dst->bind(node->label()); + } + } + else if (node_->isAlign()) { + AlignNode* node = node_->as(); + err = dst->align(node->alignMode(), node->alignment()); + } + else if (node_->isEmbedData()) { + EmbedDataNode* node = node_->as(); + err = dst->embed(node->data(), node->size()); + } + else if (node_->isEmbedLabel()) { + EmbedLabelNode* node = node_->as(); + err = dst->embedLabel(node->label()); + } + else if (node_->isEmbedLabelDelta()) { + EmbedLabelDeltaNode* node = node_->as(); + err = dst->embedLabelDelta(node->label(), node->baseLabel(), node->dataSize()); + } + else if (node_->isSection()) { + SectionNode* node = node_->as(); + err = dst->section(_code->sectionById(node->id())); + } + else if (node_->isComment()) { + CommentNode* node = node_->as(); + err = dst->comment(node->inlineComment()); + } + + if (err) break; + node_ = node_->next(); + } while (node_); + + return err; +} + +// ============================================================================ +// [asmjit::BaseBuilder - Logging] +// ============================================================================ + +#ifndef ASMJIT_NO_LOGGING +Error BaseBuilder::dump(String& sb, uint32_t flags) const noexcept { + BaseNode* node = _firstNode; + while (node) { + ASMJIT_PROPAGATE(Logging::formatNode(sb, flags, this, node)); + sb.appendChar('\n'); + node = node->next(); + } + + return kErrorOk; +} +#endif + +// ============================================================================ +// [asmjit::BaseBuilder - Events] +// ============================================================================ + +Error BaseBuilder::onAttach(CodeHolder* code) noexcept { + ASMJIT_PROPAGATE(Base::onAttach(code)); + + SectionNode* initialSection; + Error err = sectionNodeOf(&initialSection, 0); + + if (!err) + err = _passes.willGrow(&_allocator, 8); + + if (ASMJIT_UNLIKELY(err)) { + onDetach(code); + return err; + } + + + _cursor = initialSection; + _firstNode = initialSection; + _lastNode = initialSection; + initialSection->setFlags(BaseNode::kFlagIsActive); + + return kErrorOk; +} + +Error BaseBuilder::onDetach(CodeHolder* code) noexcept { + _passes.reset(); + _sectionNodes.reset(); + _labelNodes.reset(); + + _allocator.reset(&_codeZone); + _codeZone.reset(); + _dataZone.reset(); + _passZone.reset(); + + _nodeFlags = 0; + + _cursor = nullptr; + _firstNode = nullptr; + _lastNode = nullptr; + + return Base::onDetach(code); +} + +// ============================================================================ +// [asmjit::Pass - Construction / Destruction] +// ============================================================================ + +Pass::Pass(const char* name) noexcept + : _cb(nullptr), + _name(name) {} +Pass::~Pass() noexcept {} + +ASMJIT_END_NAMESPACE + +#endif // !ASMJIT_NO_BUILDER diff --git a/3rdparty/asmjit/src/asmjit/core/builder.h b/3rdparty/asmjit/src/asmjit/core/builder.h new file mode 100644 index 00000000000..c6d359995fc --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/builder.h @@ -0,0 +1,1305 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_BUILDER_H_INCLUDED +#define ASMJIT_CORE_BUILDER_H_INCLUDED + +#include "../core/api-config.h" +#ifndef ASMJIT_NO_BUILDER + +#include "../core/assembler.h" +#include "../core/codeholder.h" +#include "../core/constpool.h" +#include "../core/inst.h" +#include "../core/operand.h" +#include "../core/string.h" +#include "../core/support.h" +#include "../core/zone.h" +#include "../core/zonevector.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_builder +//! \{ + +// ============================================================================ +// [Forward Declarations] +// ============================================================================ + +class BaseBuilder; +class Pass; + +class BaseNode; +class InstNode; +class SectionNode; +class LabelNode; +class AlignNode; +class EmbedDataNode; +class EmbedLabelNode; +class ConstPoolNode; +class CommentNode; +class SentinelNode; +class LabelDeltaNode; + +// Only used by Compiler infrastructure. +class JumpAnnotation; + +// ============================================================================ +// [asmjit::BaseBuilder] +// ============================================================================ + +class ASMJIT_VIRTAPI BaseBuilder : public BaseEmitter { +public: + ASMJIT_NONCOPYABLE(BaseBuilder) + typedef BaseEmitter Base; + + //! Base zone used to allocate nodes and passes. + Zone _codeZone; + //! Data zone used to allocate data and names. + Zone _dataZone; + //! Pass zone, passed to `Pass::run()`. + Zone _passZone; + //! Allocator that uses `_codeZone`. + ZoneAllocator _allocator; + + //! Array of `Pass` objects. + ZoneVector _passes; + //! Maps section indexes to `LabelNode` nodes. + ZoneVector _sectionNodes; + //! Maps label indexes to `LabelNode` nodes. + ZoneVector _labelNodes; + + //! Current node (cursor). + BaseNode* _cursor; + //! First node of the current section. + BaseNode* _firstNode; + //! Last node of the current section. + BaseNode* _lastNode; + + //! Flags assigned to each new node. + uint32_t _nodeFlags; + //! The sections links are dirty (used internally). + bool _dirtySectionLinks; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `BaseBuilder` instance. + ASMJIT_API BaseBuilder() noexcept; + //! Destroys the `BaseBuilder` instance. + ASMJIT_API virtual ~BaseBuilder() noexcept; + + //! \} + + //! \name Node Management + //! \{ + + //! Returns the first node. + inline BaseNode* firstNode() const noexcept { return _firstNode; } + //! Returns the last node. + inline BaseNode* lastNode() const noexcept { return _lastNode; } + + //! Allocates and instantiates a new node of type `T` and returns its instance. + //! If the allocation fails `nullptr` is returned. + //! + //! The template argument `T` must be a type that is extends \ref BaseNode. + //! + //! \remarks The pointer returned (if non-null) is owned by the Builder or + //! Compiler. When the Builder/Compiler is destroyed it destroys all nodes + //! it created so no manual memory management is required. + template + inline T* newNodeT() noexcept { + return _allocator.newT(this); + } + + //! \overload + template + inline T* newNodeT(Args&&... args) noexcept { + return _allocator.newT(this, std::forward(args)...); + } + + //! Creates a new `LabelNode`. + ASMJIT_API LabelNode* newLabelNode() noexcept; + //! Creates a new `AlignNode`. + ASMJIT_API AlignNode* newAlignNode(uint32_t alignMode, uint32_t alignment) noexcept; + //! Creates a new `EmbedDataNode`. + ASMJIT_API EmbedDataNode* newEmbedDataNode(const void* data, uint32_t size) noexcept; + //! Creates a new `ConstPoolNode`. + ASMJIT_API ConstPoolNode* newConstPoolNode() noexcept; + //! Creates a new `CommentNode`. + ASMJIT_API CommentNode* newCommentNode(const char* data, size_t size) noexcept; + + ASMJIT_API InstNode* newInstNode(uint32_t instId, uint32_t instOptions, const Operand_& o0) noexcept; + ASMJIT_API InstNode* newInstNode(uint32_t instId, uint32_t instOptions, const Operand_& o0, const Operand_& o1) noexcept; + ASMJIT_API InstNode* newInstNode(uint32_t instId, uint32_t instOptions, const Operand_& o0, const Operand_& o1, const Operand_& o2) noexcept; + ASMJIT_API InstNode* newInstNode(uint32_t instId, uint32_t instOptions, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3) noexcept; + ASMJIT_API InstNode* newInstNodeRaw(uint32_t instId, uint32_t instOptions, uint32_t opCount) noexcept; + + //! Adds `node` after the current and sets the current node to the given `node`. + ASMJIT_API BaseNode* addNode(BaseNode* node) noexcept; + //! Inserts the given `node` after `ref`. + ASMJIT_API BaseNode* addAfter(BaseNode* node, BaseNode* ref) noexcept; + //! Inserts the given `node` before `ref`. + ASMJIT_API BaseNode* addBefore(BaseNode* node, BaseNode* ref) noexcept; + //! Removes the given `node`. + ASMJIT_API BaseNode* removeNode(BaseNode* node) noexcept; + //! Removes multiple nodes. + ASMJIT_API void removeNodes(BaseNode* first, BaseNode* last) noexcept; + + //! Returns the cursor. + //! + //! When the Builder/Compiler is created it automatically creates a '.text' + //! \ref SectionNode, which will be the initial one. When instructions are + //! added they are always added after the cursor and the cursor is changed + //! to be that newly added node. Use `setCursor()` to change where new nodes + //! are inserted. + inline BaseNode* cursor() const noexcept { return _cursor; } + + //! Sets the current node to `node` and return the previous one. + ASMJIT_API BaseNode* setCursor(BaseNode* node) noexcept; + + //! Sets the current node without returning the previous node. + //! + //! Only use this function if you are concerned about performance and want + //! this inlined (for example if you set the cursor in a loop, etc...). + inline void _setCursor(BaseNode* node) noexcept { _cursor = node; } + + //! \} + + //! \name Section Management + //! \{ + + //! Returns a vector of SectionNode objects. + //! + //! \note If a section of some id is not associated with the Builder/Compiler + //! it would be null, so always check for nulls if you iterate over the vector. + inline const ZoneVector& sectionNodes() const noexcept { return _sectionNodes; } + + //! Tests whether the `SectionNode` of the given `sectionId` was registered. + inline bool hasRegisteredSectionNode(uint32_t sectionId) const noexcept { + return sectionId < _sectionNodes.size() && _sectionNodes[sectionId] != nullptr; + } + + //! Returns or creates a `SectionNode` that matches the given `sectionId`. + //! + //! \remarks This function will either get the existing `SectionNode` or create + //! it in case it wasn't created before. You can check whether a section has a + //! registered `SectionNode` by using `BaseBuilder::hasRegisteredSectionNode()`. + ASMJIT_API Error sectionNodeOf(SectionNode** pOut, uint32_t sectionId) noexcept; + + ASMJIT_API Error section(Section* section) override; + + //! Returns whether the section links of active section nodes are dirty. You can + //! update these links by calling `updateSectionLinks()` in such case. + inline bool hasDirtySectionLinks() const noexcept { return _dirtySectionLinks; } + + //! Updates links of all active section nodes. + ASMJIT_API void updateSectionLinks() noexcept; + + //! \} + + //! \name Label Management + //! \{ + + //! Returns a vector of LabelNode nodes. + //! + //! \note If a label of some id is not associated with the Builder/Compiler + //! it would be null, so always check for nulls if you iterate over the vector. + inline const ZoneVector& labelNodes() const noexcept { return _labelNodes; } + + //! Tests whether the `LabelNode` of the given `labelId` was registered. + inline bool hasRegisteredLabelNode(uint32_t labelId) const noexcept { + return labelId < _labelNodes.size() && _labelNodes[labelId] != nullptr; + } + + //! \overload + inline bool hasRegisteredLabelNode(const Label& label) const noexcept { + return hasRegisteredLabelNode(label.id()); + } + + //! Gets or creates a `LabelNode` that matches the given `labelId`. + //! + //! \remarks This function will either get the existing `LabelNode` or create + //! it in case it wasn't created before. You can check whether a label has a + //! registered `LabelNode` by using `BaseBuilder::hasRegisteredLabelNode()`. + ASMJIT_API Error labelNodeOf(LabelNode** pOut, uint32_t labelId) noexcept; + + //! \overload + inline Error labelNodeOf(LabelNode** pOut, const Label& label) noexcept { + return labelNodeOf(pOut, label.id()); + } + + //! Registers this label node [Internal]. + //! + //! This function is used internally to register a newly created `LabelNode` + //! with this instance of Builder/Compiler. Use `labelNodeOf()` functions to + //! get back `LabelNode` from a label or its identifier. + ASMJIT_API Error registerLabelNode(LabelNode* node) noexcept; + + ASMJIT_API Label newLabel() override; + ASMJIT_API Label newNamedLabel(const char* name, size_t nameSize = SIZE_MAX, uint32_t type = Label::kTypeGlobal, uint32_t parentId = Globals::kInvalidId) override; + ASMJIT_API Error bind(const Label& label) override; + + //! \} + + //! \name Passes + //! \{ + + //! Returns a vector of `Pass` instances that will be executed by `runPasses()`. + inline const ZoneVector& passes() const noexcept { return _passes; } + + //! Allocates and instantiates a new pass of type `T` and returns its instance. + //! If the allocation fails `nullptr` is returned. + //! + //! The template argument `T` must be a type that is extends \ref Pass. + //! + //! \remarks The pointer returned (if non-null) is owned by the Builder or + //! Compiler. When the Builder/Compiler is destroyed it destroys all passes + //! it created so no manual memory management is required. + template + inline T* newPassT() noexcept { return _codeZone.newT(); } + + //! \overload + template + inline T* newPassT(Args&&... args) noexcept { return _codeZone.newT(std::forward(args)...); } + + template + inline Error addPassT() noexcept { return addPass(newPassT()); } + + template + inline Error addPassT(Args&&... args) noexcept { return addPass(newPassT(std::forward(args)...)); } + + //! Returns `Pass` by name. + ASMJIT_API Pass* passByName(const char* name) const noexcept; + //! Adds `pass` to the list of passes. + ASMJIT_API Error addPass(Pass* pass) noexcept; + //! Removes `pass` from the list of passes and delete it. + ASMJIT_API Error deletePass(Pass* pass) noexcept; + + //! Runs all passes in order. + ASMJIT_API Error runPasses(); + + //! \} + + //! \name Emit + //! \{ + + ASMJIT_API Error _emit(uint32_t instId, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3) override; + ASMJIT_API Error _emit(uint32_t instId, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3, const Operand_& o4, const Operand_& o5) override; + + //! \} + + //! \name Align + //! \{ + + ASMJIT_API Error align(uint32_t alignMode, uint32_t alignment) override; + + //! \} + + //! \name Embed + //! \{ + + ASMJIT_API Error embed(const void* data, uint32_t dataSize) override; + ASMJIT_API Error embedLabel(const Label& label) override; + ASMJIT_API Error embedLabelDelta(const Label& label, const Label& base, uint32_t dataSize) override; + ASMJIT_API Error embedConstPool(const Label& label, const ConstPool& pool) override; + + //! \} + + //! \name Comment + //! \{ + + ASMJIT_API Error comment(const char* data, size_t size = SIZE_MAX) override; + + //! \} + + //! \name Serialization + //! \{ + + //! Serializes everything the given emitter `dst`. + //! + //! Although not explicitly required the emitter will most probably be of + //! Assembler type. The reason is that there is no known use of serializing + //! nodes held by Builder/Compiler into another Builder-like emitter. + ASMJIT_API Error serialize(BaseEmitter* dst); + + //! \} + + //! \name Logging + //! \{ + +#ifndef ASMJIT_NO_LOGGING + ASMJIT_API Error dump(String& sb, uint32_t flags = 0) const noexcept; +#endif + + //! \} + + //! \name Events + //! \{ + + ASMJIT_API Error onAttach(CodeHolder* code) noexcept override; + ASMJIT_API Error onDetach(CodeHolder* code) noexcept override; + + //! \} +}; + +// ============================================================================ +// [asmjit::BaseNode] +// ============================================================================ + +//! Base node. +//! +//! Every node represents a building-block used by `BaseBuilder`. It can be +//! instruction, data, label, comment, directive, or any other high-level +//! representation that can be transformed to the building blocks mentioned. +//! Every class that inherits `BaseBuilder` can define its own nodes that it +//! can lower to basic nodes. +class BaseNode { +public: + ASMJIT_NONCOPYABLE(BaseNode) + + union { + struct { + //! Previous node. + BaseNode* _prev; + //! Next node. + BaseNode* _next; + }; + //! Links (previous and next nodes). + BaseNode* _links[2]; + }; + + //! Data shared between all types of nodes. + struct AnyData { + //! Node type, see \ref NodeType. + uint8_t _nodeType; + //! Node flags, see \ref Flags. + uint8_t _nodeFlags; + //! Not used by BaseNode. + uint8_t _reserved0; + //! Not used by BaseNode. + uint8_t _reserved1; + }; + + struct InstData { + //! Node type, see \ref NodeType. + uint8_t _nodeType; + //! Node flags, see \ref Flags. + uint8_t _nodeFlags; + //! Instruction operands count (used). + uint8_t _opCount; + //! Instruction operands capacity (allocated). + uint8_t _opCapacity; + }; + + struct SentinelData { + //! Node type, see \ref NodeType. + uint8_t _nodeType; + //! Node flags, see \ref Flags. + uint8_t _nodeFlags; + //! Sentinel type. + uint8_t _sentinelType; + //! Not used by BaseNode. + uint8_t _reserved1; + }; + + union { + AnyData _any; + InstData _inst; + SentinelData _sentinel; + }; + + //! Node position in code (should be unique). + uint32_t _position; + + //! Value reserved for AsmJit users never touched by AsmJit itself. + union { + uint64_t _userDataU64; + void* _userDataPtr; + }; + + //! Data used exclusively by the current `Pass`. + void* _passData; + + //! Inline comment/annotation or nullptr if not used. + const char* _inlineComment; + + //! Type of `BaseNode`. + enum NodeType : uint32_t { + //! Invalid node (internal, don't use). + kNodeNone = 0, + + // [BaseBuilder] + + //! Node is `InstNode` or `InstExNode`. + kNodeInst = 1, + //! Node is `SectionNode`. + kNodeSection = 2, + //! Node is `LabelNode`. + kNodeLabel = 3, + //! Node is `AlignNode`. + kNodeAlign = 4, + //! Node is `EmbedDataNode`. + kNodeEmbedData = 5, + //! Node is `EmbedLabelNode`. + kNodeEmbedLabel = 6, + //! Node is `EmbedLabelDeltaNode`. + kNodeEmbedLabelDelta = 7, + //! Node is `ConstPoolNode`. + kNodeConstPool = 8, + //! Node is `CommentNode`. + kNodeComment = 9, + //! Node is `SentinelNode`. + kNodeSentinel = 10, + + // [BaseCompiler] + + //! Node is `JumpNode` (acts as InstNode). + kNodeJump = 15, + //! Node is `FuncNode` (acts as LabelNode). + kNodeFunc = 16, + //! Node is `FuncRetNode` (acts as InstNode). + kNodeFuncRet = 17, + //! Node is `FuncCallNode` (acts as InstNode). + kNodeFuncCall = 18, + + // [UserDefined] + + //! First id of a user-defined node. + kNodeUser = 32 + }; + + //! Node flags, specify what the node is and/or does. + enum Flags : uint32_t { + kFlagIsCode = 0x01u, //!< Node is code that can be executed (instruction, label, align, etc...). + kFlagIsData = 0x02u, //!< Node is data that cannot be executed (data, const-pool, etc...). + kFlagIsInformative = 0x04u, //!< Node is informative, can be removed and ignored. + kFlagIsRemovable = 0x08u, //!< Node can be safely removed if unreachable. + kFlagHasNoEffect = 0x10u, //!< Node does nothing when executed (label, align, explicit nop). + kFlagActsAsInst = 0x20u, //!< Node is an instruction or acts as it. + kFlagActsAsLabel = 0x40u, //!< Node is a label or acts as it. + kFlagIsActive = 0x80u //!< Node is active (part of the code). + }; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `BaseNode` - always use `BaseBuilder` to allocate nodes. + ASMJIT_INLINE BaseNode(BaseBuilder* cb, uint32_t type, uint32_t flags = 0) noexcept { + _prev = nullptr; + _next = nullptr; + _any._nodeType = uint8_t(type); + _any._nodeFlags = uint8_t(flags | cb->_nodeFlags); + _any._reserved0 = 0; + _any._reserved1 = 0; + _position = 0; + _userDataU64 = 0; + _passData = nullptr; + _inlineComment = nullptr; + } + + //! \} + + //! \name Accessors + //! \{ + + //! Casts this node to `T*`. + template + inline T* as() noexcept { return static_cast(this); } + //! Casts this node to `const T*`. + template + inline const T* as() const noexcept { return static_cast(this); } + + //! Returns previous node or `nullptr` if this node is either first or not + //! part of Builder/Compiler node-list. + inline BaseNode* prev() const noexcept { return _prev; } + //! Returns next node or `nullptr` if this node is either last or not part + //! of Builder/Compiler node-list. + inline BaseNode* next() const noexcept { return _next; } + + //! Returns the type of the node, see `NodeType`. + inline uint32_t type() const noexcept { return _any._nodeType; } + + //! Sets the type of the node, see `NodeType` (internal). + //! + //! \remarks You should never set a type of a node to anything else than the + //! initial value. This function is only provided for users that use custom + //! nodes and need to change the type either during construction or later. + inline void setType(uint32_t type) noexcept { _any._nodeType = uint8_t(type); } + + //! Tests whether this node is either `InstNode` or extends it. + inline bool isInst() const noexcept { return hasFlag(kFlagActsAsInst); } + //! Tests whether this node is `SectionNode`. + inline bool isSection() const noexcept { return type() == kNodeSection; } + //! Tests whether this node is either `LabelNode` or extends it. + inline bool isLabel() const noexcept { return hasFlag(kFlagActsAsLabel); } + //! Tests whether this node is `AlignNode`. + inline bool isAlign() const noexcept { return type() == kNodeAlign; } + //! Tests whether this node is `EmbedDataNode`. + inline bool isEmbedData() const noexcept { return type() == kNodeEmbedData; } + //! Tests whether this node is `EmbedLabelNode`. + inline bool isEmbedLabel() const noexcept { return type() == kNodeEmbedLabel; } + //! Tests whether this node is `EmbedLabelDeltaNode`. + inline bool isEmbedLabelDelta() const noexcept { return type() == kNodeEmbedLabelDelta; } + //! Tests whether this node is `ConstPoolNode`. + inline bool isConstPool() const noexcept { return type() == kNodeConstPool; } + //! Tests whether this node is `CommentNode`. + inline bool isComment() const noexcept { return type() == kNodeComment; } + //! Tests whether this node is `SentinelNode`. + inline bool isSentinel() const noexcept { return type() == kNodeSentinel; } + + //! Tests whether this node is `FuncNode`. + inline bool isFunc() const noexcept { return type() == kNodeFunc; } + //! Tests whether this node is `FuncRetNode`. + inline bool isFuncRet() const noexcept { return type() == kNodeFuncRet; } + //! Tests whether this node is `FuncCallNode`. + inline bool isFuncCall() const noexcept { return type() == kNodeFuncCall; } + + //! Returns the node flags, see \ref Flags. + inline uint32_t flags() const noexcept { return _any._nodeFlags; } + //! Tests whether the node has the given `flag` set. + inline bool hasFlag(uint32_t flag) const noexcept { return (uint32_t(_any._nodeFlags) & flag) != 0; } + //! Replaces node flags with `flags`. + inline void setFlags(uint32_t flags) noexcept { _any._nodeFlags = uint8_t(flags); } + //! Adds the given `flags` to node flags. + inline void addFlags(uint32_t flags) noexcept { _any._nodeFlags = uint8_t(_any._nodeFlags | flags); } + //! Clears the given `flags` from node flags. + inline void clearFlags(uint32_t flags) noexcept { _any._nodeFlags = uint8_t(_any._nodeFlags & (flags ^ 0xFF)); } + + //! Tests whether the node is code that can be executed. + inline bool isCode() const noexcept { return hasFlag(kFlagIsCode); } + //! Tests whether the node is data that cannot be executed. + inline bool isData() const noexcept { return hasFlag(kFlagIsData); } + //! Tests whether the node is informative only (is never encoded like comment, etc...). + inline bool isInformative() const noexcept { return hasFlag(kFlagIsInformative); } + //! Tests whether the node is removable if it's in an unreachable code block. + inline bool isRemovable() const noexcept { return hasFlag(kFlagIsRemovable); } + //! Tests whether the node has no effect when executed (label, .align, nop, ...). + inline bool hasNoEffect() const noexcept { return hasFlag(kFlagHasNoEffect); } + //! Tests whether the node is part of the code. + inline bool isActive() const noexcept { return hasFlag(kFlagIsActive); } + + //! Tests whether the node has a position assigned. + //! + //! \remarks Returns `true` if node position is non-zero. + inline bool hasPosition() const noexcept { return _position != 0; } + //! Returns node position. + inline uint32_t position() const noexcept { return _position; } + //! Sets node position. + //! + //! Node position is a 32-bit unsigned integer that is used by Compiler to + //! track where the node is relatively to the start of the function. It doesn't + //! describe a byte position in a binary, instead it's just a pseudo position + //! used by liveness analysis and other tools around Compiler. + //! + //! If you don't use Compiler then you may use `position()` and `setPosition()` + //! freely for your own purposes if the 32-bit value limit is okay for you. + inline void setPosition(uint32_t position) noexcept { _position = position; } + + //! Returns user data casted to `T*`. + //! + //! User data is decicated to be used only by AsmJit users and not touched + //! by the library. The data has a pointer size so you can either store a + //! pointer or `intptr_t` value through `setUserDataAsIntPtr()`. + template + inline T* userDataAsPtr() const noexcept { return static_cast(_userDataPtr); } + //! Returns user data casted to `int64_t`. + inline int64_t userDataAsInt64() const noexcept { return int64_t(_userDataU64); } + //! Returns user data casted to `uint64_t`. + inline uint64_t userDataAsUInt64() const noexcept { return _userDataU64; } + + //! Sets user data to `data`. + template + inline void setUserDataAsPtr(T* data) noexcept { _userDataPtr = static_cast(data); } + //! Sets used data to the given 64-bit signed `value`. + inline void setUserDataAsInt64(int64_t value) noexcept { _userDataU64 = uint64_t(value); } + //! Sets used data to the given 64-bit unsigned `value`. + inline void setUserDataAsUInt64(uint64_t value) noexcept { _userDataU64 = value; } + + //! Resets user data to zero / nullptr. + inline void resetUserData() noexcept { _userDataU64 = 0; } + + //! Tests whether the node has an associated pass data. + inline bool hasPassData() const noexcept { return _passData != nullptr; } + //! Returns the node pass data - data used during processing & transformations. + template + inline T* passData() const noexcept { return (T*)_passData; } + //! Sets the node pass data to `data`. + template + inline void setPassData(T* data) noexcept { _passData = (void*)data; } + //! Resets the node pass data to nullptr. + inline void resetPassData() noexcept { _passData = nullptr; } + + //! Tests whether the node has an inline comment/annotation. + inline bool hasInlineComment() const noexcept { return _inlineComment != nullptr; } + //! Returns an inline comment/annotation string. + inline const char* inlineComment() const noexcept { return _inlineComment; } + //! Sets an inline comment/annotation string to `s`. + inline void setInlineComment(const char* s) noexcept { _inlineComment = s; } + //! Resets an inline comment/annotation string to nullptr. + inline void resetInlineComment() noexcept { _inlineComment = nullptr; } + + //! \} +}; + +// ============================================================================ +// [asmjit::InstNode] +// ============================================================================ + +//! Instruction node. +//! +//! Wraps an instruction with its options and operands. +class InstNode : public BaseNode { +public: + ASMJIT_NONCOPYABLE(InstNode) + + enum : uint32_t { + //! Count of embedded operands per `InstNode` that are always allocated as + //! a part of the instruction. Minimum embedded operands is 4, but in 32-bit + //! more pointers are smaller and we can embed 5. The rest (up to 6 operands) + //! is always stored in `InstExNode`. + kBaseOpCapacity = uint32_t((128 - sizeof(BaseNode) - sizeof(BaseInst)) / sizeof(Operand_)) + }; + + //! Base instruction data. + BaseInst _baseInst; + //! First 4 or 5 operands (indexed from 0). + Operand_ _opArray[kBaseOpCapacity]; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `InstNode` instance. + ASMJIT_INLINE InstNode(BaseBuilder* cb, uint32_t instId, uint32_t options, uint32_t opCount, uint32_t opCapacity = kBaseOpCapacity) noexcept + : BaseNode(cb, kNodeInst, kFlagIsCode | kFlagIsRemovable | kFlagActsAsInst), + _baseInst(instId, options) { + _inst._opCapacity = uint8_t(opCapacity); + _inst._opCount = uint8_t(opCount); + } + + //! Reset all built-in operands, including `extraReg`. + inline void _resetOps() noexcept { + _baseInst.resetExtraReg(); + for (uint32_t i = 0, count = opCapacity(); i < count; i++) + _opArray[i].reset(); + } + + //! \} + + //! \name Accessors + //! \{ + + inline BaseInst& baseInst() noexcept { return _baseInst; } + inline const BaseInst& baseInst() const noexcept { return _baseInst; } + + //! Returns the instruction id, see `BaseInst::Id`. + inline uint32_t id() const noexcept { return _baseInst.id(); } + //! Sets the instruction id to `id`, see `BaseInst::Id`. + inline void setId(uint32_t id) noexcept { _baseInst.setId(id); } + + //! Returns instruction options. + inline uint32_t instOptions() const noexcept { return _baseInst.options(); } + //! Sets instruction options. + inline void setInstOptions(uint32_t options) noexcept { _baseInst.setOptions(options); } + //! Adds instruction options. + inline void addInstOptions(uint32_t options) noexcept { _baseInst.addOptions(options); } + //! Clears instruction options. + inline void clearInstOptions(uint32_t options) noexcept { _baseInst.clearOptions(options); } + + //! Tests whether the node has an extra register operand. + inline bool hasExtraReg() const noexcept { return _baseInst.hasExtraReg(); } + //! Returns extra register operand. + inline RegOnly& extraReg() noexcept { return _baseInst.extraReg(); } + //! \overload + inline const RegOnly& extraReg() const noexcept { return _baseInst.extraReg(); } + //! Sets extra register operand to `reg`. + inline void setExtraReg(const BaseReg& reg) noexcept { _baseInst.setExtraReg(reg); } + //! Sets extra register operand to `reg`. + inline void setExtraReg(const RegOnly& reg) noexcept { _baseInst.setExtraReg(reg); } + //! Resets extra register operand. + inline void resetExtraReg() noexcept { _baseInst.resetExtraReg(); } + + //! Returns operands count. + inline uint32_t opCount() const noexcept { return _inst._opCount; } + //! Returns operands capacity. + inline uint32_t opCapacity() const noexcept { return _inst._opCapacity; } + + //! Sets operands count. + inline void setOpCount(uint32_t opCount) noexcept { _inst._opCount = uint8_t(opCount); } + + //! Returns operands array. + inline Operand* operands() noexcept { return (Operand*)_opArray; } + //! Returns operands array (const). + inline const Operand* operands() const noexcept { return (const Operand*)_opArray; } + + inline Operand& opType(uint32_t index) noexcept { + ASMJIT_ASSERT(index < opCapacity()); + return _opArray[index].as(); + } + + inline const Operand& opType(uint32_t index) const noexcept { + ASMJIT_ASSERT(index < opCapacity()); + return _opArray[index].as(); + } + + inline void setOp(uint32_t index, const Operand_& op) noexcept { + ASMJIT_ASSERT(index < opCapacity()); + _opArray[index].copyFrom(op); + } + + inline void resetOp(uint32_t index) noexcept { + ASMJIT_ASSERT(index < opCapacity()); + _opArray[index].reset(); + } + + inline void resetOps(uint32_t start, uint32_t end) noexcept { + for (uint32_t i = start; i < end; i++) + _opArray[i].reset(); + } + + //! \} + + //! \name Utilities + //! \{ + + inline bool hasOpType(uint32_t opType) const noexcept { + for (uint32_t i = 0, count = opCount(); i < count; i++) + if (_opArray[i].opType() == opType) + return true; + return false; + } + + inline bool hasRegOp() const noexcept { return hasOpType(Operand::kOpReg); } + inline bool hasMemOp() const noexcept { return hasOpType(Operand::kOpMem); } + inline bool hasImmOp() const noexcept { return hasOpType(Operand::kOpImm); } + inline bool hasLabelOp() const noexcept { return hasOpType(Operand::kOpLabel); } + + inline uint32_t indexOfOpType(uint32_t opType) const noexcept { + uint32_t i = 0; + uint32_t count = opCount(); + + while (i < count) { + if (_opArray[i].opType() == opType) + break; + i++; + } + + return i; + } + + inline uint32_t indexOfMemOp() const noexcept { return indexOfOpType(Operand::kOpMem); } + inline uint32_t indexOfImmOp() const noexcept { return indexOfOpType(Operand::kOpImm); } + inline uint32_t indexOfLabelOp() const noexcept { return indexOfOpType(Operand::kOpLabel); } + + //! \} + + //! \name Rewriting + //! \{ + + inline uint32_t* _getRewriteArray() noexcept { return &_baseInst._extraReg._id; } + inline const uint32_t* _getRewriteArray() const noexcept { return &_baseInst._extraReg._id; } + + ASMJIT_INLINE uint32_t getRewriteIndex(const uint32_t* id) const noexcept { + const uint32_t* array = _getRewriteArray(); + ASMJIT_ASSERT(array <= id); + + size_t index = (size_t)(id - array); + ASMJIT_ASSERT(index < 32); + + return uint32_t(index); + } + + ASMJIT_INLINE void rewriteIdAtIndex(uint32_t index, uint32_t id) noexcept { + uint32_t* array = _getRewriteArray(); + array[index] = id; + } + + //! \} + + //! \name Static Functions + //! \{ + + static inline uint32_t capacityOfOpCount(uint32_t opCount) noexcept { + return opCount <= kBaseOpCapacity ? kBaseOpCapacity : Globals::kMaxOpCount; + } + + static inline size_t nodeSizeOfOpCapacity(uint32_t opCapacity) noexcept { + size_t base = sizeof(InstNode) - kBaseOpCapacity * sizeof(Operand); + return base + opCapacity * sizeof(Operand); + } + + //! \} +}; + +// ============================================================================ +// [asmjit::InstExNode] +// ============================================================================ + +//! Instruction node with maximum number of operands.. +//! +//! This node is created automatically by Builder/Compiler in case that the +//! required number of operands exceeds the default capacity of `InstNode`. +class InstExNode : public InstNode { +public: + ASMJIT_NONCOPYABLE(InstExNode) + + //! Continued `_opArray[]` to hold up to `kMaxOpCount` operands. + Operand_ _opArrayEx[Globals::kMaxOpCount - kBaseOpCapacity]; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `InstExNode` instance. + inline InstExNode(BaseBuilder* cb, uint32_t instId, uint32_t options, uint32_t opCapacity = Globals::kMaxOpCount) noexcept + : InstNode(cb, instId, options, opCapacity) {} + + //! \} +}; + +// ============================================================================ +// [asmjit::SectionNode] +// ============================================================================ + +//! Section node. +class SectionNode : public BaseNode { +public: + ASMJIT_NONCOPYABLE(SectionNode) + + //! Section id. + uint32_t _id; + + //! Next section node that follows this section. + //! + //! This link is only valid when the section is active (is part of the code) + //! and when `Builder::hasDirtySectionLinks()` returns `false`. If you intend + //! to use this field you should always call `Builder::updateSectionLinks()` + //! before you do so. + SectionNode* _nextSection; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `SectionNode` instance. + inline SectionNode(BaseBuilder* cb, uint32_t id = 0) noexcept + : BaseNode(cb, kNodeSection, kFlagHasNoEffect), + _id(id), + _nextSection(nullptr) {} + + //! \} + + //! \name Accessors + //! \{ + + //! Returns the section id. + inline uint32_t id() const noexcept { return _id; } + + //! \} +}; + +// ============================================================================ +// [asmjit::LabelNode] +// ============================================================================ + +//! Label node. +class LabelNode : public BaseNode { +public: + ASMJIT_NONCOPYABLE(LabelNode) + + uint32_t _id; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `LabelNode` instance. + inline LabelNode(BaseBuilder* cb, uint32_t id = 0) noexcept + : BaseNode(cb, kNodeLabel, kFlagHasNoEffect | kFlagActsAsLabel), + _id(id) {} + + //! \} + + //! \name Accessors + //! \{ + + //! Returns the id of the label. + inline uint32_t id() const noexcept { return _id; } + //! Returns the label as `Label` operand. + inline Label label() const noexcept { return Label(_id); } + + //! \} +}; + +// ============================================================================ +// [asmjit::AlignNode] +// ============================================================================ + +//! Align directive (BaseBuilder). +//! +//! Wraps `.align` directive. +class AlignNode : public BaseNode { +public: + ASMJIT_NONCOPYABLE(AlignNode) + + //! Align mode, see `AlignMode`. + uint32_t _alignMode; + //! Alignment (in bytes). + uint32_t _alignment; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `AlignNode` instance. + inline AlignNode(BaseBuilder* cb, uint32_t alignMode, uint32_t alignment) noexcept + : BaseNode(cb, kNodeAlign, kFlagIsCode | kFlagHasNoEffect), + _alignMode(alignMode), + _alignment(alignment) {} + + //! \} + + //! \name Accessors + //! \{ + + //! Returns align mode. + inline uint32_t alignMode() const noexcept { return _alignMode; } + //! Sets align mode to `alignMode`. + inline void setAlignMode(uint32_t alignMode) noexcept { _alignMode = alignMode; } + + //! Returns align offset in bytes. + inline uint32_t alignment() const noexcept { return _alignment; } + //! Sets align offset in bytes to `offset`. + inline void setAlignment(uint32_t alignment) noexcept { _alignment = alignment; } + + //! \} +}; + +// ============================================================================ +// [asmjit::EmbedDataNode] +// ============================================================================ + +//! Embed data node. +//! +//! Wraps `.data` directive. The node contains data that will be placed at the +//! node's position in the assembler stream. The data is considered to be RAW; +//! no analysis nor byte-order conversion is performed on RAW data. +class EmbedDataNode : public BaseNode { +public: + ASMJIT_NONCOPYABLE(EmbedDataNode) + + enum : uint32_t { + kInlineBufferSize = uint32_t(64 - sizeof(BaseNode) - 4) + }; + + union { + struct { + //! Embedded data buffer. + uint8_t _buf[kInlineBufferSize]; + //! Size of the data. + uint32_t _size; + }; + struct { + //! Pointer to external data. + uint8_t* _externalPtr; + }; + }; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `EmbedDataNode` instance. + inline EmbedDataNode(BaseBuilder* cb, void* data, uint32_t size) noexcept + : BaseNode(cb, kNodeEmbedData, kFlagIsData) { + + if (size <= kInlineBufferSize) { + if (data) + memcpy(_buf, data, size); + } + else { + _externalPtr = static_cast(data); + } + _size = size; + } + + //! \} + + //! \name Accessors + //! \{ + + //! Returns pointer to the data. + inline uint8_t* data() const noexcept { return _size <= kInlineBufferSize ? const_cast(_buf) : _externalPtr; } + //! Returns size of the data. + inline uint32_t size() const noexcept { return _size; } + + //! \} +}; + +// ============================================================================ +// [asmjit::EmbedLabelNode] +// ============================================================================ + +//! Label data node. +class EmbedLabelNode : public BaseNode { +public: + ASMJIT_NONCOPYABLE(EmbedLabelNode) + + uint32_t _id; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `EmbedLabelNode` instance. + inline EmbedLabelNode(BaseBuilder* cb, uint32_t id = 0) noexcept + : BaseNode(cb, kNodeEmbedLabel, kFlagIsData), + _id(id) {} + + //! \} + + //! \name Accessors + //! \{ + + //! Returns the id of the label. + inline uint32_t id() const noexcept { return _id; } + //! Sets the label id (use with caution, improper use can break a lot of things). + inline void setId(uint32_t id) noexcept { _id = id; } + + //! Returns the label as `Label` operand. + inline Label label() const noexcept { return Label(_id); } + //! Sets the label id from `label` operand. + inline void setLabel(const Label& label) noexcept { setId(label.id()); } + + //! \} +}; + +// ============================================================================ +// [asmjit::EmbedLabelDeltaNode] +// ============================================================================ + +//! Label data node. +class EmbedLabelDeltaNode : public BaseNode { +public: + ASMJIT_NONCOPYABLE(EmbedLabelDeltaNode) + + uint32_t _id; + uint32_t _baseId; + uint32_t _dataSize; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `EmbedLabelDeltaNode` instance. + inline EmbedLabelDeltaNode(BaseBuilder* cb, uint32_t id = 0, uint32_t baseId = 0, uint32_t dataSize = 0) noexcept + : BaseNode(cb, kNodeEmbedLabelDelta, kFlagIsData), + _id(id), + _baseId(baseId), + _dataSize(dataSize) {} + + //! \} + + //! \name Accessors + //! \{ + + //! Returns the id of the label. + inline uint32_t id() const noexcept { return _id; } + //! Sets the label id. + inline void setId(uint32_t id) noexcept { _id = id; } + //! Returns the label as `Label` operand. + inline Label label() const noexcept { return Label(_id); } + //! Sets the label id from `label` operand. + inline void setLabel(const Label& label) noexcept { setId(label.id()); } + + //! Returns the id of the base label. + inline uint32_t baseId() const noexcept { return _baseId; } + //! Sets the base label id. + inline void setBaseId(uint32_t baseId) noexcept { _baseId = baseId; } + //! Returns the base label as `Label` operand. + inline Label baseLabel() const noexcept { return Label(_baseId); } + //! Sets the base label id from `label` operand. + inline void setBaseLabel(const Label& baseLabel) noexcept { setBaseId(baseLabel.id()); } + + inline uint32_t dataSize() const noexcept { return _dataSize; } + inline void setDataSize(uint32_t dataSize) noexcept { _dataSize = dataSize; } + + //! \} +}; + +// ============================================================================ +// [asmjit::ConstPoolNode] +// ============================================================================ + +//! A node that wraps `ConstPool`. +class ConstPoolNode : public LabelNode { +public: + ASMJIT_NONCOPYABLE(ConstPoolNode) + + ConstPool _constPool; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `ConstPoolNode` instance. + inline ConstPoolNode(BaseBuilder* cb, uint32_t id = 0) noexcept + : LabelNode(cb, id), + _constPool(&cb->_codeZone) { + + setType(kNodeConstPool); + addFlags(kFlagIsData); + clearFlags(kFlagIsCode | kFlagHasNoEffect); + } + + //! \} + + //! \name Accessors + //! \{ + + //! Tests whether the constant-pool is empty. + inline bool empty() const noexcept { return _constPool.empty(); } + //! Returns the size of the constant-pool in bytes. + inline size_t size() const noexcept { return _constPool.size(); } + //! Returns minimum alignment. + inline size_t alignment() const noexcept { return _constPool.alignment(); } + + //! Returns the wrapped `ConstPool` instance. + inline ConstPool& constPool() noexcept { return _constPool; } + //! Returns the wrapped `ConstPool` instance (const). + inline const ConstPool& constPool() const noexcept { return _constPool; } + + //! \} + + //! \name Utilities + //! \{ + + //! See `ConstPool::add()`. + inline Error add(const void* data, size_t size, size_t& dstOffset) noexcept { + return _constPool.add(data, size, dstOffset); + } + + //! \} +}; + +// ============================================================================ +// [asmjit::CommentNode] +// ============================================================================ + +//! Comment node. +class CommentNode : public BaseNode { +public: + ASMJIT_NONCOPYABLE(CommentNode) + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `CommentNode` instance. + inline CommentNode(BaseBuilder* cb, const char* comment) noexcept + : BaseNode(cb, kNodeComment, kFlagIsInformative | kFlagHasNoEffect | kFlagIsRemovable) { + _inlineComment = comment; + } + + //! \} +}; + +// ============================================================================ +// [asmjit::SentinelNode] +// ============================================================================ + +//! Sentinel node. +//! +//! Sentinel is a marker that is completely ignored by the code builder. It's +//! used to remember a position in a code as it never gets removed by any pass. +class SentinelNode : public BaseNode { +public: + ASMJIT_NONCOPYABLE(SentinelNode) + + //! Type of the sentinel (purery informative purpose). + enum SentinelType : uint32_t { + kSentinelUnknown = 0u, + kSentinelFuncEnd = 1u + }; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `SentinelNode` instance. + inline SentinelNode(BaseBuilder* cb, uint32_t sentinelType = kSentinelUnknown) noexcept + : BaseNode(cb, kNodeSentinel, kFlagIsInformative | kFlagHasNoEffect) { + + _sentinel._sentinelType = uint8_t(sentinelType); + } + + //! \} + + //! \name Accessors + //! \{ + + inline uint32_t sentinelType() const noexcept { return _sentinel._sentinelType; } + inline void setSentinelType(uint32_t type) noexcept { _sentinel._sentinelType = uint8_t(type); } + + //! \} +}; + +// ============================================================================ +// [asmjit::Pass] +// ============================================================================ + +//! Pass can be used to implement code transformations, analysis, and lowering. +class ASMJIT_VIRTAPI Pass { +public: + ASMJIT_BASE_CLASS(Pass) + ASMJIT_NONCOPYABLE(Pass) + + //! BaseBuilder this pass is assigned to. + BaseBuilder* _cb; + //! Name of the pass. + const char* _name; + + //! \name Construction & Destruction + //! \{ + + ASMJIT_API Pass(const char* name) noexcept; + ASMJIT_API virtual ~Pass() noexcept; + + //! \} + + //! \name Accessors + //! \{ + + inline const BaseBuilder* cb() const noexcept { return _cb; } + inline const char* name() const noexcept { return _name; } + + //! \} + + //! \name Pass Interface + //! \{ + + //! Processes the code stored in Builder or Compiler. + //! + //! This is the only function that is called by the `BaseBuilder` to process + //! the code. It passes `zone`, which will be reset after the `run()` finishes. + virtual Error run(Zone* zone, Logger* logger) noexcept = 0; + + //! \} +}; + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // !ASMJIT_NO_BUILDER +#endif // ASMJIT_CORE_BUILDER_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/callconv.cpp b/3rdparty/asmjit/src/asmjit/core/callconv.cpp new file mode 100644 index 00000000000..5d915d0e38d --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/callconv.cpp @@ -0,0 +1,59 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#include "../core/arch.h" +#include "../core/func.h" +#include "../core/type.h" + +#ifdef ASMJIT_BUILD_X86 + #include "../x86/x86callconv_p.h" +#endif + +#ifdef ASMJIT_BUILD_ARM + #include "../arm/armcallconv_p.h" +#endif + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::CallConv - Init / Reset] +// ============================================================================ + +ASMJIT_FAVOR_SIZE Error CallConv::init(uint32_t ccId) noexcept { + reset(); + +#ifdef ASMJIT_BUILD_X86 + if (CallConv::isX86Family(ccId)) + return x86::CallConvInternal::init(*this, ccId); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (CallConv::isArmFamily(ccId)) + return arm::CallConvInternal::init(*this, ccId); +#endif + + return DebugUtils::errored(kErrorInvalidArgument); +} + +ASMJIT_END_NAMESPACE diff --git a/3rdparty/asmjit/src/asmjit/core/callconv.h b/3rdparty/asmjit/src/asmjit/core/callconv.h new file mode 100644 index 00000000000..f3dc385dfec --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/callconv.h @@ -0,0 +1,411 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_CALLCONV_H_INCLUDED +#define ASMJIT_CORE_CALLCONV_H_INCLUDED + +#include "../core/arch.h" +#include "../core/operand.h" +#include "../core/support.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_func +//! \{ + +// ============================================================================ +// [asmjit::CallConv] +// ============================================================================ + +//! Function calling convention. +//! +//! Function calling convention is a scheme that defines how function parameters +//! are passed and how function returns its result. AsmJit defines a variety of +//! architecture and OS specific calling conventions and also provides a compile +//! time detection to make the code-generation easier. +struct CallConv { + //! Calling convention id, see `Id`. + uint8_t _id; + //! Architecture id (see `ArchInfo::Id`). + uint8_t _archId; + //! Register assignment strategy. + uint8_t _strategy; + //! Flags. + uint8_t _flags; + + //! Red zone size (AMD64 == 128 bytes). + uint8_t _redZoneSize; + //! Spill zone size (WIN64 == 32 bytes). + uint8_t _spillZoneSize; + //! Natural stack alignment as defined by OS/ABI. + uint8_t _naturalStackAlignment; + uint8_t _reserved[1]; + + //! Mask of all passed registers, per group. + uint32_t _passedRegs[BaseReg::kGroupVirt]; + //! Mask of all preserved registers, per group. + uint32_t _preservedRegs[BaseReg::kGroupVirt]; + + //! Internal limits of AsmJit's CallConv. + enum Limits : uint32_t { + kMaxRegArgsPerGroup = 16 + }; + + //! Passed registers' order. + union RegOrder { + //! Passed registers, ordered. + uint8_t id[kMaxRegArgsPerGroup]; + uint32_t packed[(kMaxRegArgsPerGroup + 3) / 4]; + }; + + //! Passed registers' order, per group. + RegOrder _passedOrder[BaseReg::kGroupVirt]; + + //! Calling convention id. + enum Id : uint32_t { + //! None or invalid (can't be used). + kIdNone = 0, + + // ------------------------------------------------------------------------ + // [Universal] + // ------------------------------------------------------------------------ + + // TODO: To make this possible we need to know target ARCH and ABI. + + /* + + // Universal calling conventions are applicable to any target and are + // converted to target dependent conventions at runtime. The purpose of + // these conventions is to make using functions less target dependent. + + kIdCDecl = 1, + kIdStdCall = 2, + kIdFastCall = 3, + + //! AsmJit specific calling convention designed for calling functions + //! inside a multimedia code that don't use many registers internally, + //! but are long enough to be called and not inlined. These functions are + //! usually used to calculate trigonometric functions, logarithms, etc... + kIdLightCall2 = 10, + kIdLightCall3 = 11, + kIdLightCall4 = 12, + */ + + // ------------------------------------------------------------------------ + // [X86] + // ------------------------------------------------------------------------ + + //! X86 `__cdecl` calling convention (used by C runtime and libraries). + kIdX86CDecl = 16, + //! X86 `__stdcall` calling convention (used mostly by WinAPI). + kIdX86StdCall = 17, + //! X86 `__thiscall` calling convention (MSVC/Intel). + kIdX86MsThisCall = 18, + //! X86 `__fastcall` convention (MSVC/Intel). + kIdX86MsFastCall = 19, + //! X86 `__fastcall` convention (GCC and Clang). + kIdX86GccFastCall = 20, + //! X86 `regparm(1)` convention (GCC and Clang). + kIdX86GccRegParm1 = 21, + //! X86 `regparm(2)` convention (GCC and Clang). + kIdX86GccRegParm2 = 22, + //! X86 `regparm(3)` convention (GCC and Clang). + kIdX86GccRegParm3 = 23, + + kIdX86LightCall2 = 29, + kIdX86LightCall3 = 30, + kIdX86LightCall4 = 31, + + //! X64 calling convention - WIN64-ABI. + kIdX86Win64 = 32, + //! X64 calling convention - SystemV / AMD64-ABI. + kIdX86SysV64 = 33, + + kIdX64LightCall2 = 45, + kIdX64LightCall3 = 46, + kIdX64LightCall4 = 47, + + // ------------------------------------------------------------------------ + // [ARM] + // ------------------------------------------------------------------------ + + //! Legacy calling convention, floating point arguments are passed via GP registers. + kIdArm32SoftFP = 48, + //! Modern calling convention, uses VFP registers to pass floating point arguments. + kIdArm32HardFP = 49, + + // ------------------------------------------------------------------------ + // [Internal] + // ------------------------------------------------------------------------ + + //! \cond INTERNAL + + _kIdX86Start = 16, + _kIdX86End = 31, + + _kIdX64Start = 32, + _kIdX64End = 47, + + _kIdArmStart = 48, + _kIdArmEnd = 49, + + //! \endcond + + // ------------------------------------------------------------------------ + // [Host] + // ------------------------------------------------------------------------ + +#if defined(ASMJIT_DOCGEN) + + //! Default calling convention based on the current C++ compiler's settings. + //! + //! \note This should be always the same as `kIdHostCDecl`, but some + //! compilers allow to override the default calling convention. Overriding + //! is not detected at the moment. + kIdHost = DETECTED_AT_COMPILE_TIME, + + //! Default CDECL calling convention based on the current C++ compiler's settings. + kIdHostCDecl = DETECTED_AT_COMPILE_TIME, + + //! Default STDCALL calling convention based on the current C++ compiler's settings. + //! + //! \note If not defined by the host then it's the same as `kIdHostCDecl`. + kIdHostStdCall = DETECTED_AT_COMPILE_TIME, + + //! Compatibility for `__fastcall` calling convention. + //! + //! \note If not defined by the host then it's the same as `kIdHostCDecl`. + kIdHostFastCall = DETECTED_AT_COMPILE_TIME + +#elif ASMJIT_ARCH_X86 == 32 + + kIdHost = kIdX86CDecl, + kIdHostCDecl = kIdX86CDecl, + kIdHostStdCall = kIdX86StdCall, + +# if defined(_MSC_VER) + kIdHostFastCall = kIdX86MsFastCall, +# elif defined(__GNUC__) + kIdHostFastCall = kIdX86GccFastCall, +# else + kIdHostFastCall = kIdHost, +# endif + + kIdHostLightCall2 = kIdX86LightCall2, + kIdHostLightCall3 = kIdX86LightCall3, + kIdHostLightCall4 = kIdX86LightCall4 + +#elif ASMJIT_ARCH_X86 == 64 + +# if defined(_WIN32) + kIdHost = kIdX86Win64, +# else + kIdHost = kIdX86SysV64, +# endif + + kIdHostCDecl = kIdHost, // Doesn't exist, redirected to host. + kIdHostStdCall = kIdHost, // Doesn't exist, redirected to host. + kIdHostFastCall = kIdHost, // Doesn't exist, redirected to host. + + kIdHostLightCall2 = kIdX64LightCall2, + kIdHostLightCall3 = kIdX64LightCall3, + kIdHostLightCall4 = kIdX64LightCall4 + +#elif ASMJIT_ARCH_ARM == 32 + +# if defined(__SOFTFP__) + kIdHost = kIdArm32SoftFP, +# else + kIdHost = kIdArm32HardFP, +# endif + // These don't exist on ARM. + kIdHostCDecl = kIdHost, // Doesn't exist, redirected to host. + kIdHostStdCall = kIdHost, // Doesn't exist, redirected to host. + kIdHostFastCall = kIdHost // Doesn't exist, redirected to host. + +#else + + kIdHost = kIdNone, + kIdHostCDecl = kIdHost, + kIdHostStdCall = kIdHost, + kIdHostFastCall = kIdHost + +#endif + }; + + //! Strategy used to assign registers to function arguments. + //! + //! This is AsmJit specific. It basically describes how AsmJit should convert + //! the function arguments defined by `FuncSignature` into register IDs and + //! stack offsets. The default strategy `kStrategyDefault` assigns registers + //! and then stack whereas `kStrategyWin64` strategy does register shadowing + //! as defined by WIN64 calling convention - it applies to 64-bit calling + //! conventions only. + enum Strategy : uint32_t { + kStrategyDefault = 0, //!< Default register assignment strategy. + kStrategyWin64 = 1 //!< WIN64 specific register assignment strategy. + }; + + //! Calling convention flags. + enum Flags : uint32_t { + kFlagCalleePopsStack = 0x01, //!< Callee is responsible for cleaning up the stack. + kFlagPassFloatsByVec = 0x02, //!< Pass F32 and F64 arguments by VEC128 register. + kFlagVectorCall = 0x04, //!< This is a '__vectorcall' calling convention. + kFlagIndirectVecArgs = 0x08 //!< Pass vector arguments indirectly (as a pointer). + }; + + //! \name Construction & Destruction + //! \{ + + ASMJIT_API Error init(uint32_t ccId) noexcept; + + inline void reset() noexcept { + memset(this, 0, sizeof(*this)); + memset(_passedOrder, 0xFF, sizeof(_passedOrder)); + } + + //! \} + + //! \name Accessors + //! \{ + + //! Returns the calling convention id, see `Id`. + inline uint32_t id() const noexcept { return _id; } + //! Sets the calling convention id, see `Id`. + inline void setId(uint32_t id) noexcept { _id = uint8_t(id); } + + //! Returns the calling function architecture id. + inline uint32_t archId() const noexcept { return _archId; } + //! Sets the calling function architecture id. + inline void setArchType(uint32_t archId) noexcept { _archId = uint8_t(archId); } + + //! Returns the strategy used to assign registers to arguments, see `Strategy`. + inline uint32_t strategy() const noexcept { return _strategy; } + //! Sets the strategy used to assign registers to arguments, see `Strategy`. + inline void setStrategy(uint32_t strategy) noexcept { _strategy = uint8_t(strategy); } + + //! Tests whether the calling convention has the given `flag` set. + inline bool hasFlag(uint32_t flag) const noexcept { return (uint32_t(_flags) & flag) != 0; } + //! Returns the calling convention flags, see `Flags`. + inline uint32_t flags() const noexcept { return _flags; } + //! Adds the calling convention flags, see `Flags`. + inline void setFlags(uint32_t flag) noexcept { _flags = uint8_t(flag); }; + //! Adds the calling convention flags, see `Flags`. + inline void addFlags(uint32_t flags) noexcept { _flags = uint8_t(_flags | flags); }; + + //! Tests whether this calling convention specifies 'RedZone'. + inline bool hasRedZone() const noexcept { return _redZoneSize != 0; } + //! Tests whether this calling convention specifies 'SpillZone'. + inline bool hasSpillZone() const noexcept { return _spillZoneSize != 0; } + + //! Returns size of 'RedZone'. + inline uint32_t redZoneSize() const noexcept { return _redZoneSize; } + //! Returns size of 'SpillZone'. + inline uint32_t spillZoneSize() const noexcept { return _spillZoneSize; } + + //! Sets size of 'RedZone'. + inline void setRedZoneSize(uint32_t size) noexcept { _redZoneSize = uint8_t(size); } + //! Sets size of 'SpillZone'. + inline void setSpillZoneSize(uint32_t size) noexcept { _spillZoneSize = uint8_t(size); } + + //! Returns a natural stack alignment. + inline uint32_t naturalStackAlignment() const noexcept { return _naturalStackAlignment; } + //! Sets a natural stack alignment. + //! + //! This function can be used to override the default stack alignment in case + //! that you know that it's alignment is different. For example it allows to + //! implement custom calling conventions that guarantee higher stack alignment. + inline void setNaturalStackAlignment(uint32_t value) noexcept { _naturalStackAlignment = uint8_t(value); } + + inline const uint8_t* passedOrder(uint32_t group) const noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + return _passedOrder[group].id; + } + + inline uint32_t passedRegs(uint32_t group) const noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + return _passedRegs[group]; + } + + inline void _setPassedPacked(uint32_t group, uint32_t p0, uint32_t p1, uint32_t p2, uint32_t p3) noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + + _passedOrder[group].packed[0] = p0; + _passedOrder[group].packed[1] = p1; + _passedOrder[group].packed[2] = p2; + _passedOrder[group].packed[3] = p3; + } + + inline void setPassedToNone(uint32_t group) noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + + _setPassedPacked(group, 0xFFFFFFFFu, 0xFFFFFFFFu, 0xFFFFFFFFu, 0xFFFFFFFFu); + _passedRegs[group] = 0u; + } + + inline void setPassedOrder(uint32_t group, uint32_t a0, uint32_t a1 = 0xFF, uint32_t a2 = 0xFF, uint32_t a3 = 0xFF, uint32_t a4 = 0xFF, uint32_t a5 = 0xFF, uint32_t a6 = 0xFF, uint32_t a7 = 0xFF) noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + + // NOTE: This should always be called with all arguments known at compile time, + // so even if it looks scary it should be translated into few instructions. + _setPassedPacked(group, Support::bytepack32_4x8(a0, a1, a2, a3), + Support::bytepack32_4x8(a4, a5, a6, a7), + 0xFFFFFFFFu, + 0xFFFFFFFFu); + + _passedRegs[group] = (a0 != 0xFF ? 1u << a0 : 0u) | + (a1 != 0xFF ? 1u << a1 : 0u) | + (a2 != 0xFF ? 1u << a2 : 0u) | + (a3 != 0xFF ? 1u << a3 : 0u) | + (a4 != 0xFF ? 1u << a4 : 0u) | + (a5 != 0xFF ? 1u << a5 : 0u) | + (a6 != 0xFF ? 1u << a6 : 0u) | + (a7 != 0xFF ? 1u << a7 : 0u) ; + } + + inline uint32_t preservedRegs(uint32_t group) const noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + return _preservedRegs[group]; + } + + inline void setPreservedRegs(uint32_t group, uint32_t regs) noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + _preservedRegs[group] = regs; + } + + //! \} + + //! \name Static Functions + //! \{ + + static inline bool isX86Family(uint32_t ccId) noexcept { return ccId >= _kIdX86Start && ccId <= _kIdX64End; } + static inline bool isArmFamily(uint32_t ccId) noexcept { return ccId >= _kIdArmStart && ccId <= _kIdArmEnd; } + + //! \} +}; + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_CALLCONV_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/codebufferwriter_p.h b/3rdparty/asmjit/src/asmjit/core/codebufferwriter_p.h new file mode 100644 index 00000000000..ee7521153a3 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/codebufferwriter_p.h @@ -0,0 +1,188 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_CODEBUFFERWRITER_P_H_INCLUDED +#define ASMJIT_CORE_CODEBUFFERWRITER_P_H_INCLUDED + +#include "../core/assembler.h" +#include "../core/support.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \cond INTERNAL +//! \addtogroup asmjit_core +//! \{ + +// ============================================================================ +// [asmjit::CodeBufferWriter] +// ============================================================================ + +//! Helper that is used to write into a `CodeBuffer` held by `BaseAssembler`. +class CodeBufferWriter { +public: + uint8_t* _cursor; + + ASMJIT_INLINE explicit CodeBufferWriter(BaseAssembler* a) noexcept + : _cursor(a->_bufferPtr) {} + + ASMJIT_INLINE Error ensureSpace(BaseAssembler* a, size_t n) noexcept { + size_t remainingSpace = (size_t)(a->_bufferEnd - _cursor); + if (ASMJIT_UNLIKELY(remainingSpace < n)) { + CodeBuffer& buffer = a->_section->_buffer; + Error err = a->_code->growBuffer(&buffer, n); + if (ASMJIT_UNLIKELY(err)) + return a->reportError(err); + _cursor = a->_bufferPtr; + } + return kErrorOk; + } + + ASMJIT_INLINE uint8_t* cursor() const noexcept { return _cursor; } + ASMJIT_INLINE void setCursor(uint8_t* cursor) noexcept { _cursor = cursor; } + ASMJIT_INLINE void advance(size_t n) noexcept { _cursor += n; } + + ASMJIT_INLINE size_t offsetFrom(uint8_t* from) const noexcept { + ASMJIT_ASSERT(_cursor >= from); + return (size_t)(_cursor - from); + } + + template + ASMJIT_INLINE void emit8(T val) noexcept { + typedef typename std::make_unsigned::type U; + _cursor[0] = uint8_t(U(val) & U(0xFF)); + _cursor++; + } + + template + ASMJIT_INLINE void emit8If(T val, Y cond) noexcept { + typedef typename std::make_unsigned::type U; + ASMJIT_ASSERT(size_t(cond) <= 1u); + + _cursor[0] = uint8_t(U(val) & U(0xFF)); + _cursor += size_t(cond); + } + + template + ASMJIT_INLINE void emit16uLE(T val) noexcept { + typedef typename std::make_unsigned::type U; + Support::writeU16uLE(_cursor, uint32_t(U(val) & 0xFFFFu)); + _cursor += 2; + } + + template + ASMJIT_INLINE void emit16uBE(T val) noexcept { + typedef typename std::make_unsigned::type U; + Support::writeU16uBE(_cursor, uint32_t(U(val) & 0xFFFFu)); + _cursor += 2; + } + + template + ASMJIT_INLINE void emit32uLE(T val) noexcept { + typedef typename std::make_unsigned::type U; + Support::writeU32uLE(_cursor, uint32_t(U(val) & 0xFFFFFFFFu)); + _cursor += 4; + } + + template + ASMJIT_INLINE void emit32uBE(T val) noexcept { + typedef typename std::make_unsigned::type U; + Support::writeU32uBE(_cursor, uint32_t(U(val) & 0xFFFFFFFFu)); + _cursor += 4; + } + + ASMJIT_INLINE void emitData(const void* data, size_t size) noexcept { + ASMJIT_ASSERT(size != 0); + memcpy(_cursor, data, size); + _cursor += size; + } + + template + ASMJIT_INLINE void emitValueLE(const T& value, size_t size) noexcept { + typedef typename std::make_unsigned::type U; + ASMJIT_ASSERT(size <= sizeof(T)); + + U v = U(value); + for (uint32_t i = 0; i < size; i++) { + _cursor[i] = uint8_t(v & 0xFFu); + v >>= 8; + } + _cursor += size; + } + + template + ASMJIT_INLINE void emitValueBE(const T& value, size_t size) noexcept { + typedef typename std::make_unsigned::type U; + ASMJIT_ASSERT(size <= sizeof(T)); + + U v = U(value); + for (uint32_t i = 0; i < size; i++) { + _cursor[i] = uint8_t(v >> (sizeof(T) - 8)); + v <<= 8; + } + _cursor += size; + } + + ASMJIT_INLINE void emitZeros(size_t size) noexcept { + ASMJIT_ASSERT(size != 0); + memset(_cursor, 0, size); + _cursor += size; + } + + ASMJIT_INLINE void remove8(uint8_t* where) noexcept { + ASMJIT_ASSERT(where < _cursor); + + uint8_t* p = where; + while (++p != _cursor) + p[-1] = p[0]; + _cursor--; + } + + template + ASMJIT_INLINE void insert8(uint8_t* where, T val) noexcept { + uint8_t* p = _cursor; + + while (p != where) { + p[0] = p[-1]; + p--; + } + + *p = uint8_t(val & 0xFF); + _cursor++; + } + + ASMJIT_INLINE void done(BaseAssembler* a) noexcept { + CodeBuffer& buffer = a->_section->_buffer; + size_t newSize = (size_t)(_cursor - a->_bufferData); + ASMJIT_ASSERT(newSize <= buffer.capacity()); + + a->_bufferPtr = _cursor; + buffer._size = Support::max(buffer._size, newSize); + } +}; + +//! \} +//! \endcond + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_CODEBUFFERWRITER_P_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/codeholder.cpp b/3rdparty/asmjit/src/asmjit/core/codeholder.cpp new file mode 100644 index 00000000000..93c9a99df88 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/codeholder.cpp @@ -0,0 +1,1125 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#include "../core/assembler.h" +#include "../core/logging.h" +#include "../core/support.h" + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [Globals] +// ============================================================================ + +static const char CodeHolder_addrTabName[] = ".addrtab"; + +//! Encode MOD byte. +static inline uint32_t x86EncodeMod(uint32_t m, uint32_t o, uint32_t rm) noexcept { + return (m << 6) | (o << 3) | rm; +} + +// ============================================================================ +// [asmjit::LabelLinkIterator] +// ============================================================================ + +class LabelLinkIterator { +public: + ASMJIT_INLINE LabelLinkIterator(LabelEntry* le) noexcept { reset(le); } + + ASMJIT_INLINE explicit operator bool() const noexcept { return isValid(); } + ASMJIT_INLINE bool isValid() const noexcept { return _link != nullptr; } + + ASMJIT_INLINE LabelLink* link() const noexcept { return _link; } + ASMJIT_INLINE LabelLink* operator->() const noexcept { return _link; } + + ASMJIT_INLINE void reset(LabelEntry* le) noexcept { + _pPrev = &le->_links; + _link = *_pPrev; + } + + ASMJIT_INLINE void next() noexcept { + _pPrev = &_link->next; + _link = *_pPrev; + } + + ASMJIT_INLINE void resolveAndNext(CodeHolder* code) noexcept { + LabelLink* linkToDelete = _link; + + _link = _link->next; + *_pPrev = _link; + + code->_unresolvedLinkCount--; + code->_allocator.release(linkToDelete, sizeof(LabelLink)); + } + + LabelLink** _pPrev; + LabelLink* _link; +}; + +// ============================================================================ +// [asmjit::ErrorHandler] +// ============================================================================ + +ErrorHandler::ErrorHandler() noexcept {} +ErrorHandler::~ErrorHandler() noexcept {} + +// ============================================================================ +// [asmjit::CodeHolder - Utilities] +// ============================================================================ + +static void CodeHolder_resetInternal(CodeHolder* self, uint32_t resetPolicy) noexcept { + uint32_t i; + const ZoneVector& emitters = self->emitters(); + + i = emitters.size(); + while (i) + self->detach(emitters[--i]); + + // Reset everything into its construction state. + self->_codeInfo.reset(); + self->_emitterOptions = 0; + self->_logger = nullptr; + self->_errorHandler = nullptr; + + // Reset all sections. + uint32_t numSections = self->_sections.size(); + for (i = 0; i < numSections; i++) { + Section* section = self->_sections[i]; + if (section->_buffer.data() && !section->_buffer.isExternal()) + ::free(section->_buffer._data); + section->_buffer._data = nullptr; + section->_buffer._capacity = 0; + } + + // Reset zone allocator and all containers using it. + ZoneAllocator* allocator = self->allocator(); + + self->_emitters.reset(); + self->_namedLabels.reset(); + self->_relocations.reset(); + self->_labelEntries.reset(); + self->_sections.reset(); + + self->_unresolvedLinkCount = 0; + self->_addressTableSection = nullptr; + self->_addressTableEntries.reset(); + + allocator->reset(&self->_zone); + self->_zone.reset(resetPolicy); +} + +static void CodeHolder_modifyEmitterOptions(CodeHolder* self, uint32_t clear, uint32_t add) noexcept { + uint32_t oldOpt = self->_emitterOptions; + uint32_t newOpt = (oldOpt & ~clear) | add; + + if (oldOpt == newOpt) + return; + + // Modify emitter options of `CodeHolder` itself. + self->_emitterOptions = newOpt; + + // Modify emitter options of all attached emitters. + for (BaseEmitter* emitter : self->emitters()) { + emitter->_emitterOptions = (emitter->_emitterOptions & ~clear) | add; + emitter->onUpdateGlobalInstOptions(); + } +} + +// ============================================================================ +// [asmjit::CodeHolder - Construction / Destruction] +// ============================================================================ + +CodeHolder::CodeHolder() noexcept + : _codeInfo(), + _emitterOptions(0), + _logger(nullptr), + _errorHandler(nullptr), + _zone(16384 - Zone::kBlockOverhead), + _allocator(&_zone), + _unresolvedLinkCount(0), + _addressTableSection(nullptr) {} + +CodeHolder::~CodeHolder() noexcept { + CodeHolder_resetInternal(this, Globals::kResetHard); +} + +// ============================================================================ +// [asmjit::CodeHolder - Init / Reset] +// ============================================================================ + +inline void CodeHolder_setSectionDefaultName( + Section* section, + char c0 = 0, char c1 = 0, char c2 = 0, char c3 = 0, + char c4 = 0, char c5 = 0, char c6 = 0, char c7 = 0) noexcept { + + section->_name.u32[0] = Support::bytepack32_4x8(uint8_t(c0), uint8_t(c1), uint8_t(c2), uint8_t(c3)); + section->_name.u32[1] = Support::bytepack32_4x8(uint8_t(c4), uint8_t(c5), uint8_t(c6), uint8_t(c7)); +} + +Error CodeHolder::init(const CodeInfo& info) noexcept { + // Cannot reinitialize if it's locked or there is one or more emitter attached. + if (isInitialized()) + return DebugUtils::errored(kErrorAlreadyInitialized); + + // If we are just initializing there should be no emitters attached. + ASMJIT_ASSERT(_emitters.empty()); + + // Create the default section and insert it to the `_sections` array. + Error err = _sections.willGrow(&_allocator); + if (err == kErrorOk) { + Section* section = _allocator.allocZeroedT
(); + if (ASMJIT_LIKELY(section)) { + section->_flags = Section::kFlagExec | Section::kFlagConst; + CodeHolder_setSectionDefaultName(section, '.', 't', 'e', 'x', 't'); + _sections.appendUnsafe(section); + } + else { + err = DebugUtils::errored(kErrorOutOfMemory); + } + } + + if (ASMJIT_UNLIKELY(err)) { + _zone.reset(); + return err; + } + else { + _codeInfo = info; + return kErrorOk; + } +} + +void CodeHolder::reset(uint32_t resetPolicy) noexcept { + CodeHolder_resetInternal(this, resetPolicy); +} + +// ============================================================================ +// [asmjit::CodeHolder - Attach / Detach] +// ============================================================================ + +Error CodeHolder::attach(BaseEmitter* emitter) noexcept { + // Catch a possible misuse of the API. + if (ASMJIT_UNLIKELY(!emitter)) + return DebugUtils::errored(kErrorInvalidArgument); + + // Invalid emitter, this should not be possible. + uint32_t type = emitter->emitterType(); + if (ASMJIT_UNLIKELY(type == BaseEmitter::kTypeNone || type >= BaseEmitter::kTypeCount)) + return DebugUtils::errored(kErrorInvalidState); + + // This is suspicious, but don't fail if `emitter` is already attached + // to this code holder. This is not error, but it's not recommended. + if (emitter->_code != nullptr) { + if (emitter->_code == this) + return kErrorOk; + return DebugUtils::errored(kErrorInvalidState); + } + + // Reserve the space now as we cannot fail after `onAttach()` succeeded. + ASMJIT_PROPAGATE(_emitters.willGrow(&_allocator, 1)); + ASMJIT_PROPAGATE(emitter->onAttach(this)); + + // Connect CodeHolder <-> BaseEmitter. + ASMJIT_ASSERT(emitter->_code == this); + _emitters.appendUnsafe(emitter); + + return kErrorOk; +} + +Error CodeHolder::detach(BaseEmitter* emitter) noexcept { + if (ASMJIT_UNLIKELY(!emitter)) + return DebugUtils::errored(kErrorInvalidArgument); + + if (ASMJIT_UNLIKELY(emitter->_code != this)) + return DebugUtils::errored(kErrorInvalidState); + + // NOTE: We always detach if we were asked to, if error happens during + // `emitter->onDetach()` we just propagate it, but the BaseEmitter will + // be detached. + Error err = kErrorOk; + if (!emitter->isDestroyed()) + err = emitter->onDetach(this); + + // Disconnect CodeHolder <-> BaseEmitter. + uint32_t index = _emitters.indexOf(emitter); + ASMJIT_ASSERT(index != Globals::kNotFound); + + _emitters.removeAt(index); + emitter->_code = nullptr; + + return err; +} + +// ============================================================================ +// [asmjit::CodeHolder - Emitter Options] +// ============================================================================ + +static constexpr uint32_t kEmitterOptionsFilter = ~uint32_t(BaseEmitter::kOptionLoggingEnabled); + +void CodeHolder::addEmitterOptions(uint32_t options) noexcept { + CodeHolder_modifyEmitterOptions(this, 0, options & kEmitterOptionsFilter); +} + +void CodeHolder::clearEmitterOptions(uint32_t options) noexcept { + CodeHolder_modifyEmitterOptions(this, options & kEmitterOptionsFilter, 0); +} + +// ============================================================================ +// [asmjit::CodeHolder - Logging & Error Handling] +// ============================================================================ + +void CodeHolder::setLogger(Logger* logger) noexcept { +#ifndef ASMJIT_NO_LOGGING + _logger = logger; + uint32_t option = !logger ? uint32_t(0) : uint32_t(BaseEmitter::kOptionLoggingEnabled); + CodeHolder_modifyEmitterOptions(this, BaseEmitter::kOptionLoggingEnabled, option); +#else + DebugUtils::unused(logger); +#endif +} + +// ============================================================================ +// [asmjit::CodeHolder - Code Buffer] +// ============================================================================ + +static Error CodeHolder_reserveInternal(CodeHolder* self, CodeBuffer* cb, size_t n) noexcept { + uint8_t* oldData = cb->_data; + uint8_t* newData; + + if (oldData && !cb->isExternal()) + newData = static_cast(::realloc(oldData, n)); + else + newData = static_cast(::malloc(n)); + + if (ASMJIT_UNLIKELY(!newData)) + return DebugUtils::errored(kErrorOutOfMemory); + + cb->_data = newData; + cb->_capacity = n; + + // Update pointers used by assemblers, if attached. + for (BaseEmitter* emitter : self->emitters()) { + if (emitter->isAssembler()) { + BaseAssembler* a = static_cast(emitter); + if (&a->_section->_buffer == cb) { + size_t offset = a->offset(); + + a->_bufferData = newData; + a->_bufferEnd = newData + n; + a->_bufferPtr = newData + offset; + } + } + } + + return kErrorOk; +} + +Error CodeHolder::growBuffer(CodeBuffer* cb, size_t n) noexcept { + // The size of the section must be valid. + size_t size = cb->size(); + if (ASMJIT_UNLIKELY(n > std::numeric_limits::max() - size)) + return DebugUtils::errored(kErrorOutOfMemory); + + // We can now check if growing the buffer is really necessary. It's unlikely + // that this function is called while there is still room for `n` bytes. + size_t capacity = cb->capacity(); + size_t required = cb->size() + n; + if (ASMJIT_UNLIKELY(required <= capacity)) + return kErrorOk; + + if (cb->isFixed()) + return DebugUtils::errored(kErrorTooLarge); + + size_t kInitialCapacity = 8096; + if (capacity < kInitialCapacity) + capacity = kInitialCapacity; + else + capacity += Globals::kAllocOverhead; + + do { + size_t old = capacity; + if (capacity < Globals::kGrowThreshold) + capacity *= 2; + else + capacity += Globals::kGrowThreshold; + + // Overflow. + if (ASMJIT_UNLIKELY(old > capacity)) + return DebugUtils::errored(kErrorOutOfMemory); + } while (capacity - Globals::kAllocOverhead < required); + + return CodeHolder_reserveInternal(this, cb, capacity - Globals::kAllocOverhead); +} + +Error CodeHolder::reserveBuffer(CodeBuffer* cb, size_t n) noexcept { + size_t capacity = cb->capacity(); + if (n <= capacity) return kErrorOk; + + if (cb->isFixed()) + return DebugUtils::errored(kErrorTooLarge); + + return CodeHolder_reserveInternal(this, cb, n); +} + +// ============================================================================ +// [asmjit::CodeHolder - Sections] +// ============================================================================ + +Error CodeHolder::newSection(Section** sectionOut, const char* name, size_t nameSize, uint32_t flags, uint32_t alignment) noexcept { + *sectionOut = nullptr; + + if (nameSize == SIZE_MAX) + nameSize = strlen(name); + + if (alignment == 0) + alignment = 1; + + if (ASMJIT_UNLIKELY(!Support::isPowerOf2(alignment))) + return DebugUtils::errored(kErrorInvalidArgument); + + if (ASMJIT_UNLIKELY(nameSize > Globals::kMaxSectionNameSize)) + return DebugUtils::errored(kErrorInvalidSectionName); + + uint32_t sectionId = _sections.size(); + if (ASMJIT_UNLIKELY(sectionId == Globals::kInvalidId)) + return DebugUtils::errored(kErrorTooManySections); + + ASMJIT_PROPAGATE(_sections.willGrow(&_allocator)); + Section* section = _allocator.allocZeroedT
(); + + if (ASMJIT_UNLIKELY(!section)) + return DebugUtils::errored(kErrorOutOfMemory); + + section->_id = sectionId; + section->_flags = flags; + section->_alignment = alignment; + memcpy(section->_name.str, name, nameSize); + _sections.appendUnsafe(section); + + *sectionOut = section; + return kErrorOk; +} + +Section* CodeHolder::sectionByName(const char* name, size_t nameSize) const noexcept { + if (nameSize == SIZE_MAX) + nameSize = strlen(name); + + // This could be also put in a hash-table similarly like we do with labels, + // however it's questionable as the number of sections should be pretty low + // in general. Create an issue if this becomes a problem. + if (ASMJIT_UNLIKELY(nameSize <= Globals::kMaxSectionNameSize)) { + for (Section* section : _sections) + if (memcmp(section->_name.str, name, nameSize) == 0 && section->_name.str[nameSize] == '\0') + return section; + } + + return nullptr; +} + +Section* CodeHolder::ensureAddressTableSection() noexcept { + if (_addressTableSection) + return _addressTableSection; + + newSection(&_addressTableSection, CodeHolder_addrTabName, sizeof(CodeHolder_addrTabName) - 1, 0, _codeInfo.gpSize()); + return _addressTableSection; +} + +Error CodeHolder::addAddressToAddressTable(uint64_t address) noexcept { + AddressTableEntry* entry = _addressTableEntries.get(address); + if (entry) + return kErrorOk; + + Section* section = ensureAddressTableSection(); + if (ASMJIT_UNLIKELY(!section)) + return DebugUtils::errored(kErrorOutOfMemory); + + entry = _zone.newT(address); + if (ASMJIT_UNLIKELY(!entry)) + return DebugUtils::errored(kErrorOutOfMemory); + + _addressTableEntries.insert(entry); + section->_virtualSize += _codeInfo.gpSize(); + + return kErrorOk; +} + +// ============================================================================ +// [asmjit::CodeHolder - Labels / Symbols] +// ============================================================================ + +//! Only used to lookup a label from `_namedLabels`. +class LabelByName { +public: + inline LabelByName(const char* key, size_t keySize, uint32_t hashCode) noexcept + : _key(key), + _keySize(uint32_t(keySize)), + _hashCode(hashCode) {} + + inline uint32_t hashCode() const noexcept { return _hashCode; } + + inline bool matches(const LabelEntry* entry) const noexcept { + return entry->nameSize() == _keySize && ::memcmp(entry->name(), _key, _keySize) == 0; + } + + const char* _key; + uint32_t _keySize; + uint32_t _hashCode; +}; + +// Returns a hash of `name` and fixes `nameSize` if it's `SIZE_MAX`. +static uint32_t CodeHolder_hashNameAndGetSize(const char* name, size_t& nameSize) noexcept { + uint32_t hashCode = 0; + if (nameSize == SIZE_MAX) { + size_t i = 0; + for (;;) { + uint8_t c = uint8_t(name[i]); + if (!c) break; + hashCode = Support::hashRound(hashCode, c); + i++; + } + nameSize = i; + } + else { + for (size_t i = 0; i < nameSize; i++) { + uint8_t c = uint8_t(name[i]); + if (ASMJIT_UNLIKELY(!c)) return DebugUtils::errored(kErrorInvalidLabelName); + hashCode = Support::hashRound(hashCode, c); + } + } + return hashCode; +} + +static bool CodeHolder_writeDisplacement(void* dst, int64_t displacement, uint32_t displacementSize) { + if (displacementSize == 4 && Support::isInt32(displacement)) { + Support::writeI32uLE(dst, int32_t(displacement)); + return true; + } + else if (displacementSize == 1 && Support::isInt8(displacement)) { + Support::writeI8(dst, int8_t(displacement)); + return true; + } + + return false; +} + +LabelLink* CodeHolder::newLabelLink(LabelEntry* le, uint32_t sectionId, size_t offset, intptr_t rel) noexcept { + LabelLink* link = _allocator.allocT(); + if (ASMJIT_UNLIKELY(!link)) return nullptr; + + link->next = le->_links; + le->_links = link; + + link->sectionId = sectionId; + link->relocId = Globals::kInvalidId; + link->offset = offset; + link->rel = rel; + + _unresolvedLinkCount++; + return link; +} + +Error CodeHolder::newLabelEntry(LabelEntry** entryOut) noexcept { + *entryOut = 0; + + uint32_t labelId = _labelEntries.size(); + if (ASMJIT_UNLIKELY(labelId == Globals::kInvalidId)) + return DebugUtils::errored(kErrorTooManyLabels); + + ASMJIT_PROPAGATE(_labelEntries.willGrow(&_allocator)); + LabelEntry* le = _allocator.allocZeroedT(); + + if (ASMJIT_UNLIKELY(!le)) + return DebugUtils::errored(kErrorOutOfMemory); + + le->_setId(labelId); + le->_parentId = Globals::kInvalidId; + le->_offset = 0; + _labelEntries.appendUnsafe(le); + + *entryOut = le; + return kErrorOk; +} + +Error CodeHolder::newNamedLabelEntry(LabelEntry** entryOut, const char* name, size_t nameSize, uint32_t type, uint32_t parentId) noexcept { + *entryOut = 0; + uint32_t hashCode = CodeHolder_hashNameAndGetSize(name, nameSize); + + if (ASMJIT_UNLIKELY(nameSize == 0)) + return DebugUtils::errored(kErrorInvalidLabelName); + + if (ASMJIT_UNLIKELY(nameSize > Globals::kMaxLabelNameSize)) + return DebugUtils::errored(kErrorLabelNameTooLong); + + switch (type) { + case Label::kTypeLocal: + if (ASMJIT_UNLIKELY(parentId >= _labelEntries.size())) + return DebugUtils::errored(kErrorInvalidParentLabel); + + hashCode ^= parentId; + break; + + case Label::kTypeGlobal: + if (ASMJIT_UNLIKELY(parentId != Globals::kInvalidId)) + return DebugUtils::errored(kErrorNonLocalLabelCantHaveParent); + + break; + + default: + return DebugUtils::errored(kErrorInvalidArgument); + } + + // Don't allow to insert duplicates. Local labels allow duplicates that have + // different id, this is already accomplished by having a different hashes + // between the same label names having different parent labels. + LabelEntry* le = _namedLabels.get(LabelByName(name, nameSize, hashCode)); + if (ASMJIT_UNLIKELY(le)) + return DebugUtils::errored(kErrorLabelAlreadyDefined); + + Error err = kErrorOk; + uint32_t labelId = _labelEntries.size(); + + if (ASMJIT_UNLIKELY(labelId == Globals::kInvalidId)) + return DebugUtils::errored(kErrorTooManyLabels); + + ASMJIT_PROPAGATE(_labelEntries.willGrow(&_allocator)); + le = _allocator.allocZeroedT(); + + if (ASMJIT_UNLIKELY(!le)) + return DebugUtils::errored(kErrorOutOfMemory); + + le->_hashCode = hashCode; + le->_setId(labelId); + le->_type = uint8_t(type); + le->_parentId = Globals::kInvalidId; + le->_offset = 0; + ASMJIT_PROPAGATE(le->_name.setData(&_zone, name, nameSize)); + + _labelEntries.appendUnsafe(le); + _namedLabels.insert(allocator(), le); + + *entryOut = le; + return err; +} + +uint32_t CodeHolder::labelIdByName(const char* name, size_t nameSize, uint32_t parentId) noexcept { + // TODO: Finalize - parent id is not used here? + DebugUtils::unused(parentId); + + uint32_t hashCode = CodeHolder_hashNameAndGetSize(name, nameSize); + if (ASMJIT_UNLIKELY(!nameSize)) return 0; + + LabelEntry* le = _namedLabels.get(LabelByName(name, nameSize, hashCode)); + return le ? le->id() : uint32_t(Globals::kInvalidId); +} + +ASMJIT_API Error CodeHolder::resolveUnresolvedLinks() noexcept { + if (!hasUnresolvedLinks()) + return kErrorOk; + + Error err = kErrorOk; + for (LabelEntry* le : labelEntries()) { + if (!le->isBound()) + continue; + + LabelLinkIterator link(le); + if (link) { + Support::FastUInt8 of = 0; + Section* toSection = le->section(); + uint64_t toOffset = Support::addOverflow(toSection->offset(), le->offset(), &of); + + do { + uint32_t linkSectionId = link->sectionId; + if (link->relocId == Globals::kInvalidId) { + Section* fromSection = sectionById(linkSectionId); + size_t linkOffset = link->offset; + + CodeBuffer& buf = _sections[linkSectionId]->buffer(); + ASMJIT_ASSERT(linkOffset < buf.size()); + + // Calculate the offset relative to the start of the virtual base. + uint64_t fromOffset = Support::addOverflow(fromSection->offset(), linkOffset, &of); + int64_t displacement = int64_t(toOffset - fromOffset + uint64_t(int64_t(link->rel))); + + if (!of) { + ASMJIT_ASSERT(size_t(linkOffset) < buf.size()); + + // Size of the value we are going to patch. Only BYTE/DWORD is allowed. + uint32_t displacementSize = buf._data[linkOffset]; + ASMJIT_ASSERT(buf.size() - size_t(linkOffset) >= displacementSize); + + // Overwrite a real displacement in the CodeBuffer. + if (CodeHolder_writeDisplacement(buf._data + linkOffset, displacement, displacementSize)) { + link.resolveAndNext(this); + continue; + } + } + + err = DebugUtils::errored(kErrorInvalidDisplacement); + // Falls through to `link.next()`. + } + + link.next(); + } while (link); + } + } + + return err; +} + +ASMJIT_API Error CodeHolder::bindLabel(const Label& label, uint32_t toSectionId, uint64_t toOffset) noexcept { + LabelEntry* le = labelEntry(label); + if (ASMJIT_UNLIKELY(!le)) + return DebugUtils::errored(kErrorInvalidLabel); + + if (ASMJIT_UNLIKELY(toSectionId > _sections.size())) + return DebugUtils::errored(kErrorInvalidSection); + + // Label can be bound only once. + if (ASMJIT_UNLIKELY(le->isBound())) + return DebugUtils::errored(kErrorLabelAlreadyBound); + + // Bind the label. + Section* section = _sections[toSectionId]; + le->_section = section; + le->_offset = toOffset; + + Error err = kErrorOk; + CodeBuffer& buf = section->buffer(); + + // Fix all links to this label we have collected so far if they are within + // the same section. We ignore any inter-section links as these have to be + // fixed later. + LabelLinkIterator link(le); + while (link) { + uint32_t linkSectionId = link->sectionId; + size_t linkOffset = link->offset; + + uint32_t relocId = link->relocId; + if (relocId != Globals::kInvalidId) { + // Adjust relocation data only. + RelocEntry* re = _relocations[relocId]; + re->_payload += toOffset; + re->_targetSectionId = toSectionId; + } + else { + if (linkSectionId != toSectionId) { + link.next(); + continue; + } + + ASMJIT_ASSERT(linkOffset < buf.size()); + int64_t displacement = int64_t(toOffset - uint64_t(linkOffset) + uint64_t(int64_t(link->rel))); + + // Size of the value we are going to patch. Only BYTE/DWORD is allowed. + uint32_t displacementSize = buf._data[linkOffset]; + ASMJIT_ASSERT(buf.size() - size_t(linkOffset) >= displacementSize); + + // Overwrite a real displacement in the CodeBuffer. + if (!CodeHolder_writeDisplacement(buf._data + linkOffset, displacement, displacementSize)) { + err = DebugUtils::errored(kErrorInvalidDisplacement); + link.next(); + continue; + } + } + + link.resolveAndNext(this); + } + + return err; +} + +// ============================================================================ +// [asmjit::BaseEmitter - Relocations] +// ============================================================================ + +Error CodeHolder::newRelocEntry(RelocEntry** dst, uint32_t relocType, uint32_t valueSize) noexcept { + ASMJIT_PROPAGATE(_relocations.willGrow(&_allocator)); + + uint32_t relocId = _relocations.size(); + if (ASMJIT_UNLIKELY(relocId == Globals::kInvalidId)) + return DebugUtils::errored(kErrorTooManyRelocations); + + RelocEntry* re = _allocator.allocZeroedT(); + if (ASMJIT_UNLIKELY(!re)) + return DebugUtils::errored(kErrorOutOfMemory); + + re->_id = relocId; + re->_relocType = uint8_t(relocType); + re->_valueSize = uint8_t(valueSize); + re->_sourceSectionId = Globals::kInvalidId; + re->_targetSectionId = Globals::kInvalidId; + _relocations.appendUnsafe(re); + + *dst = re; + return kErrorOk; +} + +// ============================================================================ +// [asmjit::BaseEmitter - Expression Evaluation] +// ============================================================================ + +static Error CodeHolder_evaluateExpression(CodeHolder* self, Expression* exp, uint64_t* out) noexcept { + uint64_t value[2]; + for (size_t i = 0; i < 2; i++) { + uint64_t v; + switch (exp->valueType[i]) { + case Expression::kValueNone: { + v = 0; + break; + } + + case Expression::kValueConstant: { + v = exp->value[i].constant; + break; + } + + case Expression::kValueLabel: { + LabelEntry* le = exp->value[i].label; + if (!le->isBound()) + return DebugUtils::errored(kErrorExpressionLabelNotBound); + v = le->section()->offset() + le->offset(); + break; + } + + case Expression::kValueExpression: { + Expression* nested = exp->value[i].expression; + ASMJIT_PROPAGATE(CodeHolder_evaluateExpression(self, nested, &v)); + break; + } + + default: + return DebugUtils::errored(kErrorInvalidState); + } + + value[i] = v; + } + + uint64_t result; + uint64_t& a = value[0]; + uint64_t& b = value[1]; + + switch (exp->opType) { + case Expression::kOpAdd: + result = a + b; + break; + + case Expression::kOpSub: + result = a - b; + break; + + case Expression::kOpMul: + result = a * b; + break; + + case Expression::kOpSll: + result = (b > 63) ? uint64_t(0) : uint64_t(a << b); + break; + + case Expression::kOpSrl: + result = (b > 63) ? uint64_t(0) : uint64_t(a >> b); + break; + + case Expression::kOpSra: + result = Support::sar(a, Support::min(b, 63)); + break; + + default: + return DebugUtils::errored(kErrorInvalidState); + } + + *out = result; + return kErrorOk; +} + +// ============================================================================ +// [asmjit::BaseEmitter - Utilities] +// ============================================================================ + +Error CodeHolder::flatten() noexcept { + uint64_t offset = 0; + for (Section* section : _sections) { + uint64_t realSize = section->realSize(); + if (realSize) { + uint64_t alignedOffset = Support::alignUp(offset, section->alignment()); + if (ASMJIT_UNLIKELY(alignedOffset < offset)) + return DebugUtils::errored(kErrorTooLarge); + + Support::FastUInt8 of = 0; + offset = Support::addOverflow(alignedOffset, realSize, &of); + + if (ASMJIT_UNLIKELY(of)) + return DebugUtils::errored(kErrorTooLarge); + } + } + + // Now we know that we can assign offsets of all sections properly. + Section* prev = nullptr; + offset = 0; + for (Section* section : _sections) { + uint64_t realSize = section->realSize(); + if (realSize) + offset = Support::alignUp(offset, section->alignment()); + section->_offset = offset; + + // Make sure the previous section extends a bit to cover the alignment. + if (prev) + prev->_virtualSize = offset - prev->_offset; + + prev = section; + offset += realSize; + } + + return kErrorOk; +} + +size_t CodeHolder::codeSize() const noexcept { + Support::FastUInt8 of = 0; + uint64_t offset = 0; + + for (Section* section : _sections) { + uint64_t realSize = section->realSize(); + + if (realSize) { + uint64_t alignedOffset = Support::alignUp(offset, section->alignment()); + ASMJIT_ASSERT(alignedOffset >= offset); + offset = Support::addOverflow(alignedOffset, realSize, &of); + } + } + + // TODO: Not nice, maybe changing `codeSize()` to return `uint64_t` instead? + if ((sizeof(uint64_t) > sizeof(size_t) && offset > SIZE_MAX) || of) + return SIZE_MAX; + + return size_t(offset); +} + +Error CodeHolder::relocateToBase(uint64_t baseAddress) noexcept { + // Base address must be provided. + if (ASMJIT_UNLIKELY(baseAddress == Globals::kNoBaseAddress)) + return DebugUtils::errored(kErrorInvalidArgument); + + _codeInfo.setBaseAddress(baseAddress); + uint32_t gpSize = _codeInfo.gpSize(); + + Section* addressTableSection = _addressTableSection; + uint32_t addressTableEntryCount = 0; + uint8_t* addressTableEntryData = nullptr; + + if (addressTableSection) { + ASMJIT_PROPAGATE( + reserveBuffer(&addressTableSection->_buffer, size_t(addressTableSection->virtualSize()))); + addressTableEntryData = addressTableSection->_buffer.data(); + } + + // Relocate all recorded locations. + for (const RelocEntry* re : _relocations) { + // Possibly deleted or optimized-out entry. + if (re->relocType() == RelocEntry::kTypeNone) + continue; + + Section* sourceSection = sectionById(re->sourceSectionId()); + Section* targetSection = nullptr; + + if (re->targetSectionId() != Globals::kInvalidId) + targetSection = sectionById(re->targetSectionId()); + + uint64_t value = re->payload(); + uint64_t sectionOffset = sourceSection->offset(); + uint64_t sourceOffset = re->sourceOffset(); + + // Make sure that the `RelocEntry` doesn't go out of bounds. + size_t regionSize = re->leadingSize() + re->valueSize() + re->trailingSize(); + if (ASMJIT_UNLIKELY(re->sourceOffset() >= sourceSection->bufferSize() || + sourceSection->bufferSize() - size_t(re->sourceOffset()) < regionSize)) + return DebugUtils::errored(kErrorInvalidRelocEntry); + + uint8_t* buffer = sourceSection->data(); + size_t valueOffset = size_t(re->sourceOffset()) + re->leadingSize(); + + switch (re->relocType()) { + case RelocEntry::kTypeExpression: { + Expression* expression = (Expression*)(uintptr_t(value)); + ASMJIT_PROPAGATE(CodeHolder_evaluateExpression(this, expression, &value)); + break; + } + + case RelocEntry::kTypeAbsToAbs: { + break; + } + + case RelocEntry::kTypeRelToAbs: { + // Value is currently a relative offset from the start of its section. + // We have to convert it to an absolute offset (including base address). + if (ASMJIT_UNLIKELY(!targetSection)) + return DebugUtils::errored(kErrorInvalidRelocEntry); + + //value += baseAddress + sectionOffset + sourceOffset + regionSize; + value += baseAddress + targetSection->offset(); + break; + } + + case RelocEntry::kTypeAbsToRel: { + value -= baseAddress + sectionOffset + sourceOffset + regionSize; + if (gpSize > 4 && !Support::isInt32(int64_t(value))) + return DebugUtils::errored(kErrorRelocOffsetOutOfRange); + break; + } + + case RelocEntry::kTypeX64AddressEntry: { + if (re->valueSize() != 4 || re->leadingSize() < 2) + return DebugUtils::errored(kErrorInvalidRelocEntry); + + // First try whether a relative 32-bit displacement would work. + value -= baseAddress + sectionOffset + sourceOffset + regionSize; + if (!Support::isInt32(int64_t(value))) { + // Relative 32-bit displacement is not possible, use '.addrtab' section. + AddressTableEntry* atEntry = _addressTableEntries.get(re->payload()); + if (ASMJIT_UNLIKELY(!atEntry)) + return DebugUtils::errored(kErrorInvalidRelocEntry); + + // Cannot be null as we have just matched the `AddressTableEntry`. + ASMJIT_ASSERT(addressTableSection != nullptr); + + if (!atEntry->hasAssignedSlot()) + atEntry->_slot = addressTableEntryCount++; + + size_t atEntryIndex = size_t(atEntry->slot()) * gpSize; + uint64_t addrSrc = sectionOffset + sourceOffset + regionSize; + uint64_t addrDst = addressTableSection->offset() + uint64_t(atEntryIndex); + + value = addrDst - addrSrc; + if (!Support::isInt32(int64_t(value))) + return DebugUtils::errored(kErrorRelocOffsetOutOfRange); + + // Bytes that replace [REX, OPCODE] bytes. + uint32_t byte0 = 0xFF; + uint32_t byte1 = buffer[valueOffset - 1]; + + if (byte1 == 0xE8) { + // Patch CALL/MOD byte to FF /2 (-> 0x15). + byte1 = x86EncodeMod(0, 2, 5); + } + else if (byte1 == 0xE9) { + // Patch JMP/MOD byte to FF /4 (-> 0x25). + byte1 = x86EncodeMod(0, 4, 5); + } + else { + return DebugUtils::errored(kErrorInvalidRelocEntry); + } + + // Patch `jmp/call` instruction. + buffer[valueOffset - 2] = uint8_t(byte0); + buffer[valueOffset - 1] = uint8_t(byte1); + + Support::writeU64uLE(addressTableEntryData + atEntryIndex, re->payload()); + } + break; + } + + default: + return DebugUtils::errored(kErrorInvalidRelocEntry); + } + + switch (re->valueSize()) { + case 1: + Support::writeU8(buffer + valueOffset, uint32_t(value & 0xFFu)); + break; + + case 2: + Support::writeU16uLE(buffer + valueOffset, uint32_t(value & 0xFFFFu)); + break; + + case 4: + Support::writeU32uLE(buffer + valueOffset, uint32_t(value & 0xFFFFFFFFu)); + break; + + case 8: + Support::writeU64uLE(buffer + valueOffset, value); + break; + + default: + return DebugUtils::errored(kErrorInvalidRelocEntry); + } + } + + // Fixup the virtual size of the address table if it's the last section. + if (_sections.last() == addressTableSection) { + size_t addressTableSize = addressTableEntryCount * gpSize; + addressTableSection->_buffer._size = addressTableSize; + addressTableSection->_virtualSize = addressTableSize; + } + + return kErrorOk; +} + +Error CodeHolder::copySectionData(void* dst, size_t dstSize, uint32_t sectionId, uint32_t options) noexcept { + if (ASMJIT_UNLIKELY(!isSectionValid(sectionId))) + return DebugUtils::errored(kErrorInvalidSection); + + Section* section = sectionById(sectionId); + size_t bufferSize = section->bufferSize(); + + if (ASMJIT_UNLIKELY(dstSize < bufferSize)) + return DebugUtils::errored(kErrorInvalidArgument); + + memcpy(dst, section->data(), bufferSize); + + if (bufferSize < dstSize && (options & kCopyWithPadding)) { + size_t paddingSize = dstSize - bufferSize; + memset(static_cast(dst) + bufferSize, 0, paddingSize); + } + + return kErrorOk; +} + +Error CodeHolder::copyFlattenedData(void* dst, size_t dstSize, uint32_t options) noexcept { + size_t end = 0; + for (Section* section : _sections) { + if (section->offset() > dstSize) + return DebugUtils::errored(kErrorInvalidArgument); + + size_t bufferSize = section->bufferSize(); + size_t offset = size_t(section->offset()); + + if (ASMJIT_UNLIKELY(dstSize - offset < bufferSize)) + return DebugUtils::errored(kErrorInvalidArgument); + + uint8_t* dstTarget = static_cast(dst) + offset; + size_t paddingSize = 0; + memcpy(dstTarget, section->data(), bufferSize); + + if ((options & kCopyWithPadding) && bufferSize < section->virtualSize()) { + paddingSize = Support::min(dstSize - offset, size_t(section->virtualSize())) - bufferSize; + memset(dstTarget + bufferSize, 0, paddingSize); + } + + end = Support::max(end, offset + bufferSize + paddingSize); + } + + // TODO: `end` is not used atm, we need an option to also pad anything beyond + // the code in case that the destination was much larger (for example page-size). + + return kErrorOk; +} + +ASMJIT_END_NAMESPACE diff --git a/3rdparty/asmjit/src/asmjit/core/codeholder.h b/3rdparty/asmjit/src/asmjit/core/codeholder.h new file mode 100644 index 00000000000..5f6a21d6241 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/codeholder.h @@ -0,0 +1,930 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_CODEHOLDER_H_INCLUDED +#define ASMJIT_CORE_CODEHOLDER_H_INCLUDED + +#include "../core/arch.h" +#include "../core/datatypes.h" +#include "../core/operand.h" +#include "../core/string.h" +#include "../core/support.h" +#include "../core/target.h" +#include "../core/zone.h" +#include "../core/zonehash.h" +#include "../core/zonestring.h" +#include "../core/zonetree.h" +#include "../core/zonevector.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_core +//! \{ + +// ============================================================================ +// [Forward Declarations] +// ============================================================================ + +class BaseEmitter; +class CodeHolder; +class LabelEntry; +class Logger; + +// ============================================================================ +// [asmjit::AlignMode] +// ============================================================================ + +//! Align mode. +enum AlignMode : uint32_t { + kAlignCode = 0, //!< Align executable code. + kAlignData = 1, //!< Align non-executable code. + kAlignZero = 2, //!< Align by a sequence of zeros. + kAlignCount = 3 //!< Count of alignment modes. +}; + +// ============================================================================ +// [asmjit::ErrorHandler] +// ============================================================================ + +//! Error handler can be used to override the default behavior of error handling +//! available to all classes that inherit `BaseEmitter`. +//! +//! Override `ErrorHandler::handleError()` to implement your own error handler. +class ASMJIT_VIRTAPI ErrorHandler { +public: + ASMJIT_BASE_CLASS(ErrorHandler) + + // -------------------------------------------------------------------------- + // [Construction / Destruction] + // -------------------------------------------------------------------------- + + //! Creates a new `ErrorHandler` instance. + ASMJIT_API ErrorHandler() noexcept; + //! Destroys the `ErrorHandler` instance. + ASMJIT_API virtual ~ErrorHandler() noexcept; + + // -------------------------------------------------------------------------- + // [Handle Error] + // -------------------------------------------------------------------------- + + //! Error handler (must be reimplemented). + //! + //! Error handler is called after an error happened and before it's propagated + //! to the caller. There are multiple ways how the error handler can be used: + //! + //! 1. User-based error handling without throwing exception or using C's + //! `longjmp()`. This is for users that don't use exceptions and want + //! customized error handling. + //! + //! 2. Throwing an exception. AsmJit doesn't use exceptions and is completely + //! exception-safe, but you can throw exception from your error handler if + //! this way is the preferred way of handling errors in your project. + //! + //! 3. Using plain old C's `setjmp()` and `longjmp()`. Asmjit always puts + //! `BaseEmitter` to a consistent state before calling `handleError()` + //! so `longjmp()` can be used without any issues to cancel the code + //! generation if an error occurred. There is no difference between + //! exceptions and `longjmp()` from AsmJit's perspective, however, + //! never jump outside of `CodeHolder` and `BaseEmitter` scope as you + //! would leak memory. + virtual void handleError(Error err, const char* message, BaseEmitter* origin) = 0; +}; + +// ============================================================================ +// [asmjit::CodeBuffer] +// ============================================================================ + +//! Code or data buffer. +struct CodeBuffer { + //! The content of the buffer (data). + uint8_t* _data; + //! Number of bytes of `data` used. + size_t _size; + //! Buffer capacity (in bytes). + size_t _capacity; + //! Buffer flags. + uint32_t _flags; + + enum Flags : uint32_t { + //! Buffer is external (not allocated by asmjit). + kFlagIsExternal = 0x00000001u, + //! Buffer is fixed (cannot be reallocated). + kFlagIsFixed = 0x00000002u + }; + + //! \name Overloaded Operators + //! \{ + + inline uint8_t& operator[](size_t index) noexcept { + ASMJIT_ASSERT(index < _size); + return _data[index]; + } + + inline const uint8_t& operator[](size_t index) const noexcept { + ASMJIT_ASSERT(index < _size); + return _data[index]; + } + + //! \} + + //! \name Accessors + //! \{ + + inline uint32_t flags() const noexcept { return _flags; } + inline bool hasFlag(uint32_t flag) const noexcept { return (_flags & flag) != 0; } + + inline bool isAllocated() const noexcept { return _data != nullptr; } + inline bool isFixed() const noexcept { return hasFlag(kFlagIsFixed); } + inline bool isExternal() const noexcept { return hasFlag(kFlagIsExternal); } + + inline uint8_t* data() noexcept { return _data; } + inline const uint8_t* data() const noexcept { return _data; } + + inline bool empty() const noexcept { return !_size; } + inline size_t size() const noexcept { return _size; } + inline size_t capacity() const noexcept { return _capacity; } + + //! \} + + //! \name Iterators + //! \{ + + inline uint8_t* begin() noexcept { return _data; } + inline const uint8_t* begin() const noexcept { return _data; } + + inline uint8_t* end() noexcept { return _data + _size; } + inline const uint8_t* end() const noexcept { return _data + _size; } + + //! \} +}; + +// ============================================================================ +// [asmjit::Section] +// ============================================================================ + +//! Section entry. +class Section { +public: + //! Section id. + uint32_t _id; + //! Section flags. + uint32_t _flags; + //! Section alignment requirements (0 if no requirements). + uint32_t _alignment; + //! Reserved for future use (padding). + uint32_t _reserved; + //! Offset of this section from base-address. + uint64_t _offset; + //! Virtual size of the section (zero initialized sections). + uint64_t _virtualSize; + //! Section name (max 35 characters, PE allows max 8). + FixedString _name; + //! Code or data buffer. + CodeBuffer _buffer; + + //! Section flags. + enum Flags : uint32_t { + kFlagExec = 0x00000001u, //!< Executable (.text sections). + kFlagConst = 0x00000002u, //!< Read-only (.text and .data sections). + kFlagZero = 0x00000004u, //!< Zero initialized by the loader (BSS). + kFlagInfo = 0x00000008u, //!< Info / comment flag. + kFlagImplicit = 0x80000000u //!< Section created implicitly and can be deleted by `Target`. + }; + + //! \name Accessors + //! \{ + + inline uint32_t id() const noexcept { return _id; } + inline const char* name() const noexcept { return _name.str; } + + inline uint8_t* data() noexcept { return _buffer.data(); } + inline const uint8_t* data() const noexcept { return _buffer.data(); } + + inline uint32_t flags() const noexcept { return _flags; } + inline bool hasFlag(uint32_t flag) const noexcept { return (_flags & flag) != 0; } + inline void addFlags(uint32_t flags) noexcept { _flags |= flags; } + inline void clearFlags(uint32_t flags) noexcept { _flags &= ~flags; } + + inline uint32_t alignment() const noexcept { return _alignment; } + inline void setAlignment(uint32_t alignment) noexcept { _alignment = alignment; } + + inline uint64_t offset() const noexcept { return _offset; } + inline void setOffset(uint64_t offset) noexcept { _offset = offset; } + + //! Returns the virtual size of the section. + //! + //! Virtual size is initially zero and is never changed by AsmJit. It's normal + //! if virtual size is smaller than size returned by `bufferSize()` as the buffer + //! stores real data emitted by assemblers or appended by users. + //! + //! Use `realSize()` to get the real and final size of this section. + inline uint64_t virtualSize() const noexcept { return _virtualSize; } + //! Sets the virtual size of the section. + inline void setVirtualSize(uint64_t virtualSize) noexcept { _virtualSize = virtualSize; } + + //! Returns the buffer size of the section. + inline size_t bufferSize() const noexcept { return _buffer.size(); } + //! Returns the real size of the section calculated from virtual and buffer sizes. + inline uint64_t realSize() const noexcept { return Support::max(virtualSize(), bufferSize()); } + + //! Returns the `CodeBuffer` used by this section. + inline CodeBuffer& buffer() noexcept { return _buffer; } + //! Returns the `CodeBuffer` used by this section (const). + inline const CodeBuffer& buffer() const noexcept { return _buffer; } + + //! \} +}; + +// ============================================================================ +// [asmjit::LabelLink] +// ============================================================================ + +//! Data structure used to link either unbound labels or cross-section links. +struct LabelLink { + //! Next link (single-linked list). + LabelLink* next; + //! Section id where the label is bound. + uint32_t sectionId; + //! Relocation id or Globals::kInvalidId. + uint32_t relocId; + //! Label offset relative to the start of the section. + size_t offset; + //! Inlined rel8/rel32. + intptr_t rel; +}; + +// ============================================================================ +// [asmjit::Expression] +// ============================================================================ + +struct Expression { + enum OpType : uint8_t { + kOpAdd = 0, + kOpSub = 1, + kOpMul = 2, + kOpSll = 3, + kOpSrl = 4, + kOpSra = 5 + }; + + enum ValueType : uint8_t { + kValueNone = 0, + kValueConstant = 1, + kValueLabel = 2, + kValueExpression = 3 + }; + + union Value { + uint64_t constant; + Expression* expression; + LabelEntry* label; + }; + + uint8_t opType; + uint8_t valueType[2]; + uint8_t reserved[5]; + Value value[2]; + + inline void reset() noexcept { memset(this, 0, sizeof(*this)); } + + inline void setValueAsConstant(size_t index, uint64_t constant) noexcept { + valueType[index] = kValueConstant; + value[index].constant = constant; + } + + inline void setValueAsLabel(size_t index, LabelEntry* label) noexcept { + valueType[index] = kValueLabel; + value[index].label = label; + } + + inline void setValueAsExpression(size_t index, Expression* expression) noexcept { + valueType[index] = kValueLabel; + value[index].expression = expression; + } +}; + +// ============================================================================ +// [asmjit::LabelEntry] +// ============================================================================ + +//! Label entry. +//! +//! Contains the following properties: +//! * Label id - This is the only thing that is set to the `Label` operand. +//! * Label name - Optional, used mostly to create executables and libraries. +//! * Label type - Type of the label, default `Label::kTypeAnonymous`. +//! * Label parent id - Derived from many assemblers that allow to define a +//! local label that falls under a global label. This allows to define +//! many labels of the same name that have different parent (global) label. +//! * Offset - offset of the label bound by `Assembler`. +//! * Links - single-linked list that contains locations of code that has +//! to be patched when the label gets bound. Every use of unbound label +//! adds one link to `_links` list. +//! * HVal - Hash value of label's name and optionally parentId. +//! * HashNext - Hash-table implementation detail. +class LabelEntry : public ZoneHashNode { +public: + // Let's round the size of `LabelEntry` to 64 bytes (as `ZoneAllocator` has + // granularity of 32 bytes anyway). This gives `_name` the remaining space, + // which is should be 16 bytes on 64-bit and 28 bytes on 32-bit architectures. + static constexpr uint32_t kStaticNameSize = + 64 - (sizeof(ZoneHashNode) + 8 + sizeof(Section*) + sizeof(size_t) + sizeof(LabelLink*)); + + //! Label type, see `Label::LabelType`. + uint8_t _type; + //! Must be zero. + uint8_t _flags; + //! Reserved. + uint16_t _reserved16; + //! Label parent id or zero. + uint32_t _parentId; + //! Label offset relative to the start of the `_section`. + uint64_t _offset; + //! Section where the label was bound. + Section* _section; + //! Label links. + LabelLink* _links; + //! Label name. + ZoneString _name; + + //! \name Accessors + //! \{ + + // NOTE: Label id is stored in `_customData`, which is provided by ZoneHashNode + // to fill a padding that a C++ compiler targeting 64-bit CPU will add to align + // the structure to 64-bits. + + //! Returns label id. + inline uint32_t id() const noexcept { return _customData; } + //! Sets label id (internal, used only by `CodeHolder`). + inline void _setId(uint32_t id) noexcept { _customData = id; } + + //! Returns label type, see `Label::LabelType`. + inline uint32_t type() const noexcept { return _type; } + //! Returns label flags, returns 0 at the moment. + inline uint32_t flags() const noexcept { return _flags; } + + //! Tests whether the label has a parent label. + inline bool hasParent() const noexcept { return _parentId != Globals::kInvalidId; } + //! Returns label's parent id. + inline uint32_t parentId() const noexcept { return _parentId; } + + //! Returns the section where the label was bound. + //! + //! If the label was not yet bound the return value is `nullptr`. + inline Section* section() const noexcept { return _section; } + + //! Tests whether the label has name. + inline bool hasName() const noexcept { return !_name.empty(); } + + //! Returns the label's name. + //! + //! \note Local labels will return their local name without their parent + //! part, for example ".L1". + inline const char* name() const noexcept { return _name.data(); } + + //! Returns size of label's name. + //! + //! \note Label name is always null terminated, so you can use `strlen()` to + //! get it, however, it's also cached in `LabelEntry` itself, so if you want + //! to know the size the fastest way is to call `LabelEntry::nameSize()`. + inline uint32_t nameSize() const noexcept { return _name.size(); } + + //! Returns links associated with this label. + inline LabelLink* links() const noexcept { return _links; } + + //! Tests whether the label is bound. + inline bool isBound() const noexcept { return _section != nullptr; } + //! Tests whether the label is bound to a the given `sectionId`. + inline bool isBoundTo(Section* section) const noexcept { return _section == section; } + + //! Returns the label offset (only useful if the label is bound). + inline uint64_t offset() const noexcept { return _offset; } + + //! Returns the hash-value of label's name and its parent label (if any). + //! + //! Label hash is calculated as `HASH(Name) ^ ParentId`. The hash function + //! is implemented in `Support::hashString()` and `Support::hashRound()`. + inline uint32_t hashCode() const noexcept { return _hashCode; } + + //! \} +}; + +// ============================================================================ +// [asmjit::RelocEntry] +// ============================================================================ + +//! Relocation entry. +//! +//! We describe relocation data in the following way: +//! +//! ``` +//! +- Start of the buffer +- End of the data +//! | |*PATCHED*| | or instruction +//! |xxxxxxxxxxxxxxxxxxxxxx|LeadSize|ValueSize|TrailSize|xxxxxxxxxxxxxxxxxxxx-> +//! | +//! +- Source offset +//! ``` +struct RelocEntry { + //! Relocation id. + uint32_t _id; + //! Type of the relocation. + uint8_t _relocType; + //! Size of the relocation data/value (1, 2, 4 or 8 bytes). + uint8_t _valueSize; + //! Number of bytes after `_sourceOffset` to reach the value to be patched. + uint8_t _leadingSize; + //! Number of bytes after `_sourceOffset + _valueSize` to reach end of the + //! instruction. + uint8_t _trailingSize; + //! Source section id. + uint32_t _sourceSectionId; + //! Target section id. + uint32_t _targetSectionId; + //! Source offset (relative to start of the section). + uint64_t _sourceOffset; + //! Payload (target offset, target address, expression, etc). + uint64_t _payload; + + //! Relocation type. + enum RelocType : uint32_t { + //! None/deleted (no relocation). + kTypeNone = 0, + //! Expression evaluation, `_payload` is pointer to `Expression`. + kTypeExpression = 1, + //! Relocate absolute to absolute. + kTypeAbsToAbs = 2, + //! Relocate relative to absolute. + kTypeRelToAbs = 3, + //! Relocate absolute to relative. + kTypeAbsToRel = 4, + //! Relocate absolute to relative or use trampoline. + kTypeX64AddressEntry = 5 + }; + + //! \name Accessors + //! \{ + + inline uint32_t id() const noexcept { return _id; } + + inline uint32_t relocType() const noexcept { return _relocType; } + inline uint32_t valueSize() const noexcept { return _valueSize; } + + inline uint32_t leadingSize() const noexcept { return _leadingSize; } + inline uint32_t trailingSize() const noexcept { return _trailingSize; } + + inline uint32_t sourceSectionId() const noexcept { return _sourceSectionId; } + inline uint32_t targetSectionId() const noexcept { return _targetSectionId; } + + inline uint64_t sourceOffset() const noexcept { return _sourceOffset; } + inline uint64_t payload() const noexcept { return _payload; } + + Expression* payloadAsExpression() const noexcept { + return reinterpret_cast(uintptr_t(_payload)); + } + + //! \} +}; + +// ============================================================================ +// [asmjit::AddressTableEntry] +// ============================================================================ + +class AddressTableEntry : public ZoneTreeNodeT { +public: + ASMJIT_NONCOPYABLE(AddressTableEntry) + + uint64_t _address; + uint32_t _slot; + + //! \name Construction & Destruction + //! \{ + + inline explicit AddressTableEntry(uint64_t address) noexcept + : _address(address), + _slot(0xFFFFFFFFu) {} + + //! \} + + //! \name Accessors + //! \{ + + inline uint64_t address() const noexcept { return _address; } + inline uint32_t slot() const noexcept { return _slot; } + + inline bool hasAssignedSlot() const noexcept { return _slot != 0xFFFFFFFFu; } + + inline bool operator<(const AddressTableEntry& other) const noexcept { return _address < other._address; } + inline bool operator>(const AddressTableEntry& other) const noexcept { return _address > other._address; } + + inline bool operator<(uint64_t queryAddress) const noexcept { return _address < queryAddress; } + inline bool operator>(uint64_t queryAddress) const noexcept { return _address > queryAddress; } + + //! \} +}; + +// ============================================================================ +// [asmjit::CodeHolder] +// ============================================================================ + +//! Contains basic information about the target architecture plus its settings, +//! and holds code & data (including sections, labels, and relocation information). +//! CodeHolder can store both binary and intermediate representation of assembly, +//! which can be generated by `BaseAssembler` and/or `BaseBuilder`. +//! +//! \note `CodeHolder` has ability to attach an `ErrorHandler`, however, the +//! error handler is not triggered by `CodeHolder` itself, it's only used by +//! emitters attached to `CodeHolder`. +class CodeHolder { +public: + ASMJIT_NONCOPYABLE(CodeHolder) + + //! Basic information about the code (architecture and other info). + CodeInfo _codeInfo; + //! Emitter options, propagated to all emitters when changed. + uint32_t _emitterOptions; + + //! Attached `Logger`, used by all consumers. + Logger* _logger; + //! Attached `ErrorHandler`. + ErrorHandler* _errorHandler; + + //! Code zone (used to allocate core structures). + Zone _zone; + //! Zone allocator, used to manage internal containers. + ZoneAllocator _allocator; + + //! Attached code emitters. + ZoneVector _emitters; + //! Section entries. + ZoneVector _sections; + //! Label entries. + ZoneVector _labelEntries; + //! Relocation entries. + ZoneVector _relocations; + //! Label name -> LabelEntry (only named labels). + ZoneHash _namedLabels; + + //! Count of label links, which are not resolved. + size_t _unresolvedLinkCount; + //! Pointer to an address table section (or null if this section doesn't exist). + Section* _addressTableSection; + //! Address table entries. + ZoneTree _addressTableEntries; + + //! \name Construction & Destruction + //! \{ + + //! Creates an uninitialized CodeHolder (you must init() it before it can be used). + ASMJIT_API CodeHolder() noexcept; + //! Destroys the CodeHolder. + ASMJIT_API ~CodeHolder() noexcept; + + inline bool isInitialized() const noexcept { return _codeInfo.isInitialized(); } + + //! Initializes CodeHolder to hold code described by `codeInfo`. + ASMJIT_API Error init(const CodeInfo& info) noexcept; + //! Detaches all code-generators attached and resets the `CodeHolder`. + ASMJIT_API void reset(uint32_t resetPolicy = Globals::kResetSoft) noexcept; + + //! \} + + //! \name Attach & Detach + //! \{ + + //! Attaches an emitter to this `CodeHolder`. + ASMJIT_API Error attach(BaseEmitter* emitter) noexcept; + //! Detaches an emitter from this `CodeHolder`. + ASMJIT_API Error detach(BaseEmitter* emitter) noexcept; + + //! \} + + //! \name Allocators + //! \{ + + inline ZoneAllocator* allocator() const noexcept { return const_cast(&_allocator); } + + //! \} + + //! \name Code Emitter + //! \{ + + inline const ZoneVector& emitters() const noexcept { return _emitters; } + + //! Returns global emitter options, internally propagated to all attached emitters. + inline uint32_t emitterOptions() const noexcept { return _emitterOptions; } + + //! Enables the given global emitter `options` and propagates the resulting + //! options to all attached emitters. + ASMJIT_API void addEmitterOptions(uint32_t options) noexcept; + + //! Disables the given global emitter `options` and propagates the resulting + //! options to all attached emitters. + ASMJIT_API void clearEmitterOptions(uint32_t options) noexcept; + + //! \} + + //! \name Code & Architecture + //! \{ + + //! Returns the target architecture information, see `ArchInfo`. + inline const ArchInfo& archInfo() const noexcept { return _codeInfo.archInfo(); } + //! Returns the target code information, see `CodeInfo`. + inline const CodeInfo& codeInfo() const noexcept { return _codeInfo; } + + //! Returns the target architecture id. + inline uint32_t archId() const noexcept { return archInfo().archId(); } + //! Returns the target architecture sub-id. + inline uint32_t archSubId() const noexcept { return archInfo().archSubId(); } + + //! Tests whether a static base-address is set. + inline bool hasBaseAddress() const noexcept { return _codeInfo.hasBaseAddress(); } + //! Returns a static base-address (uint64_t). + inline uint64_t baseAddress() const noexcept { return _codeInfo.baseAddress(); } + + //! \} + + //! \name Logging & Error Handling + //! \{ + + //! Returns the attached logger. + inline Logger* logger() const noexcept { return _logger; } + //! Attaches a `logger` to CodeHolder and propagates it to all attached emitters. + ASMJIT_API void setLogger(Logger* logger) noexcept; + //! Resets the logger to none. + inline void resetLogger() noexcept { setLogger(nullptr); } + + //! Tests whether the global error handler is attached. + inline bool hasErrorHandler() const noexcept { return _errorHandler != nullptr; } + //! Returns the global error handler. + inline ErrorHandler* errorHandler() const noexcept { return _errorHandler; } + //! Sets the global error handler. + inline void setErrorHandler(ErrorHandler* handler) noexcept { _errorHandler = handler; } + //! Resets the global error handler to none. + inline void resetErrorHandler() noexcept { setErrorHandler(nullptr); } + + //! \} + + //! \name Code Buffer + //! \{ + + ASMJIT_API Error growBuffer(CodeBuffer* cb, size_t n) noexcept; + ASMJIT_API Error reserveBuffer(CodeBuffer* cb, size_t n) noexcept; + + //! \} + + //! \name Sections + //! \{ + + //! Returns an array of `Section*` records. + inline const ZoneVector& sections() const noexcept { return _sections; } + //! Returns the number of sections. + inline uint32_t sectionCount() const noexcept { return _sections.size(); } + + //! Tests whether the given `sectionId` is valid. + inline bool isSectionValid(uint32_t sectionId) const noexcept { return sectionId < _sections.size(); } + + //! Creates a new section and return its pointer in `sectionOut`. + //! + //! Returns `Error`, does not report a possible error to `ErrorHandler`. + ASMJIT_API Error newSection(Section** sectionOut, const char* name, size_t nameSize = SIZE_MAX, uint32_t flags = 0, uint32_t alignment = 1) noexcept; + + //! Returns a section entry of the given index. + inline Section* sectionById(uint32_t sectionId) const noexcept { return _sections[sectionId]; } + + //! Returns section-id that matches the given `name`. + //! + //! If there is no such section `Section::kInvalidId` is returned. + ASMJIT_API Section* sectionByName(const char* name, size_t nameSize = SIZE_MAX) const noexcept; + + //! Returns '.text' section (section that commonly represents code). + //! + //! \note Text section is always the first section in `CodeHolder::sections()` array. + inline Section* textSection() const noexcept { return _sections[0]; } + + //! Tests whether '.addrtab' section exists. + inline bool hasAddressTable() const noexcept { return _addressTableSection != nullptr; } + + //! Returns '.addrtab' section. + //! + //! This section is used exclusively by AsmJit to store absolute 64-bit + //! addresses that cannot be encoded in instructions like 'jmp' or 'call'. + inline Section* addressTableSection() const noexcept { return _addressTableSection; } + + //! Ensures that '.addrtab' section exists (creates it if it doesn't) and + //! returns it. Can return `nullptr` on out of memory condition. + ASMJIT_API Section* ensureAddressTableSection() noexcept; + + //! Used to add an address to an address table. + //! + //! This implicitly calls `ensureAddressTableSection()` and then creates + //! `AddressTableEntry` that is inserted to `_addressTableEntries`. If the + //! address already exists this operation does nothing as the same addresses + //! use the same slot. + //! + //! This function should be considered internal as it's used by assemblers to + //! insert an absolute address into the address table. Inserting address into + //! address table without creating a particula relocation entry makes no sense. + ASMJIT_API Error addAddressToAddressTable(uint64_t address) noexcept; + + //! \} + + //! \name Labels & Symbols + //! \{ + + //! Returns array of `LabelEntry*` records. + inline const ZoneVector& labelEntries() const noexcept { return _labelEntries; } + + //! Returns number of labels created. + inline uint32_t labelCount() const noexcept { return _labelEntries.size(); } + + //! Tests whether the label having `id` is valid (i.e. created by `newLabelEntry()`). + inline bool isLabelValid(uint32_t labelId) const noexcept { + return labelId < _labelEntries.size(); + } + + //! Tests whether the `label` is valid (i.e. created by `newLabelEntry()`). + inline bool isLabelValid(const Label& label) const noexcept { + return label.id() < _labelEntries.size(); + } + + //! \overload + inline bool isLabelBound(uint32_t labelId) const noexcept { + return isLabelValid(labelId) && _labelEntries[labelId]->isBound(); + } + + //! Tests whether the `label` is already bound. + //! + //! Returns `false` if the `label` is not valid. + inline bool isLabelBound(const Label& label) const noexcept { + return isLabelBound(label.id()); + } + + //! Returns LabelEntry of the given label `id`. + inline LabelEntry* labelEntry(uint32_t labelId) const noexcept { + return isLabelValid(labelId) ? _labelEntries[labelId] : static_cast(nullptr); + } + + //! Returns LabelEntry of the given `label`. + inline LabelEntry* labelEntry(const Label& label) const noexcept { + return labelEntry(label.id()); + } + + //! Returns offset of a `Label` by its `labelId`. + //! + //! The offset returned is relative to the start of the section. Zero offset + //! is returned for unbound labels, which is their initial offset value. + inline uint64_t labelOffset(uint32_t labelId) const noexcept { + ASMJIT_ASSERT(isLabelValid(labelId)); + return _labelEntries[labelId]->offset(); + } + + //! \overload + inline uint64_t labelOffset(const Label& label) const noexcept { + return labelOffset(label.id()); + } + + //! Returns offset of a label by it's `labelId` relative to the base offset. + //! + //! \remarks The offset of the section where the label is bound must be valid + //! in order to use this function, otherwise the value returned will not be + //! reliable. + inline uint64_t labelOffsetFromBase(uint32_t labelId) const noexcept { + ASMJIT_ASSERT(isLabelValid(labelId)); + const LabelEntry* le = _labelEntries[labelId]; + return (le->isBound() ? le->section()->offset() : uint64_t(0)) + le->offset(); + } + + //! \overload + inline uint64_t labelOffsetFromBase(const Label& label) const noexcept { + return labelOffsetFromBase(label.id()); + } + + //! Creates a new anonymous label and return its id in `idOut`. + //! + //! Returns `Error`, does not report error to `ErrorHandler`. + ASMJIT_API Error newLabelEntry(LabelEntry** entryOut) noexcept; + + //! Creates a new named label label-type `type`. + //! + //! Returns `Error`, does not report a possible error to `ErrorHandler`. + ASMJIT_API Error newNamedLabelEntry(LabelEntry** entryOut, const char* name, size_t nameSize, uint32_t type, uint32_t parentId = Globals::kInvalidId) noexcept; + + //! Returns a label id by name. + ASMJIT_API uint32_t labelIdByName(const char* name, size_t nameSize = SIZE_MAX, uint32_t parentId = Globals::kInvalidId) noexcept; + + inline Label labelByName(const char* name, size_t nameSize = SIZE_MAX, uint32_t parentId = Globals::kInvalidId) noexcept { + return Label(labelIdByName(name, nameSize, parentId)); + } + + //! Tests whether there are any unresolved label links. + inline bool hasUnresolvedLinks() const noexcept { return _unresolvedLinkCount != 0; } + //! Returns the number of label links, which are unresolved. + inline size_t unresolvedLinkCount() const noexcept { return _unresolvedLinkCount; } + + //! Creates a new label-link used to store information about yet unbound labels. + //! + //! Returns `null` if the allocation failed. + ASMJIT_API LabelLink* newLabelLink(LabelEntry* le, uint32_t sectionId, size_t offset, intptr_t rel) noexcept; + + //! Resolves cross-section links (`LabelLink`) associated with each label that + //! was used as a destination in code of a different section. It's only useful + //! to people that use multiple sections as it will do nothing if the code only + //! contains a single section in which cross-section links are not possible. + ASMJIT_API Error resolveUnresolvedLinks() noexcept; + + //! Binds a label to a given `sectionId` and `offset` (relative to start of the section). + //! + //! This function is generally used by `BaseAssembler::bind()` to do the heavy lifting. + ASMJIT_API Error bindLabel(const Label& label, uint32_t sectionId, uint64_t offset) noexcept; + + //! \} + + //! \name Relocations + //! \{ + + //! Tests whether the code contains relocation entries. + inline bool hasRelocEntries() const noexcept { return !_relocations.empty(); } + //! Returns array of `RelocEntry*` records. + inline const ZoneVector& relocEntries() const noexcept { return _relocations; } + + //! Returns a RelocEntry of the given `id`. + inline RelocEntry* relocEntry(uint32_t id) const noexcept { return _relocations[id]; } + + //! Creates a new relocation entry of type `relocType` and size `valueSize`. + //! + //! Additional fields can be set after the relocation entry was created. + ASMJIT_API Error newRelocEntry(RelocEntry** dst, uint32_t relocType, uint32_t valueSize) noexcept; + + //! \} + + //! \name Utilities + //! \{ + + //! Flattens all sections by recalculating their offsets, starting at 0. + //! + //! \note This should never be called more than once. + ASMJIT_API Error flatten() noexcept; + + //! Returns computed the size of code & data of all sections. + //! + //! \note All sections will be iterated over and the code size returned + //! would represent the minimum code size of all combined sections after + //! applying minimum alignment. Code size may decrease after calling + //! `flatten()` and `relocateToBase()`. + ASMJIT_API size_t codeSize() const noexcept; + + //! Relocates the code to the given `baseAddress`. + //! + //! \param baseAddress Absolute base address where the code will be relocated + //! to. Please note that nothing is copied to such base address, it's just an + //! absolute value used by the relocator to resolve all stored relocations. + //! + //! \note This should never be called more than once. + ASMJIT_API Error relocateToBase(uint64_t baseAddress) noexcept; + + //! Options that can be used with \ref copySectionData(). + enum CopyOptions : uint32_t { + //! If virtual size of the section is larger than the size of its buffer + //! then all bytes between buffer size and virtual size will be zeroed. + kCopyWithPadding = 0x1 + }; + + //! Copies a single section into `dst`. + ASMJIT_API Error copySectionData(void* dst, size_t dstSize, uint32_t sectionId, uint32_t options = 0) noexcept; + + //! Copies all sections into `dst`. + //! + //! This should only be used if the data was flattened and there are no gaps + //! between the sections. The `dstSize` is always checked and the copy will + //! never write anything outside the provided buffer. + ASMJIT_API Error copyFlattenedData(void* dst, size_t dstSize, uint32_t options = 0) noexcept; + + //! \} +}; + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_CODEHOLDER_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/compiler.cpp b/3rdparty/asmjit/src/asmjit/core/compiler.cpp new file mode 100644 index 00000000000..13dbf54300a --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/compiler.cpp @@ -0,0 +1,669 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#ifndef ASMJIT_NO_COMPILER + +#include "../core/assembler.h" +#include "../core/compiler.h" +#include "../core/cpuinfo.h" +#include "../core/logging.h" +#include "../core/rapass_p.h" +#include "../core/rastack_p.h" +#include "../core/support.h" +#include "../core/type.h" + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::GlobalConstPoolPass] +// ============================================================================ + +class GlobalConstPoolPass : public Pass { + ASMJIT_NONCOPYABLE(GlobalConstPoolPass) + typedef Pass Base; + + GlobalConstPoolPass() noexcept : Pass("GlobalConstPoolPass") {} + + Error run(Zone* zone, Logger* logger) noexcept override { + DebugUtils::unused(zone, logger); + + // Flush the global constant pool. + BaseCompiler* compiler = static_cast(_cb); + if (compiler->_globalConstPool) { + compiler->addAfter(compiler->_globalConstPool, compiler->lastNode()); + compiler->_globalConstPool = nullptr; + } + return kErrorOk; + } +}; + +// ============================================================================ +// [asmjit::FuncCallNode - Arg / Ret] +// ============================================================================ + +bool FuncCallNode::_setArg(uint32_t i, const Operand_& op) noexcept { + if ((i & ~kFuncArgHi) >= _funcDetail.argCount()) + return false; + + _args[i] = op; + return true; +} + +bool FuncCallNode::_setRet(uint32_t i, const Operand_& op) noexcept { + if (i >= 2) + return false; + + _rets[i] = op; + return true; +} + +// ============================================================================ +// [asmjit::BaseCompiler - Construction / Destruction] +// ============================================================================ + +BaseCompiler::BaseCompiler() noexcept + : BaseBuilder(), + _func(nullptr), + _vRegZone(4096 - Zone::kBlockOverhead), + _vRegArray(), + _localConstPool(nullptr), + _globalConstPool(nullptr) { + + _type = kTypeCompiler; +} +BaseCompiler::~BaseCompiler() noexcept {} + +// ============================================================================ +// [asmjit::BaseCompiler - Function API] +// ============================================================================ + +FuncNode* BaseCompiler::newFunc(const FuncSignature& sign) noexcept { + Error err; + + FuncNode* func = newNodeT(); + if (ASMJIT_UNLIKELY(!func)) { + reportError(DebugUtils::errored(kErrorOutOfMemory)); + return nullptr; + } + + err = registerLabelNode(func); + if (ASMJIT_UNLIKELY(err)) { + // TODO: Calls reportError, maybe rethink noexcept? + reportError(err); + return nullptr; + } + + // Create helper nodes. + func->_exitNode = newLabelNode(); + func->_end = newNodeT(SentinelNode::kSentinelFuncEnd); + + if (ASMJIT_UNLIKELY(!func->_exitNode || !func->_end)) { + reportError(DebugUtils::errored(kErrorOutOfMemory)); + return nullptr; + } + + // Initialize the function info. + err = func->detail().init(sign); + if (ASMJIT_UNLIKELY(err)) { + reportError(err); + return nullptr; + } + + // If the Target guarantees greater stack alignment than required by the + // calling convention then override it as we can prevent having to perform + // dynamic stack alignment + if (func->_funcDetail._callConv.naturalStackAlignment() < _codeInfo.stackAlignment()) + func->_funcDetail._callConv.setNaturalStackAlignment(_codeInfo.stackAlignment()); + + // Initialize the function frame. + err = func->_frame.init(func->_funcDetail); + if (ASMJIT_UNLIKELY(err)) { + reportError(err); + return nullptr; + } + + // Allocate space for function arguments. + func->_args = nullptr; + if (func->argCount() != 0) { + func->_args = _allocator.allocT(func->argCount() * sizeof(VirtReg*)); + if (ASMJIT_UNLIKELY(!func->_args)) { + reportError(DebugUtils::errored(kErrorOutOfMemory)); + return nullptr; + } + + memset(func->_args, 0, func->argCount() * sizeof(VirtReg*)); + } + + return func; +} + +FuncNode* BaseCompiler::addFunc(FuncNode* func) { + ASMJIT_ASSERT(_func == nullptr); + _func = func; + + addNode(func); // Function node. + BaseNode* prev = cursor(); // {CURSOR}. + addNode(func->exitNode()); // Function exit label. + addNode(func->endNode()); // Function end marker. + + _setCursor(prev); + return func; +} + +FuncNode* BaseCompiler::addFunc(const FuncSignature& sign) { + FuncNode* func = newFunc(sign); + + if (!func) { + reportError(DebugUtils::errored(kErrorOutOfMemory)); + return nullptr; + } + + return addFunc(func); +} + +Error BaseCompiler::endFunc() { + FuncNode* func = _func; + if (ASMJIT_UNLIKELY(!func)) + return reportError(DebugUtils::errored(kErrorInvalidState)); + + // Add the local constant pool at the end of the function (if exists). + if (_localConstPool) { + setCursor(func->endNode()->prev()); + addNode(_localConstPool); + _localConstPool = nullptr; + } + + // Mark as finished. + _func = nullptr; + + SentinelNode* end = func->endNode(); + setCursor(end); + return kErrorOk; +} + +Error BaseCompiler::setArg(uint32_t argIndex, const BaseReg& r) { + FuncNode* func = _func; + + if (ASMJIT_UNLIKELY(!func)) + return reportError(DebugUtils::errored(kErrorInvalidState)); + + if (ASMJIT_UNLIKELY(!isVirtRegValid(r))) + return reportError(DebugUtils::errored(kErrorInvalidVirtId)); + + VirtReg* vReg = virtRegByReg(r); + func->setArg(argIndex, vReg); + + return kErrorOk; +} + +FuncRetNode* BaseCompiler::newRet(const Operand_& o0, const Operand_& o1) noexcept { + FuncRetNode* node = newNodeT(); + if (!node) { + reportError(DebugUtils::errored(kErrorOutOfMemory)); + return nullptr; + } + + node->setOp(0, o0); + node->setOp(1, o1); + node->setOpCount(!o1.isNone() ? 2u : !o0.isNone() ? 1u : 0u); + + return node; +} + +FuncRetNode* BaseCompiler::addRet(const Operand_& o0, const Operand_& o1) noexcept { + FuncRetNode* node = newRet(o0, o1); + if (!node) return nullptr; + return addNode(node)->as(); +} + +// ============================================================================ +// [asmjit::BaseCompiler - Call] +// ============================================================================ + +FuncCallNode* BaseCompiler::newCall(uint32_t instId, const Operand_& o0, const FuncSignature& sign) noexcept { + FuncCallNode* node = newNodeT(instId, 0u); + if (ASMJIT_UNLIKELY(!node)) { + reportError(DebugUtils::errored(kErrorOutOfMemory)); + return nullptr; + } + + node->setOpCount(1); + node->setOp(0, o0); + node->resetOp(1); + node->resetOp(2); + node->resetOp(3); + + Error err = node->detail().init(sign); + if (ASMJIT_UNLIKELY(err)) { + reportError(err); + return nullptr; + } + + // If there are no arguments skip the allocation. + uint32_t nArgs = sign.argCount(); + if (!nArgs) return node; + + node->_args = static_cast(_allocator.alloc(nArgs * sizeof(Operand))); + if (!node->_args) { + reportError(DebugUtils::errored(kErrorOutOfMemory)); + return nullptr; + } + + memset(node->_args, 0, nArgs * sizeof(Operand)); + return node; +} + +FuncCallNode* BaseCompiler::addCall(uint32_t instId, const Operand_& o0, const FuncSignature& sign) noexcept { + FuncCallNode* node = newCall(instId, o0, sign); + if (!node) return nullptr; + return addNode(node)->as(); +} + +// ============================================================================ +// [asmjit::BaseCompiler - Vars] +// ============================================================================ + +static void BaseCompiler_assignGenericName(BaseCompiler* self, VirtReg* vReg) { + uint32_t index = unsigned(Operand::virtIdToIndex(vReg->_id)); + + char buf[64]; + int size = snprintf(buf, ASMJIT_ARRAY_SIZE(buf), "%%%u", unsigned(index)); + + ASMJIT_ASSERT(size > 0 && size < int(ASMJIT_ARRAY_SIZE(buf))); + vReg->_name.setData(&self->_dataZone, buf, unsigned(size)); +} + +VirtReg* BaseCompiler::newVirtReg(uint32_t typeId, uint32_t signature, const char* name) noexcept { + uint32_t index = _vRegArray.size(); + if (ASMJIT_UNLIKELY(index >= uint32_t(Operand::kVirtIdCount))) + return nullptr; + + if (_vRegArray.willGrow(&_allocator) != kErrorOk) + return nullptr; + + VirtReg* vReg = _vRegZone.allocZeroedT(); + if (ASMJIT_UNLIKELY(!vReg)) return nullptr; + + uint32_t size = Type::sizeOf(typeId); + uint32_t alignment = Support::min(size, 64); + + vReg = new(vReg) VirtReg(Operand::indexToVirtId(index), signature, size, alignment, typeId); + +#ifndef ASMJIT_NO_LOGGING + if (name && name[0] != '\0') + vReg->_name.setData(&_dataZone, name, SIZE_MAX); + else + BaseCompiler_assignGenericName(this, vReg); +#else + DebugUtils::unused(name); +#endif + + _vRegArray.appendUnsafe(vReg); + return vReg; +} + +Error BaseCompiler::_newReg(BaseReg& out, uint32_t typeId, const char* name) { + RegInfo regInfo; + + Error err = ArchUtils::typeIdToRegInfo(archId(), typeId, regInfo); + if (ASMJIT_UNLIKELY(err)) return reportError(err); + + VirtReg* vReg = newVirtReg(typeId, regInfo.signature(), name); + if (ASMJIT_UNLIKELY(!vReg)) { + out.reset(); + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + } + + out._initReg(regInfo.signature(), vReg->id()); + return kErrorOk; +} + +Error BaseCompiler::_newRegFmt(BaseReg& out, uint32_t typeId, const char* fmt, ...) { + va_list ap; + StringTmp<256> sb; + + va_start(ap, fmt); + sb.appendVFormat(fmt, ap); + va_end(ap); + + return _newReg(out, typeId, sb.data()); +} + +Error BaseCompiler::_newReg(BaseReg& out, const BaseReg& ref, const char* name) { + RegInfo regInfo; + uint32_t typeId; + + if (isVirtRegValid(ref)) { + VirtReg* vRef = virtRegByReg(ref); + typeId = vRef->typeId(); + + // NOTE: It's possible to cast one register type to another if it's the + // same register group. However, VirtReg always contains the TypeId that + // was used to create the register. This means that in some cases we may + // end up having different size of `ref` and `vRef`. In such case we + // adjust the TypeId to match the `ref` register type instead of the + // original register type, which should be the expected behavior. + uint32_t typeSize = Type::sizeOf(typeId); + uint32_t refSize = ref.size(); + + if (typeSize != refSize) { + if (Type::isInt(typeId)) { + // GP register - change TypeId to match `ref`, but keep sign of `vRef`. + switch (refSize) { + case 1: typeId = Type::kIdI8 | (typeId & 1); break; + case 2: typeId = Type::kIdI16 | (typeId & 1); break; + case 4: typeId = Type::kIdI32 | (typeId & 1); break; + case 8: typeId = Type::kIdI64 | (typeId & 1); break; + default: typeId = Type::kIdVoid; break; + } + } + else if (Type::isMmx(typeId)) { + // MMX register - always use 64-bit. + typeId = Type::kIdMmx64; + } + else if (Type::isMask(typeId)) { + // Mask register - change TypeId to match `ref` size. + switch (refSize) { + case 1: typeId = Type::kIdMask8; break; + case 2: typeId = Type::kIdMask16; break; + case 4: typeId = Type::kIdMask32; break; + case 8: typeId = Type::kIdMask64; break; + default: typeId = Type::kIdVoid; break; + } + } + else { + // VEC register - change TypeId to match `ref` size, keep vector metadata. + uint32_t elementTypeId = Type::baseOf(typeId); + + switch (refSize) { + case 16: typeId = Type::_kIdVec128Start + (elementTypeId - Type::kIdI8); break; + case 32: typeId = Type::_kIdVec256Start + (elementTypeId - Type::kIdI8); break; + case 64: typeId = Type::_kIdVec512Start + (elementTypeId - Type::kIdI8); break; + default: typeId = Type::kIdVoid; break; + } + } + + if (typeId == Type::kIdVoid) + return reportError(DebugUtils::errored(kErrorInvalidState)); + } + } + else { + typeId = ref.type(); + } + + Error err = ArchUtils::typeIdToRegInfo(archId(), typeId, regInfo); + if (ASMJIT_UNLIKELY(err)) return reportError(err); + + VirtReg* vReg = newVirtReg(typeId, regInfo.signature(), name); + if (ASMJIT_UNLIKELY(!vReg)) { + out.reset(); + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + } + + out._initReg(regInfo.signature(), vReg->id()); + return kErrorOk; +} + +Error BaseCompiler::_newRegFmt(BaseReg& out, const BaseReg& ref, const char* fmt, ...) { + va_list ap; + StringTmp<256> sb; + + va_start(ap, fmt); + sb.appendVFormat(fmt, ap); + va_end(ap); + + return _newReg(out, ref, sb.data()); +} + +Error BaseCompiler::_newStack(BaseMem& out, uint32_t size, uint32_t alignment, const char* name) { + if (size == 0) + return reportError(DebugUtils::errored(kErrorInvalidArgument)); + + if (alignment == 0) + alignment = 1; + + if (!Support::isPowerOf2(alignment)) + return reportError(DebugUtils::errored(kErrorInvalidArgument)); + + if (alignment > 64) + alignment = 64; + + VirtReg* vReg = newVirtReg(0, 0, name); + if (ASMJIT_UNLIKELY(!vReg)) { + out.reset(); + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + } + + vReg->_virtSize = size; + vReg->_isStack = true; + vReg->_alignment = uint8_t(alignment); + + // Set the memory operand to GPD/GPQ and its id to VirtReg. + out = BaseMem(BaseMem::Decomposed { _gpRegInfo.type(), vReg->id(), BaseReg::kTypeNone, 0, 0, 0, BaseMem::kSignatureMemRegHomeFlag }); + return kErrorOk; +} + +Error BaseCompiler::setStackSize(uint32_t virtId, uint32_t newSize, uint32_t newAlignment) noexcept { + if (!isVirtIdValid(virtId)) + return DebugUtils::errored(kErrorInvalidVirtId); + + if (newAlignment && !Support::isPowerOf2(newAlignment)) + return reportError(DebugUtils::errored(kErrorInvalidArgument)); + + if (newAlignment > 64) + newAlignment = 64; + + VirtReg* vReg = virtRegById(virtId); + if (newSize) + vReg->_virtSize = newSize; + + if (newAlignment) + vReg->_alignment = uint8_t(newAlignment); + + // This is required if the RAPass is already running. There is a chance that + // a stack-slot has been already allocated and in that case it has to be + // updated as well, otherwise we would allocate wrong amount of memory. + RAWorkReg* workReg = vReg->_workReg; + if (workReg && workReg->_stackSlot) { + workReg->_stackSlot->_size = vReg->_virtSize; + workReg->_stackSlot->_alignment = vReg->_alignment; + } + + return kErrorOk; +} + +Error BaseCompiler::_newConst(BaseMem& out, uint32_t scope, const void* data, size_t size) { + ConstPoolNode** pPool; + if (scope == ConstPool::kScopeLocal) + pPool = &_localConstPool; + else if (scope == ConstPool::kScopeGlobal) + pPool = &_globalConstPool; + else + return reportError(DebugUtils::errored(kErrorInvalidArgument)); + + ConstPoolNode* pool = *pPool; + if (!pool) { + pool = newConstPoolNode(); + if (ASMJIT_UNLIKELY(!pool)) + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + *pPool = pool; + } + + size_t off; + Error err = pool->add(data, size, off); + + if (ASMJIT_UNLIKELY(err)) + return reportError(err); + + out = BaseMem(BaseMem::Decomposed { + Label::kLabelTag, // Base type. + pool->id(), // Base id. + 0, // Index type. + 0, // Index id. + int32_t(off), // Offset. + uint32_t(size), // Size. + 0 // Flags. + }); + return kErrorOk; +} + +void BaseCompiler::rename(const BaseReg& reg, const char* fmt, ...) { + if (!reg.isVirtReg()) return; + + VirtReg* vReg = virtRegById(reg.id()); + if (!vReg) return; + + if (fmt && fmt[0] != '\0') { + char buf[128]; + va_list ap; + + va_start(ap, fmt); + vsnprintf(buf, ASMJIT_ARRAY_SIZE(buf), fmt, ap); + va_end(ap); + + vReg->_name.setData(&_dataZone, buf, SIZE_MAX); + } + else { + BaseCompiler_assignGenericName(this, vReg); + } +} + +// ============================================================================ +// [asmjit::BaseCompiler - Jump Annotations] +// ============================================================================ + +JumpNode* BaseCompiler::newJumpNode(uint32_t instId, uint32_t instOptions, const Operand_& o0, JumpAnnotation* annotation) noexcept { + uint32_t opCount = 1; + JumpNode* node = _allocator.allocT(); + if (ASMJIT_UNLIKELY(!node)) + return nullptr; + + node = new(node) JumpNode(this, instId, instOptions, opCount, annotation); + node->setOp(0, o0); + node->resetOps(opCount, JumpNode::kBaseOpCapacity); + return node; +} + +Error BaseCompiler::emitAnnotatedJump(uint32_t instId, const Operand_& o0, JumpAnnotation* annotation) { + uint32_t options = instOptions() | globalInstOptions(); + const char* comment = inlineComment(); + + JumpNode* node = newJumpNode(instId, options, o0, annotation); + + resetInstOptions(); + resetInlineComment(); + + if (ASMJIT_UNLIKELY(!node)) { + resetExtraReg(); + return reportError(DebugUtils::errored(kErrorOutOfMemory)); + } + + node->setExtraReg(extraReg()); + if (comment) + node->setInlineComment(static_cast(_dataZone.dup(comment, strlen(comment), true))); + + addNode(node); + resetExtraReg(); + return kErrorOk; +} + +JumpAnnotation* BaseCompiler::newJumpAnnotation() { + if (_jumpAnnotations.grow(&_allocator, 1) != kErrorOk) { + reportError(DebugUtils::errored(kErrorOutOfMemory)); + return nullptr; + } + + uint32_t id = _jumpAnnotations.size(); + JumpAnnotation* jumpAnnotation = _allocator.newT(this, id); + + if (!jumpAnnotation) { + reportError(DebugUtils::errored(kErrorOutOfMemory)); + return nullptr; + } + + _jumpAnnotations.appendUnsafe(jumpAnnotation); + return jumpAnnotation; +} + +// ============================================================================ +// [asmjit::BaseCompiler - Events] +// ============================================================================ + +Error BaseCompiler::onAttach(CodeHolder* code) noexcept { + ASMJIT_PROPAGATE(Base::onAttach(code)); + + Error err = addPassT(); + if (ASMJIT_UNLIKELY(err)) { + onDetach(code); + return err; + } + + return kErrorOk; +} + +Error BaseCompiler::onDetach(CodeHolder* code) noexcept { + _func = nullptr; + _localConstPool = nullptr; + _globalConstPool = nullptr; + + _vRegArray.reset(); + _vRegZone.reset(); + + return Base::onDetach(code); +} + +// ============================================================================ +// [asmjit::FuncPass - Construction / Destruction] +// ============================================================================ + +FuncPass::FuncPass(const char* name) noexcept + : Pass(name) {} + +// ============================================================================ +// [asmjit::FuncPass - Run] +// ============================================================================ + +Error FuncPass::run(Zone* zone, Logger* logger) noexcept { + BaseNode* node = cb()->firstNode(); + if (!node) return kErrorOk; + + do { + if (node->type() == BaseNode::kNodeFunc) { + FuncNode* func = node->as(); + node = func->endNode(); + ASMJIT_PROPAGATE(runOnFunction(zone, logger, func)); + } + + // Find a function by skipping all nodes that are not `kNodeFunc`. + do { + node = node->next(); + } while (node && node->type() != BaseNode::kNodeFunc); + } while (node); + + return kErrorOk; +} + +ASMJIT_END_NAMESPACE + +#endif // !ASMJIT_NO_COMPILER diff --git a/3rdparty/asmjit/src/asmjit/core/compiler.h b/3rdparty/asmjit/src/asmjit/core/compiler.h new file mode 100644 index 00000000000..32b2a8bb271 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/compiler.h @@ -0,0 +1,674 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_COMPILER_H_INCLUDED +#define ASMJIT_CORE_COMPILER_H_INCLUDED + +#include "../core/api-config.h" +#ifndef ASMJIT_NO_COMPILER + +#include "../core/assembler.h" +#include "../core/builder.h" +#include "../core/constpool.h" +#include "../core/func.h" +#include "../core/inst.h" +#include "../core/operand.h" +#include "../core/support.h" +#include "../core/zone.h" +#include "../core/zonevector.h" + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [Forward Declarations] +// ============================================================================ + +struct RATiedReg; +class RAWorkReg; + +class JumpAnnotation; + +class JumpNode; +class FuncNode; +class FuncRetNode; +class FuncCallNode; + +//! \addtogroup asmjit_compiler +//! \{ + +// ============================================================================ +// [asmjit::VirtReg] +// ============================================================================ + +//! Virtual register data (BaseCompiler). +class VirtReg { +public: + ASMJIT_NONCOPYABLE(VirtReg) + + //! Virtual register id. + uint32_t _id; + //! Virtual register info (signature). + RegInfo _info; + //! Virtual register size (can be smaller than `regInfo._size`). + uint32_t _virtSize; + //! Virtual register alignment (for spilling). + uint8_t _alignment; + //! Type-id. + uint8_t _typeId; + //! Virtual register weight for alloc/spill decisions. + uint8_t _weight; + //! True if this is a fixed register, never reallocated. + uint8_t _isFixed : 1; + //! True if the virtual register is only used as a stack (never accessed as register). + uint8_t _isStack : 1; + uint8_t _reserved : 6; + + //! Virtual register name (user provided or automatically generated). + ZoneString<16> _name; + + // ------------------------------------------------------------------------- + // The following members are used exclusively by RAPass. They are initialized + // when the VirtReg is created to NULL pointers and then changed during RAPass + // execution. RAPass sets them back to NULL before it returns. + // ------------------------------------------------------------------------- + + //! Reference to `RAWorkReg`, used during register allocation. + RAWorkReg* _workReg; + + //! \name Construction & Destruction + //! \{ + + inline VirtReg(uint32_t id, uint32_t signature, uint32_t virtSize, uint32_t alignment, uint32_t typeId) noexcept + : _id(id), + _virtSize(virtSize), + _alignment(uint8_t(alignment)), + _typeId(uint8_t(typeId)), + _weight(1), + _isFixed(false), + _isStack(false), + _reserved(0), + _name(), + _workReg(nullptr) { _info._signature = signature; } + + //! \} + + //! \name Accessors + //! \{ + + //! Returns the virtual register id. + inline uint32_t id() const noexcept { return _id; } + + //! Returns the virtual register name. + inline const char* name() const noexcept { return _name.data(); } + //! Returns the size of the virtual register name. + inline uint32_t nameSize() const noexcept { return _name.size(); } + + //! Returns a register information that wraps the register signature. + inline const RegInfo& info() const noexcept { return _info; } + //! Returns a virtual register type (maps to the physical register type as well). + inline uint32_t type() const noexcept { return _info.type(); } + //! Returns a virtual register group (maps to the physical register group as well). + inline uint32_t group() const noexcept { return _info.group(); } + + //! Returns a real size of the register this virtual register maps to. + //! + //! For example if this is a 128-bit SIMD register used for a scalar single + //! precision floating point value then its virtSize would be 4, however, the + //! `regSize` would still say 16 (128-bits), because it's the smallest size + //! of that register type. + inline uint32_t regSize() const noexcept { return _info.size(); } + + //! Returns a register signature of this virtual register. + inline uint32_t signature() const noexcept { return _info.signature(); } + + //! Returns the virtual register size. + //! + //! The virtual register size describes how many bytes the virtual register + //! needs to store its content. It can be smaller than the physical register + //! size, see `regSize()`. + inline uint32_t virtSize() const noexcept { return _virtSize; } + + //! Returns the virtual register alignment. + inline uint32_t alignment() const noexcept { return _alignment; } + + //! Returns the virtual register type id, see `Type::Id`. + inline uint32_t typeId() const noexcept { return _typeId; } + + //! Returns the virtual register weight - the register allocator can use it + //! as explicit hint for alloc/spill decisions. + inline uint32_t weight() const noexcept { return _weight; } + //! Sets the virtual register weight (0 to 255) - the register allocator can + //! use it as explicit hint for alloc/spill decisions and initial bin-packing. + inline void setWeight(uint32_t weight) noexcept { _weight = uint8_t(weight); } + + //! Returns whether the virtual register is always allocated to a fixed + //! physical register (and never reallocated). + //! + //! \note This is only used for special purposes and it's mostly internal. + inline bool isFixed() const noexcept { return bool(_isFixed); } + + //! Returns whether the virtual register is indeed a stack that only uses + //! the virtual register id for making it accessible. + //! + //! \note It's an error if a stack is accessed as a register. + inline bool isStack() const noexcept { return bool(_isStack); } + + inline bool hasWorkReg() const noexcept { return _workReg != nullptr; } + inline RAWorkReg* workReg() const noexcept { return _workReg; } + inline void setWorkReg(RAWorkReg* workReg) noexcept { _workReg = workReg; } + inline void resetWorkReg() noexcept { _workReg = nullptr; } + + //! \} +}; + +// ============================================================================ +// [asmjit::BaseCompiler] +// ============================================================================ + +//! Code emitter that uses virtual registers and performs register allocation. +//! +//! Compiler is a high-level code-generation tool that provides register +//! allocation and automatic handling of function calling conventions. It was +//! primarily designed for merging multiple parts of code into a function +//! without worrying about registers and function calling conventions. +//! +//! BaseCompiler can be used, with a minimum effort, to handle 32-bit and 64-bit +//! code at the same time. +//! +//! BaseCompiler is based on BaseBuilder and contains all the features it +//! provides. It means that the code it stores can be modified (removed, added, +//! injected) and analyzed. When the code is finalized the compiler can emit +//! the code into an Assembler to translate the abstract representation into a +//! machine code. +class ASMJIT_VIRTAPI BaseCompiler : public BaseBuilder { +public: + ASMJIT_NONCOPYABLE(BaseCompiler) + typedef BaseBuilder Base; + + //! Current function. + FuncNode* _func; + //! Allocates `VirtReg` objects. + Zone _vRegZone; + //! Stores array of `VirtReg` pointers. + ZoneVector _vRegArray; + //! Stores jump annotations. + ZoneVector _jumpAnnotations; + + //! Local constant pool, flushed at the end of each function. + ConstPoolNode* _localConstPool; + //! Global constant pool, flushed by `finalize()`. + ConstPoolNode* _globalConstPool; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `BaseCompiler` instance. + ASMJIT_API BaseCompiler() noexcept; + //! Destroys the `BaseCompiler` instance. + ASMJIT_API virtual ~BaseCompiler() noexcept; + + //! \} + + //! \name Function API + //! \{ + + //! Returns the current function. + inline FuncNode* func() const noexcept { return _func; } + + //! Creates a new `FuncNode`. + ASMJIT_API FuncNode* newFunc(const FuncSignature& sign) noexcept; + //! Adds a function `node` to the stream. + ASMJIT_API FuncNode* addFunc(FuncNode* func); + //! Adds a new function. + ASMJIT_API FuncNode* addFunc(const FuncSignature& sign); + //! Emits a sentinel that marks the end of the current function. + ASMJIT_API Error endFunc(); + + //! Sets a function argument at `argIndex` to `reg`. + ASMJIT_API Error setArg(uint32_t argIndex, const BaseReg& reg); + + //! Creates a new `FuncRetNode`. + ASMJIT_API FuncRetNode* newRet(const Operand_& o0, const Operand_& o1) noexcept; + //! Adds a new `FuncRetNode`. + ASMJIT_API FuncRetNode* addRet(const Operand_& o0, const Operand_& o1) noexcept; + + //! \} + + //! \name Function Calls + //! \{ + + //! Creates a new `FuncCallNode`. + ASMJIT_API FuncCallNode* newCall(uint32_t instId, const Operand_& o0, const FuncSignature& sign) noexcept; + //! Adds a new `FuncCallNode`. + ASMJIT_API FuncCallNode* addCall(uint32_t instId, const Operand_& o0, const FuncSignature& sign) noexcept; + + //! \} + + //! \name Virtual Registers + //! \{ + + //! Creates a new virtual register representing the given `typeId` and `signature`. + ASMJIT_API VirtReg* newVirtReg(uint32_t typeId, uint32_t signature, const char* name) noexcept; + + ASMJIT_API Error _newReg(BaseReg& out, uint32_t typeId, const char* name = nullptr); + ASMJIT_API Error _newRegFmt(BaseReg& out, uint32_t typeId, const char* fmt, ...); + + ASMJIT_API Error _newReg(BaseReg& out, const BaseReg& ref, const char* name = nullptr); + ASMJIT_API Error _newRegFmt(BaseReg& out, const BaseReg& ref, const char* fmt, ...); + + //! Tests whether the given `id` is a valid virtual register id. + inline bool isVirtIdValid(uint32_t id) const noexcept { + uint32_t index = Operand::virtIdToIndex(id); + return index < _vRegArray.size(); + } + //! Tests whether the given `reg` is a virtual register having a valid id. + inline bool isVirtRegValid(const BaseReg& reg) const noexcept { + return isVirtIdValid(reg.id()); + } + + //! Returns `VirtReg` associated with the given `id`. + inline VirtReg* virtRegById(uint32_t id) const noexcept { + ASMJIT_ASSERT(isVirtIdValid(id)); + return _vRegArray[Operand::virtIdToIndex(id)]; + } + //! Returns `VirtReg` associated with the given `reg`. + inline VirtReg* virtRegByReg(const BaseReg& reg) const noexcept { return virtRegById(reg.id()); } + //! Returns `VirtReg` associated with the given `index`. + inline VirtReg* virtRegByIndex(uint32_t index) const noexcept { return _vRegArray[index]; } + + //! Returns an array of all virtual registers managed by the Compiler. + inline const ZoneVector& virtRegs() const noexcept { return _vRegArray; } + + //! \name Stack + //! \{ + + ASMJIT_API Error _newStack(BaseMem& out, uint32_t size, uint32_t alignment, const char* name = nullptr); + + //! Updates the stack size of a stack created by `_newStack()` by its `virtId`. + ASMJIT_API Error setStackSize(uint32_t virtId, uint32_t newSize, uint32_t newAlignment = 0) noexcept; + + //! Updates the stack size of a stack created by `_newStack()`. + inline Error setStackSize(const BaseMem& mem, uint32_t newSize, uint32_t newAlignment = 0) noexcept { + return setStackSize(mem.id(), newSize, newAlignment); + } + + //! \} + + //! \name Constants + //! \{ + + ASMJIT_API Error _newConst(BaseMem& out, uint32_t scope, const void* data, size_t size); + + //! \} + + //! \name Miscellaneous + //! \{ + + //! Rename the given virtual register `reg` to a formatted string `fmt`. + //! + //! \note Only new name will appear in the logger. + ASMJIT_API void rename(const BaseReg& reg, const char* fmt, ...); + + //! \} + + //! \name Jump Annotations + //! \{ + + inline const ZoneVector& jumpAnnotations() const noexcept { + return _jumpAnnotations; + } + + ASMJIT_API JumpNode* newJumpNode(uint32_t instId, uint32_t instOptions, const Operand_& o0, JumpAnnotation* annotation) noexcept; + ASMJIT_API Error emitAnnotatedJump(uint32_t instId, const Operand_& o0, JumpAnnotation* annotation); + + //! Returns a new `JumpAnnotation` instance, which can be used to aggregate + //! possible targets of a jump where the target is not a label, for example + //! to implement jump tables. + ASMJIT_API JumpAnnotation* newJumpAnnotation(); + + //! \} + + // TODO: These should be removed + inline void alloc(BaseReg& reg) { DebugUtils::unused(reg); } + inline void spill(BaseReg& reg) { DebugUtils::unused(reg); } + + //! \name Events + //! \{ + + ASMJIT_API Error onAttach(CodeHolder* code) noexcept override; + ASMJIT_API Error onDetach(CodeHolder* code) noexcept override; + + //! \} +}; + +// ============================================================================ +// [asmjit::JumpAnnotation] +// ============================================================================ + +class JumpAnnotation { +public: + ASMJIT_NONCOPYABLE(JumpAnnotation) + + BaseCompiler* _compiler; + uint32_t _annotationId; + ZoneVector _labelIds; + + inline JumpAnnotation(BaseCompiler* compiler, uint32_t annotationId) noexcept + : _compiler(compiler), + _annotationId(annotationId) {} + + inline BaseCompiler* compiler() const noexcept { return _compiler; } + inline uint32_t annotationId() const noexcept { return _annotationId; } + const ZoneVector& labelIds() const noexcept { return _labelIds; } + + inline bool hasLabel(const Label& label) const noexcept { return hasLabelId(label.id()); } + inline bool hasLabelId(uint32_t labelId) const noexcept { return _labelIds.contains(labelId); } + + inline Error addLabel(const Label& label) noexcept { return addLabelId(label.id()); } + inline Error addLabelId(uint32_t labelId) noexcept { return _labelIds.append(&_compiler->_allocator, labelId); } +}; + +// ============================================================================ +// [asmjit::JumpNode] +// ============================================================================ + +//! Jump instruction with \ref JumpAnnotation. +//! +//! \note This node should be only used to represent jump where the jump target +//! cannot be deduced by examining instruction operands. For example if the jump +//! target is register or memory location. This pattern is often used to perform +//! indirect jumps that use jump table, e.g. to implement `switch{}` statement. +class JumpNode : public InstNode { +public: + ASMJIT_NONCOPYABLE(JumpNode) + + JumpAnnotation* _annotation; + + //! \name Construction & Destruction + //! \{ + + ASMJIT_INLINE JumpNode(BaseCompiler* cc, uint32_t instId, uint32_t options, uint32_t opCount, JumpAnnotation* annotation) noexcept + : InstNode(cc, instId, options, opCount, kBaseOpCapacity), + _annotation(annotation) { + setType(kNodeJump); + } + + //! \} + + //! \name Accessors + //! \{ + + inline bool hasAnnotation() const noexcept { return _annotation != nullptr; } + inline JumpAnnotation* annotation() const noexcept { return _annotation; } + inline void setAnnotation(JumpAnnotation* annotation) noexcept { _annotation = annotation; } + + //! \} +}; + +// ============================================================================ +// [asmjit::FuncNode] +// ============================================================================ + +//! Function entry (BaseCompiler). +class FuncNode : public LabelNode { +public: + ASMJIT_NONCOPYABLE(FuncNode) + + //! Function detail. + FuncDetail _funcDetail; + //! Function frame. + FuncFrame _frame; + //! Function exit (label). + LabelNode* _exitNode; + //! Function end (sentinel). + SentinelNode* _end; + //! Arguments array as `VirtReg`. + VirtReg** _args; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `FuncNode` instance. + //! + //! Always use `BaseCompiler::addFunc()` to create `FuncNode`. + ASMJIT_INLINE FuncNode(BaseBuilder* cb) noexcept + : LabelNode(cb), + _funcDetail(), + _frame(), + _exitNode(nullptr), + _end(nullptr), + _args(nullptr) { + setType(kNodeFunc); + } + + //! \} + + //! \{ + //! \name Accessors + + //! Returns function exit `LabelNode`. + inline LabelNode* exitNode() const noexcept { return _exitNode; } + //! Returns function exit label. + inline Label exitLabel() const noexcept { return _exitNode->label(); } + + //! Returns "End of Func" sentinel. + inline SentinelNode* endNode() const noexcept { return _end; } + + //! Returns function declaration. + inline FuncDetail& detail() noexcept { return _funcDetail; } + //! Returns function declaration. + inline const FuncDetail& detail() const noexcept { return _funcDetail; } + + //! Returns function frame. + inline FuncFrame& frame() noexcept { return _frame; } + //! Returns function frame. + inline const FuncFrame& frame() const noexcept { return _frame; } + + //! Returns arguments count. + inline uint32_t argCount() const noexcept { return _funcDetail.argCount(); } + //! Returns returns count. + inline uint32_t retCount() const noexcept { return _funcDetail.retCount(); } + + //! Returns arguments list. + inline VirtReg** args() const noexcept { return _args; } + + //! Returns argument at `i`. + inline VirtReg* arg(uint32_t i) const noexcept { + ASMJIT_ASSERT(i < argCount()); + return _args[i]; + } + + //! Sets argument at `i`. + inline void setArg(uint32_t i, VirtReg* vReg) noexcept { + ASMJIT_ASSERT(i < argCount()); + _args[i] = vReg; + } + + //! Resets argument at `i`. + inline void resetArg(uint32_t i) noexcept { + ASMJIT_ASSERT(i < argCount()); + _args[i] = nullptr; + } + + inline uint32_t attributes() const noexcept { return _frame.attributes(); } + inline void addAttributes(uint32_t attrs) noexcept { _frame.addAttributes(attrs); } + + //! \} +}; + +// ============================================================================ +// [asmjit::FuncRetNode] +// ============================================================================ + +//! Function return (BaseCompiler). +class FuncRetNode : public InstNode { +public: + ASMJIT_NONCOPYABLE(FuncRetNode) + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `FuncRetNode` instance. + inline FuncRetNode(BaseBuilder* cb) noexcept : InstNode(cb, BaseInst::kIdAbstract, 0, 0) { + _any._nodeType = kNodeFuncRet; + } + + //! \} +}; + +// ============================================================================ +// [asmjit::FuncCallNode] +// ============================================================================ + +//! Function call (BaseCompiler). +class FuncCallNode : public InstNode { +public: + ASMJIT_NONCOPYABLE(FuncCallNode) + + //! Function detail. + FuncDetail _funcDetail; + //! Returns. + Operand_ _rets[2]; + //! Arguments. + Operand_* _args; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `FuncCallNode` instance. + inline FuncCallNode(BaseBuilder* cb, uint32_t instId, uint32_t options) noexcept + : InstNode(cb, instId, options, kBaseOpCapacity), + _funcDetail(), + _args(nullptr) { + setType(kNodeFuncCall); + _resetOps(); + _rets[0].reset(); + _rets[1].reset(); + addFlags(kFlagIsRemovable); + } + + //! \} + + //! \name Accessors + //! \{ + + //! Sets the function signature. + inline Error setSignature(const FuncSignature& sign) noexcept { + return _funcDetail.init(sign); + } + + //! Returns the function detail. + inline FuncDetail& detail() noexcept { return _funcDetail; } + //! Returns the function detail. + inline const FuncDetail& detail() const noexcept { return _funcDetail; } + + //! Returns the target operand. + inline Operand& target() noexcept { return _opArray[0].as(); } + //! \overload + inline const Operand& target() const noexcept { return _opArray[0].as(); } + + //! Returns the number of function arguments. + inline uint32_t argCount() const noexcept { return _funcDetail.argCount(); } + //! Returns the number of function return values. + inline uint32_t retCount() const noexcept { return _funcDetail.retCount(); } + + //! Returns the return value at `i`. + inline Operand& ret(uint32_t i = 0) noexcept { + ASMJIT_ASSERT(i < 2); + return _rets[i].as(); + } + //! \overload + inline const Operand& ret(uint32_t i = 0) const noexcept { + ASMJIT_ASSERT(i < 2); + return _rets[i].as(); + } + + //! Returns the function argument at `i`. + inline Operand& arg(uint32_t i) noexcept { + ASMJIT_ASSERT(i < kFuncArgCountLoHi); + return _args[i].as(); + } + //! \overload + inline const Operand& arg(uint32_t i) const noexcept { + ASMJIT_ASSERT(i < kFuncArgCountLoHi); + return _args[i].as(); + } + + //! Sets the function argument at `i` to `op`. + ASMJIT_API bool _setArg(uint32_t i, const Operand_& op) noexcept; + //! Sets the function return value at `i` to `op`. + ASMJIT_API bool _setRet(uint32_t i, const Operand_& op) noexcept; + + //! Sets the function argument at `i` to `reg`. + inline bool setArg(uint32_t i, const BaseReg& reg) noexcept { return _setArg(i, reg); } + //! Sets the function argument at `i` to `imm`. + inline bool setArg(uint32_t i, const Imm& imm) noexcept { return _setArg(i, imm); } + + //! Sets the function return value at `i` to `var`. + inline bool setRet(uint32_t i, const BaseReg& reg) noexcept { return _setRet(i, reg); } + + //! \} +}; + +// ============================================================================ +// [asmjit::FuncPass] +// ============================================================================ + +class ASMJIT_VIRTAPI FuncPass : public Pass { +public: + ASMJIT_NONCOPYABLE(FuncPass) + typedef Pass Base; + + //! \name Construction & Destruction + //! \{ + + ASMJIT_API FuncPass(const char* name) noexcept; + + //! \} + + //! \name Accessors + //! \{ + + //! Returns the associated `BaseCompiler`. + inline BaseCompiler* cc() const noexcept { return static_cast(_cb); } + + //! \} + + //! \name Run + //! \{ + + //! Calls `runOnFunction()` on each `FuncNode` node found. + ASMJIT_API Error run(Zone* zone, Logger* logger) noexcept override; + + //! Called once per `FuncNode`. + virtual Error runOnFunction(Zone* zone, Logger* logger, FuncNode* func) noexcept = 0; + + //! \} +}; + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // !ASMJIT_NO_COMPILER +#endif // ASMJIT_CORE_COMPILER_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/constpool.cpp b/3rdparty/asmjit/src/asmjit/core/constpool.cpp new file mode 100644 index 00000000000..4db68e2e6e9 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/constpool.cpp @@ -0,0 +1,375 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#include "../core/constpool.h" +#include "../core/support.h" + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::ConstPool - Construction / Destruction] +// ============================================================================ + +ConstPool::ConstPool(Zone* zone) noexcept { reset(zone); } +ConstPool::~ConstPool() noexcept {} + +// ============================================================================ +// [asmjit::ConstPool - Reset] +// ============================================================================ + +void ConstPool::reset(Zone* zone) noexcept { + _zone = zone; + + size_t dataSize = 1; + for (size_t i = 0; i < ASMJIT_ARRAY_SIZE(_tree); i++) { + _tree[i].reset(); + _tree[i].setDataSize(dataSize); + _gaps[i] = nullptr; + dataSize <<= 1; + } + + _gapPool = nullptr; + _size = 0; + _alignment = 0; +} + +// ============================================================================ +// [asmjit::ConstPool - Ops] +// ============================================================================ + +static ASMJIT_INLINE ConstPool::Gap* ConstPool_allocGap(ConstPool* self) noexcept { + ConstPool::Gap* gap = self->_gapPool; + if (!gap) + return self->_zone->allocT(); + + self->_gapPool = gap->_next; + return gap; +} + +static ASMJIT_INLINE void ConstPool_freeGap(ConstPool* self, ConstPool::Gap* gap) noexcept { + gap->_next = self->_gapPool; + self->_gapPool = gap; +} + +static void ConstPool_addGap(ConstPool* self, size_t offset, size_t size) noexcept { + ASMJIT_ASSERT(size > 0); + + while (size > 0) { + size_t gapIndex; + size_t gapSize; + + if (size >= 16 && Support::isAligned(offset, 16)) { + gapIndex = ConstPool::kIndex16; + gapSize = 16; + } + else if (size >= 8 && Support::isAligned(offset, 8)) { + gapIndex = ConstPool::kIndex8; + gapSize = 8; + } + else if (size >= 4 && Support::isAligned(offset, 4)) { + gapIndex = ConstPool::kIndex4; + gapSize = 4; + } + else if (size >= 2 && Support::isAligned(offset, 2)) { + gapIndex = ConstPool::kIndex2; + gapSize = 2; + } + else { + gapIndex = ConstPool::kIndex1; + gapSize = 1; + } + + // We don't have to check for errors here, if this failed nothing really + // happened (just the gap won't be visible) and it will fail again at + // place where the same check would generate `kErrorOutOfMemory` error. + ConstPool::Gap* gap = ConstPool_allocGap(self); + if (!gap) + return; + + gap->_next = self->_gaps[gapIndex]; + self->_gaps[gapIndex] = gap; + + gap->_offset = offset; + gap->_size = gapSize; + + offset += gapSize; + size -= gapSize; + } +} + +Error ConstPool::add(const void* data, size_t size, size_t& dstOffset) noexcept { + size_t treeIndex; + + if (size == 32) + treeIndex = kIndex32; + else if (size == 16) + treeIndex = kIndex16; + else if (size == 8) + treeIndex = kIndex8; + else if (size == 4) + treeIndex = kIndex4; + else if (size == 2) + treeIndex = kIndex2; + else if (size == 1) + treeIndex = kIndex1; + else + return DebugUtils::errored(kErrorInvalidArgument); + + ConstPool::Node* node = _tree[treeIndex].get(data); + if (node) { + dstOffset = node->_offset; + return kErrorOk; + } + + // Before incrementing the current offset try if there is a gap that can + // be used for the requested data. + size_t offset = ~size_t(0); + size_t gapIndex = treeIndex; + + while (gapIndex != kIndexCount - 1) { + ConstPool::Gap* gap = _gaps[treeIndex]; + + // Check if there is a gap. + if (gap) { + size_t gapOffset = gap->_offset; + size_t gapSize = gap->_size; + + // Destroy the gap for now. + _gaps[treeIndex] = gap->_next; + ConstPool_freeGap(this, gap); + + offset = gapOffset; + ASMJIT_ASSERT(Support::isAligned(offset, size)); + + gapSize -= size; + if (gapSize > 0) + ConstPool_addGap(this, gapOffset, gapSize); + } + + gapIndex++; + } + + if (offset == ~size_t(0)) { + // Get how many bytes have to be skipped so the address is aligned accordingly + // to the 'size'. + size_t diff = Support::alignUpDiff(_size, size); + + if (diff != 0) { + ConstPool_addGap(this, _size, diff); + _size += diff; + } + + offset = _size; + _size += size; + } + + // Add the initial node to the right index. + node = ConstPool::Tree::_newNode(_zone, data, size, offset, false); + if (!node) return DebugUtils::errored(kErrorOutOfMemory); + + _tree[treeIndex].insert(node); + _alignment = Support::max(_alignment, size); + + dstOffset = offset; + + // Now create a bunch of shared constants that are based on the data pattern. + // We stop at size 4, it probably doesn't make sense to split constants down + // to 1 byte. + size_t pCount = 1; + while (size > 4) { + size >>= 1; + pCount <<= 1; + + ASMJIT_ASSERT(treeIndex != 0); + treeIndex--; + + const uint8_t* pData = static_cast(data); + for (size_t i = 0; i < pCount; i++, pData += size) { + node = _tree[treeIndex].get(pData); + if (node) continue; + + node = ConstPool::Tree::_newNode(_zone, pData, size, offset + (i * size), true); + _tree[treeIndex].insert(node); + } + } + + return kErrorOk; +} + +// ============================================================================ +// [asmjit::ConstPool - Reset] +// ============================================================================ + +struct ConstPoolFill { + inline ConstPoolFill(uint8_t* dst, size_t dataSize) noexcept : + _dst(dst), + _dataSize(dataSize) {} + + inline void operator()(const ConstPool::Node* node) noexcept { + if (!node->_shared) + memcpy(_dst + node->_offset, node->data(), _dataSize); + } + + uint8_t* _dst; + size_t _dataSize; +}; + +void ConstPool::fill(void* dst) const noexcept { + // Clears possible gaps, asmjit should never emit garbage to the output. + memset(dst, 0, _size); + + ConstPoolFill filler(static_cast(dst), 1); + for (size_t i = 0; i < ASMJIT_ARRAY_SIZE(_tree); i++) { + _tree[i].forEach(filler); + filler._dataSize <<= 1; + } +} + +// ============================================================================ +// [asmjit::ConstPool - Unit] +// ============================================================================ + +#if defined(ASMJIT_TEST) +UNIT(const_pool) { + Zone zone(32384 - Zone::kBlockOverhead); + ConstPool pool(&zone); + + uint32_t i; + uint32_t kCount = BrokenAPI::hasArg("--quick") ? 1000 : 1000000; + + INFO("Adding %u constants to the pool.", kCount); + { + size_t prevOffset; + size_t curOffset; + uint64_t c = 0x0101010101010101u; + + EXPECT(pool.add(&c, 8, prevOffset) == kErrorOk); + EXPECT(prevOffset == 0); + + for (i = 1; i < kCount; i++) { + c++; + EXPECT(pool.add(&c, 8, curOffset) == kErrorOk); + EXPECT(prevOffset + 8 == curOffset); + EXPECT(pool.size() == (i + 1) * 8); + prevOffset = curOffset; + } + + EXPECT(pool.alignment() == 8); + } + + INFO("Retrieving %u constants from the pool.", kCount); + { + uint64_t c = 0x0101010101010101u; + + for (i = 0; i < kCount; i++) { + size_t offset; + EXPECT(pool.add(&c, 8, offset) == kErrorOk); + EXPECT(offset == i * 8); + c++; + } + } + + INFO("Checking if the constants were split into 4-byte patterns"); + { + uint32_t c = 0x01010101; + for (i = 0; i < kCount; i++) { + size_t offset; + EXPECT(pool.add(&c, 4, offset) == kErrorOk); + EXPECT(offset == i * 8); + c++; + } + } + + INFO("Adding 2 byte constant to misalign the current offset"); + { + uint16_t c = 0xFFFF; + size_t offset; + + EXPECT(pool.add(&c, 2, offset) == kErrorOk); + EXPECT(offset == kCount * 8); + EXPECT(pool.alignment() == 8); + } + + INFO("Adding 8 byte constant to check if pool gets aligned again"); + { + uint64_t c = 0xFFFFFFFFFFFFFFFFu; + size_t offset; + + EXPECT(pool.add(&c, 8, offset) == kErrorOk); + EXPECT(offset == kCount * 8 + 8); + } + + INFO("Adding 2 byte constant to verify the gap is filled"); + { + uint16_t c = 0xFFFE; + size_t offset; + + EXPECT(pool.add(&c, 2, offset) == kErrorOk); + EXPECT(offset == kCount * 8 + 2); + EXPECT(pool.alignment() == 8); + } + + INFO("Checking reset functionality"); + { + pool.reset(&zone); + zone.reset(); + + EXPECT(pool.size() == 0); + EXPECT(pool.alignment() == 0); + } + + INFO("Checking pool alignment when combined constants are added"); + { + uint8_t bytes[32] = { 0 }; + size_t offset; + + pool.add(bytes, 1, offset); + EXPECT(pool.size() == 1); + EXPECT(pool.alignment() == 1); + EXPECT(offset == 0); + + pool.add(bytes, 2, offset); + EXPECT(pool.size() == 4); + EXPECT(pool.alignment() == 2); + EXPECT(offset == 2); + + pool.add(bytes, 4, offset); + EXPECT(pool.size() == 8); + EXPECT(pool.alignment() == 4); + EXPECT(offset == 4); + + pool.add(bytes, 4, offset); + EXPECT(pool.size() == 8); + EXPECT(pool.alignment() == 4); + EXPECT(offset == 4); + + pool.add(bytes, 32, offset); + EXPECT(pool.size() == 64); + EXPECT(pool.alignment() == 32); + EXPECT(offset == 32); + } +} +#endif + +ASMJIT_END_NAMESPACE diff --git a/3rdparty/asmjit/src/asmjit/core/constpool.h b/3rdparty/asmjit/src/asmjit/core/constpool.h new file mode 100644 index 00000000000..259615fcaa8 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/constpool.h @@ -0,0 +1,257 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_CONSTPOOL_H_INCLUDED +#define ASMJIT_CORE_CONSTPOOL_H_INCLUDED + +#include "../core/support.h" +#include "../core/zone.h" +#include "../core/zonetree.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_core +//! \{ + +// ============================================================================ +// [asmjit::ConstPool] +// ============================================================================ + +//! Constant pool. +class ConstPool { +public: + ASMJIT_NONCOPYABLE(ConstPool) + + //! Constant pool scope. + enum Scope : uint32_t { + //! Local constant, always embedded right after the current function. + kScopeLocal = 0, + //! Global constant, embedded at the end of the currently compiled code. + kScopeGlobal = 1 + }; + + //! \cond INTERNAL + + //! Index of a given size in const-pool table. + enum Index : uint32_t { + kIndex1 = 0, + kIndex2 = 1, + kIndex4 = 2, + kIndex8 = 3, + kIndex16 = 4, + kIndex32 = 5, + kIndexCount = 6 + }; + + //! Zone-allocated const-pool gap created by two differently aligned constants. + struct Gap { + Gap* _next; //!< Pointer to the next gap + size_t _offset; //!< Offset of the gap. + size_t _size; //!< Remaining bytes of the gap (basically a gap size). + }; + + //! Zone-allocated const-pool node. + class Node : public ZoneTreeNodeT { + public: + ASMJIT_NONCOPYABLE(Node) + + inline Node(size_t offset, bool shared) noexcept + : ZoneTreeNodeT(), + _shared(shared), + _offset(uint32_t(offset)) {} + + inline void* data() const noexcept { + return static_cast(const_cast(this) + 1); + } + + uint32_t _shared : 1; //!< If this constant is shared with another. + uint32_t _offset; //!< Data offset from the beginning of the pool. + }; + + //! Data comparer used internally. + class Compare { + public: + inline Compare(size_t dataSize) noexcept + : _dataSize(dataSize) {} + + inline int operator()(const Node& a, const Node& b) const noexcept { + return ::memcmp(a.data(), b.data(), _dataSize); + } + + inline int operator()(const Node& a, const void* data) const noexcept { + return ::memcmp(a.data(), data, _dataSize); + } + + size_t _dataSize; + }; + + //! Zone-allocated const-pool tree. + struct Tree { + inline explicit Tree(size_t dataSize = 0) noexcept + : _tree(), + _size(0), + _dataSize(dataSize) {} + + inline void reset() noexcept { + _tree.reset(); + _size = 0; + } + + inline bool empty() const noexcept { return _size == 0; } + inline size_t size() const noexcept { return _size; } + + inline void setDataSize(size_t dataSize) noexcept { + ASMJIT_ASSERT(empty()); + _dataSize = dataSize; + } + + inline Node* get(const void* data) noexcept { + Compare cmp(_dataSize); + return _tree.get(data, cmp); + } + + inline void insert(Node* node) noexcept { + Compare cmp(_dataSize); + _tree.insert(node, cmp); + _size++; + } + + template + inline void forEach(Visitor& visitor) const noexcept { + Node* node = _tree.root(); + if (!node) return; + + Node* stack[Globals::kMaxTreeHeight]; + size_t top = 0; + + for (;;) { + Node* left = node->left(); + if (left != nullptr) { + ASMJIT_ASSERT(top != Globals::kMaxTreeHeight); + stack[top++] = node; + + node = left; + continue; + } + + for (;;) { + visitor(node); + node = node->right(); + + if (node != nullptr) + break; + + if (top == 0) + return; + + node = stack[--top]; + } + } + } + + static inline Node* _newNode(Zone* zone, const void* data, size_t size, size_t offset, bool shared) noexcept { + Node* node = zone->allocT(sizeof(Node) + size); + if (ASMJIT_UNLIKELY(!node)) return nullptr; + + node = new(node) Node(offset, shared); + memcpy(node->data(), data, size); + return node; + } + + //! RB tree. + ZoneTree _tree; + //! Size of the tree (number of nodes). + size_t _size; + //! Size of the data. + size_t _dataSize; + }; + + //! \endcond + + //! Zone allocator. + Zone* _zone; + //! Tree per size. + Tree _tree[kIndexCount]; + //! Gaps per size. + Gap* _gaps[kIndexCount]; + //! Gaps pool + Gap* _gapPool; + + //! Size of the pool (in bytes). + size_t _size; + //! Required pool alignment. + size_t _alignment; + + //! \name Construction & Destruction + //! \{ + + ASMJIT_API ConstPool(Zone* zone) noexcept; + ASMJIT_API ~ConstPool() noexcept; + + ASMJIT_API void reset(Zone* zone) noexcept; + + //! \} + + //! \name Accessors + //! \{ + + //! Tests whether the constant-pool is empty. + inline bool empty() const noexcept { return _size == 0; } + //! Returns the size of the constant-pool in bytes. + inline size_t size() const noexcept { return _size; } + //! Returns minimum alignment. + inline size_t alignment() const noexcept { return _alignment; } + + //! \} + + //! \name Utilities + //! \{ + + //! Adds a constant to the constant pool. + //! + //! The constant must have known size, which is 1, 2, 4, 8, 16 or 32 bytes. + //! The constant is added to the pool only if it doesn't not exist, otherwise + //! cached value is returned. + //! + //! AsmJit is able to subdivide added constants, so for example if you add + //! 8-byte constant 0x1122334455667788 it will create the following slots: + //! + //! 8-byte: 0x1122334455667788 + //! 4-byte: 0x11223344, 0x55667788 + //! + //! The reason is that when combining MMX/SSE/AVX code some patterns are used + //! frequently. However, AsmJit is not able to reallocate a constant that has + //! been already added. For example if you try to add 4-byte constant and then + //! 8-byte constant having the same 4-byte pattern as the previous one, two + //! independent slots will be generated by the pool. + ASMJIT_API Error add(const void* data, size_t size, size_t& dstOffset) noexcept; + + //! Fills the destination with the content of this constant pool. + ASMJIT_API void fill(void* dst) const noexcept; +}; + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_CONSTPOOL_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/cpuinfo.cpp b/3rdparty/asmjit/src/asmjit/core/cpuinfo.cpp new file mode 100644 index 00000000000..edc7d172227 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/cpuinfo.cpp @@ -0,0 +1,97 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#include "../core/cpuinfo.h" + +#if !defined(_WIN32) + #include + #include + #include +#endif + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::CpuInfo - Detect - CPU NumThreads] +// ============================================================================ + +#if defined(_WIN32) +static inline uint32_t detectHWThreadCount() noexcept { + SYSTEM_INFO info; + ::GetSystemInfo(&info); + return info.dwNumberOfProcessors; +} +#elif defined(_SC_NPROCESSORS_ONLN) +static inline uint32_t detectHWThreadCount() noexcept { + long res = ::sysconf(_SC_NPROCESSORS_ONLN); + return res <= 0 ? uint32_t(1) : uint32_t(res); +} +#else +static inline uint32_t detectHWThreadCount() noexcept { + return 1; +} +#endif + +// ============================================================================ +// [asmjit::CpuInfo - Detect - CPU Features] +// ============================================================================ + +#if defined(ASMJIT_BUILD_X86) && ASMJIT_ARCH_X86 +namespace x86 { void detectCpu(CpuInfo& cpu) noexcept; } +#endif + +#if defined(ASMJIT_BUILD_ARM) && ASMJIT_ARCH_ARM +namespace arm { void detectCpu(CpuInfo& cpu) noexcept; } +#endif + +// ============================================================================ +// [asmjit::CpuInfo - Detect - Static Initializer] +// ============================================================================ + +static uint32_t cpuInfoInitialized; +static CpuInfo cpuInfoGlobal(Globals::NoInit); + +const CpuInfo& CpuInfo::host() noexcept { + // This should never cause a problem as the resulting information should + // always be the same. + if (!cpuInfoInitialized) { + CpuInfo cpuInfoLocal; + +#if defined(ASMJIT_BUILD_X86) && ASMJIT_ARCH_X86 + x86::detectCpu(cpuInfoLocal); +#endif + +#if defined(ASMJIT_BUILD_ARM) && ASMJIT_ARCH_ARM + arm::detectCpu(cpuInfoLocal); +#endif + + cpuInfoLocal._hwThreadCount = detectHWThreadCount(); + cpuInfoGlobal = cpuInfoLocal; + cpuInfoInitialized = 1; + } + + return cpuInfoGlobal; +} + +ASMJIT_END_NAMESPACE diff --git a/3rdparty/asmjit/src/asmjit/core/cpuinfo.h b/3rdparty/asmjit/src/asmjit/core/cpuinfo.h new file mode 100644 index 00000000000..d2defb90ed6 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/cpuinfo.h @@ -0,0 +1,152 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_CPUINFO_H_INCLUDED +#define ASMJIT_CORE_CPUINFO_H_INCLUDED + +#include "../core/arch.h" +#include "../core/features.h" +#include "../core/globals.h" +#include "../core/string.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_support +//! \{ + +// ============================================================================ +// [asmjit::CpuInfo] +// ============================================================================ + +//! CPU information. +class CpuInfo { +public: + //! CPU architecture information. + ArchInfo _archInfo; + //! CPU family ID. + uint32_t _familyId; + //! CPU model ID. + uint32_t _modelId; + //! CPU brand ID. + uint32_t _brandId; + //! CPU stepping. + uint32_t _stepping; + //! Processor type. + uint32_t _processorType; + //! Maximum number of addressable IDs for logical processors. + uint32_t _maxLogicalProcessors; + //! Cache line size (in bytes). + uint32_t _cacheLineSize; + //! Number of hardware threads. + uint32_t _hwThreadCount; + + //! CPU vendor string. + FixedString<16> _vendor; + //! CPU brand string. + FixedString<64> _brand; + //! CPU features. + BaseFeatures _features; + + //! \name Construction & Destruction + //! \{ + + inline CpuInfo() noexcept { reset(); } + inline CpuInfo(const CpuInfo& other) noexcept = default; + + inline explicit CpuInfo(Globals::NoInit_) noexcept + : _archInfo(Globals::NoInit), + _features(Globals::NoInit) {}; + + //! Returns the host CPU information. + ASMJIT_API static const CpuInfo& host() noexcept; + + //! Initializes CpuInfo to the given architecture, see `ArchInfo`. + inline void initArch(uint32_t archId, uint32_t archMode = 0) noexcept { + _archInfo.init(archId, archMode); + } + + inline void reset() noexcept { memset(this, 0, sizeof(*this)); } + + //! \} + + //! \name Overloaded Operators + //! \{ + + inline CpuInfo& operator=(const CpuInfo& other) noexcept = default; + + //! \} + + //! \name Accessors + //! \{ + + //! Returns the CPU architecture information. + inline const ArchInfo& archInfo() const noexcept { return _archInfo; } + //! Returns the CPU architecture id, see `ArchInfo::Id`. + inline uint32_t archId() const noexcept { return _archInfo.archId(); } + //! Returns the CPU architecture sub-id, see `ArchInfo::SubId`. + inline uint32_t archSubId() const noexcept { return _archInfo.archSubId(); } + + //! Returns the CPU family ID. + inline uint32_t familyId() const noexcept { return _familyId; } + //! Returns the CPU model ID. + inline uint32_t modelId() const noexcept { return _modelId; } + //! Returns the CPU brand id. + inline uint32_t brandId() const noexcept { return _brandId; } + //! Returns the CPU stepping. + inline uint32_t stepping() const noexcept { return _stepping; } + //! Returns the processor type. + inline uint32_t processorType() const noexcept { return _processorType; } + //! Returns the number of maximum logical processors. + inline uint32_t maxLogicalProcessors() const noexcept { return _maxLogicalProcessors; } + + //! Returns the size of a cache line flush. + inline uint32_t cacheLineSize() const noexcept { return _cacheLineSize; } + //! Returns number of hardware threads available. + inline uint32_t hwThreadCount() const noexcept { return _hwThreadCount; } + + //! Returns the CPU vendor. + inline const char* vendor() const noexcept { return _vendor.str; } + //! Tests whether the CPU vendor is equal to `s`. + inline bool isVendor(const char* s) const noexcept { return _vendor.eq(s); } + + //! Returns the CPU brand string. + inline const char* brand() const noexcept { return _brand.str; } + + //! Returns all CPU features as `BaseFeatures`, cast to your arch-specific class + //! if needed. + template + inline const T& features() const noexcept { return _features.as(); } + + //! Tests whether the CPU has the given `feature`. + inline bool hasFeature(uint32_t featureId) const noexcept { return _features.has(featureId); } + //! Adds the given CPU `feature` to the list of this CpuInfo features. + inline CpuInfo& addFeature(uint32_t featureId) noexcept { _features.add(featureId); return *this; } + + //! \} +}; + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_CPUINFO_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/datatypes.h b/3rdparty/asmjit/src/asmjit/core/datatypes.h new file mode 100644 index 00000000000..bee4572294c --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/datatypes.h @@ -0,0 +1,1073 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_DATATYPES_H_INCLUDED +#define ASMJIT_CORE_DATATYPES_H_INCLUDED + +#include "../core/globals.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_support +//! \{ + +// ============================================================================ +// [asmjit::Data64] +// ============================================================================ + +//! 64-bit data useful for creating SIMD constants. +union Data64 { + //! Array of eight 8-bit signed integers. + int8_t sb[8]; + //! Array of eight 8-bit unsigned integers. + uint8_t ub[8]; + //! Array of four 16-bit signed integers. + int16_t sw[4]; + //! Array of four 16-bit unsigned integers. + uint16_t uw[4]; + //! Array of two 32-bit signed integers. + int32_t sd[2]; + //! Array of two 32-bit unsigned integers. + uint32_t ud[2]; + //! Array of one 64-bit signed integer. + int64_t sq[1]; + //! Array of one 64-bit unsigned integer. + uint64_t uq[1]; + + //! Array of two SP-FP values. + float sf[2]; + //! Array of one DP-FP value. + double df[1]; + + //! \name Construction & Destruction + //! \{ + + //! Sets all eight 8-bit signed integers. + static inline Data64 fromI8(int8_t x0) noexcept { + Data64 self; + self.setI8(x0); + return self; + } + + //! Sets all eight 8-bit unsigned integers. + static inline Data64 fromU8(uint8_t x0) noexcept { + Data64 self; + self.setU8(x0); + return self; + } + + //! Sets all eight 8-bit signed integers. + static inline Data64 fromI8( + int8_t x0, int8_t x1, int8_t x2, int8_t x3, int8_t x4, int8_t x5, int8_t x6, int8_t x7) noexcept { + + Data64 self; + self.setI8(x0, x1, x2, x3, x4, x5, x6, x7); + return self; + } + + //! Sets all eight 8-bit unsigned integers. + static inline Data64 fromU8( + uint8_t x0, uint8_t x1, uint8_t x2, uint8_t x3, uint8_t x4, uint8_t x5, uint8_t x6, uint8_t x7) noexcept { + + Data64 self; + self.setU8(x0, x1, x2, x3, x4, x5, x6, x7); + return self; + } + + //! Sets all four 16-bit signed integers. + static inline Data64 fromI16(int16_t x0) noexcept { + Data64 self; + self.setI16(x0); + return self; + } + + //! Sets all four 16-bit unsigned integers. + static inline Data64 fromU16(uint16_t x0) noexcept { + Data64 self; + self.setU16(x0); + return self; + } + + //! Sets all four 16-bit signed integers. + static inline Data64 fromI16(int16_t x0, int16_t x1, int16_t x2, int16_t x3) noexcept { + Data64 self; + self.setI16(x0, x1, x2, x3); + return self; + } + + //! Sets all four 16-bit unsigned integers. + static inline Data64 fromU16(uint16_t x0, uint16_t x1, uint16_t x2, uint16_t x3) noexcept { + Data64 self; + self.setU16(x0, x1, x2, x3); + return self; + } + + //! Sets all two 32-bit signed integers. + static inline Data64 fromI32(int32_t x0) noexcept { + Data64 self; + self.setI32(x0); + return self; + } + + //! Sets all two 32-bit unsigned integers. + static inline Data64 fromU32(uint32_t x0) noexcept { + Data64 self; + self.setU32(x0); + return self; + } + + //! Sets all two 32-bit signed integers. + static inline Data64 fromI32(int32_t x0, int32_t x1) noexcept { + Data64 self; + self.setI32(x0, x1); + return self; + } + + //! Sets all two 32-bit unsigned integers. + static inline Data64 fromU32(uint32_t x0, uint32_t x1) noexcept { + Data64 self; + self.setU32(x0, x1); + return self; + } + + //! Sets 64-bit signed integer. + static inline Data64 fromI64(int64_t x0) noexcept { + Data64 self; + self.setI64(x0); + return self; + } + + //! Sets 64-bit unsigned integer. + static inline Data64 fromU64(uint64_t x0) noexcept { + Data64 self; + self.setU64(x0); + return self; + } + + //! Sets all two SP-FP values. + static inline Data64 fromF32(float x0) noexcept { + Data64 self; + self.setF32(x0); + return self; + } + + //! Sets all two SP-FP values. + static inline Data64 fromF32(float x0, float x1) noexcept { + Data64 self; + self.setF32(x0, x1); + return self; + } + + //! Sets all two SP-FP values. + static inline Data64 fromF64(double x0) noexcept { + Data64 self; + self.setF64(x0); + return self; + } + + //! \} + + //! \name Accessors + //! \{ + + //! Sets all eight 8-bit signed integers. + inline void setI8(int8_t x0) noexcept { + setU8(uint8_t(x0)); + } + + //! Sets all eight 8-bit unsigned integers. + inline void setU8(uint8_t x0) noexcept { + if (ASMJIT_ARCH_BITS >= 64) { + uint64_t xq = uint64_t(x0) * 0x0101010101010101u; + uq[0] = xq; + } + else { + uint32_t xd = uint32_t(x0) * 0x01010101u; + ud[0] = xd; + ud[1] = xd; + } + } + + //! Sets all eight 8-bit signed integers. + inline void setI8( + int8_t x0, int8_t x1, int8_t x2, int8_t x3, int8_t x4, int8_t x5, int8_t x6, int8_t x7) noexcept { + + sb[0] = x0; sb[1] = x1; sb[2] = x2; sb[3] = x3; + sb[4] = x4; sb[5] = x5; sb[6] = x6; sb[7] = x7; + } + + //! Sets all eight 8-bit unsigned integers. + inline void setU8( + uint8_t x0, uint8_t x1, uint8_t x2, uint8_t x3, uint8_t x4, uint8_t x5, uint8_t x6, uint8_t x7) noexcept { + + ub[0] = x0; ub[1] = x1; ub[2] = x2; ub[3] = x3; + ub[4] = x4; ub[5] = x5; ub[6] = x6; ub[7] = x7; + } + + //! Sets all four 16-bit signed integers. + inline void setI16(int16_t x0) noexcept { + setU16(uint16_t(x0)); + } + + //! Sets all four 16-bit unsigned integers. + inline void setU16(uint16_t x0) noexcept { + if (ASMJIT_ARCH_BITS >= 64) { + uint64_t xq = uint64_t(x0) * 0x0001000100010001u; + uq[0] = xq; + } + else { + uint32_t xd = uint32_t(x0) * 0x00010001u; + ud[0] = xd; + ud[1] = xd; + } + } + + //! Sets all four 16-bit signed integers. + inline void setI16(int16_t x0, int16_t x1, int16_t x2, int16_t x3) noexcept { + sw[0] = x0; sw[1] = x1; sw[2] = x2; sw[3] = x3; + } + + //! Sets all four 16-bit unsigned integers. + inline void setU16(uint16_t x0, uint16_t x1, uint16_t x2, uint16_t x3) noexcept { + uw[0] = x0; uw[1] = x1; uw[2] = x2; uw[3] = x3; + } + + //! Sets all two 32-bit signed integers. + inline void setI32(int32_t x0) noexcept { + sd[0] = x0; sd[1] = x0; + } + + //! Sets all two 32-bit unsigned integers. + inline void setU32(uint32_t x0) noexcept { + ud[0] = x0; ud[1] = x0; + } + + //! Sets all two 32-bit signed integers. + inline void setI32(int32_t x0, int32_t x1) noexcept { + sd[0] = x0; sd[1] = x1; + } + + //! Sets all two 32-bit unsigned integers. + inline void setU32(uint32_t x0, uint32_t x1) noexcept { + ud[0] = x0; ud[1] = x1; + } + + //! Sets 64-bit signed integer. + inline void setI64(int64_t x0) noexcept { + sq[0] = x0; + } + + //! Sets 64-bit unsigned integer. + inline void setU64(uint64_t x0) noexcept { + uq[0] = x0; + } + + //! Sets all two SP-FP values. + inline void setF32(float x0) noexcept { + sf[0] = x0; sf[1] = x0; + } + + //! Sets all two SP-FP values. + inline void setF32(float x0, float x1) noexcept { + sf[0] = x0; sf[1] = x1; + } + + //! Sets all two SP-FP values. + inline void setF64(double x0) noexcept { + df[0] = x0; + } +}; + +// ============================================================================ +// [asmjit::Data128] +// ============================================================================ + +//! 128-bit data useful for creating SIMD constants. +union Data128 { + //! Array of sixteen 8-bit signed integers. + int8_t sb[16]; + //! Array of sixteen 8-bit unsigned integers. + uint8_t ub[16]; + //! Array of eight 16-bit signed integers. + int16_t sw[8]; + //! Array of eight 16-bit unsigned integers. + uint16_t uw[8]; + //! Array of four 32-bit signed integers. + int32_t sd[4]; + //! Array of four 32-bit unsigned integers. + uint32_t ud[4]; + //! Array of two 64-bit signed integers. + int64_t sq[2]; + //! Array of two 64-bit unsigned integers. + uint64_t uq[2]; + + //! Array of four 32-bit single precision floating points. + float sf[4]; + //! Array of two 64-bit double precision floating points. + double df[2]; + + //! \name Construction & Destruction + //! \{ + + //! Sets all sixteen 8-bit signed integers. + static inline Data128 fromI8(int8_t x0) noexcept { + Data128 self; + self.setI8(x0); + return self; + } + + //! Sets all sixteen 8-bit unsigned integers. + static inline Data128 fromU8(uint8_t x0) noexcept { + Data128 self; + self.setU8(x0); + return self; + } + + //! Sets all sixteen 8-bit signed integers. + static inline Data128 fromI8( + int8_t x0 , int8_t x1 , int8_t x2 , int8_t x3 , + int8_t x4 , int8_t x5 , int8_t x6 , int8_t x7 , + int8_t x8 , int8_t x9 , int8_t x10, int8_t x11, + int8_t x12, int8_t x13, int8_t x14, int8_t x15) noexcept { + + Data128 self; + self.setI8(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9, x10, x11, x12, x13, x14, x15); + return self; + } + + //! Sets all sixteen 8-bit unsigned integers. + static inline Data128 fromU8( + uint8_t x0 , uint8_t x1 , uint8_t x2 , uint8_t x3 , + uint8_t x4 , uint8_t x5 , uint8_t x6 , uint8_t x7 , + uint8_t x8 , uint8_t x9 , uint8_t x10, uint8_t x11, + uint8_t x12, uint8_t x13, uint8_t x14, uint8_t x15) noexcept { + + Data128 self; + self.setU8(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9, x10, x11, x12, x13, x14, x15); + return self; + } + + //! Sets all eight 16-bit signed integers. + static inline Data128 fromI16(int16_t x0) noexcept { + Data128 self; + self.setI16(x0); + return self; + } + + //! Sets all eight 16-bit unsigned integers. + static inline Data128 fromU16(uint16_t x0) noexcept { + Data128 self; + self.setU16(x0); + return self; + } + + //! Sets all eight 16-bit signed integers. + static inline Data128 fromI16( + int16_t x0, int16_t x1, int16_t x2, int16_t x3, int16_t x4, int16_t x5, int16_t x6, int16_t x7) noexcept { + + Data128 self; + self.setI16(x0, x1, x2, x3, x4, x5, x6, x7); + return self; + } + + //! Sets all eight 16-bit unsigned integers. + static inline Data128 fromU16( + uint16_t x0, uint16_t x1, uint16_t x2, uint16_t x3, uint16_t x4, uint16_t x5, uint16_t x6, uint16_t x7) noexcept { + + Data128 self; + self.setU16(x0, x1, x2, x3, x4, x5, x6, x7); + return self; + } + + //! Sets all four 32-bit signed integers. + static inline Data128 fromI32(int32_t x0) noexcept { + Data128 self; + self.setI32(x0); + return self; + } + + //! Sets all four 32-bit unsigned integers. + static inline Data128 fromU32(uint32_t x0) noexcept { + Data128 self; + self.setU32(x0); + return self; + } + + //! Sets all four 32-bit signed integers. + static inline Data128 fromI32(int32_t x0, int32_t x1, int32_t x2, int32_t x3) noexcept { + Data128 self; + self.setI32(x0, x1, x2, x3); + return self; + } + + //! Sets all four 32-bit unsigned integers. + static inline Data128 fromU32(uint32_t x0, uint32_t x1, uint32_t x2, uint32_t x3) noexcept { + Data128 self; + self.setU32(x0, x1, x2, x3); + return self; + } + + //! Sets all two 64-bit signed integers. + static inline Data128 fromI64(int64_t x0) noexcept { + Data128 self; + self.setI64(x0); + return self; + } + + //! Sets all two 64-bit unsigned integers. + static inline Data128 fromU64(uint64_t x0) noexcept { + Data128 self; + self.setU64(x0); + return self; + } + + //! Sets all two 64-bit signed integers. + static inline Data128 fromI64(int64_t x0, int64_t x1) noexcept { + Data128 self; + self.setI64(x0, x1); + return self; + } + + //! Sets all two 64-bit unsigned integers. + static inline Data128 fromU64(uint64_t x0, uint64_t x1) noexcept { + Data128 self; + self.setU64(x0, x1); + return self; + } + + //! Sets all four SP-FP floats. + static inline Data128 fromF32(float x0) noexcept { + Data128 self; + self.setF32(x0); + return self; + } + + //! Sets all four SP-FP floats. + static inline Data128 fromF32(float x0, float x1, float x2, float x3) noexcept { + Data128 self; + self.setF32(x0, x1, x2, x3); + return self; + } + + //! Sets all two DP-FP floats. + static inline Data128 fromF64(double x0) noexcept { + Data128 self; + self.setF64(x0); + return self; + } + + //! Sets all two DP-FP floats. + static inline Data128 fromF64(double x0, double x1) noexcept { + Data128 self; + self.setF64(x0, x1); + return self; + } + + //! \} + + //! \name Accessors + //! \{ + + //! Sets all sixteen 8-bit signed integers. + inline void setI8(int8_t x0) noexcept { + setU8(uint8_t(x0)); + } + + //! Sets all sixteen 8-bit unsigned integers. + inline void setU8(uint8_t x0) noexcept { + if (ASMJIT_ARCH_BITS >= 64) { + uint64_t xq = uint64_t(x0) * 0x0101010101010101u; + uq[0] = xq; + uq[1] = xq; + } + else { + uint32_t xd = uint32_t(x0) * 0x01010101u; + ud[0] = xd; + ud[1] = xd; + ud[2] = xd; + ud[3] = xd; + } + } + + //! Sets all sixteen 8-bit signed integers. + inline void setI8( + int8_t x0 , int8_t x1 , int8_t x2 , int8_t x3 , + int8_t x4 , int8_t x5 , int8_t x6 , int8_t x7 , + int8_t x8 , int8_t x9 , int8_t x10, int8_t x11, + int8_t x12, int8_t x13, int8_t x14, int8_t x15) noexcept { + + sb[0 ] = x0 ; sb[1 ] = x1 ; sb[2 ] = x2 ; sb[3 ] = x3 ; + sb[4 ] = x4 ; sb[5 ] = x5 ; sb[6 ] = x6 ; sb[7 ] = x7 ; + sb[8 ] = x8 ; sb[9 ] = x9 ; sb[10] = x10; sb[11] = x11; + sb[12] = x12; sb[13] = x13; sb[14] = x14; sb[15] = x15; + } + + //! Sets all sixteen 8-bit unsigned integers. + inline void setU8( + uint8_t x0 , uint8_t x1 , uint8_t x2 , uint8_t x3 , + uint8_t x4 , uint8_t x5 , uint8_t x6 , uint8_t x7 , + uint8_t x8 , uint8_t x9 , uint8_t x10, uint8_t x11, + uint8_t x12, uint8_t x13, uint8_t x14, uint8_t x15) noexcept { + + ub[0 ] = x0 ; ub[1 ] = x1 ; ub[2 ] = x2 ; ub[3 ] = x3 ; + ub[4 ] = x4 ; ub[5 ] = x5 ; ub[6 ] = x6 ; ub[7 ] = x7 ; + ub[8 ] = x8 ; ub[9 ] = x9 ; ub[10] = x10; ub[11] = x11; + ub[12] = x12; ub[13] = x13; ub[14] = x14; ub[15] = x15; + } + + //! Sets all eight 16-bit signed integers. + inline void setI16(int16_t x0) noexcept { + setU16(uint16_t(x0)); + } + + //! Sets all eight 16-bit unsigned integers. + inline void setU16(uint16_t x0) noexcept { + if (ASMJIT_ARCH_BITS >= 64) { + uint64_t xq = uint64_t(x0) * 0x0001000100010001u; + uq[0] = xq; + uq[1] = xq; + } + else { + uint32_t xd = uint32_t(x0) * 0x00010001u; + ud[0] = xd; + ud[1] = xd; + ud[2] = xd; + ud[3] = xd; + } + } + + //! Sets all eight 16-bit signed integers. + inline void setI16( + int16_t x0, int16_t x1, int16_t x2, int16_t x3, int16_t x4, int16_t x5, int16_t x6, int16_t x7) noexcept { + + sw[0] = x0; sw[1] = x1; sw[2] = x2; sw[3] = x3; + sw[4] = x4; sw[5] = x5; sw[6] = x6; sw[7] = x7; + } + + //! Sets all eight 16-bit unsigned integers. + inline void setU16( + uint16_t x0, uint16_t x1, uint16_t x2, uint16_t x3, uint16_t x4, uint16_t x5, uint16_t x6, uint16_t x7) noexcept { + + uw[0] = x0; uw[1] = x1; uw[2] = x2; uw[3] = x3; + uw[4] = x4; uw[5] = x5; uw[6] = x6; uw[7] = x7; + } + + //! Sets all four 32-bit signed integers. + inline void setI32(int32_t x0) noexcept { + setU32(uint32_t(x0)); + } + + //! Sets all four 32-bit unsigned integers. + inline void setU32(uint32_t x0) noexcept { + if (ASMJIT_ARCH_BITS >= 64) { + uint64_t t = (uint64_t(x0) << 32) + x0; + uq[0] = t; + uq[1] = t; + } + else { + ud[0] = x0; + ud[1] = x0; + ud[2] = x0; + ud[3] = x0; + } + } + + //! Sets all four 32-bit signed integers. + inline void setI32(int32_t x0, int32_t x1, int32_t x2, int32_t x3) noexcept { + sd[0] = x0; sd[1] = x1; sd[2] = x2; sd[3] = x3; + } + + //! Sets all four 32-bit unsigned integers. + inline void setU32(uint32_t x0, uint32_t x1, uint32_t x2, uint32_t x3) noexcept { + ud[0] = x0; ud[1] = x1; ud[2] = x2; ud[3] = x3; + } + + //! Sets all two 64-bit signed integers. + inline void setI64(int64_t x0) noexcept { + sq[0] = x0; sq[1] = x0; + } + + //! Sets all two 64-bit unsigned integers. + inline void setU64(uint64_t x0) noexcept { + uq[0] = x0; uq[1] = x0; + } + + //! Sets all two 64-bit signed integers. + inline void setI64(int64_t x0, int64_t x1) noexcept { + sq[0] = x0; sq[1] = x1; + } + + //! Sets all two 64-bit unsigned integers. + inline void setU64(uint64_t x0, uint64_t x1) noexcept { + uq[0] = x0; uq[1] = x1; + } + + //! Sets all four SP-FP floats. + inline void setF32(float x0) noexcept { + sf[0] = x0; sf[1] = x0; sf[2] = x0; sf[3] = x0; + } + + //! Sets all four SP-FP floats. + inline void setF32(float x0, float x1, float x2, float x3) noexcept { + sf[0] = x0; sf[1] = x1; sf[2] = x2; sf[3] = x3; + } + + //! Sets all two DP-FP floats. + inline void setF64(double x0) noexcept { + df[0] = x0; df[1] = x0; + } + + //! Sets all two DP-FP floats. + inline void setF64(double x0, double x1) noexcept { + df[0] = x0; df[1] = x1; + } +}; + +// ============================================================================ +// [asmjit::Data256] +// ============================================================================ + +//! 256-bit data useful for creating SIMD constants. +union Data256 { + //! Array of thirty two 8-bit signed integers. + int8_t sb[32]; + //! Array of thirty two 8-bit unsigned integers. + uint8_t ub[32]; + //! Array of sixteen 16-bit signed integers. + int16_t sw[16]; + //! Array of sixteen 16-bit unsigned integers. + uint16_t uw[16]; + //! Array of eight 32-bit signed integers. + int32_t sd[8]; + //! Array of eight 32-bit unsigned integers. + uint32_t ud[8]; + //! Array of four 64-bit signed integers. + int64_t sq[4]; + //! Array of four 64-bit unsigned integers. + uint64_t uq[4]; + + //! Array of eight 32-bit single precision floating points. + float sf[8]; + //! Array of four 64-bit double precision floating points. + double df[4]; + + //! \name Construction & Destruction + //! \{ + + //! Sets all thirty two 8-bit signed integers. + static inline Data256 fromI8(int8_t x0) noexcept { + Data256 self; + self.setI8(x0); + return self; + } + + //! Sets all thirty two 8-bit unsigned integers. + static inline Data256 fromU8(uint8_t x0) noexcept { + Data256 self; + self.setU8(x0); + return self; + } + + //! Sets all thirty two 8-bit signed integers. + static inline Data256 fromI8( + int8_t x0 , int8_t x1 , int8_t x2 , int8_t x3 , + int8_t x4 , int8_t x5 , int8_t x6 , int8_t x7 , + int8_t x8 , int8_t x9 , int8_t x10, int8_t x11, + int8_t x12, int8_t x13, int8_t x14, int8_t x15, + int8_t x16, int8_t x17, int8_t x18, int8_t x19, + int8_t x20, int8_t x21, int8_t x22, int8_t x23, + int8_t x24, int8_t x25, int8_t x26, int8_t x27, + int8_t x28, int8_t x29, int8_t x30, int8_t x31) noexcept { + + Data256 self; + self.setI8( + x0, x1 , x2 , x3 , x4 , x5 , x6 , x7 , x8 , x9 , x10, x11, x12, x13, x14, x15, + x16, x17, x18, x19, x20, x21, x22, x23, x24, x25, x26, x27, x28, x29, x30, x31); + return self; + } + + //! Sets all thirty two 8-bit unsigned integers. + static inline Data256 fromU8( + uint8_t x0 , uint8_t x1 , uint8_t x2 , uint8_t x3 , + uint8_t x4 , uint8_t x5 , uint8_t x6 , uint8_t x7 , + uint8_t x8 , uint8_t x9 , uint8_t x10, uint8_t x11, + uint8_t x12, uint8_t x13, uint8_t x14, uint8_t x15, + uint8_t x16, uint8_t x17, uint8_t x18, uint8_t x19, + uint8_t x20, uint8_t x21, uint8_t x22, uint8_t x23, + uint8_t x24, uint8_t x25, uint8_t x26, uint8_t x27, + uint8_t x28, uint8_t x29, uint8_t x30, uint8_t x31) noexcept { + + Data256 self; + self.setU8( + x0, x1 , x2 , x3 , x4 , x5 , x6 , x7 , x8 , x9 , x10, x11, x12, x13, x14, x15, + x16, x17, x18, x19, x20, x21, x22, x23, x24, x25, x26, x27, x28, x29, x30, x31); + return self; + } + + //! Sets all sixteen 16-bit signed integers. + static inline Data256 fromI16(int16_t x0) noexcept { + Data256 self; + self.setI16(x0); + return self; + } + + //! Sets all sixteen 16-bit unsigned integers. + static inline Data256 fromU16(uint16_t x0) noexcept { + Data256 self; + self.setU16(x0); + return self; + } + + //! Sets all sixteen 16-bit signed integers. + static inline Data256 fromI16( + int16_t x0, int16_t x1, int16_t x2 , int16_t x3 , int16_t x4 , int16_t x5 , int16_t x6 , int16_t x7 , + int16_t x8, int16_t x9, int16_t x10, int16_t x11, int16_t x12, int16_t x13, int16_t x14, int16_t x15) noexcept { + + Data256 self; + self.setI16(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9, x10, x11, x12, x13, x14, x15); + return self; + } + + //! Sets all sixteen 16-bit unsigned integers. + static inline Data256 fromU16( + uint16_t x0, uint16_t x1, uint16_t x2 , uint16_t x3 , uint16_t x4 , uint16_t x5 , uint16_t x6 , uint16_t x7 , + uint16_t x8, uint16_t x9, uint16_t x10, uint16_t x11, uint16_t x12, uint16_t x13, uint16_t x14, uint16_t x15) noexcept { + + Data256 self; + self.setU16(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9, x10, x11, x12, x13, x14, x15); + return self; + } + + //! Sets all eight 32-bit signed integers. + static inline Data256 fromI32(int32_t x0) noexcept { + Data256 self; + self.setI32(x0); + return self; + } + + //! Sets all eight 32-bit unsigned integers. + static inline Data256 fromU32(uint32_t x0) noexcept { + Data256 self; + self.setU32(x0); + return self; + } + + //! Sets all eight 32-bit signed integers. + static inline Data256 fromI32( + int32_t x0, int32_t x1, int32_t x2, int32_t x3, + int32_t x4, int32_t x5, int32_t x6, int32_t x7) noexcept { + + Data256 self; + self.setI32(x0, x1, x2, x3, x4, x5, x6, x7); + return self; + } + + //! Sets all eight 32-bit unsigned integers. + static inline Data256 fromU32( + uint32_t x0, uint32_t x1, uint32_t x2, uint32_t x3, + uint32_t x4, uint32_t x5, uint32_t x6, uint32_t x7) noexcept { + + Data256 self; + self.setU32(x0, x1, x2, x3, x4, x5, x6, x7); + return self; + } + + //! Sets all four 64-bit signed integers. + static inline Data256 fromI64(int64_t x0) noexcept { + Data256 self; + self.setI64(x0); + return self; + } + + //! Sets all four 64-bit unsigned integers. + static inline Data256 fromU64(uint64_t x0) noexcept { + Data256 self; + self.setU64(x0); + return self; + } + + //! Sets all four 64-bit signed integers. + static inline Data256 fromI64(int64_t x0, int64_t x1, int64_t x2, int64_t x3) noexcept { + Data256 self; + self.setI64(x0, x1, x2, x3); + return self; + } + + //! Sets all four 64-bit unsigned integers. + static inline Data256 fromU64(uint64_t x0, uint64_t x1, uint64_t x2, uint64_t x3) noexcept { + Data256 self; + self.setU64(x0, x1, x2, x3); + return self; + } + + //! Sets all eight SP-FP floats. + static inline Data256 fromF32(float x0) noexcept { + Data256 self; + self.setF32(x0); + return self; + } + + //! Sets all eight SP-FP floats. + static inline Data256 fromF32( + float x0, float x1, float x2, float x3, + float x4, float x5, float x6, float x7) noexcept { + + Data256 self; + self.setF32(x0, x1, x2, x3, x4, x5, x6, x7); + return self; + } + + //! Sets all four DP-FP floats. + static inline Data256 fromF64(double x0) noexcept { + Data256 self; + self.setF64(x0); + return self; + } + + //! Sets all four DP-FP floats. + static inline Data256 fromF64(double x0, double x1, double x2, double x3) noexcept { + Data256 self; + self.setF64(x0, x1, x2, x3); + return self; + } + + //! \} + + //! \name Accessors + //! \{ + + //! Sets all thirty two 8-bit signed integers. + inline void setI8(int8_t x0) noexcept { + setU8(uint8_t(x0)); + } + + //! Sets all thirty two 8-bit unsigned integers. + inline void setU8(uint8_t x0) noexcept { + if (ASMJIT_ARCH_BITS >= 64) { + uint64_t xq = uint64_t(x0) * 0x0101010101010101u; + uq[0] = xq; + uq[1] = xq; + uq[2] = xq; + uq[3] = xq; + } + else { + uint32_t xd = uint32_t(x0) * 0x01010101u; + ud[0] = xd; + ud[1] = xd; + ud[2] = xd; + ud[3] = xd; + ud[4] = xd; + ud[5] = xd; + ud[6] = xd; + ud[7] = xd; + } + } + + //! Sets all thirty two 8-bit signed integers. + inline void setI8( + int8_t x0 , int8_t x1 , int8_t x2 , int8_t x3 , + int8_t x4 , int8_t x5 , int8_t x6 , int8_t x7 , + int8_t x8 , int8_t x9 , int8_t x10, int8_t x11, + int8_t x12, int8_t x13, int8_t x14, int8_t x15, + int8_t x16, int8_t x17, int8_t x18, int8_t x19, + int8_t x20, int8_t x21, int8_t x22, int8_t x23, + int8_t x24, int8_t x25, int8_t x26, int8_t x27, + int8_t x28, int8_t x29, int8_t x30, int8_t x31) noexcept { + + sb[0 ] = x0 ; sb[1 ] = x1 ; sb[2 ] = x2 ; sb[3 ] = x3 ; + sb[4 ] = x4 ; sb[5 ] = x5 ; sb[6 ] = x6 ; sb[7 ] = x7 ; + sb[8 ] = x8 ; sb[9 ] = x9 ; sb[10] = x10; sb[11] = x11; + sb[12] = x12; sb[13] = x13; sb[14] = x14; sb[15] = x15; + sb[16] = x16; sb[17] = x17; sb[18] = x18; sb[19] = x19; + sb[20] = x20; sb[21] = x21; sb[22] = x22; sb[23] = x23; + sb[24] = x24; sb[25] = x25; sb[26] = x26; sb[27] = x27; + sb[28] = x28; sb[29] = x29; sb[30] = x30; sb[31] = x31; + } + + //! Sets all thirty two 8-bit unsigned integers. + inline void setU8( + uint8_t x0 , uint8_t x1 , uint8_t x2 , uint8_t x3 , + uint8_t x4 , uint8_t x5 , uint8_t x6 , uint8_t x7 , + uint8_t x8 , uint8_t x9 , uint8_t x10, uint8_t x11, + uint8_t x12, uint8_t x13, uint8_t x14, uint8_t x15, + uint8_t x16, uint8_t x17, uint8_t x18, uint8_t x19, + uint8_t x20, uint8_t x21, uint8_t x22, uint8_t x23, + uint8_t x24, uint8_t x25, uint8_t x26, uint8_t x27, + uint8_t x28, uint8_t x29, uint8_t x30, uint8_t x31) noexcept { + + ub[0 ] = x0 ; ub[1 ] = x1 ; ub[2 ] = x2 ; ub[3 ] = x3 ; + ub[4 ] = x4 ; ub[5 ] = x5 ; ub[6 ] = x6 ; ub[7 ] = x7 ; + ub[8 ] = x8 ; ub[9 ] = x9 ; ub[10] = x10; ub[11] = x11; + ub[12] = x12; ub[13] = x13; ub[14] = x14; ub[15] = x15; + ub[16] = x16; ub[17] = x17; ub[18] = x18; ub[19] = x19; + ub[20] = x20; ub[21] = x21; ub[22] = x22; ub[23] = x23; + ub[24] = x24; ub[25] = x25; ub[26] = x26; ub[27] = x27; + ub[28] = x28; ub[29] = x29; ub[30] = x30; ub[31] = x31; + } + + //! Sets all sixteen 16-bit signed integers. + inline void setI16(int16_t x0) noexcept { + setU16(uint16_t(x0)); + } + + //! Sets all eight 16-bit unsigned integers. + inline void setU16(uint16_t x0) noexcept { + if (ASMJIT_ARCH_BITS >= 64) { + uint64_t xq = uint64_t(x0) * 0x0001000100010001u; + uq[0] = xq; + uq[1] = xq; + uq[2] = xq; + uq[3] = xq; + } + else { + uint32_t xd = uint32_t(x0) * 0x00010001u; + ud[0] = xd; + ud[1] = xd; + ud[2] = xd; + ud[3] = xd; + ud[4] = xd; + ud[5] = xd; + ud[6] = xd; + ud[7] = xd; + } + } + + //! Sets all sixteen 16-bit signed integers. + inline void setI16( + int16_t x0, int16_t x1, int16_t x2 , int16_t x3 , int16_t x4 , int16_t x5 , int16_t x6 , int16_t x7, + int16_t x8, int16_t x9, int16_t x10, int16_t x11, int16_t x12, int16_t x13, int16_t x14, int16_t x15) noexcept { + + sw[0 ] = x0 ; sw[1 ] = x1 ; sw[2 ] = x2 ; sw[3 ] = x3 ; + sw[4 ] = x4 ; sw[5 ] = x5 ; sw[6 ] = x6 ; sw[7 ] = x7 ; + sw[8 ] = x8 ; sw[9 ] = x9 ; sw[10] = x10; sw[11] = x11; + sw[12] = x12; sw[13] = x13; sw[14] = x14; sw[15] = x15; + } + + //! Sets all sixteen 16-bit unsigned integers. + inline void setU16( + uint16_t x0, uint16_t x1, uint16_t x2 , uint16_t x3 , uint16_t x4 , uint16_t x5 , uint16_t x6 , uint16_t x7, + uint16_t x8, uint16_t x9, uint16_t x10, uint16_t x11, uint16_t x12, uint16_t x13, uint16_t x14, uint16_t x15) noexcept { + + uw[0 ] = x0 ; uw[1 ] = x1 ; uw[2 ] = x2 ; uw[3 ] = x3 ; + uw[4 ] = x4 ; uw[5 ] = x5 ; uw[6 ] = x6 ; uw[7 ] = x7 ; + uw[8 ] = x8 ; uw[9 ] = x9 ; uw[10] = x10; uw[11] = x11; + uw[12] = x12; uw[13] = x13; uw[14] = x14; uw[15] = x15; + } + + //! Sets all eight 32-bit signed integers. + inline void setI32(int32_t x0) noexcept { + setU32(uint32_t(x0)); + } + + //! Sets all eight 32-bit unsigned integers. + inline void setU32(uint32_t x0) noexcept { + if (ASMJIT_ARCH_BITS >= 64) { + uint64_t xq = (uint64_t(x0) << 32) + x0; + uq[0] = xq; + uq[1] = xq; + uq[2] = xq; + uq[3] = xq; + } + else { + ud[0] = x0; + ud[1] = x0; + ud[2] = x0; + ud[3] = x0; + ud[4] = x0; + ud[5] = x0; + ud[6] = x0; + ud[7] = x0; + } + } + + //! Sets all eight 32-bit signed integers. + inline void setI32( + int32_t x0, int32_t x1, int32_t x2, int32_t x3, + int32_t x4, int32_t x5, int32_t x6, int32_t x7) noexcept { + + sd[0] = x0; sd[1] = x1; sd[2] = x2; sd[3] = x3; + sd[4] = x4; sd[5] = x5; sd[6] = x6; sd[7] = x7; + } + + //! Sets all eight 32-bit unsigned integers. + inline void setU32( + uint32_t x0, uint32_t x1, uint32_t x2, uint32_t x3, + uint32_t x4, uint32_t x5, uint32_t x6, uint32_t x7) noexcept { + + ud[0] = x0; ud[1] = x1; ud[2] = x2; ud[3] = x3; + ud[4] = x4; ud[5] = x5; ud[6] = x6; ud[7] = x7; + } + + //! Sets all four 64-bit signed integers. + inline void setI64(int64_t x0) noexcept { + sq[0] = x0; sq[1] = x0; sq[2] = x0; sq[3] = x0; + } + + //! Sets all four 64-bit unsigned integers. + inline void setU64(uint64_t x0) noexcept { + uq[0] = x0; uq[1] = x0; uq[2] = x0; uq[3] = x0; + } + + //! Sets all four 64-bit signed integers. + inline void setI64(int64_t x0, int64_t x1, int64_t x2, int64_t x3) noexcept { + sq[0] = x0; sq[1] = x1; sq[2] = x2; sq[3] = x3; + } + + //! Sets all four 64-bit unsigned integers. + inline void setU64(uint64_t x0, uint64_t x1, uint64_t x2, uint64_t x3) noexcept { + uq[0] = x0; uq[1] = x1; uq[2] = x2; uq[3] = x3; + } + + //! Sets all eight SP-FP floats. + inline void setF32(float x0) noexcept { + sf[0] = x0; sf[1] = x0; sf[2] = x0; sf[3] = x0; + sf[4] = x0; sf[5] = x0; sf[6] = x0; sf[7] = x0; + } + + //! Sets all eight SP-FP floats. + inline void setF32( + float x0, float x1, float x2, float x3, + float x4, float x5, float x6, float x7) noexcept { + + sf[0] = x0; sf[1] = x1; sf[2] = x2; sf[3] = x3; + sf[4] = x4; sf[5] = x5; sf[6] = x6; sf[7] = x7; + } + + //! Sets all four DP-FP floats. + inline void setF64(double x0) noexcept { + df[0] = x0; df[1] = x0; df[2] = x0; df[3] = x0; + } + + //! Sets all four DP-FP floats. + inline void setF64(double x0, double x1, double x2, double x3) noexcept { + df[0] = x0; df[1] = x1; df[2] = x2; df[3] = x3; + } + + //! \} +}; + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_DATATYPES_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/emitter.cpp b/3rdparty/asmjit/src/asmjit/core/emitter.cpp new file mode 100644 index 00000000000..ebf8c179008 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/emitter.cpp @@ -0,0 +1,272 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#include "../core/logging.h" +#include "../core/support.h" + +#ifdef ASMJIT_BUILD_X86 + #include "../x86/x86internal_p.h" + #include "../x86/x86instdb_p.h" +#endif // ASMJIT_BUILD_X86 + +#ifdef ASMJIT_BUILD_ARM + #include "../arm/arminternal_p.h" + #include "../arm/arminstdb.h" +#endif // ASMJIT_BUILD_ARM + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::BaseEmitter - Construction / Destruction] +// ============================================================================ + +BaseEmitter::BaseEmitter(uint32_t type) noexcept + : _type(uint8_t(type)), + _reserved(0), + _flags(0), + _emitterOptions(0), + _code(nullptr), + _errorHandler(nullptr), + _codeInfo(), + _gpRegInfo(), + _privateData(0), + _instOptions(0), + _globalInstOptions(BaseInst::kOptionReserved), + _extraReg(), + _inlineComment(nullptr) {} + +BaseEmitter::~BaseEmitter() noexcept { + if (_code) { + _addFlags(kFlagDestroyed); + _code->detach(this); + } +} + +// ============================================================================ +// [asmjit::BaseEmitter - Code-Generation] +// ============================================================================ + +Error BaseEmitter::_emitOpArray(uint32_t instId, const Operand_* operands, size_t count) { + const Operand_* op = operands; + const Operand& none_ = Globals::none; + + switch (count) { + case 0: return _emit(instId, none_, none_, none_, none_); + case 1: return _emit(instId, op[0], none_, none_, none_); + case 2: return _emit(instId, op[0], op[1], none_, none_); + case 3: return _emit(instId, op[0], op[1], op[2], none_); + case 4: return _emit(instId, op[0], op[1], op[2], op[3]); + case 5: return _emit(instId, op[0], op[1], op[2], op[3], op[4], none_); + case 6: return _emit(instId, op[0], op[1], op[2], op[3], op[4], op[5]); + default: return DebugUtils::errored(kErrorInvalidArgument); + } +} + +// ============================================================================ +// [asmjit::BaseEmitter - Finalize] +// ============================================================================ + +Label BaseEmitter::labelByName(const char* name, size_t nameSize, uint32_t parentId) noexcept { + return Label(_code ? _code->labelIdByName(name, nameSize, parentId) : uint32_t(Globals::kInvalidId)); +} + +// ============================================================================ +// [asmjit::BaseEmitter - Finalize] +// ============================================================================ + +Error BaseEmitter::finalize() { + // Does nothing by default, overridden by `BaseBuilder` and `BaseCompiler`. + return kErrorOk; +} + +// ============================================================================ +// [asmjit::BaseEmitter - Error Handling] +// ============================================================================ + +Error BaseEmitter::reportError(Error err, const char* message) { + ErrorHandler* handler = errorHandler(); + if (!handler) { + if (code()) + handler = code()->errorHandler(); + } + + if (handler) { + if (!message) + message = DebugUtils::errorAsString(err); + handler->handleError(err, message, this); + } + + return err; +} + +// ============================================================================ +// [asmjit::BaseEmitter - Label Management] +// ============================================================================ + +bool BaseEmitter::isLabelValid(uint32_t labelId) const noexcept { + return _code && labelId < _code->labelCount(); +} + +// ============================================================================ +// [asmjit::BaseEmitter - Emit (High-Level)] +// ============================================================================ + +ASMJIT_FAVOR_SIZE Error BaseEmitter::emitProlog(const FuncFrame& frame) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + +#ifdef ASMJIT_BUILD_X86 + if (archInfo().isX86Family()) + return x86::X86Internal::emitProlog(as(), frame); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (archInfo().isArmFamily()) + return arm::ArmInternal::emitProlog(as(), frame); +#endif + + return DebugUtils::errored(kErrorInvalidArch); +} + +ASMJIT_FAVOR_SIZE Error BaseEmitter::emitEpilog(const FuncFrame& frame) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + +#ifdef ASMJIT_BUILD_X86 + if (archInfo().isX86Family()) + return x86::X86Internal::emitEpilog(as(), frame); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (archInfo().isArmFamily()) + return arm::ArmInternal::emitEpilog(as(), frame); +#endif + + return DebugUtils::errored(kErrorInvalidArch); +} + +ASMJIT_FAVOR_SIZE Error BaseEmitter::emitArgsAssignment(const FuncFrame& frame, const FuncArgsAssignment& args) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + +#ifdef ASMJIT_BUILD_X86 + if (archInfo().isX86Family()) + return x86::X86Internal::emitArgsAssignment(as(), frame, args); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (archInfo().isArmFamily()) + return arm::ArmInternal::emitArgsAssignment(as(), frame, args); +#endif + + return DebugUtils::errored(kErrorInvalidArch); +} + +// ============================================================================ +// [asmjit::BaseEmitter - Comment] +// ============================================================================ + +Error BaseEmitter::commentf(const char* fmt, ...) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + +#ifndef ASMJIT_NO_LOGGING + StringTmp<1024> sb; + + va_list ap; + va_start(ap, fmt); + Error err = sb.appendVFormat(fmt, ap); + va_end(ap); + + if (ASMJIT_UNLIKELY(err)) + return err; + + return comment(sb.data(), sb.size()); +#else + DebugUtils::unused(fmt); + return kErrorOk; +#endif +} + +Error BaseEmitter::commentv(const char* fmt, va_list ap) { + if (ASMJIT_UNLIKELY(!_code)) + return DebugUtils::errored(kErrorNotInitialized); + +#ifndef ASMJIT_NO_LOGGING + StringTmp<1024> sb; + + Error err = sb.appendVFormat(fmt, ap); + if (ASMJIT_UNLIKELY(err)) + return err; + + return comment(sb.data(), sb.size()); +#else + DebugUtils::unused(fmt, ap); + return kErrorOk; +#endif +} + +// ============================================================================ +// [asmjit::BaseEmitter - Events] +// ============================================================================ + +Error BaseEmitter::onAttach(CodeHolder* code) noexcept { + _code = code; + _codeInfo = code->codeInfo(); + _emitterOptions = code->emitterOptions(); + + onUpdateGlobalInstOptions(); + return kErrorOk; +} + +Error BaseEmitter::onDetach(CodeHolder* code) noexcept { + DebugUtils::unused(code); + + _flags = 0; + _emitterOptions = 0; + _errorHandler = nullptr; + + _codeInfo.reset(); + _gpRegInfo.reset(); + _privateData = 0; + + _instOptions = 0; + _globalInstOptions = BaseInst::kOptionReserved; + _extraReg.reset(); + _inlineComment = nullptr; + + return kErrorOk; +} + +void BaseEmitter::onUpdateGlobalInstOptions() noexcept { + constexpr uint32_t kCriticalEmitterOptions = + kOptionLoggingEnabled | + kOptionStrictValidation ; + + _globalInstOptions &= ~BaseInst::kOptionReserved; + if ((_emitterOptions & kCriticalEmitterOptions) != 0) + _globalInstOptions |= BaseInst::kOptionReserved; +} + +ASMJIT_END_NAMESPACE diff --git a/3rdparty/asmjit/src/asmjit/core/emitter.h b/3rdparty/asmjit/src/asmjit/core/emitter.h new file mode 100644 index 00000000000..585558457bd --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/emitter.h @@ -0,0 +1,554 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_EMITTER_H_INCLUDED +#define ASMJIT_CORE_EMITTER_H_INCLUDED + +#include "../core/arch.h" +#include "../core/inst.h" +#include "../core/operand.h" +#include "../core/codeholder.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_core +//! \{ + +// ============================================================================ +// [Forward Declarations] +// ============================================================================ + +class ConstPool; +class FuncFrame; +class FuncArgsAssignment; + +// ============================================================================ +// [asmjit::BaseEmitter] +// ============================================================================ + +//! Provides a base foundation to emit code - specialized by `Assembler` and +//! `BaseBuilder`. +class ASMJIT_VIRTAPI BaseEmitter { +public: + ASMJIT_BASE_CLASS(BaseEmitter) + + //! See `EmitterType`. + uint8_t _type; + //! Reserved for future use. + uint8_t _reserved; + //! See \ref BaseEmitter::Flags. + uint16_t _flags; + //! Emitter options, always in sync with CodeHolder. + uint32_t _emitterOptions; + + //! CodeHolder the BaseEmitter is attached to. + CodeHolder* _code; + //! Attached `ErrorHandler`. + ErrorHandler* _errorHandler; + + //! Basic information about the code (matches CodeHolder::_codeInfo). + CodeInfo _codeInfo; + //! Native GP register signature and signature related information. + RegInfo _gpRegInfo; + //! Internal private data used freely by any emitter. + uint32_t _privateData; + + //! Next instruction options (affects the next instruction). + uint32_t _instOptions; + //! Global Instruction options (combined with `_instOptions` by `emit...()`). + uint32_t _globalInstOptions; + //! Extra register (op-mask {k} on AVX-512) (affects the next instruction). + RegOnly _extraReg; + //! Inline comment of the next instruction (affects the next instruction). + const char* _inlineComment; + + //! Emitter type. + enum EmitterType : uint32_t { + //! Unknown or uninitialized. + kTypeNone = 0, + //! Emitter inherits from `BaseAssembler`. + kTypeAssembler = 1, + //! Emitter inherits from `BaseBuilder`. + kTypeBuilder = 2, + //! Emitter inherits from `BaseCompiler`. + kTypeCompiler = 3, + //! Count of emitter types. + kTypeCount = 4 + }; + + //! Emitter flags. + enum Flags : uint32_t { + //! The emitter was finalized. + kFlagFinalized = 0x4000u, + //! The emitter was destroyed. + kFlagDestroyed = 0x8000u + }; + + //! Emitter options. + enum Options : uint32_t { + //! Logging is enabled, `BaseEmitter::logger()` must return a valid logger. + //! This option is set automatically by the emitter if the logger is present. + //! User code should never alter this value. + //! + //! Default `false`. + kOptionLoggingEnabled = 0x00000001u, + + //! Stricly validate each instruction before it's emitted. + //! + //! Default `false`. + kOptionStrictValidation = 0x00000002u, + + //! Emit instructions that are optimized for size, if possible. + //! + //! Default `false`. + //! + //! X86 Specific + //! ------------ + //! + //! When this option is set it the assembler will try to fix instructions + //! if possible into operation equivalent instructions that take less bytes + //! by taking advantage of implicit zero extension. For example instruction + //! like `mov r64, imm` and `and r64, imm` can be translated to `mov r32, imm` + //! and `and r32, imm` when the immediate constant is lesser than `2^31`. + kOptionOptimizedForSize = 0x00000004u, + + //! Emit optimized code-alignment sequences. + //! + //! Default `false`. + //! + //! X86 Specific + //! ------------ + //! + //! Default align sequence used by X86 architecture is one-byte (0x90) + //! opcode that is often shown by disassemblers as NOP. However there are + //! more optimized align sequences for 2-11 bytes that may execute faster + //! on certain CPUs. If this feature is enabled AsmJit will generate + //! specialized sequences for alignment between 2 to 11 bytes. + kOptionOptimizedAlign = 0x00000008u, + + //! Emit jump-prediction hints. + //! + //! Default `false`. + //! + //! X86 Specific + //! ------------ + //! + //! Jump prediction is usually based on the direction of the jump. If the + //! jump is backward it is usually predicted as taken; and if the jump is + //! forward it is usually predicted as not-taken. The reason is that loops + //! generally use backward jumps and conditions usually use forward jumps. + //! However this behavior can be overridden by using instruction prefixes. + //! If this option is enabled these hints will be emitted. + //! + //! This feature is disabled by default, because the only processor that + //! used to take into consideration prediction hints was P4. Newer processors + //! implement heuristics for branch prediction and ignore static hints. This + //! means that this feature can be used for annotation purposes. + kOptionPredictedJumps = 0x00000010u + }; + + //! \name Construction & Destruction + //! \{ + + ASMJIT_API explicit BaseEmitter(uint32_t type) noexcept; + ASMJIT_API virtual ~BaseEmitter() noexcept; + + //! \} + + //! \name Cast + //! \{ + + template + inline T* as() noexcept { return reinterpret_cast(this); } + + template + inline const T* as() const noexcept { return reinterpret_cast(this); } + + //! \} + + //! \name Emitter Type & Flags + //! \{ + + //! Returns the type of this emitter, see `EmitterType`. + inline uint32_t emitterType() const noexcept { return _type; } + //! Returns emitter flags , see `Flags`. + inline uint32_t emitterFlags() const noexcept { return _flags; } + + //! Tests whether the emitter inherits from `BaseAssembler`. + inline bool isAssembler() const noexcept { return _type == kTypeAssembler; } + //! Tests whether the emitter inherits from `BaseBuilder`. + //! + //! \note Both Builder and Compiler emitters would return `true`. + inline bool isBuilder() const noexcept { return _type >= kTypeBuilder; } + //! Tests whether the emitter inherits from `BaseCompiler`. + inline bool isCompiler() const noexcept { return _type == kTypeCompiler; } + + //! Tests whether the emitter has the given `flag` enabled. + inline bool hasFlag(uint32_t flag) const noexcept { return (_flags & flag) != 0; } + //! Tests whether the emitter is finalized. + inline bool isFinalized() const noexcept { return hasFlag(kFlagFinalized); } + //! Tests whether the emitter is destroyed (only used during destruction). + inline bool isDestroyed() const noexcept { return hasFlag(kFlagDestroyed); } + + inline void _addFlags(uint32_t flags) noexcept { _flags = uint16_t(_flags | flags); } + inline void _clearFlags(uint32_t flags) noexcept { _flags = uint16_t(_flags & ~flags); } + + //! \} + + //! \name Target Information + //! \{ + + //! Returns the CodeHolder this emitter is attached to. + inline CodeHolder* code() const noexcept { return _code; } + //! Returns an information about the code, see `CodeInfo`. + inline const CodeInfo& codeInfo() const noexcept { return _codeInfo; } + //! Returns an information about the architecture, see `ArchInfo`. + inline const ArchInfo& archInfo() const noexcept { return _codeInfo.archInfo(); } + + //! Tests whether the target architecture is 32-bit. + inline bool is32Bit() const noexcept { return archInfo().is32Bit(); } + //! Tests whether the target architecture is 64-bit. + inline bool is64Bit() const noexcept { return archInfo().is64Bit(); } + + //! Returns the target architecture type. + inline uint32_t archId() const noexcept { return archInfo().archId(); } + //! Returns the target architecture sub-type. + inline uint32_t archSubId() const noexcept { return archInfo().archSubId(); } + //! Returns the target architecture's GP register size (4 or 8 bytes). + inline uint32_t gpSize() const noexcept { return archInfo().gpSize(); } + //! Returns the number of target GP registers. + inline uint32_t gpCount() const noexcept { return archInfo().gpCount(); } + + //! \} + + //! \name Initialization & Finalization + //! \{ + + //! Tests whether the BaseEmitter is initialized (i.e. attached to the `CodeHolder`). + inline bool isInitialized() const noexcept { return _code != nullptr; } + + ASMJIT_API virtual Error finalize(); + + //! \} + + //! \name Emitter Options + //! \{ + + //! Tests whether the `option` is present in emitter options. + inline bool hasEmitterOption(uint32_t option) const noexcept { return (_emitterOptions & option) != 0; } + //! Returns the emitter options. + inline uint32_t emitterOptions() const noexcept { return _emitterOptions; } + + // TODO: Deprecate and remove, CodeHolder::addEmitterOptions() is the way. + inline void addEmitterOptions(uint32_t options) noexcept { + _emitterOptions |= options; + onUpdateGlobalInstOptions(); + } + + inline void clearEmitterOptions(uint32_t options) noexcept { + _emitterOptions &= ~options; + onUpdateGlobalInstOptions(); + } + + //! Returns the global instruction options. + //! + //! Default instruction options are merged with instruction options before the + //! instruction is encoded. These options have some bits reserved that are used + //! for error handling, logging, and strict validation. Other options are globals that + //! affect each instruction, for example if VEX3 is set globally, it will all + //! instructions, even those that don't have such option set. + inline uint32_t globalInstOptions() const noexcept { return _globalInstOptions; } + + //! \} + + //! \name Error Handling + //! \{ + + //! Tests whether the local error handler is attached. + inline bool hasErrorHandler() const noexcept { return _errorHandler != nullptr; } + //! Returns the local error handler. + inline ErrorHandler* errorHandler() const noexcept { return _errorHandler; } + //! Sets the local error handler. + inline void setErrorHandler(ErrorHandler* handler) noexcept { _errorHandler = handler; } + //! Resets the local error handler (does nothing if not attached). + inline void resetErrorHandler() noexcept { setErrorHandler(nullptr); } + + //! Handles the given error in the following way: + //! 1. Gets either Emitter's (preferred) or CodeHolder's ErrorHandler. + //! 2. If exists, calls `ErrorHandler::handleError(error, message, this)`. + //! 3. Returns the given `err` if ErrorHandler haven't thrown. + ASMJIT_API Error reportError(Error err, const char* message = nullptr); + + //! \} + + //! \name Instruction Options + //! \{ + + //! Returns options of the next instruction. + inline uint32_t instOptions() const noexcept { return _instOptions; } + //! Returns options of the next instruction. + inline void setInstOptions(uint32_t options) noexcept { _instOptions = options; } + //! Adds options of the next instruction. + inline void addInstOptions(uint32_t options) noexcept { _instOptions |= options; } + //! Resets options of the next instruction. + inline void resetInstOptions() noexcept { _instOptions = 0; } + + //! Tests whether the extra register operand is valid. + inline bool hasExtraReg() const noexcept { return _extraReg.isReg(); } + //! Returns an extra operand that will be used by the next instruction (architecture specific). + inline const RegOnly& extraReg() const noexcept { return _extraReg; } + //! Sets an extra operand that will be used by the next instruction (architecture specific). + inline void setExtraReg(const BaseReg& reg) noexcept { _extraReg.init(reg); } + //! Sets an extra operand that will be used by the next instruction (architecture specific). + inline void setExtraReg(const RegOnly& reg) noexcept { _extraReg.init(reg); } + //! Resets an extra operand that will be used by the next instruction (architecture specific). + inline void resetExtraReg() noexcept { _extraReg.reset(); } + + //! Returns comment/annotation of the next instruction. + inline const char* inlineComment() const noexcept { return _inlineComment; } + //! Sets comment/annotation of the next instruction. + //! + //! \note This string is set back to null by `_emit()`, but until that it has + //! to remain valid as the Emitter is not required to make a copy of it (and + //! it would be slow to do that for each instruction). + inline void setInlineComment(const char* s) noexcept { _inlineComment = s; } + //! Resets the comment/annotation to nullptr. + inline void resetInlineComment() noexcept { _inlineComment = nullptr; } + + //! \} + + //! \name Sections + //! \{ + + virtual Error section(Section* section) = 0; + + //! \} + + //! \name Labels + //! \{ + + //! Creates a new label. + virtual Label newLabel() = 0; + //! Creates a new named label. + virtual Label newNamedLabel(const char* name, size_t nameSize = SIZE_MAX, uint32_t type = Label::kTypeGlobal, uint32_t parentId = Globals::kInvalidId) = 0; + + //! Returns `Label` by `name`. + //! + //! Returns invalid Label in case that the name is invalid or label was not found. + //! + //! \note This function doesn't trigger ErrorHandler in case the name is invalid + //! or no such label exist. You must always check the validity of the `Label` returned. + ASMJIT_API Label labelByName(const char* name, size_t nameSize = SIZE_MAX, uint32_t parentId = Globals::kInvalidId) noexcept; + + //! Binds the `label` to the current position of the current section. + //! + //! \note Attempt to bind the same label multiple times will return an error. + virtual Error bind(const Label& label) = 0; + + //! Tests whether the label `id` is valid (i.e. registered). + ASMJIT_API bool isLabelValid(uint32_t labelId) const noexcept; + //! Tests whether the `label` is valid (i.e. registered). + inline bool isLabelValid(const Label& label) const noexcept { return isLabelValid(label.id()); } + + //! \} + + //! \name Emit + //! \{ + + // NOTE: These `emit()` helpers are designed to address a code-bloat generated + // by C++ compilers to call a function having many arguments. Each parameter to + // `_emit()` requires some code to pass it, which means that if we default to 4 + // operand parameters in `_emit()` and instId the C++ compiler would have to + // generate a virtual function call having 5 parameters, which is quite a lot. + // Since by default asm instructions have 2 to 3 operands it's better to + // introduce helpers that pass those and fill out the remaining operands. + + #define OP const Operand_& + #define NONE Globals::none + + //! Emits an instruction. + ASMJIT_NOINLINE Error emit(uint32_t instId) { return _emit(instId, NONE, NONE, NONE, NONE); } + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, OP o0) { return _emit(instId, o0, NONE, NONE, NONE); } + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, OP o0, OP o1) { return _emit(instId, o0, o1, NONE, NONE); } + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, OP o0, OP o1, OP o2) { return _emit(instId, o0, o1, o2, NONE); } + //! \overload + inline Error emit(uint32_t instId, OP o0, OP o1, OP o2, OP o3) { return _emit(instId, o0, o1, o2, o3); } + //! \overload + inline Error emit(uint32_t instId, OP o0, OP o1, OP o2, OP o3, OP o4) { return _emit(instId, o0, o1, o2, o3, o4, NONE); } + //! \overload + inline Error emit(uint32_t instId, OP o0, OP o1, OP o2, OP o3, OP o4, OP o5) { return _emit(instId, o0, o1, o2, o3, o4, o5); } + + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, int o0) { return _emit(instId, Imm(o0), NONE, NONE, NONE); } + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, OP o0, int o1) { return _emit(instId, o0, Imm(o1), NONE, NONE); } + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, OP o0, OP o1, int o2) { return _emit(instId, o0, o1, Imm(o2), NONE); } + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, OP o0, OP o1, OP o2, int o3) { return _emit(instId, o0, o1, o2, Imm(o3)); } + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, OP o0, OP o1, OP o2, OP o3, int o4) { return _emit(instId, o0, o1, o2, o3, Imm(o4), NONE); } + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, OP o0, OP o1, OP o2, OP o3, OP o4, int o5) { return _emit(instId, o0, o1, o2, o3, o4, Imm(o5)); } + + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, int64_t o0) { return _emit(instId, Imm(o0), NONE, NONE, NONE); } + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, OP o0, int64_t o1) { return _emit(instId, o0, Imm(o1), NONE, NONE); } + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, OP o0, OP o1, int64_t o2) { return _emit(instId, o0, o1, Imm(o2), NONE); } + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, OP o0, OP o1, OP o2, int64_t o3) { return _emit(instId, o0, o1, o2, Imm(o3)); } + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, OP o0, OP o1, OP o2, OP o3, int64_t o4) { return _emit(instId, o0, o1, o2, o3, Imm(o4), NONE); } + //! \overload + ASMJIT_NOINLINE Error emit(uint32_t instId, OP o0, OP o1, OP o2, OP o3, OP o4, int64_t o5) { return _emit(instId, o0, o1, o2, o3, o4, Imm(o5)); } + + //! \overload + inline Error emit(uint32_t instId, unsigned int o0) { return emit(instId, int64_t(o0)); } + //! \overload + inline Error emit(uint32_t instId, OP o0, unsigned int o1) { return emit(instId, o0, int64_t(o1)); } + //! \overload + inline Error emit(uint32_t instId, OP o0, OP o1, unsigned int o2) { return emit(instId, o0, o1, int64_t(o2)); } + //! \overload + inline Error emit(uint32_t instId, OP o0, OP o1, OP o2, unsigned int o3) { return emit(instId, o0, o1, o2, int64_t(o3)); } + //! \overload + inline Error emit(uint32_t instId, OP o0, OP o1, OP o2, OP o3, unsigned int o4) { return emit(instId, o0, o1, o2, o3, int64_t(o4)); } + //! \overload + inline Error emit(uint32_t instId, OP o0, OP o1, OP o2, OP o3, OP o4, unsigned int o5) { return emit(instId, o0, o1, o2, o3, o4, int64_t(o5)); } + + //! \overload + inline Error emit(uint32_t instId, uint64_t o0) { return emit(instId, int64_t(o0)); } + //! \overload + inline Error emit(uint32_t instId, OP o0, uint64_t o1) { return emit(instId, o0, int64_t(o1)); } + //! \overload + inline Error emit(uint32_t instId, OP o0, OP o1, uint64_t o2) { return emit(instId, o0, o1, int64_t(o2)); } + //! \overload + inline Error emit(uint32_t instId, OP o0, OP o1, OP o2, uint64_t o3) { return emit(instId, o0, o1, o2, int64_t(o3)); } + //! \overload + inline Error emit(uint32_t instId, OP o0, OP o1, OP o2, OP o3, uint64_t o4) { return emit(instId, o0, o1, o2, o3, int64_t(o4)); } + //! \overload + inline Error emit(uint32_t instId, OP o0, OP o1, OP o2, OP o3, OP o4, uint64_t o5) { return emit(instId, o0, o1, o2, o3, o4, int64_t(o5)); } + + #undef NONE + #undef OP + + inline Error emitOpArray(uint32_t instId, const Operand_* operands, size_t count) { return _emitOpArray(instId, operands, count); } + + inline Error emitInst(const BaseInst& inst, const Operand_* operands, size_t count) { + setInstOptions(inst.options()); + setExtraReg(inst.extraReg()); + return _emitOpArray(inst.id(), operands, count); + } + + //! \cond INTERNAL + //! Emits instruction having max 4 operands. + virtual Error _emit(uint32_t instId, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3) = 0; + //! Emits instruction having max 6 operands. + virtual Error _emit(uint32_t instId, const Operand_& o0, const Operand_& o1, const Operand_& o2, const Operand_& o3, const Operand_& o4, const Operand_& o5) = 0; + //! Emits instruction having operands stored in array. + virtual Error _emitOpArray(uint32_t instId, const Operand_* operands, size_t count); + //! \endcond + + //! \} + + //! \name Emit Utilities + //! \{ + + ASMJIT_API Error emitProlog(const FuncFrame& layout); + ASMJIT_API Error emitEpilog(const FuncFrame& layout); + ASMJIT_API Error emitArgsAssignment(const FuncFrame& layout, const FuncArgsAssignment& args); + + //! \} + + //! \name Align + //! \{ + + //! Aligns the current CodeBuffer to the `alignment` specified. + //! + //! The sequence that is used to fill the gap between the aligned location + //! and the current location depends on the align `mode`, see `AlignMode`. + virtual Error align(uint32_t alignMode, uint32_t alignment) = 0; + + //! \} + + //! \name Embed + //! \{ + + //! Embeds raw data into the CodeBuffer. + virtual Error embed(const void* data, uint32_t dataSize) = 0; + + //! Embeds an absolute label address as data (4 or 8 bytes). + virtual Error embedLabel(const Label& label) = 0; + + //! Embeds a delta (distance) between the `label` and `base` calculating it + //! as `label - base`. This function was designed to make it easier to embed + //! lookup tables where each index is a relative distance of two labels. + virtual Error embedLabelDelta(const Label& label, const Label& base, uint32_t dataSize) = 0; + + //! Embeds a constant pool at the current offset by performing the following: + //! 1. Aligns by using kAlignData to the minimum `pool` alignment. + //! 2. Binds the ConstPool label so it's bound to an aligned location. + //! 3. Emits ConstPool content. + virtual Error embedConstPool(const Label& label, const ConstPool& pool) = 0; + + //! \} + + //! \name Comment + //! \{ + + //! Emits a comment stored in `data` with an optional `size` parameter. + virtual Error comment(const char* data, size_t size = SIZE_MAX) = 0; + + //! Emits a formatted comment specified by `fmt` and variable number of arguments. + ASMJIT_API Error commentf(const char* fmt, ...); + //! Emits a formatted comment specified by `fmt` and `ap`. + ASMJIT_API Error commentv(const char* fmt, va_list ap); + + //! \} + + //! \name Events + //! \{ + + //! Called after the emitter was attached to `CodeHolder`. + virtual Error onAttach(CodeHolder* code) noexcept = 0; + //! Called after the emitter was detached from `CodeHolder`. + virtual Error onDetach(CodeHolder* code) noexcept = 0; + + //! Called to update `_globalInstOptions` based on `_emitterOptions`. + //! + //! This function should only touch one bit `BaseInst::kOptionReserved`, which + //! is used to handle errors and special-cases in a way that minimizes branching. + ASMJIT_API void onUpdateGlobalInstOptions() noexcept; + + //! \} +}; + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_EMITTER_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/features.h b/3rdparty/asmjit/src/asmjit/core/features.h new file mode 100644 index 00000000000..193841c76c8 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/features.h @@ -0,0 +1,162 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_FEATURES_H_INCLUDED +#define ASMJIT_CORE_FEATURES_H_INCLUDED + +#include "../core/globals.h" +#include "../core/support.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_core +//! \{ + +// ============================================================================ +// [asmjit::BaseFeatures] +// ============================================================================ + +class BaseFeatures { +public: + typedef Support::BitWord BitWord; + + enum : uint32_t { + kMaxFeatures = 128, + kNumBitWords = kMaxFeatures / Support::kBitWordSizeInBits + }; + + BitWord _bits[kNumBitWords]; + + //! \name Construction & Destruction + //! \{ + + inline BaseFeatures() noexcept { reset(); } + inline BaseFeatures(const BaseFeatures& other) noexcept = default; + inline explicit BaseFeatures(Globals::NoInit_) noexcept {} + + inline void reset() noexcept { + for (size_t i = 0; i < kNumBitWords; i++) + _bits[i] = 0; + } + + //! \} + + //! \name Overloaded Operators + //! \{ + + inline BaseFeatures& operator=(const BaseFeatures& other) noexcept = default; + + inline bool operator==(const BaseFeatures& other) noexcept { return eq(other); } + inline bool operator!=(const BaseFeatures& other) noexcept { return !eq(other); } + + //! \} + + //! \name Cast + //! \{ + + template + inline T& as() noexcept { return static_cast(*this); } + + template + inline const T& as() const noexcept { return static_cast(*this); } + + //! \} + + //! \name Accessors + //! \{ + + //! Returns all features as `BitWord` array. + inline BitWord* bits() noexcept { return _bits; } + //! Returns all features as `BitWord` array (const). + inline const BitWord* bits() const noexcept { return _bits; } + + //! Tests whether the feature `featureId` is present. + inline bool has(uint32_t featureId) const noexcept { + ASMJIT_ASSERT(featureId < kMaxFeatures); + + uint32_t idx = featureId / Support::kBitWordSizeInBits; + uint32_t bit = featureId % Support::kBitWordSizeInBits; + + return bool((_bits[idx] >> bit) & 0x1); + } + + //! Tests whether all features as defined by `other` are present. + inline bool hasAll(const BaseFeatures& other) const noexcept { + for (uint32_t i = 0; i < kNumBitWords; i++) + if ((_bits[i] & other._bits[i]) != other._bits[i]) + return false; + return true; + } + + //! \} + + //! \name Utilities + //! \{ + + //! Adds the given CPU `featureId` to the list of features. + inline void add(uint32_t featureId) noexcept { + ASMJIT_ASSERT(featureId < kMaxFeatures); + + uint32_t idx = featureId / Support::kBitWordSizeInBits; + uint32_t bit = featureId % Support::kBitWordSizeInBits; + + _bits[idx] |= BitWord(1) << bit; + } + + template + inline void add(uint32_t featureId, Args... otherIds) noexcept { + add(featureId); + add(otherIds...); + } + + //! Removes the given CPU `featureId` from the list of features. + inline void remove(uint32_t featureId) noexcept { + ASMJIT_ASSERT(featureId < kMaxFeatures); + + uint32_t idx = featureId / Support::kBitWordSizeInBits; + uint32_t bit = featureId % Support::kBitWordSizeInBits; + + _bits[idx] &= ~(BitWord(1) << bit); + } + + template + inline void remove(uint32_t featureId, Args... otherIds) noexcept { + remove(featureId); + remove(otherIds...); + } + + inline bool eq(const BaseFeatures& other) const noexcept { + for (size_t i = 0; i < kNumBitWords; i++) + if (_bits[i] != other._bits[i]) + return false; + return true; + } + + //! \} +}; + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_FEATURES_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/func.cpp b/3rdparty/asmjit/src/asmjit/core/func.cpp new file mode 100644 index 00000000000..79eab2e83ad --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/func.cpp @@ -0,0 +1,144 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#include "../core/arch.h" +#include "../core/func.h" +#include "../core/type.h" + +#ifdef ASMJIT_BUILD_X86 + #include "../x86/x86internal_p.h" + #include "../x86/x86operand.h" +#endif + +#ifdef ASMJIT_BUILD_ARM + #include "../arm/arminternal_p.h" + #include "../arm/armoperand.h" +#endif + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::FuncDetail - Init / Reset] +// ============================================================================ + +ASMJIT_FAVOR_SIZE Error FuncDetail::init(const FuncSignature& sign) { + uint32_t ccId = sign.callConv(); + CallConv& cc = _callConv; + + uint32_t argCount = sign.argCount(); + if (ASMJIT_UNLIKELY(argCount > Globals::kMaxFuncArgs)) + return DebugUtils::errored(kErrorInvalidArgument); + + ASMJIT_PROPAGATE(cc.init(ccId)); + + uint32_t gpSize = (cc.archId() == ArchInfo::kIdX86) ? 4 : 8; + uint32_t deabstractDelta = Type::deabstractDeltaOfSize(gpSize); + + const uint8_t* args = sign.args(); + for (uint32_t i = 0; i < argCount; i++) { + FuncValue& arg = _args[i]; + arg.initTypeId(Type::deabstract(args[i], deabstractDelta)); + } + _argCount = uint8_t(argCount); + _vaIndex = uint8_t(sign.vaIndex()); + + uint32_t ret = sign.ret(); + if (ret != Type::kIdVoid) { + _rets[0].initTypeId(Type::deabstract(ret, deabstractDelta)); + _retCount = 1; + } + +#ifdef ASMJIT_BUILD_X86 + if (CallConv::isX86Family(ccId)) + return x86::X86Internal::initFuncDetail(*this, sign, gpSize); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (CallConv::isArmFamily(ccId)) + return arm::ArmInternal::initFuncDetail(*this, sign, gpSize); +#endif + + // We should never bubble here as if `cc.init()` succeeded then there has to + // be an implementation for the current architecture. However, stay safe. + return DebugUtils::errored(kErrorInvalidArgument); +} + +// ============================================================================ +// [asmjit::FuncFrame - Init / Reset / Finalize] +// ============================================================================ + +ASMJIT_FAVOR_SIZE Error FuncFrame::init(const FuncDetail& func) noexcept { + uint32_t ccId = func.callConv().id(); + +#ifdef ASMJIT_BUILD_X86 + if (CallConv::isX86Family(ccId)) + return x86::X86Internal::initFuncFrame(*this, func); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (CallConv::isArmFamily(ccId)) + return arm::ArmInternal::initFuncFrame(*this, func); +#endif + + return DebugUtils::errored(kErrorInvalidArgument); +} + +ASMJIT_FAVOR_SIZE Error FuncFrame::finalize() noexcept { +#ifdef ASMJIT_BUILD_X86 + if (ArchInfo::isX86Family(archId())) + return x86::X86Internal::finalizeFuncFrame(*this); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (ArchInfo::isArmFamily(archId())) + return arm::ArmInternal::finalizeFuncFrame(*this); +#endif + + return DebugUtils::errored(kErrorInvalidArgument); +} + +// ============================================================================ +// [asmjit::FuncArgsAssignment] +// ============================================================================ + +ASMJIT_FAVOR_SIZE Error FuncArgsAssignment::updateFuncFrame(FuncFrame& frame) const noexcept { + const FuncDetail* func = funcDetail(); + if (!func) return DebugUtils::errored(kErrorInvalidState); + + uint32_t ccId = func->callConv().id(); + +#ifdef ASMJIT_BUILD_X86 + if (CallConv::isX86Family(ccId)) + return x86::X86Internal::argsToFuncFrame(*this, frame); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (CallConv::isArmFamily(ccId)) + return arm::ArmInternal::argsToFuncFrame(*this, frame); +#endif + + return DebugUtils::errored(kErrorInvalidArch); +} + +ASMJIT_END_NAMESPACE diff --git a/3rdparty/asmjit/src/asmjit/core/func.h b/3rdparty/asmjit/src/asmjit/core/func.h new file mode 100644 index 00000000000..36ebf9bb526 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/func.h @@ -0,0 +1,966 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_FUNC_H_INCLUDED +#define ASMJIT_CORE_FUNC_H_INCLUDED + +#include "../core/arch.h" +#include "../core/callconv.h" +#include "../core/operand.h" +#include "../core/type.h" +#include "../core/support.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_func +//! \{ + +// ============================================================================ +// [asmjit::FuncArgIndex] +// ============================================================================ + +//! Function argument index (lo/hi). +enum FuncArgIndex : uint32_t { + //! Maximum number of function arguments supported by AsmJit. + kFuncArgCount = Globals::kMaxFuncArgs, + //! Extended maximum number of arguments (used internally). + kFuncArgCountLoHi = kFuncArgCount * 2, + + //! Index to the LO part of function argument (default). + //! + //! This value is typically omitted and added only if there is HI argument + //! accessed. + kFuncArgLo = 0, + + //! Index to the HI part of function argument. + //! + //! HI part of function argument depends on target architecture. On x86 it's + //! typically used to transfer 64-bit integers (they form a pair of 32-bit + //! integers). + kFuncArgHi = kFuncArgCount +}; + +// ============================================================================ +// [asmjit::FuncSignature] +// ============================================================================ + +//! Function signature. +//! +//! Contains information about function return type, count of arguments and +//! their TypeIds. Function signature is a low level structure which doesn't +//! contain platform specific or calling convention specific information. +struct FuncSignature { + //! Calling convention id. + uint8_t _callConv; + //! Count of arguments. + uint8_t _argCount; + //! Index of a first VA or `kNoVarArgs`. + uint8_t _vaIndex; + //! Return value TypeId. + uint8_t _ret; + //! Function arguments TypeIds. + const uint8_t* _args; + + enum : uint8_t { + //! Doesn't have variable number of arguments (`...`). + kNoVarArgs = 0xFF + }; + + //! \name Initializtion & Reset + //! \{ + + //! Initializes the function signature. + inline void init(uint32_t ccId, uint32_t vaIndex, uint32_t ret, const uint8_t* args, uint32_t argCount) noexcept { + ASMJIT_ASSERT(ccId <= 0xFF); + ASMJIT_ASSERT(argCount <= 0xFF); + + _callConv = uint8_t(ccId); + _argCount = uint8_t(argCount); + _vaIndex = uint8_t(vaIndex); + _ret = uint8_t(ret); + _args = args; + } + + inline void reset() noexcept { memset(this, 0, sizeof(*this)); } + + //! \} + + //! \name Accessors + //! \{ + + //! Returns the calling convention. + inline uint32_t callConv() const noexcept { return _callConv; } + //! Sets the calling convention to `ccId`; + inline void setCallConv(uint32_t ccId) noexcept { _callConv = uint8_t(ccId); } + + //! Tests whether the function has variable number of arguments (...). + inline bool hasVarArgs() const noexcept { return _vaIndex != kNoVarArgs; } + //! Returns the variable arguments (...) index, `kNoVarArgs` if none. + inline uint32_t vaIndex() const noexcept { return _vaIndex; } + //! Sets the variable arguments (...) index to `index`. + inline void setVaIndex(uint32_t index) noexcept { _vaIndex = uint8_t(index); } + //! Resets the variable arguments index (making it a non-va function). + inline void resetVaIndex() noexcept { _vaIndex = kNoVarArgs; } + + //! Returns the number of function arguments. + inline uint32_t argCount() const noexcept { return _argCount; } + + inline bool hasRet() const noexcept { return _ret != Type::kIdVoid; } + //! Returns the return value type. + inline uint32_t ret() const noexcept { return _ret; } + + //! Returns the type of the argument at index `i`. + inline uint32_t arg(uint32_t i) const noexcept { + ASMJIT_ASSERT(i < _argCount); + return _args[i]; + } + //! Returns the array of function arguments' types. + inline const uint8_t* args() const noexcept { return _args; } + + //! \} +}; + +// ============================================================================ +// [asmjit::FuncSignatureT] +// ============================================================================ + +template +class FuncSignatureT : public FuncSignature { +public: + inline FuncSignatureT(uint32_t ccId = CallConv::kIdHost, uint32_t vaIndex = kNoVarArgs) noexcept { + static const uint8_t ret_args[] = { (uint8_t(Type::IdOfT::kTypeId))... }; + init(ccId, vaIndex, ret_args[0], ret_args + 1, uint32_t(ASMJIT_ARRAY_SIZE(ret_args) - 1)); + } +}; + +// ============================================================================ +// [asmjit::FuncSignatureBuilder] +// ============================================================================ + +//! Function signature builder. +class FuncSignatureBuilder : public FuncSignature { +public: + uint8_t _builderArgList[kFuncArgCount]; + + //! \name Initializtion & Reset + //! \{ + + inline FuncSignatureBuilder(uint32_t ccId = CallConv::kIdHost, uint32_t vaIndex = kNoVarArgs) noexcept { + init(ccId, vaIndex, Type::kIdVoid, _builderArgList, 0); + } + + //! \} + + //! \name Accessors + //! \{ + + //! Sets the return type to `retType`. + inline void setRet(uint32_t retType) noexcept { _ret = uint8_t(retType); } + //! Sets the return type based on `T`. + template + inline void setRetT() noexcept { setRet(Type::IdOfT::kTypeId); } + + //! Sets the argument at index `index` to `argType`. + inline void setArg(uint32_t index, uint32_t argType) noexcept { + ASMJIT_ASSERT(index < _argCount); + _builderArgList[index] = uint8_t(argType); + } + //! Sets the argument at index `i` to the type based on `T`. + template + inline void setArgT(uint32_t index) noexcept { setArg(index, Type::IdOfT::kTypeId); } + + //! Appends an argument of `type` to the function prototype. + inline void addArg(uint32_t type) noexcept { + ASMJIT_ASSERT(_argCount < kFuncArgCount); + _builderArgList[_argCount++] = uint8_t(type); + } + //! Appends an argument of type based on `T` to the function prototype. + template + inline void addArgT() noexcept { addArg(Type::IdOfT::kTypeId); } + + //! \} +}; + +// ============================================================================ +// [asmjit::FuncValue] +// ============================================================================ + +//! Argument or return value as defined by `FuncSignature`, but with register +//! or stack address (and other metadata) assigned to it. +struct FuncValue { + uint32_t _data; + + enum Parts : uint32_t { + kTypeIdShift = 0, //!< TypeId shift. + kTypeIdMask = 0x000000FFu, //!< TypeId mask. + + kFlagIsReg = 0x00000100u, //!< Passed by register. + kFlagIsStack = 0x00000200u, //!< Passed by stack. + kFlagIsIndirect = 0x00000400u, //!< Passed indirectly by reference (internally a pointer). + kFlagIsDone = 0x00000800u, //!< Used internally by arguments allocator. + + kStackOffsetShift = 12, //!< Stack offset shift. + kStackOffsetMask = 0xFFFFF000u, //!< Stack offset mask (must occupy MSB bits). + + kRegIdShift = 16, //!< RegId shift. + kRegIdMask = 0x00FF0000u, //!< RegId mask. + + kRegTypeShift = 24, //!< RegType shift. + kRegTypeMask = 0xFF000000u //!< RegType mask. + }; + + //! \name Initializtion & Reset + //! \{ + + // These initialize the whole `FuncValue` to either register or stack. Useful + // when you know all of these properties and wanna just set it up. + + //! Initializes the `typeId` of this `FuncValue`. + inline void initTypeId(uint32_t typeId) noexcept { + _data = typeId << kTypeIdShift; + } + + inline void initReg(uint32_t regType, uint32_t regId, uint32_t typeId, uint32_t flags = 0) noexcept { + _data = (regType << kRegTypeShift) | (regId << kRegIdShift) | (typeId << kTypeIdShift) | kFlagIsReg | flags; + } + + inline void initStack(int32_t offset, uint32_t typeId) noexcept { + _data = (uint32_t(offset) << kStackOffsetShift) | (typeId << kTypeIdShift) | kFlagIsStack; + } + + //! Resets the value to its unassigned state. + inline void reset() noexcept { _data = 0; } + + //! \} + + //! \name Assign + //! \{ + + // These initialize only part of `FuncValue`, useful when building `FuncValue` + // incrementally. The caller should first init the type-id by caliing `initTypeId` + // and then continue building either register or stack. + + inline void assignRegData(uint32_t regType, uint32_t regId) noexcept { + ASMJIT_ASSERT((_data & (kRegTypeMask | kRegIdMask)) == 0); + _data |= (regType << kRegTypeShift) | (regId << kRegIdShift) | kFlagIsReg; + } + + inline void assignStackOffset(int32_t offset) noexcept { + ASMJIT_ASSERT((_data & kStackOffsetMask) == 0); + _data |= (uint32_t(offset) << kStackOffsetShift) | kFlagIsStack; + } + + //! \} + + //! \name Accessors + //! \{ + + inline void _replaceValue(uint32_t mask, uint32_t value) noexcept { _data = (_data & ~mask) | value; } + + //! Tests whether the `FuncValue` has a flag `flag` set. + inline bool hasFlag(uint32_t flag) const noexcept { return (_data & flag) != 0; } + //! Adds `flags` to `FuncValue`. + inline void addFlags(uint32_t flags) noexcept { _data |= flags; } + //! Clears `flags` of `FuncValue`. + inline void clearFlags(uint32_t flags) noexcept { _data &= ~flags; } + + //! Tests whether the value is initialized (i.e. contains a valid data). + inline bool isInitialized() const noexcept { return _data != 0; } + //! Tests whether the argument is passed by register. + inline bool isReg() const noexcept { return hasFlag(kFlagIsReg); } + //! Tests whether the argument is passed by stack. + inline bool isStack() const noexcept { return hasFlag(kFlagIsStack); } + //! Tests whether the argument is passed by register. + inline bool isAssigned() const noexcept { return hasFlag(kFlagIsReg | kFlagIsStack); } + //! Tests whether the argument is passed through a pointer (used by WIN64 to pass XMM|YMM|ZMM). + inline bool isIndirect() const noexcept { return hasFlag(kFlagIsIndirect); } + + //! Tests whether the argument was already processed (used internally). + inline bool isDone() const noexcept { return hasFlag(kFlagIsDone); } + + //! Returns a register type of the register used to pass function argument or return value. + inline uint32_t regType() const noexcept { return (_data & kRegTypeMask) >> kRegTypeShift; } + //! Sets a register type of the register used to pass function argument or return value. + inline void setRegType(uint32_t regType) noexcept { _replaceValue(kRegTypeMask, regType << kRegTypeShift); } + + //! Returns a physical id of the register used to pass function argument or return value. + inline uint32_t regId() const noexcept { return (_data & kRegIdMask) >> kRegIdShift; } + //! Sets a physical id of the register used to pass function argument or return value. + inline void setRegId(uint32_t regId) noexcept { _replaceValue(kRegIdMask, regId << kRegIdShift); } + + //! Returns a stack offset of this argument. + inline int32_t stackOffset() const noexcept { return int32_t(_data & kStackOffsetMask) >> kStackOffsetShift; } + //! Sets a stack offset of this argument. + inline void setStackOffset(int32_t offset) noexcept { _replaceValue(kStackOffsetMask, uint32_t(offset) << kStackOffsetShift); } + + //! Tests whether the argument or return value has associated `Type::Id`. + inline bool hasTypeId() const noexcept { return (_data & kTypeIdMask) != 0; } + //! Returns a TypeId of this argument or return value. + inline uint32_t typeId() const noexcept { return (_data & kTypeIdMask) >> kTypeIdShift; } + //! Sets a TypeId of this argument or return value. + inline void setTypeId(uint32_t typeId) noexcept { _replaceValue(kTypeIdMask, typeId << kTypeIdShift); } + + //! \} +}; + +// ============================================================================ +// [asmjit::FuncDetail] +// ============================================================================ + +//! Function detail - CallConv and expanded FuncSignature. +//! +//! Function detail is architecture and OS dependent representation of a function. +//! It contains calling convention and expanded function signature so all +//! arguments have assigned either register type & id or stack address. +class FuncDetail { +public: + //! Calling convention. + CallConv _callConv; + //! Number of function arguments. + uint8_t _argCount; + //! Number of function return values. + uint8_t _retCount; + //! Variable arguments index of `kNoVarArgs`. + uint8_t _vaIndex; + //! Reserved for future use. + uint8_t _reserved; + //! Registers that contains arguments. + uint32_t _usedRegs[BaseReg::kGroupVirt]; + //! Size of arguments passed by stack. + uint32_t _argStackSize; + //! Function return values. + FuncValue _rets[2]; + //! Function arguments. + FuncValue _args[kFuncArgCountLoHi]; + + enum : uint8_t { + //! Doesn't have variable number of arguments (`...`). + kNoVarArgs = 0xFF + }; + + //! \name Construction & Destruction + //! \{ + + inline FuncDetail() noexcept { reset(); } + inline FuncDetail(const FuncDetail& other) noexcept = default; + + //! Initializes this `FuncDetail` to the given signature. + ASMJIT_API Error init(const FuncSignature& sign); + inline void reset() noexcept { memset(this, 0, sizeof(*this)); } + + //! \} + + //! \name Accessors + //! \{ + + //! Returns the function's calling convention, see `CallConv`. + inline const CallConv& callConv() const noexcept { return _callConv; } + + //! Returns the associated calling convention flags, see `CallConv::Flags`. + inline uint32_t flags() const noexcept { return _callConv.flags(); } + //! Checks whether a CallConv `flag` is set, see `CallConv::Flags`. + inline bool hasFlag(uint32_t ccFlag) const noexcept { return _callConv.hasFlag(ccFlag); } + + //! Returns count of function return values. + inline uint32_t retCount() const noexcept { return _retCount; } + //! Returns the number of function arguments. + inline uint32_t argCount() const noexcept { return _argCount; } + + //! Tests whether the function has a return value. + inline bool hasRet() const noexcept { return _retCount != 0; } + //! Returns function return value associated with the given `index`. + inline FuncValue& ret(uint32_t index = 0) noexcept { + ASMJIT_ASSERT(index < ASMJIT_ARRAY_SIZE(_rets)); + return _rets[index]; + } + //! Returns function return value associated with the given `index` (const). + inline const FuncValue& ret(uint32_t index = 0) const noexcept { + ASMJIT_ASSERT(index < ASMJIT_ARRAY_SIZE(_rets)); + return _rets[index]; + } + + //! Returns function arguments array. + inline FuncValue* args() noexcept { return _args; } + //! Returns function arguments array (const). + inline const FuncValue* args() const noexcept { return _args; } + + inline bool hasArg(uint32_t index) const noexcept { + ASMJIT_ASSERT(index < kFuncArgCountLoHi); + return _args[index].isInitialized(); + } + + //! Returns function argument at the given `index`. + inline FuncValue& arg(uint32_t index) noexcept { + ASMJIT_ASSERT(index < kFuncArgCountLoHi); + return _args[index]; + } + + //! Returnsfunction argument at the given index `index` (const). + inline const FuncValue& arg(uint32_t index) const noexcept { + ASMJIT_ASSERT(index < kFuncArgCountLoHi); + return _args[index]; + } + + inline void resetArg(uint32_t index) noexcept { + ASMJIT_ASSERT(index < kFuncArgCountLoHi); + _args[index].reset(); + } + + inline bool hasVarArgs() const noexcept { return _vaIndex != kNoVarArgs; } + inline uint32_t vaIndex() const noexcept { return _vaIndex; } + + //! Tests whether the function passes one or more argument by stack. + inline bool hasStackArgs() const noexcept { return _argStackSize != 0; } + //! Returns stack size needed for function arguments passed on the stack. + inline uint32_t argStackSize() const noexcept { return _argStackSize; } + + inline uint32_t redZoneSize() const noexcept { return _callConv.redZoneSize(); } + inline uint32_t spillZoneSize() const noexcept { return _callConv.spillZoneSize(); } + inline uint32_t naturalStackAlignment() const noexcept { return _callConv.naturalStackAlignment(); } + + inline uint32_t passedRegs(uint32_t group) const noexcept { return _callConv.passedRegs(group); } + inline uint32_t preservedRegs(uint32_t group) const noexcept { return _callConv.preservedRegs(group); } + + inline uint32_t usedRegs(uint32_t group) const noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + return _usedRegs[group]; + } + + inline void addUsedRegs(uint32_t group, uint32_t regs) noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + _usedRegs[group] |= regs; + } + + //! \} +}; + +// ============================================================================ +// [asmjit::FuncFrame] +// ============================================================================ + +//! Function frame. +//! +//! Function frame is used directly by prolog and epilog insertion (PEI) utils. +//! It provides information necessary to insert a proper and ABI comforming +//! prolog and epilog. Function frame calculation is based on `CallConv` and +//! other function attributes. +//! +//! Function Frame Structure +//! ------------------------ +//! +//! Various properties can contribute to the size and structure of the function +//! frame. The function frame in most cases won't use all of the properties +//! illustrated (for example Spill Zone and Red Zone are never used together). +//! +//! +-----------------------------+ +//! | Arguments Passed by Stack | +//! +-----------------------------+ +//! | Spill Zone | +//! +-----------------------------+ <- Stack offset (args) starts from here. +//! | Return Address if Pushed | +//! +-----------------------------+ <- Stack pointer (SP) upon entry. +//! | Save/Restore Stack. | +//! +-----------------------------+-----------------------------+ +//! | Local Stack | | +//! +-----------------------------+ Final Stack | +//! | Call Stack | | +//! +-----------------------------+-----------------------------+ <- SP after prolog. +//! | Red Zone | +//! +-----------------------------+ +class FuncFrame { +public: + enum Tag : uint32_t { + kTagInvalidOffset = 0xFFFFFFFFu //!< Tag used to inform that some offset is invalid. + }; + + //! Attributes are designed in a way that all are initially false, and user + //! or FuncFrame finalizer adds them when necessary. + enum Attributes : uint32_t { + kAttrHasVarArgs = 0x00000001u, //!< Function has variable number of arguments. + kAttrHasPreservedFP = 0x00000010u, //!< Preserve frame pointer (don't omit FP). + kAttrHasFuncCalls = 0x00000020u, //!< Function calls other functions (is not leaf). + + kAttrX86AvxEnabled = 0x00010000u, //!< Use AVX instead of SSE for all operations (X86). + kAttrX86AvxCleanup = 0x00020000u, //!< Emit VZEROUPPER instruction in epilog (X86). + kAttrX86MmxCleanup = 0x00040000u, //!< Emit EMMS instruction in epilog (X86). + + kAttrAlignedVecSR = 0x40000000u, //!< Function has aligned save/restore of vector registers. + kAttrIsFinalized = 0x80000000u //!< FuncFrame is finalized and can be used by PEI. + }; + + //! Function attributes. + uint32_t _attributes; + + //! Architecture ID. + uint8_t _archId; + //! SP register ID (to access call stack and local stack). + uint8_t _spRegId; + //! SA register ID (to access stack arguments). + uint8_t _saRegId; + + //! Red zone size (copied from CallConv). + uint8_t _redZoneSize; + //! Spill zone size (copied from CallConv). + uint8_t _spillZoneSize; + //! Natural stack alignment (copied from CallConv). + uint8_t _naturalStackAlignment; + //! Minimum stack alignment to turn on dynamic alignment. + uint8_t _minDynamicAlignment; + + //! Call stack alignment. + uint8_t _callStackAlignment; + //! Local stack alignment. + uint8_t _localStackAlignment; + //! Final stack alignment. + uint8_t _finalStackAlignment; + + //! Adjustment of the stack before returning (X86-STDCALL). + uint16_t _calleeStackCleanup; + + //! Call stack size. + uint32_t _callStackSize; + //! Local stack size. + uint32_t _localStackSize; + //! Final stack size (sum of call stack and local stack). + uint32_t _finalStackSize; + + //! Local stack offset (non-zero only if call stack is used). + uint32_t _localStackOffset; + //! Offset relative to SP that contains previous SP (before alignment). + uint32_t _daOffset; + //! Offset of the first stack argument relative to SP. + uint32_t _saOffsetFromSP; + //! Offset of the first stack argument relative to SA (_saRegId or FP). + uint32_t _saOffsetFromSA; + + //! Local stack adjustment in prolog/epilog. + uint32_t _stackAdjustment; + + //! Registers that are dirty. + uint32_t _dirtyRegs[BaseReg::kGroupVirt]; + //! Registers that must be preserved (copied from CallConv). + uint32_t _preservedRegs[BaseReg::kGroupVirt]; + + //! Final stack size required to save GP regs. + uint16_t _gpSaveSize; + //! Final Stack size required to save other than GP regs. + uint16_t _nonGpSaveSize; + //! Final offset where saved GP regs are stored. + uint32_t _gpSaveOffset; + //! Final offset where saved other than GP regs are stored. + uint32_t _nonGpSaveOffset; + + //! \name Construction & Destruction + //! \{ + + inline FuncFrame() noexcept { reset(); } + inline FuncFrame(const FuncFrame& other) noexcept = default; + + ASMJIT_API Error init(const FuncDetail& func) noexcept; + + inline void reset() noexcept { + memset(this, 0, sizeof(FuncFrame)); + _spRegId = BaseReg::kIdBad; + _saRegId = BaseReg::kIdBad; + _daOffset = kTagInvalidOffset; + } + + //! \} + + //! \name Accessors + //! \{ + + //! Returns the target architecture of the function frame. + inline uint32_t archId() const noexcept { return _archId; } + + //! Returns function frame attributes, see `Attributes`. + inline uint32_t attributes() const noexcept { return _attributes; } + //! Checks whether the FuncFame contains an attribute `attr`. + inline bool hasAttribute(uint32_t attr) const noexcept { return (_attributes & attr) != 0; } + //! Adds attributes `attrs` to the FuncFrame. + inline void addAttributes(uint32_t attrs) noexcept { _attributes |= attrs; } + //! Clears attributes `attrs` from the FrameFrame. + inline void clearAttributes(uint32_t attrs) noexcept { _attributes &= ~attrs; } + + //! Tests whether the function has variable number of arguments. + inline bool hasVarArgs() const noexcept { return hasAttribute(kAttrHasVarArgs); } + //! Sets the variable arguments flag. + inline void setVarArgs() noexcept { addAttributes(kAttrHasVarArgs); } + //! Resets variable arguments flag. + inline void resetVarArgs() noexcept { clearAttributes(kAttrHasVarArgs); } + + //! Tests whether the function preserves frame pointer (EBP|ESP on X86). + inline bool hasPreservedFP() const noexcept { return hasAttribute(kAttrHasPreservedFP); } + //! Enables preserved frame pointer. + inline void setPreservedFP() noexcept { addAttributes(kAttrHasPreservedFP); } + //! Disables preserved frame pointer. + inline void resetPreservedFP() noexcept { clearAttributes(kAttrHasPreservedFP); } + + //! Tests whether the function calls other functions. + inline bool hasFuncCalls() const noexcept { return hasAttribute(kAttrHasFuncCalls); } + //! Sets `kFlagHasCalls` to true. + inline void setFuncCalls() noexcept { addAttributes(kAttrHasFuncCalls); } + //! Sets `kFlagHasCalls` to false. + inline void resetFuncCalls() noexcept { clearAttributes(kAttrHasFuncCalls); } + + //! Tests whether the function contains AVX cleanup - 'vzeroupper' instruction in epilog. + inline bool hasAvxCleanup() const noexcept { return hasAttribute(kAttrX86AvxCleanup); } + //! Enables AVX cleanup. + inline void setAvxCleanup() noexcept { addAttributes(kAttrX86AvxCleanup); } + //! Disables AVX cleanup. + inline void resetAvxCleanup() noexcept { clearAttributes(kAttrX86AvxCleanup); } + + //! Tests whether the function contains AVX cleanup - 'vzeroupper' instruction in epilog. + inline bool isAvxEnabled() const noexcept { return hasAttribute(kAttrX86AvxEnabled); } + //! Enables AVX cleanup. + inline void setAvxEnabled() noexcept { addAttributes(kAttrX86AvxEnabled); } + //! Disables AVX cleanup. + inline void resetAvxEnabled() noexcept { clearAttributes(kAttrX86AvxEnabled); } + + //! Tests whether the function contains MMX cleanup - 'emms' instruction in epilog. + inline bool hasMmxCleanup() const noexcept { return hasAttribute(kAttrX86MmxCleanup); } + //! Enables MMX cleanup. + inline void setMmxCleanup() noexcept { addAttributes(kAttrX86MmxCleanup); } + //! Disables MMX cleanup. + inline void resetMmxCleanup() noexcept { clearAttributes(kAttrX86MmxCleanup); } + + //! Tests whether the function uses call stack. + inline bool hasCallStack() const noexcept { return _callStackSize != 0; } + //! Tests whether the function uses local stack. + inline bool hasLocalStack() const noexcept { return _localStackSize != 0; } + //! Tests whether vector registers can be saved and restored by using aligned reads and writes. + inline bool hasAlignedVecSR() const noexcept { return hasAttribute(kAttrAlignedVecSR); } + //! Tests whether the function has to align stack dynamically. + inline bool hasDynamicAlignment() const noexcept { return _finalStackAlignment >= _minDynamicAlignment; } + + //! Tests whether the calling convention specifies 'RedZone'. + inline bool hasRedZone() const noexcept { return _redZoneSize != 0; } + //! Tests whether the calling convention specifies 'SpillZone'. + inline bool hasSpillZone() const noexcept { return _spillZoneSize != 0; } + + //! Returns the size of 'RedZone'. + inline uint32_t redZoneSize() const noexcept { return _redZoneSize; } + //! Returns the size of 'SpillZone'. + inline uint32_t spillZoneSize() const noexcept { return _spillZoneSize; } + //! Returns natural stack alignment (guaranteed stack alignment upon entry). + inline uint32_t naturalStackAlignment() const noexcept { return _naturalStackAlignment; } + //! Returns natural stack alignment (guaranteed stack alignment upon entry). + inline uint32_t minDynamicAlignment() const noexcept { return _minDynamicAlignment; } + + //! Tests whether the callee must adjust SP before returning (X86-STDCALL only) + inline bool hasCalleeStackCleanup() const noexcept { return _calleeStackCleanup != 0; } + //! Returns home many bytes of the stack the the callee must adjust before returning (X86-STDCALL only) + inline uint32_t calleeStackCleanup() const noexcept { return _calleeStackCleanup; } + + //! Returns call stack alignment. + inline uint32_t callStackAlignment() const noexcept { return _callStackAlignment; } + //! Returns local stack alignment. + inline uint32_t localStackAlignment() const noexcept { return _localStackAlignment; } + //! Returns final stack alignment (the maximum value of call, local, and natural stack alignments). + inline uint32_t finalStackAlignment() const noexcept { return _finalStackAlignment; } + + //! Sets call stack alignment. + //! + //! \note This also updates the final stack alignment. + inline void setCallStackAlignment(uint32_t alignment) noexcept { + _callStackAlignment = uint8_t(alignment); + _finalStackAlignment = Support::max(_naturalStackAlignment, _callStackAlignment, _localStackAlignment); + } + + //! Sets local stack alignment. + //! + //! \note This also updates the final stack alignment. + inline void setLocalStackAlignment(uint32_t value) noexcept { + _localStackAlignment = uint8_t(value); + _finalStackAlignment = Support::max(_naturalStackAlignment, _callStackAlignment, _localStackAlignment); + } + + //! Combines call stack alignment with `alignment`, updating it to the greater value. + //! + //! \note This also updates the final stack alignment. + inline void updateCallStackAlignment(uint32_t alignment) noexcept { + _callStackAlignment = uint8_t(Support::max(_callStackAlignment, alignment)); + _finalStackAlignment = Support::max(_finalStackAlignment, _callStackAlignment); + } + + //! Combines local stack alignment with `alignment`, updating it to the greater value. + //! + //! \note This also updates the final stack alignment. + inline void updateLocalStackAlignment(uint32_t alignment) noexcept { + _localStackAlignment = uint8_t(Support::max(_localStackAlignment, alignment)); + _finalStackAlignment = Support::max(_finalStackAlignment, _localStackAlignment); + } + + //! Returns call stack size. + inline uint32_t callStackSize() const noexcept { return _callStackSize; } + //! Returns local stack size. + inline uint32_t localStackSize() const noexcept { return _localStackSize; } + + //! Sets call stack size. + inline void setCallStackSize(uint32_t size) noexcept { _callStackSize = size; } + //! Sets local stack size. + inline void setLocalStackSize(uint32_t size) noexcept { _localStackSize = size; } + + //! Combines call stack size with `size`, updating it to the greater value. + inline void updateCallStackSize(uint32_t size) noexcept { _callStackSize = Support::max(_callStackSize, size); } + //! Combines local stack size with `size`, updating it to the greater value. + inline void updateLocalStackSize(uint32_t size) noexcept { _localStackSize = Support::max(_localStackSize, size); } + + //! Returns final stack size (only valid after the FuncFrame is finalized). + inline uint32_t finalStackSize() const noexcept { return _finalStackSize; } + + //! Returns an offset to access the local stack (non-zero only if call stack is used). + inline uint32_t localStackOffset() const noexcept { return _localStackOffset; } + + //! Tests whether the function prolog/epilog requires a memory slot for storing unaligned SP. + inline bool hasDAOffset() const noexcept { return _daOffset != kTagInvalidOffset; } + //! Returns a memory offset used to store DA (dynamic alignment) slot (relative to SP). + inline uint32_t daOffset() const noexcept { return _daOffset; } + + inline uint32_t saOffset(uint32_t regId) const noexcept { + return regId == _spRegId ? saOffsetFromSP() + : saOffsetFromSA(); + } + + inline uint32_t saOffsetFromSP() const noexcept { return _saOffsetFromSP; } + inline uint32_t saOffsetFromSA() const noexcept { return _saOffsetFromSA; } + + //! Returns mask of registers of the given register `group` that are modified + //! by the function. The engine would then calculate which registers must be + //! saved & restored by the function by using the data provided by the calling + //! convention. + inline uint32_t dirtyRegs(uint32_t group) const noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + return _dirtyRegs[group]; + } + + //! Sets which registers (as a mask) are modified by the function. + //! + //! \remarks Please note that this will completely overwrite the existing + //! register mask, use `addDirtyRegs()` to modify the existing register + //! mask. + inline void setDirtyRegs(uint32_t group, uint32_t regs) noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + _dirtyRegs[group] = regs; + } + + //! Adds which registers (as a mask) are modified by the function. + inline void addDirtyRegs(uint32_t group, uint32_t regs) noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + _dirtyRegs[group] |= regs; + } + + //! \overload + inline void addDirtyRegs(const BaseReg& reg) noexcept { + ASMJIT_ASSERT(reg.id() < Globals::kMaxPhysRegs); + addDirtyRegs(reg.group(), Support::bitMask(reg.id())); + } + + //! \overload + template + ASMJIT_INLINE void addDirtyRegs(const BaseReg& reg, Args&&... args) noexcept { + addDirtyRegs(reg); + addDirtyRegs(std::forward(args)...); + } + + inline void setAllDirty() noexcept { + _dirtyRegs[0] = 0xFFFFFFFFu; + _dirtyRegs[1] = 0xFFFFFFFFu; + _dirtyRegs[2] = 0xFFFFFFFFu; + _dirtyRegs[3] = 0xFFFFFFFFu; + } + + inline void setAllDirty(uint32_t group) noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + _dirtyRegs[group] = 0xFFFFFFFFu; + } + + //! Returns a calculated mask of registers of the given `group` that will be + //! saved and restored in the function's prolog and epilog, respectively. The + //! register mask is calculated from both `dirtyRegs` (provided by user) and + //! `preservedMask` (provided by the calling convention). + inline uint32_t savedRegs(uint32_t group) const noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + return _dirtyRegs[group] & _preservedRegs[group]; + } + + //! Returns the mask of preserved registers of the given register `group`. + //! + //! Preserved registers are those that must survive the function call + //! unmodified. The function can only modify preserved registers it they + //! are saved and restored in funciton's prolog and epilog, respectively. + inline uint32_t preservedRegs(uint32_t group) const noexcept { + ASMJIT_ASSERT(group < BaseReg::kGroupVirt); + return _preservedRegs[group]; + } + + inline bool hasSARegId() const noexcept { return _saRegId != BaseReg::kIdBad; } + inline uint32_t saRegId() const noexcept { return _saRegId; } + inline void setSARegId(uint32_t regId) { _saRegId = uint8_t(regId); } + inline void resetSARegId() { setSARegId(BaseReg::kIdBad); } + + //! Returns stack size required to save GP registers. + inline uint32_t gpSaveSize() const noexcept { return _gpSaveSize; } + //! Returns stack size required to save other than GP registers (MM, XMM|YMM|ZMM, K, VFP, etc...). + inline uint32_t nonGpSaveSize() const noexcept { return _nonGpSaveSize; } + + //! Returns an offset to the stack where general purpose registers are saved. + inline uint32_t gpSaveOffset() const noexcept { return _gpSaveOffset; } + //! Returns an offset to the stack where other than GP registers are saved. + inline uint32_t nonGpSaveOffset() const noexcept { return _nonGpSaveOffset; } + + //! Tests whether the functions contains stack adjustment. + inline bool hasStackAdjustment() const noexcept { return _stackAdjustment != 0; } + //! Returns function's stack adjustment used in function's prolog and epilog. + //! + //! If the returned value is zero it means that the stack is not adjusted. + //! This can mean both that the stack is not used and/or the stack is only + //! adjusted by instructions that pust/pop registers into/from stack. + inline uint32_t stackAdjustment() const noexcept { return _stackAdjustment; } + + //! \} + + //! \name Finaliztion + //! \{ + + ASMJIT_API Error finalize() noexcept; + + //! \} +}; + +// ============================================================================ +// [asmjit::FuncArgsAssignment] +// ============================================================================ + +//! A helper class that can be used to assign a physical register for each +//! function argument. Use with `BaseEmitter::emitArgsAssignment()`. +class FuncArgsAssignment { +public: + //! Function detail. + const FuncDetail* _funcDetail; + //! Register that can be used to access arguments passed by stack. + uint8_t _saRegId; + //! Reserved for future use. + uint8_t _reserved[3]; + //! Mapping of each function argument. + FuncValue _args[kFuncArgCountLoHi]; + + //! \name Construction & Destruction + //! \{ + + inline explicit FuncArgsAssignment(const FuncDetail* fd = nullptr) noexcept { reset(fd); } + + inline FuncArgsAssignment(const FuncArgsAssignment& other) noexcept { + memcpy(this, &other, sizeof(*this)); + } + + inline void reset(const FuncDetail* fd = nullptr) noexcept { + _funcDetail = fd; + _saRegId = uint8_t(BaseReg::kIdBad); + memset(_reserved, 0, sizeof(_reserved)); + memset(_args, 0, sizeof(_args)); + } + + //! \} + + //! \name Accessors + //! \{ + + inline const FuncDetail* funcDetail() const noexcept { return _funcDetail; } + inline void setFuncDetail(const FuncDetail* fd) noexcept { _funcDetail = fd; } + + inline bool hasSARegId() const noexcept { return _saRegId != BaseReg::kIdBad; } + inline uint32_t saRegId() const noexcept { return _saRegId; } + inline void setSARegId(uint32_t regId) { _saRegId = uint8_t(regId); } + inline void resetSARegId() { _saRegId = uint8_t(BaseReg::kIdBad); } + + inline FuncValue& arg(uint32_t index) noexcept { + ASMJIT_ASSERT(index < ASMJIT_ARRAY_SIZE(_args)); + return _args[index]; + } + inline const FuncValue& arg(uint32_t index) const noexcept { + ASMJIT_ASSERT(index < ASMJIT_ARRAY_SIZE(_args)); + return _args[index]; + } + + inline bool isAssigned(uint32_t argIndex) const noexcept { + ASMJIT_ASSERT(argIndex < ASMJIT_ARRAY_SIZE(_args)); + return _args[argIndex].isAssigned(); + } + + inline void assignReg(uint32_t argIndex, const BaseReg& reg, uint32_t typeId = Type::kIdVoid) noexcept { + ASMJIT_ASSERT(argIndex < ASMJIT_ARRAY_SIZE(_args)); + ASMJIT_ASSERT(reg.isPhysReg()); + _args[argIndex].initReg(reg.type(), reg.id(), typeId); + } + + inline void assignReg(uint32_t argIndex, uint32_t regType, uint32_t regId, uint32_t typeId = Type::kIdVoid) noexcept { + ASMJIT_ASSERT(argIndex < ASMJIT_ARRAY_SIZE(_args)); + _args[argIndex].initReg(regType, regId, typeId); + } + + inline void assignStack(uint32_t argIndex, int32_t offset, uint32_t typeId = Type::kIdVoid) { + ASMJIT_ASSERT(argIndex < ASMJIT_ARRAY_SIZE(_args)); + _args[argIndex].initStack(offset, typeId); + } + + // NOTE: All `assignAll()` methods are shortcuts to assign all arguments at + // once, however, since registers are passed all at once these initializers + // don't provide any way to pass TypeId and/or to keep any argument between + // the arguments passed unassigned. + inline void _assignAllInternal(uint32_t argIndex, const BaseReg& reg) noexcept { + assignReg(argIndex, reg); + } + + template + inline void _assignAllInternal(uint32_t argIndex, const BaseReg& reg, Args&&... args) noexcept { + assignReg(argIndex, reg); + _assignAllInternal(argIndex + 1, std::forward(args)...); + } + + template + inline void assignAll(Args&&... args) noexcept { + _assignAllInternal(0, std::forward(args)...); + } + + //! \} + + //! \name Utilities + //! \{ + + //! Update `FuncFrame` based on function's arguments assignment. + //! + //! \note You MUST call this in orher to use `BaseEmitter::emitArgsAssignment()`, + //! otherwise the FuncFrame would not contain the information necessary to + //! assign all arguments into the registers and/or stack specified. + ASMJIT_API Error updateFuncFrame(FuncFrame& frame) const noexcept; + + //! \} +}; + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_FUNC_H_INCLUDED + diff --git a/3rdparty/asmjit/src/asmjit/core/globals.cpp b/3rdparty/asmjit/src/asmjit/core/globals.cpp new file mode 100644 index 00000000000..426fce8f533 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/globals.cpp @@ -0,0 +1,131 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#include "../core/globals.h" +#include "../core/support.h" + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::DebugUtils] +// ============================================================================ + +ASMJIT_FAVOR_SIZE const char* DebugUtils::errorAsString(Error err) noexcept { +#ifndef ASMJIT_NO_TEXT + static const char errorMessages[] = + "Ok\0" + "Out of memory\0" + "Invalid argument\0" + "Invalid state\0" + "Invalid architecture\0" + "Not initialized\0" + "Already initialized\0" + "Feature not enabled\0" + "Too many handles or file descriptors\0" + "Too large (code or memory request)\0" + "No code generated\0" + "Invalid directive\0" + "Invalid label\0" + "Too many labels\0" + "Label already bound\0" + "Label already defined\0" + "Label name too long\0" + "Invalid label name\0" + "Invalid parent label\0" + "Non-local label can't have parent\0" + "Invalid section\0" + "Too many sections\0" + "Invalid section name\0" + "Too many relocations\0" + "Invalid relocation entry\0" + "Relocation offset out of range\0" + "Invalid assignment\0" + "Invalid instruction\0" + "Invalid register type\0" + "Invalid register group\0" + "Invalid register physical id\0" + "Invalid register virtual id\0" + "Invalid prefix combination\0" + "Invalid lock prefix\0" + "Invalid xacquire prefix\0" + "Invalid xrelease prefix\0" + "Invalid rep prefix\0" + "Invalid rex prefix\0" + "Invalid {...} register \0" + "Invalid use of {k}\0" + "Invalid use of {k}{z}\0" + "Invalid broadcast {1tox}\0" + "Invalid {er} or {sae} option\0" + "Invalid address\0" + "Invalid address index\0" + "Invalid address scale\0" + "Invalid use of 64-bit address or offset\0" + "Invalid use of 64-bit address or offset that requires 32-bit zero-extension\0" + "Invalid displacement\0" + "Invalid segment\0" + "Invalid immediate value\0" + "Invalid operand size\0" + "Ambiguous operand size\0" + "Operand size mismatch\0" + "Invalid option\0" + "Option already defined\0" + "Invalid type-info\0" + "Invalid use of a low 8-bit GPB register\0" + "Invalid use of a 64-bit GPQ register in 32-bit mode\0" + "Invalid use of an 80-bit float\0" + "Not consecutive registers\0" + "No more physical registers\0" + "Overlapped registers\0" + "Overlapping register and arguments base-address register\0" + "Unbound label cannot be evaluated by expression\0" + "Arithmetic overflow during expression evaluation\0" + "Unknown error\0"; + return Support::findPackedString(errorMessages, Support::min(err, kErrorCount)); +#else + DebugUtils::unused(err); + static const char noMessage[] = ""; + return noMessage; +#endif +} + +ASMJIT_FAVOR_SIZE void DebugUtils::debugOutput(const char* str) noexcept { +#if defined(_WIN32) + ::OutputDebugStringA(str); +#else + ::fputs(str, stderr); +#endif +} + +ASMJIT_FAVOR_SIZE void DebugUtils::assertionFailed(const char* file, int line, const char* msg) noexcept { + char str[1024]; + + snprintf(str, 1024, + "[asmjit] Assertion failed at %s (line %d):\n" + "[asmjit] %s\n", file, line, msg); + + debugOutput(str); + ::abort(); +} + +ASMJIT_END_NAMESPACE diff --git a/3rdparty/asmjit/src/asmjit/core/globals.h b/3rdparty/asmjit/src/asmjit/core/globals.h new file mode 100644 index 00000000000..6373b7e8c6a --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/globals.h @@ -0,0 +1,425 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_GLOBALS_H_INCLUDED +#define ASMJIT_CORE_GLOBALS_H_INCLUDED + +#include "../core/api-config.h" + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::Support] +// ============================================================================ + +//! \cond INTERNAL +//! \addtogroup Support +//! \{ +namespace Support { + //! Cast designed to cast between function and void* pointers. + template + static inline Dst ptr_cast_impl(Src p) noexcept { return (Dst)p; } +} // {Support} + +#if defined(ASMJIT_NO_STDCXX) +namespace Support { + ASMJIT_INLINE void* operatorNew(size_t n) noexcept { return malloc(n); } + ASMJIT_INLINE void operatorDelete(void* p) noexcept { if (p) free(p); } +} // {Support} + +#define ASMJIT_BASE_CLASS(TYPE) \ + ASMJIT_INLINE void* operator new(size_t n) noexcept { \ + return Support::operatorNew(n); \ + } \ + \ + ASMJIT_INLINE void operator delete(void* p) noexcept { \ + Support::operatorDelete(p); \ + } \ + \ + ASMJIT_INLINE void* operator new(size_t, void* p) noexcept { return p; } \ + ASMJIT_INLINE void operator delete(void*, void*) noexcept {} +#else +#define ASMJIT_BASE_CLASS(TYPE) +#endif + +//! \} +//! \endcond + +// ============================================================================ +// [asmjit::Globals] +// ============================================================================ + +//! \addtogroup asmjit_core +//! \{ + +//! Contains typedefs, constants, and variables used globally by AsmJit. +namespace Globals { + +// ============================================================================ +// [asmjit::Globals::] +// ============================================================================ + +//! Host memory allocator overhead. +constexpr uint32_t kAllocOverhead = uint32_t(sizeof(intptr_t) * 4); + +//! Host memory allocator alignment. +constexpr uint32_t kAllocAlignment = 8; + +//! Aggressive growing strategy threshold. +constexpr uint32_t kGrowThreshold = 1024 * 1024 * 16; + +//! Maximum height of RB-Tree is: +//! +//! `2 * log2(n + 1)`. +//! +//! Size of RB node is at least two pointers (without data), +//! so a theoretical architecture limit would be: +//! +//! `2 * log2(addressableMemorySize / sizeof(Node) + 1)` +//! +//! Which yields 30 on 32-bit arch and 61 on 64-bit arch. +//! The final value was adjusted by +1 for safety reasons. +constexpr uint32_t kMaxTreeHeight = (ASMJIT_ARCH_BITS == 32 ? 30 : 61) + 1; + +//! Maximum number of operands per a single instruction. +constexpr uint32_t kMaxOpCount = 6; + +// TODO: Use this one. +constexpr uint32_t kMaxFuncArgs = 16; + +//! Maximum number of physical registers AsmJit can use per register group. +constexpr uint32_t kMaxPhysRegs = 32; + +//! Maximum alignment. +constexpr uint32_t kMaxAlignment = 64; + +//! Maximum label or symbol size in bytes. +constexpr uint32_t kMaxLabelNameSize = 2048; + +//! Maximum section name size. +constexpr uint32_t kMaxSectionNameSize = 35; + +//! Maximum size of comment. +constexpr uint32_t kMaxCommentSize = 1024; + +//! Invalid identifier. +constexpr uint32_t kInvalidId = 0xFFFFFFFFu; + +//! Returned by `indexOf()` and similar when working with containers that use 32-bit index/size. +constexpr uint32_t kNotFound = 0xFFFFFFFFu; + +//! Invalid base address. +constexpr uint64_t kNoBaseAddress = ~uint64_t(0); + +// ============================================================================ +// [asmjit::Globals::ResetPolicy] +// ============================================================================ + +//! Reset policy used by most `reset()` functions. +enum ResetPolicy : uint32_t { + //! Soft reset, doesn't deallocate memory (default). + kResetSoft = 0, + //! Hard reset, releases all memory used, if any. + kResetHard = 1 +}; + +// ============================================================================ +// [asmjit::Globals::Link] +// ============================================================================ + +enum Link : uint32_t { + kLinkLeft = 0, + kLinkRight = 1, + + kLinkPrev = 0, + kLinkNext = 1, + + kLinkFirst = 0, + kLinkLast = 1, + + kLinkCount = 2 +}; + +struct Init_ {}; +struct NoInit_ {}; + +static const constexpr Init_ Init {}; +static const constexpr NoInit_ NoInit {}; + +} // {Globals} + +// ============================================================================ +// [asmjit::Error] +// ============================================================================ + +//! AsmJit error type (uint32_t). +typedef uint32_t Error; + +//! AsmJit error codes. +enum ErrorCode : uint32_t { + //! No error (success). + kErrorOk = 0, + + //! Out of memory. + kErrorOutOfMemory, + + //! Invalid argument. + kErrorInvalidArgument, + + //! Invalid state. + //! + //! If this error is returned it means that either you are doing something + //! wrong or AsmJit caught itself by doing something wrong. This error should + //! never be ignored. + kErrorInvalidState, + + //! Invalid or incompatible architecture. + kErrorInvalidArch, + + //! The object is not initialized. + kErrorNotInitialized, + //! The object is already initialized. + kErrorAlreadyInitialized, + + //! Built-in feature was disabled at compile time and it's not available. + kErrorFeatureNotEnabled, + + //! Too many handles (Windows) or file descriptors (Unix/Posix). + kErrorTooManyHandles, + //! Code generated is larger than allowed. + kErrorTooLarge, + + //! No code generated. + //! + //! Returned by runtime if the `CodeHolder` contains no code. + kErrorNoCodeGenerated, + + //! Invalid directive. + kErrorInvalidDirective, + //! Attempt to use uninitialized label. + kErrorInvalidLabel, + //! Label index overflow - a single `Assembler` instance can hold almost + //! 2^32 (4 billion) labels. If there is an attempt to create more labels + //! then this error is returned. + kErrorTooManyLabels, + //! Label is already bound. + kErrorLabelAlreadyBound, + //! Label is already defined (named labels). + kErrorLabelAlreadyDefined, + //! Label name is too long. + kErrorLabelNameTooLong, + //! Label must always be local if it's anonymous (without a name). + kErrorInvalidLabelName, + //! Parent id passed to `CodeHolder::newNamedLabelId()` was invalid. + kErrorInvalidParentLabel, + //! Parent id specified for a non-local (global) label. + kErrorNonLocalLabelCantHaveParent, + + //! Invalid section. + kErrorInvalidSection, + //! Too many sections (section index overflow). + kErrorTooManySections, + //! Invalid section name (most probably too long). + kErrorInvalidSectionName, + + //! Relocation index overflow (too many relocations). + kErrorTooManyRelocations, + //! Invalid relocation entry. + kErrorInvalidRelocEntry, + //! Reloc entry contains address that is out of range (unencodable). + kErrorRelocOffsetOutOfRange, + + //! Invalid assignment to a register, function argument, or function return value. + kErrorInvalidAssignment, + //! Invalid instruction. + kErrorInvalidInstruction, + //! Invalid register type. + kErrorInvalidRegType, + //! Invalid register group. + kErrorInvalidRegGroup, + //! Invalid register's physical id. + kErrorInvalidPhysId, + //! Invalid register's virtual id. + kErrorInvalidVirtId, + //! Invalid prefix combination. + kErrorInvalidPrefixCombination, + //! Invalid LOCK prefix. + kErrorInvalidLockPrefix, + //! Invalid XACQUIRE prefix. + kErrorInvalidXAcquirePrefix, + //! Invalid XRELEASE prefix. + kErrorInvalidXReleasePrefix, + //! Invalid REP prefix. + kErrorInvalidRepPrefix, + //! Invalid REX prefix. + kErrorInvalidRexPrefix, + //! Invalid {...} register. + kErrorInvalidExtraReg, + //! Invalid {k} use (not supported by the instruction). + kErrorInvalidKMaskUse, + //! Invalid {k}{z} use (not supported by the instruction). + kErrorInvalidKZeroUse, + //! Invalid broadcast - Currently only related to invalid use of AVX-512 {1tox}. + kErrorInvalidBroadcast, + //! Invalid 'embedded-rounding' {er} or 'suppress-all-exceptions' {sae} (AVX-512). + kErrorInvalidEROrSAE, + //! Invalid address used (not encodable). + kErrorInvalidAddress, + //! Invalid index register used in memory address (not encodable). + kErrorInvalidAddressIndex, + //! Invalid address scale (not encodable). + kErrorInvalidAddressScale, + //! Invalid use of 64-bit address. + kErrorInvalidAddress64Bit, + //! Invalid use of 64-bit address that require 32-bit zero-extension (X64). + kErrorInvalidAddress64BitZeroExtension, + //! Invalid displacement (not encodable). + kErrorInvalidDisplacement, + //! Invalid segment (X86). + kErrorInvalidSegment, + + //! Invalid immediate (out of bounds on X86 and invalid pattern on ARM). + kErrorInvalidImmediate, + + //! Invalid operand size. + kErrorInvalidOperandSize, + //! Ambiguous operand size (memory has zero size while it's required to determine the operation type. + kErrorAmbiguousOperandSize, + //! Mismatching operand size (size of multiple operands doesn't match the operation size). + kErrorOperandSizeMismatch, + + //! Invalid option. + kErrorInvalidOption, + //! Option already defined. + kErrorOptionAlreadyDefined, + + //! Invalid TypeId. + kErrorInvalidTypeId, + //! Invalid use of a 8-bit GPB-HIGH register. + kErrorInvalidUseOfGpbHi, + //! Invalid use of a 64-bit GPQ register in 32-bit mode. + kErrorInvalidUseOfGpq, + //! Invalid use of an 80-bit float (Type::kIdF80). + kErrorInvalidUseOfF80, + //! Some registers in the instruction muse be consecutive (some ARM and AVX512 neural-net instructions). + kErrorNotConsecutiveRegs, + + //! AsmJit requires a physical register, but no one is available. + kErrorNoMorePhysRegs, + //! A variable has been assigned more than once to a function argument (BaseCompiler). + kErrorOverlappedRegs, + //! Invalid register to hold stack arguments offset. + kErrorOverlappingStackRegWithRegArg, + + //! Unbound label cannot be evaluated by expression. + kErrorExpressionLabelNotBound, + //! Arithmetic overflow during expression evaluation. + kErrorExpressionOverflow, + + //! Count of AsmJit error codes. + kErrorCount +}; + +// ============================================================================ +// [asmjit::ByteOrder] +// ============================================================================ + +//! Byte order. +namespace ByteOrder { + enum : uint32_t { + kLE = 0, + kBE = 1, + kNative = ASMJIT_ARCH_LE ? kLE : kBE, + kSwapped = ASMJIT_ARCH_LE ? kBE : kLE + }; +} + +// ============================================================================ +// [asmjit::ptr_as_func / func_as_ptr] +// ============================================================================ + +template +static inline Func ptr_as_func(void* func) noexcept { return Support::ptr_cast_impl(func); } +template +static inline void* func_as_ptr(Func func) noexcept { return Support::ptr_cast_impl(func); } + +// ============================================================================ +// [asmjit::DebugUtils] +// ============================================================================ + +//! Debugging utilities. +namespace DebugUtils { + +//! Used to silence warnings about unused arguments or variables. +template +static ASMJIT_INLINE void unused(Args&&...) noexcept {} + +//! Returns the error `err` passed. +//! +//! Provided for debugging purposes. Putting a breakpoint inside `errored` can +//! help with tracing the origin of any error reported / returned by AsmJit. +static constexpr Error errored(Error err) noexcept { return err; } + +//! Returns a printable version of `asmjit::Error` code. +ASMJIT_API const char* errorAsString(Error err) noexcept; + +//! Called to output debugging message(s). +ASMJIT_API void debugOutput(const char* str) noexcept; + +//! Called on assertion failure. +//! +//! \param file Source file name where it happened. +//! \param line Line in the source file. +//! \param msg Message to display. +//! +//! If you have problems with assertions put a breakpoint at assertionFailed() +//! function (asmjit/core/globals.cpp) and check the call stack to locate the +//! failing code. +ASMJIT_API void ASMJIT_NORETURN assertionFailed(const char* file, int line, const char* msg) noexcept; + +#if defined(ASMJIT_BUILD_DEBUG) +#define ASMJIT_ASSERT(EXP) \ + do { \ + if (ASMJIT_LIKELY(EXP)) \ + break; \ + ::asmjit::DebugUtils::assertionFailed(__FILE__, __LINE__, #EXP); \ + } while (0) +#else +#define ASMJIT_ASSERT(EXP) ((void)0) +#endif + +//! Used by AsmJit to propagate a possible `Error` produced by `...` to the caller. +#define ASMJIT_PROPAGATE(...) \ + do { \ + ::asmjit::Error _err = __VA_ARGS__; \ + if (ASMJIT_UNLIKELY(_err)) \ + return _err; \ + } while (0) + +} // {DebugUtils} + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_GLOBALS_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/inst.cpp b/3rdparty/asmjit/src/asmjit/core/inst.cpp new file mode 100644 index 00000000000..d89c29f1917 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/inst.cpp @@ -0,0 +1,139 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#ifdef ASMJIT_BUILD_X86 + +#include "../core/arch.h" +#include "../core/inst.h" + +#ifdef ASMJIT_BUILD_X86 + #include "../x86/x86instapi_p.h" +#endif + +#ifdef ASMJIT_BUILD_ARM + #include "../arm/arminstapi_p.h" +#endif + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::InstAPI - Text] +// ============================================================================ + +#ifndef ASMJIT_NO_TEXT +Error InstAPI::instIdToString(uint32_t archId, uint32_t instId, String& output) noexcept { +#ifdef ASMJIT_BUILD_X86 + if (ArchInfo::isX86Family(archId)) + return x86::InstInternal::instIdToString(archId, instId, output); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (ArchInfo::isArmFamily(archId)) + return arm::InstInternal::instIdToString(archId, instId, output); +#endif + + return DebugUtils::errored(kErrorInvalidArch); +} + +uint32_t InstAPI::stringToInstId(uint32_t archId, const char* s, size_t len) noexcept { +#ifdef ASMJIT_BUILD_X86 + if (ArchInfo::isX86Family(archId)) + return x86::InstInternal::stringToInstId(archId, s, len); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (ArchInfo::isArmFamily(archId)) + return arm::InstInternal::stringToInstId(archId, s, len); +#endif + + return 0; +} +#endif // !ASMJIT_NO_TEXT + +// ============================================================================ +// [asmjit::InstAPI - Validate] +// ============================================================================ + +#ifndef ASMJIT_NO_VALIDATION +Error InstAPI::validate(uint32_t archId, const BaseInst& inst, const Operand_* operands, uint32_t opCount) noexcept { +#ifdef ASMJIT_BUILD_X86 + if (ArchInfo::isX86Family(archId)) + return x86::InstInternal::validate(archId, inst, operands, opCount); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (ArchInfo::isArmFamily(archId)) + return arm::InstInternal::validate(archId, inst, operands, opCount); +#endif + + return DebugUtils::errored(kErrorInvalidArch); +} +#endif // !ASMJIT_NO_VALIDATION + +// ============================================================================ +// [asmjit::InstAPI - QueryRWInfo] +// ============================================================================ + +#ifndef ASMJIT_NO_INTROSPECTION +Error InstAPI::queryRWInfo(uint32_t archId, const BaseInst& inst, const Operand_* operands, uint32_t opCount, InstRWInfo& out) noexcept { + if (ASMJIT_UNLIKELY(opCount > 6)) + return DebugUtils::errored(kErrorInvalidArgument); + +#ifdef ASMJIT_BUILD_X86 + if (ArchInfo::isX86Family(archId)) + return x86::InstInternal::queryRWInfo(archId, inst, operands, opCount, out); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (ArchInfo::isArmFamily(archId)) + return arm::InstInternal::queryRWInfo(archId, inst, operands, opCount, out); +#endif + + return DebugUtils::errored(kErrorInvalidArch); +} +#endif // !ASMJIT_NO_INTROSPECTION + +// ============================================================================ +// [asmjit::InstAPI - QueryFeatures] +// ============================================================================ + +#ifndef ASMJIT_NO_INTROSPECTION +Error InstAPI::queryFeatures(uint32_t archId, const BaseInst& inst, const Operand_* operands, uint32_t opCount, BaseFeatures& out) noexcept { +#ifdef ASMJIT_BUILD_X86 + if (ArchInfo::isX86Family(archId)) + return x86::InstInternal::queryFeatures(archId, inst, operands, opCount, out); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (ArchInfo::isArmFamily(archId)) + return arm::InstInternal::queryFeatures(archId, inst, operands, opCount, out); +#endif + + return DebugUtils::errored(kErrorInvalidArch); +} +#endif // !ASMJIT_NO_INTROSPECTION + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_BUILD_X86 diff --git a/3rdparty/asmjit/src/asmjit/core/inst.h b/3rdparty/asmjit/src/asmjit/core/inst.h new file mode 100644 index 00000000000..91671822043 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/inst.h @@ -0,0 +1,469 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_INST_H_INCLUDED +#define ASMJIT_CORE_INST_H_INCLUDED + +#include "../core/cpuinfo.h" +#include "../core/operand.h" +#include "../core/string.h" +#include "../core/support.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_core +//! \{ + +// ============================================================================ +// [asmjit::InstInfo] +// ============================================================================ + +// TODO: Finalize instruction info and make more x86::InstDB methods/structs private. + +/* + +struct InstInfo { + //! Architecture agnostic attributes. + enum Attributes : uint32_t { + + + }; + + //! Instruction attributes. + uint32_t _attributes; + + inline void reset() noexcept { memset(this, 0, sizeof(*this)); } + + inline uint32_t attributes() const noexcept { return _attributes; } + inline bool hasAttribute(uint32_t attr) const noexcept { return (_attributes & attr) != 0; } +}; + +//! Gets attributes of the given instruction. +ASMJIT_API Error queryCommonInfo(uint32_t archId, uint32_t instId, InstInfo& out) noexcept; + +*/ + +// ============================================================================ +// [asmjit::InstRWInfo / OpRWInfo] +// ============================================================================ + +//! Read/Write information related to a single operand, used by `InstRWInfo`. +struct OpRWInfo { + //! Read/Write flags, see `OpRWInfo::Flags`. + uint32_t _opFlags; + //! Physical register index, if required. + uint8_t _physId; + //! Size of a possible memory operand that can replace a register operand. + uint8_t _rmSize; + //! Reserved for future use. + uint8_t _reserved[2]; + //! Read bit-mask where each bit represents one byte read from Reg/Mem. + uint64_t _readByteMask; + //! Write bit-mask where each bit represents one byte written to Reg/Mem. + uint64_t _writeByteMask; + //! Zero/Sign extend bit-mask where each bit represents one byte written to Reg/Mem. + uint64_t _extendByteMask; + + //! Flags describe how the operand is accessed and some additional information. + enum Flags : uint32_t { + //! Operand is read. + //! + //! \note This flag must be `0x00000001`. + kRead = 0x00000001u, + + //! Operand is written. + //! + //! \note This flag must be `0x00000002`. + kWrite = 0x00000002u, + + //! Operand is both read and written. + //! + //! \note This combination of flags must be `0x00000003`. + kRW = 0x00000003u, + + //! Register operand can be replaced by a memory operand. + kRegMem = 0x00000004u, + + //! The `extendByteMask()` represents a zero extension. + kZExt = 0x00000010u, + + //! Register operand must use `physId()`. + kRegPhysId = 0x00000100u, + //! Base register of a memory operand must use `physId()`. + kMemPhysId = 0x00000200u, + + //! This memory operand is only used to encode registers and doesn't access memory. + //! + //! X86 Specific + //! ------------ + //! + //! Instructions that use such feature include BNDLDX, BNDSTX, and LEA. + kMemFake = 0x000000400u, + + //! Base register of the memory operand will be read. + kMemBaseRead = 0x00001000u, + //! Base register of the memory operand will be written. + kMemBaseWrite = 0x00002000u, + //! Base register of the memory operand will be read & written. + kMemBaseRW = 0x00003000u, + + //! Index register of the memory operand will be read. + kMemIndexRead = 0x00004000u, + //! Index register of the memory operand will be written. + kMemIndexWrite = 0x00008000u, + //! Index register of the memory operand will be read & written. + kMemIndexRW = 0x0000C000u, + + //! Base register of the memory operand will be modified before the operation. + kMemBasePreModify = 0x00010000u, + //! Base register of the memory operand will be modified after the operation. + kMemBasePostModify = 0x00020000u + }; + + static_assert(kRead == 0x1, "OpRWInfo::kRead flag must be 0x1"); + static_assert(kWrite == 0x2, "OpRWInfo::kWrite flag must be 0x2"); + static_assert(kRegMem == 0x4, "OpRWInfo::kRegMem flag must be 0x4"); + + //! \name Reset + //! \{ + + inline void reset() noexcept { memset(this, 0, sizeof(*this)); } + inline void reset(uint32_t opFlags, uint32_t regSize, uint32_t physId = BaseReg::kIdBad) noexcept { + _opFlags = opFlags; + _physId = uint8_t(physId); + _rmSize = uint8_t((opFlags & kRegMem) ? regSize : uint32_t(0)); + _resetReserved(); + + uint64_t mask = Support::lsbMask(regSize); + _readByteMask = opFlags & kRead ? mask : uint64_t(0); + _writeByteMask = opFlags & kWrite ? mask : uint64_t(0); + _extendByteMask = 0; + } + + inline void _resetReserved() noexcept { + memset(_reserved, 0, sizeof(_reserved)); + } + + //! \} + + //! \name Operand Flags + //! \{ + + inline uint32_t opFlags() const noexcept { return _opFlags; } + inline bool hasOpFlag(uint32_t flag) const noexcept { return (_opFlags & flag) != 0; } + + inline void addOpFlags(uint32_t flags) noexcept { _opFlags |= flags; } + inline void clearOpFlags(uint32_t flags) noexcept { _opFlags &= ~flags; } + + inline bool isRead() const noexcept { return hasOpFlag(kRead); } + inline bool isWrite() const noexcept { return hasOpFlag(kWrite); } + inline bool isReadWrite() const noexcept { return (_opFlags & kRW) == kRW; } + inline bool isReadOnly() const noexcept { return (_opFlags & kRW) == kRead; } + inline bool isWriteOnly() const noexcept { return (_opFlags & kRW) == kWrite; } + inline bool isRm() const noexcept { return hasOpFlag(kRegMem); } + inline bool isZExt() const noexcept { return hasOpFlag(kZExt); } + + //! \} + + //! \name Physical Register ID + //! \{ + + inline uint32_t physId() const noexcept { return _physId; } + inline bool hasPhysId() const noexcept { return _physId != BaseReg::kIdBad; } + inline void setPhysId(uint32_t physId) noexcept { _physId = uint8_t(physId); } + + //! \} + + //! \name Reg/Mem + //! \{ + + inline uint32_t rmSize() const noexcept { return _rmSize; } + inline void setRmSize(uint32_t rmSize) noexcept { _rmSize = uint8_t(rmSize); } + + //! \} + + //! \name Read & Write Masks + //! \{ + + inline uint64_t readByteMask() const noexcept { return _readByteMask; } + inline uint64_t writeByteMask() const noexcept { return _writeByteMask; } + inline uint64_t extendByteMask() const noexcept { return _extendByteMask; } + + inline void setReadByteMask(uint64_t mask) noexcept { _readByteMask = mask; } + inline void setWriteByteMask(uint64_t mask) noexcept { _writeByteMask = mask; } + inline void setExtendByteMask(uint64_t mask) noexcept { _extendByteMask = mask; } + + //! \} +}; + +//! Read/Write information of an instruction. +struct InstRWInfo { + //! Instruction flags. + uint32_t _instFlags; + //! Mask of flags read. + uint32_t _readFlags; + //! Mask of flags written. + uint32_t _writeFlags; + //! Count of operands. + uint8_t _opCount; + //! CPU feature required for replacing register operand with memory operand. + uint8_t _rmFeature; + //! Reserved for future use. + uint8_t _reserved[19]; + //! Read/Write onfo of extra register (rep{} or kz{}). + OpRWInfo _extraReg; + //! Read/Write info of instruction operands. + OpRWInfo _operands[Globals::kMaxOpCount]; + + inline void reset() noexcept { memset(this, 0, sizeof(*this)); } + + inline uint32_t instFlags() const noexcept { return _instFlags; } + inline bool hasInstFlag(uint32_t flag) const noexcept { return (_instFlags & flag) != 0; } + + inline uint32_t opCount() const noexcept { return _opCount; } + + inline uint32_t readFlags() const noexcept { return _readFlags; } + inline uint32_t writeFlags() const noexcept { return _writeFlags; } + + //! Returns the CPU feature required to replace a register operand with memory + //! operand. If the returned feature is zero (none) then this instruction + //! either doesn't provide memory operand combination or there is no extra + //! CPU feature required. + //! + //! X86 Specific + //! ------------ + //! + //! Some AVX+ instructions may require extra features for replacing registers + //! with memory operands, for example VPSLLDQ instruction only supports + //! 'reg/reg/imm' combination on AVX/AVX2 capable CPUs and requires AVX-512 for + //! 'reg/mem/imm' combination. + inline uint32_t rmFeature() const noexcept { return _rmFeature; } + + inline const OpRWInfo& extraReg() const noexcept { return _extraReg; } + inline const OpRWInfo* operands() const noexcept { return _operands; } + + inline const OpRWInfo& operand(size_t index) const noexcept { + ASMJIT_ASSERT(index < Globals::kMaxOpCount); + return _operands[index]; + } +}; + +// ============================================================================ +// [asmjit::BaseInst] +// ============================================================================ + +//! Instruction id, options, and extraReg in a single structure. This structure +//! exists mainly to simplify analysis and validation API that requires `BaseInst` +//! and `Operand[]` array. +class BaseInst { +public: + //! Instruction id. + uint32_t _id; + //! Instruction options. + uint32_t _options; + //! Extra register used by instruction (either REP register or AVX-512 selector). + RegOnly _extraReg; + + enum Id : uint32_t { + //! Invalid or uninitialized instruction id. + kIdNone = 0x00000000u, + //! Abstract instruction (BaseBuilder and BaseCompiler). + kIdAbstract = 0x80000000u + }; + + enum Options : uint32_t { + //! Used internally by emitters for handling errors and rare cases. + kOptionReserved = 0x00000001u, + + //! Used only by Assembler to mark that `_op4` and `_op5` are used (internal). + //! + //! TODO: This should be removed in the future. + kOptionOp4Op5Used = 0x00000002u, + + //! Prevents following a jump during compilation (BaseCompiler). + //! + //! TODO: This should be renamed to kOptionNoReturn. + kOptionUnfollow = 0x00000010u, + + //! Overwrite the destination operand(s) (BaseCompiler). + //! + //! Hint that is important for register liveness analysis. It tells the + //! compiler that the destination operand will be overwritten now or by + //! adjacent instructions. BaseCompiler knows when a register is completely + //! overwritten by a single instruction, for example you don't have to + //! mark "movaps" or "pxor x, x", however, if a pair of instructions is + //! used and the first of them doesn't completely overwrite the content + //! of the destination, BaseCompiler fails to mark that register as dead. + //! + //! X86 Specific + //! ------------ + //! + //! - All instructions that always overwrite at least the size of the + //! register the virtual-register uses , for example "mov", "movq", + //! "movaps" don't need the overwrite option to be used - conversion, + //! shuffle, and other miscellaneous instructions included. + //! + //! - All instructions that clear the destination register if all operands + //! are the same, for example "xor x, x", "pcmpeqb x x", etc... + //! + //! - Consecutive instructions that partially overwrite the variable until + //! there is no old content require `BaseCompiler::overwrite()` to be used. + //! Some examples (not always the best use cases thought): + //! + //! - `movlps xmm0, ?` followed by `movhps xmm0, ?` and vice versa + //! - `movlpd xmm0, ?` followed by `movhpd xmm0, ?` and vice versa + //! - `mov al, ?` followed by `and ax, 0xFF` + //! - `mov al, ?` followed by `mov ah, al` + //! - `pinsrq xmm0, ?, 0` followed by `pinsrq xmm0, ?, 1` + //! + //! - If allocated variable is used temporarily for scalar operations. For + //! example if you allocate a full vector like `x86::Compiler::newXmm()` + //! and then use that vector for scalar operations you should use + //! `overwrite()` directive: + //! + //! - `sqrtss x, y` - only LO element of `x` is changed, if you don't + //! use HI elements, use `compiler.overwrite().sqrtss(x, y)`. + kOptionOverwrite = 0x00000020u, + + //! Emit short-form of the instruction. + kOptionShortForm = 0x00000040u, + //! Emit long-form of the instruction. + kOptionLongForm = 0x00000080u, + + //! Conditional jump is likely to be taken. + kOptionTaken = 0x00000100u, + //! Conditional jump is unlikely to be taken. + kOptionNotTaken = 0x00000200u + }; + + //! Control type. + enum ControlType : uint32_t { + //! No control type (doesn't jump). + kControlNone = 0u, + //! Unconditional jump. + kControlJump = 1u, + //! Conditional jump (branch). + kControlBranch = 2u, + //! Function call. + kControlCall = 3u, + //! Function return. + kControlReturn = 4u + }; + + //! \name Construction & Destruction + //! \{ + + inline explicit BaseInst(uint32_t id = 0, uint32_t options = 0) noexcept + : _id(id), + _options(options), + _extraReg() {} + + inline BaseInst(uint32_t id, uint32_t options, const RegOnly& extraReg) noexcept + : _id(id), + _options(options), + _extraReg(extraReg) {} + + inline BaseInst(uint32_t id, uint32_t options, const BaseReg& extraReg) noexcept + : _id(id), + _options(options), + _extraReg { extraReg.signature(), extraReg.id() } {} + + //! \} + + //! \name Instruction ID + //! \{ + + inline uint32_t id() const noexcept { return _id; } + inline void setId(uint32_t id) noexcept { _id = id; } + inline void resetId() noexcept { _id = 0; } + + //! \} + + //! \name Instruction Options + //! \{ + + inline uint32_t options() const noexcept { return _options; } + inline void setOptions(uint32_t options) noexcept { _options = options; } + inline void addOptions(uint32_t options) noexcept { _options |= options; } + inline void clearOptions(uint32_t options) noexcept { _options &= ~options; } + inline void resetOptions() noexcept { _options = 0; } + + //! \} + + //! \name Extra Register + //! \{ + + inline bool hasExtraReg() const noexcept { return _extraReg.isReg(); } + inline RegOnly& extraReg() noexcept { return _extraReg; } + inline const RegOnly& extraReg() const noexcept { return _extraReg; } + inline void setExtraReg(const BaseReg& reg) noexcept { _extraReg.init(reg); } + inline void setExtraReg(const RegOnly& reg) noexcept { _extraReg.init(reg); } + inline void resetExtraReg() noexcept { _extraReg.reset(); } + + //! \} +}; + +// ============================================================================ +// [asmjit::InstAPI] +// ============================================================================ + +//! Instruction API. +namespace InstAPI { + +#ifndef ASMJIT_NO_TEXT +//! Appends the name of the instruction specified by `instId` and `instOptions` +//! into the `output` string. +//! +//! \note Instruction options would only affect instruction prefix & suffix, +//! other options would be ignored. If `instOptions` is zero then only raw +//! instruction name (without any additional text) will be appended. +ASMJIT_API Error instIdToString(uint32_t archId, uint32_t instId, String& output) noexcept; + +//! Parses an instruction name in the given string `s`. Length is specified +//! by `len` argument, which can be `SIZE_MAX` if `s` is known to be null +//! terminated. +//! +//! The output is stored in `instId`. +ASMJIT_API uint32_t stringToInstId(uint32_t archId, const char* s, size_t len) noexcept; +#endif // !ASMJIT_NO_TEXT + +#ifndef ASMJIT_NO_VALIDATION +//! Validates the given instruction. +ASMJIT_API Error validate(uint32_t archId, const BaseInst& inst, const Operand_* operands, uint32_t opCount) noexcept; +#endif // !ASMJIT_NO_VALIDATION + +#ifndef ASMJIT_NO_INTROSPECTION +//! Gets Read/Write information of the given instruction. +ASMJIT_API Error queryRWInfo(uint32_t archId, const BaseInst& inst, const Operand_* operands, uint32_t opCount, InstRWInfo& out) noexcept; + +//! Gets CPU features required by the given instruction. +ASMJIT_API Error queryFeatures(uint32_t archId, const BaseInst& inst, const Operand_* operands, uint32_t opCount, BaseFeatures& out) noexcept; +#endif // !ASMJIT_NO_INTROSPECTION + +} // {InstAPI} + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_INST_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/jitallocator.cpp b/3rdparty/asmjit/src/asmjit/core/jitallocator.cpp new file mode 100644 index 00000000000..a8ca0c3d75a --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/jitallocator.cpp @@ -0,0 +1,1152 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#ifndef ASMJIT_NO_JIT + +#include "../core/arch.h" +#include "../core/jitallocator.h" +#include "../core/osutils.h" +#include "../core/support.h" +#include "../core/virtmem.h" +#include "../core/zone.h" +#include "../core/zonelist.h" +#include "../core/zonetree.h" + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::JitAllocator - Constants] +// ============================================================================ + +enum JitAllocatorConstants : uint32_t { + //! Number of pools to use when `JitAllocator::kOptionUseMultiplePools` is set. + //! + //! Each pool increases granularity twice to make memory management more + //! efficient. Ideal number of pools appears to be 3 to 4 as it distributes + //! small and large functions properly. + kJitAllocatorMultiPoolCount = 3, + + //! Minimum granularity (and the default granularity for pool #0). + kJitAllocatorBaseGranularity = 64, + + //! Maximum block size (16MB). + kJitAllocatorMaxBlockSize = 1024 * 1024 * 16 +}; + +static inline uint32_t JitAllocator_defaultFillPattern() noexcept { + // X86 and X86_64 - 4x 'int3' instruction. + if (ASMJIT_ARCH_X86) + return 0xCCCCCCCCu; + + // Unknown... + return 0u; +} + +// ============================================================================ +// [asmjit::JitAllocator - BitFlipIterator] +// ============================================================================ + +//! BitWord[] iterator used by `JitAllocator` that can flip the search pattern +//! during iteration. +template +class BitFlipIterator { +public: + ASMJIT_INLINE BitFlipIterator(const T* data, size_t numBitWords, size_t start = 0, T xorMask = 0) noexcept { + init(data, numBitWords, start, xorMask); + } + + ASMJIT_INLINE void init(const T* data, size_t numBitWords, size_t start = 0, T xorMask = 0) noexcept { + const T* ptr = data + (start / Support::bitSizeOf()); + size_t idx = Support::alignDown(start, Support::bitSizeOf()); + size_t end = numBitWords * Support::bitSizeOf(); + + T bitWord = T(0); + if (idx < end) { + bitWord = (*ptr++ ^ xorMask) & (Support::allOnes() << (start % Support::bitSizeOf())); + while (!bitWord && (idx += Support::bitSizeOf()) < end) + bitWord = *ptr++ ^ xorMask; + } + + _ptr = ptr; + _idx = idx; + _end = end; + _current = bitWord; + _xorMask = xorMask; + } + + ASMJIT_INLINE bool hasNext() const noexcept { + return _current != T(0); + } + + ASMJIT_INLINE size_t next() noexcept { + T bitWord = _current; + ASMJIT_ASSERT(bitWord != T(0)); + + uint32_t bit = Support::ctz(bitWord); + bitWord ^= T(1u) << bit; + + size_t n = _idx + bit; + while (!bitWord && (_idx += Support::bitSizeOf()) < _end) + bitWord = *_ptr++ ^ _xorMask; + + _current = bitWord; + return n; + } + + ASMJIT_INLINE size_t nextAndFlip() noexcept { + T bitWord = _current; + ASMJIT_ASSERT(bitWord != T(0)); + + uint32_t bit = Support::ctz(bitWord); + bitWord ^= Support::allOnes() << bit; + _xorMask ^= Support::allOnes(); + + size_t n = _idx + bit; + while (!bitWord && (_idx += Support::bitSizeOf()) < _end) + bitWord = *_ptr++ ^ _xorMask; + + _current = bitWord; + return n; + } + + ASMJIT_INLINE size_t peekNext() const noexcept { + ASMJIT_ASSERT(_current != T(0)); + return _idx + Support::ctz(_current); + } + + const T* _ptr; + size_t _idx; + size_t _end; + T _current; + T _xorMask; +}; + +// ============================================================================ +// [asmjit::JitAllocator - Pool] +// ============================================================================ + +class JitAllocatorBlock; + +class JitAllocatorPool { +public: + ASMJIT_NONCOPYABLE(JitAllocatorPool) + + inline JitAllocatorPool(uint32_t granularity) noexcept + : blocks(), + cursor(nullptr), + blockCount(0), + granularity(uint16_t(granularity)), + granularityLog2(uint8_t(Support::ctz(granularity))), + emptyBlockCount(0), + totalAreaSize(0), + totalAreaUsed(0), + totalOverheadBytes(0) {} + + inline void reset() noexcept { + blocks.reset(); + cursor = nullptr; + blockCount = 0; + totalAreaSize = 0; + totalAreaUsed = 0; + totalOverheadBytes = 0; + } + + inline size_t byteSizeFromAreaSize(uint32_t areaSize) const noexcept { return size_t(areaSize) * granularity; } + inline uint32_t areaSizeFromByteSize(size_t size) const noexcept { return uint32_t((size + granularity - 1) >> granularityLog2); } + + inline size_t bitWordCountFromAreaSize(uint32_t areaSize) const noexcept { + using namespace Support; + return alignUp(areaSize, kBitWordSizeInBits) / kBitWordSizeInBits; + } + + //! Double linked list of blocks. + ZoneList blocks; + //! Where to start looking first. + JitAllocatorBlock* cursor; + + //! Count of blocks. + uint32_t blockCount; + //! Allocation granularity. + uint16_t granularity; + //! Log2(granularity). + uint8_t granularityLog2; + //! Count of empty blocks (either 0 or 1 as we won't keep more blocks empty). + uint8_t emptyBlockCount; + + //! Number of bits reserved across all blocks. + size_t totalAreaSize; + //! Number of bits used across all blocks. + size_t totalAreaUsed; + //! Overhead of all blocks (in bytes). + size_t totalOverheadBytes; +}; + +// ============================================================================ +// [asmjit::JitAllocator - Block] +// ============================================================================ + +class JitAllocatorBlock : public ZoneTreeNodeT, + public ZoneListNode { +public: + ASMJIT_NONCOPYABLE(JitAllocatorBlock) + + enum Flags : uint32_t { + //! Block is empty. + kFlagEmpty = 0x00000001u, + //! Block is dirty (largestUnusedArea, searchStart, searchEnd). + kFlagDirty = 0x00000002u, + //! Block is dual-mapped. + kFlagDualMapped = 0x00000004u + }; + + inline JitAllocatorBlock( + JitAllocatorPool* pool, + VirtMem::DualMapping mapping, + size_t blockSize, + uint32_t blockFlags, + Support::BitWord* usedBitVector, + Support::BitWord* stopBitVector, + uint32_t areaSize) noexcept + : ZoneTreeNodeT(), + pool(pool), + mapping(mapping), + blockSize(blockSize), + flags(blockFlags), + areaSize(areaSize), + areaUsed(0), + largestUnusedArea(areaSize), + searchStart(0), + searchEnd(areaSize), + usedBitVector(usedBitVector), + stopBitVector(stopBitVector) {} + + inline uint8_t* roPtr() const noexcept { return static_cast(mapping.ro); } + inline uint8_t* rwPtr() const noexcept { return static_cast(mapping.rw); } + + inline bool hasFlag(uint32_t f) const noexcept { return (flags & f) != 0; } + inline void addFlags(uint32_t f) noexcept { flags |= f; } + inline void clearFlags(uint32_t f) noexcept { flags &= ~f; } + + inline uint32_t areaAvailable() const noexcept { return areaSize - areaUsed; } + + inline void increaseUsedArea(uint32_t value) noexcept { + areaUsed += value; + pool->totalAreaUsed += value; + } + + inline void decreaseUsedArea(uint32_t value) noexcept { + areaUsed -= value; + pool->totalAreaUsed -= value; + } + + // RBTree default CMP uses '<' and '>' operators. + inline bool operator<(const JitAllocatorBlock& other) const noexcept { return roPtr() < other.roPtr(); } + inline bool operator>(const JitAllocatorBlock& other) const noexcept { return roPtr() > other.roPtr(); } + + // Special implementation for querying blocks by `key`, which must be in `[BlockPtr, BlockPtr + BlockSize)` range. + inline bool operator<(const uint8_t* key) const noexcept { return roPtr() + blockSize <= key; } + inline bool operator>(const uint8_t* key) const noexcept { return roPtr() > key; } + + //! Link to the pool that owns this block. + JitAllocatorPool* pool; + //! Virtual memory mapping - either single mapping (both pointers equal) or + //! dual mapping, where one pointer is Read+Execute and the second Read+Write. + VirtMem::DualMapping mapping; + //! Virtual memory size (block size) [bytes]. + size_t blockSize; + + //! Block flags. + uint32_t flags; + //! Size of the whole block area (bit-vector size). + uint32_t areaSize; + //! Used area (number of bits in bit-vector used). + uint32_t areaUsed; + //! The largest unused continuous area in the bit-vector (or `areaSize` to initiate rescan). + uint32_t largestUnusedArea; + //! Start of a search range (for unused bits). + uint32_t searchStart; + //! End of a search range (for unused bits). + uint32_t searchEnd; + + //! Used bit-vector (0 = unused, 1 = used). + Support::BitWord* usedBitVector; + //! Stop bit-vector (0 = don't care, 1 = stop). + Support::BitWord* stopBitVector; +}; + +// ============================================================================ +// [asmjit::JitAllocator - PrivateImpl] +// ============================================================================ + +class JitAllocatorPrivateImpl : public JitAllocator::Impl { +public: + inline JitAllocatorPrivateImpl(JitAllocatorPool* pools, size_t poolCount) noexcept + : JitAllocator::Impl {}, + pools(pools), + poolCount(poolCount) {} + inline ~JitAllocatorPrivateImpl() noexcept {} + + //! Lock for thread safety. + mutable Lock lock; + //! System page size (also a minimum block size). + uint32_t pageSize; + + //! Blocks from all pools in RBTree. + ZoneTree tree; + //! Allocator pools. + JitAllocatorPool* pools; + //! Number of allocator pools. + size_t poolCount; +}; + +static const JitAllocator::Impl JitAllocatorImpl_none {}; +static const JitAllocator::CreateParams JitAllocatorParams_none {}; + +// ============================================================================ +// [asmjit::JitAllocator - Utilities] +// ============================================================================ + +static inline JitAllocatorPrivateImpl* JitAllocatorImpl_new(const JitAllocator::CreateParams* params) noexcept { + VirtMem::Info vmInfo = VirtMem::info(); + + if (!params) + params = &JitAllocatorParams_none; + + uint32_t options = params->options; + uint32_t blockSize = params->blockSize; + uint32_t granularity = params->granularity; + uint32_t fillPattern = params->fillPattern; + + // Setup pool count to [1..3]. + size_t poolCount = 1; + if (options & JitAllocator::kOptionUseMultiplePools) + poolCount = kJitAllocatorMultiPoolCount;; + + // Setup block size [64kB..256MB]. + if (blockSize < 64 * 1024 || blockSize > 256 * 1024 * 1024 || !Support::isPowerOf2(blockSize)) + blockSize = vmInfo.pageGranularity; + + // Setup granularity [64..256]. + if (granularity < 64 || granularity > 256 || !Support::isPowerOf2(granularity)) + granularity = kJitAllocatorBaseGranularity; + + // Setup fill-pattern. + if (!(options & JitAllocator::kOptionCustomFillPattern)) + fillPattern = JitAllocator_defaultFillPattern(); + + size_t size = sizeof(JitAllocatorPrivateImpl) + sizeof(JitAllocatorPool) * poolCount; + void* p = ::malloc(size); + if (ASMJIT_UNLIKELY(!p)) + return nullptr; + + JitAllocatorPool* pools = reinterpret_cast((uint8_t*)p + sizeof(JitAllocatorPrivateImpl)); + JitAllocatorPrivateImpl* impl = new(p) JitAllocatorPrivateImpl(pools, poolCount); + + impl->options = options; + impl->blockSize = blockSize; + impl->granularity = granularity; + impl->fillPattern = fillPattern; + impl->pageSize = vmInfo.pageSize; + + for (size_t poolId = 0; poolId < poolCount; poolId++) + new(&pools[poolId]) JitAllocatorPool(granularity << poolId); + + return impl; +} + +static inline void JitAllocatorImpl_destroy(JitAllocatorPrivateImpl* impl) noexcept { + impl->~JitAllocatorPrivateImpl(); + ::free(impl); +} + +static inline size_t JitAllocatorImpl_sizeToPoolId(const JitAllocatorPrivateImpl* impl, size_t size) noexcept { + size_t poolId = impl->poolCount - 1; + size_t granularity = size_t(impl->granularity) << poolId; + + while (poolId) { + if (Support::alignUp(size, granularity) == size) + break; + poolId--; + granularity >>= 1; + } + + return poolId; +} + +static inline size_t JitAllocatorImpl_bitVectorSizeToByteSize(uint32_t areaSize) noexcept { + using Support::kBitWordSizeInBits; + return ((areaSize + kBitWordSizeInBits - 1u) / kBitWordSizeInBits) * sizeof(Support::BitWord); +} + +static inline size_t JitAllocatorImpl_calculateIdealBlockSize(JitAllocatorPrivateImpl* impl, JitAllocatorPool* pool, size_t allocationSize) noexcept { + JitAllocatorBlock* last = pool->blocks.last(); + size_t blockSize = last ? last->blockSize : size_t(impl->blockSize); + + if (blockSize < kJitAllocatorMaxBlockSize) + blockSize *= 2u; + + if (allocationSize > blockSize) { + blockSize = Support::alignUp(allocationSize, impl->blockSize); + if (ASMJIT_UNLIKELY(blockSize < allocationSize)) + return 0; // Overflown. + } + + return blockSize; +} + +ASMJIT_FAVOR_SPEED static void JitAllocatorImpl_fillPattern(void* mem, uint32_t pattern, size_t sizeInBytes) noexcept { + size_t n = sizeInBytes / 4u; + uint32_t* p = static_cast(mem); + + for (size_t i = 0; i < n; i++) + p[i] = pattern; +} + +// Allocate a new `JitAllocatorBlock` for the given `blockSize`. +// +// NOTE: The block doesn't have `kFlagEmpty` flag set, because the new block +// is only allocated when it's actually needed, so it would be cleared anyway. +static JitAllocatorBlock* JitAllocatorImpl_newBlock(JitAllocatorPrivateImpl* impl, JitAllocatorPool* pool, size_t blockSize) noexcept { + using Support::BitWord; + using Support::kBitWordSizeInBits; + + uint32_t areaSize = uint32_t((blockSize + pool->granularity - 1) >> pool->granularityLog2); + uint32_t numBitWords = (areaSize + kBitWordSizeInBits - 1u) / kBitWordSizeInBits; + + JitAllocatorBlock* block = static_cast(::malloc(sizeof(JitAllocatorBlock))); + BitWord* bitWords = nullptr; + VirtMem::DualMapping virtMem {}; + Error err = kErrorOutOfMemory; + + if (block != nullptr) + bitWords = static_cast(::malloc(size_t(numBitWords) * 2 * sizeof(BitWord))); + + uint32_t blockFlags = 0; + if (bitWords != nullptr) { + if (impl->options & JitAllocator::kOptionUseDualMapping) { + err = VirtMem::allocDualMapping(&virtMem, blockSize, VirtMem::kAccessReadWrite | VirtMem::kAccessExecute); + blockFlags |= JitAllocatorBlock::kFlagDualMapped; + } + else { + err = VirtMem::alloc(&virtMem.ro, blockSize, VirtMem::kAccessReadWrite | VirtMem::kAccessExecute); + virtMem.rw = virtMem.ro; + } + } + + // Out of memory. + if (ASMJIT_UNLIKELY(!block || !bitWords || err != kErrorOk)) { + if (bitWords) ::free(bitWords); + if (block) ::free(block); + return nullptr; + } + + // Fill the memory if the secure mode is enabled. + if (impl->options & JitAllocator::kOptionFillUnusedMemory) + JitAllocatorImpl_fillPattern(virtMem.rw, impl->fillPattern, blockSize); + + memset(bitWords, 0, size_t(numBitWords) * 2 * sizeof(BitWord)); + return new(block) JitAllocatorBlock(pool, virtMem, blockSize, blockFlags, bitWords, bitWords + numBitWords, areaSize); +} + +static void JitAllocatorImpl_deleteBlock(JitAllocatorPrivateImpl* impl, JitAllocatorBlock* block) noexcept { + DebugUtils::unused(impl); + + if (block->flags & JitAllocatorBlock::kFlagDualMapped) + VirtMem::releaseDualMapping(&block->mapping, block->blockSize); + else + VirtMem::release(block->mapping.ro, block->blockSize); + + ::free(block->usedBitVector); + ::free(block); +} + +static void JitAllocatorImpl_insertBlock(JitAllocatorPrivateImpl* impl, JitAllocatorBlock* block) noexcept { + JitAllocatorPool* pool = block->pool; + + if (!pool->cursor) + pool->cursor = block; + + // Add to RBTree and List. + impl->tree.insert(block); + pool->blocks.append(block); + + // Update statistics. + pool->blockCount++; + pool->totalAreaSize += block->areaSize; + pool->totalOverheadBytes += sizeof(JitAllocatorBlock) + JitAllocatorImpl_bitVectorSizeToByteSize(block->areaSize) * 2u; +} + +static void JitAllocatorImpl_removeBlock(JitAllocatorPrivateImpl* impl, JitAllocatorBlock* block) noexcept { + JitAllocatorPool* pool = block->pool; + + // Remove from RBTree and List. + if (pool->cursor == block) + pool->cursor = block->hasPrev() ? block->prev() : block->next(); + + impl->tree.remove(block); + pool->blocks.unlink(block); + + // Update statistics. + pool->blockCount--; + pool->totalAreaSize -= block->areaSize; + pool->totalOverheadBytes -= sizeof(JitAllocatorBlock) + JitAllocatorImpl_bitVectorSizeToByteSize(block->areaSize) * 2u; +} + +static void JitAllocatorImpl_wipeOutBlock(JitAllocatorPrivateImpl* impl, JitAllocatorBlock* block) noexcept { + JitAllocatorPool* pool = block->pool; + + if (block->hasFlag(JitAllocatorBlock::kFlagEmpty)) + return; + + uint32_t areaSize = block->areaSize; + uint32_t granularity = pool->granularity; + size_t numBitWords = pool->bitWordCountFromAreaSize(areaSize); + + if (impl->options & JitAllocator::kOptionFillUnusedMemory) { + BitFlipIterator it(block->usedBitVector, numBitWords); + + while (it.hasNext()) { + uint32_t start = uint32_t(it.nextAndFlip()); + uint32_t end = areaSize; + + if (it.hasNext()) + end = uint32_t(it.nextAndFlip()); + + JitAllocatorImpl_fillPattern(block->rwPtr() + start * granularity, impl->fillPattern, (end - start) * granularity); + } + } + + memset(block->usedBitVector, 0, size_t(numBitWords) * sizeof(Support::BitWord)); + memset(block->stopBitVector, 0, size_t(numBitWords) * sizeof(Support::BitWord)); + + block->areaUsed = 0; + block->largestUnusedArea = areaSize; + block->searchStart = 0; + block->searchEnd = areaSize; + block->addFlags(JitAllocatorBlock::kFlagEmpty); + block->clearFlags(JitAllocatorBlock::kFlagDirty); +} + +// ============================================================================ +// [asmjit::JitAllocator - Construction / Destruction] +// ============================================================================ + +JitAllocator::JitAllocator(const CreateParams* params) noexcept { + _impl = JitAllocatorImpl_new(params); + if (ASMJIT_UNLIKELY(!_impl)) + _impl = const_cast(&JitAllocatorImpl_none); +} + +JitAllocator::~JitAllocator() noexcept { + if (_impl == &JitAllocatorImpl_none) + return; + + reset(Globals::kResetHard); + JitAllocatorImpl_destroy(static_cast(_impl)); +} + +// ============================================================================ +// [asmjit::JitAllocator - Reset] +// ============================================================================ + +void JitAllocator::reset(uint32_t resetPolicy) noexcept { + if (_impl == &JitAllocatorImpl_none) + return; + + JitAllocatorPrivateImpl* impl = static_cast(_impl); + impl->tree.reset(); + size_t poolCount = impl->poolCount; + + for (size_t poolId = 0; poolId < poolCount; poolId++) { + JitAllocatorPool& pool = impl->pools[poolId]; + JitAllocatorBlock* block = pool.blocks.first(); + + JitAllocatorBlock* blockToKeep = nullptr; + if (resetPolicy != Globals::kResetHard && !(impl->options & kOptionImmediateRelease)) { + blockToKeep = block; + block = block->next(); + } + + while (block) { + JitAllocatorBlock* next = block->next(); + JitAllocatorImpl_deleteBlock(impl, block); + block = next; + } + + pool.reset(); + + if (blockToKeep) { + blockToKeep->_listNodes[0] = nullptr; + blockToKeep->_listNodes[1] = nullptr; + JitAllocatorImpl_wipeOutBlock(impl, blockToKeep); + JitAllocatorImpl_insertBlock(impl, blockToKeep); + pool.emptyBlockCount = 1; + } + } +} + +// ============================================================================ +// [asmjit::JitAllocator - Statistics] +// ============================================================================ + +JitAllocator::Statistics JitAllocator::statistics() const noexcept { + Statistics statistics; + statistics.reset(); + + if (ASMJIT_LIKELY(_impl != &JitAllocatorImpl_none)) { + JitAllocatorPrivateImpl* impl = static_cast(_impl); + LockGuard guard(impl->lock); + + size_t poolCount = impl->poolCount; + for (size_t poolId = 0; poolId < poolCount; poolId++) { + const JitAllocatorPool& pool = impl->pools[poolId]; + statistics._blockCount += size_t(pool.blockCount); + statistics._reservedSize += size_t(pool.totalAreaSize) * pool.granularity; + statistics._usedSize += size_t(pool.totalAreaUsed) * pool.granularity; + statistics._overheadSize += size_t(pool.totalOverheadBytes); + } + } + + return statistics; +} + +// ============================================================================ +// [asmjit::JitAllocator - Alloc / Release] +// ============================================================================ + +Error JitAllocator::alloc(void** roPtrOut, void** rwPtrOut, size_t size) noexcept { + if (ASMJIT_UNLIKELY(_impl == &JitAllocatorImpl_none)) + return DebugUtils::errored(kErrorNotInitialized); + + JitAllocatorPrivateImpl* impl = static_cast(_impl); + constexpr uint32_t kNoIndex = std::numeric_limits::max(); + + *roPtrOut = nullptr; + *rwPtrOut = nullptr; + + // Align to the minimum granularity by default. + size = Support::alignUp(size, impl->granularity); + if (ASMJIT_UNLIKELY(size == 0)) + return DebugUtils::errored(kErrorInvalidArgument); + + if (ASMJIT_UNLIKELY(size > std::numeric_limits::max() / 2)) + return DebugUtils::errored(kErrorTooLarge); + + LockGuard guard(impl->lock); + JitAllocatorPool* pool = &impl->pools[JitAllocatorImpl_sizeToPoolId(impl, size)]; + + uint32_t areaIndex = kNoIndex; + uint32_t areaSize = uint32_t(pool->areaSizeFromByteSize(size)); + + // Try to find the requested memory area in existing blocks. + JitAllocatorBlock* block = pool->blocks.first(); + if (block) { + JitAllocatorBlock* initial = block; + do { + JitAllocatorBlock* next = block->hasNext() ? block->next() : pool->blocks.first(); + if (block->areaAvailable() >= areaSize) { + if (block->hasFlag(JitAllocatorBlock::kFlagDirty) || block->largestUnusedArea >= areaSize) { + uint32_t blockAreaSize = block->areaSize; + uint32_t searchStart = block->searchStart; + uint32_t searchEnd = block->searchEnd; + + BitFlipIterator it( + block->usedBitVector, + pool->bitWordCountFromAreaSize(searchEnd), + searchStart, + Support::allOnes()); + + // If there is unused area available then there has to be at least one match. + ASMJIT_ASSERT(it.hasNext()); + + uint32_t bestArea = blockAreaSize; + uint32_t largestArea = 0; + uint32_t holeIndex = uint32_t(it.peekNext()); + uint32_t holeEnd = holeIndex; + + searchStart = holeIndex; + do { + holeIndex = uint32_t(it.nextAndFlip()); + if (holeIndex >= searchEnd) break; + + holeEnd = it.hasNext() ? Support::min(searchEnd, uint32_t(it.nextAndFlip())) : searchEnd; + uint32_t holeSize = holeEnd - holeIndex; + + if (holeSize >= areaSize && bestArea >= holeSize) { + largestArea = Support::max(largestArea, bestArea); + bestArea = holeSize; + areaIndex = holeIndex; + } + else { + largestArea = Support::max(largestArea, holeSize); + } + } while (it.hasNext()); + searchEnd = holeEnd; + + // Because we have traversed the entire block, we can now mark the + // largest unused area that can be used to cache the next traversal. + block->searchStart = searchStart; + block->searchEnd = searchEnd; + block->largestUnusedArea = largestArea; + block->clearFlags(JitAllocatorBlock::kFlagDirty); + + if (areaIndex != kNoIndex) { + if (searchStart == areaIndex) + block->searchStart += areaSize; + break; + } + } + } + + block = next; + } while (block != initial); + } + + // Allocate a new block if there is no region of a required width. + if (areaIndex == kNoIndex) { + size_t blockSize = JitAllocatorImpl_calculateIdealBlockSize(impl, pool, size); + if (ASMJIT_UNLIKELY(!blockSize)) + return DebugUtils::errored(kErrorOutOfMemory); + + block = JitAllocatorImpl_newBlock(impl, pool, blockSize); + + if (ASMJIT_UNLIKELY(!block)) + return DebugUtils::errored(kErrorOutOfMemory); + + JitAllocatorImpl_insertBlock(impl, block); + areaIndex = 0; + block->searchStart = areaSize; + block->largestUnusedArea = block->areaSize - areaSize; + } + + // Update statistics. + block->increaseUsedArea(areaSize); + + // Handle special cases. + if (block->hasFlag(JitAllocatorBlock::kFlagEmpty)) { + pool->emptyBlockCount--; + block->clearFlags(JitAllocatorBlock::kFlagEmpty); + } + + if (block->areaAvailable() == 0) { + // The whole block is filled. + block->searchStart = block->areaSize; + block->searchEnd = 0; + block->largestUnusedArea = 0; + block->clearFlags(JitAllocatorBlock::kFlagDirty); + } + + // Mark the newly allocated space as occupied and also the sentinel. + Support::bitVectorFill(block->usedBitVector, areaIndex, areaSize); + Support::bitVectorSetBit(block->stopBitVector, areaIndex + areaSize - 1, true); + + // Return a pointer to the allocated memory. + size_t offset = pool->byteSizeFromAreaSize(areaIndex); + ASMJIT_ASSERT(offset <= block->blockSize - size); + + *roPtrOut = block->roPtr() + offset; + *rwPtrOut = block->rwPtr() + offset; + return kErrorOk; +} + +Error JitAllocator::release(void* ro) noexcept { + if (ASMJIT_UNLIKELY(_impl == &JitAllocatorImpl_none)) + return DebugUtils::errored(kErrorNotInitialized); + + if (ASMJIT_UNLIKELY(!ro)) + return DebugUtils::errored(kErrorInvalidArgument); + + JitAllocatorPrivateImpl* impl = static_cast(_impl); + LockGuard guard(impl->lock); + + JitAllocatorBlock* block = impl->tree.get(static_cast(ro)); + if (ASMJIT_UNLIKELY(!block)) + return DebugUtils::errored(kErrorInvalidState); + + // Offset relative to the start of the block. + JitAllocatorPool* pool = block->pool; + size_t offset = (size_t)((uint8_t*)ro - block->roPtr()); + + // The first bit representing the allocated area and its size. + uint32_t areaIndex = uint32_t(offset >> pool->granularityLog2); + uint32_t areaLast = uint32_t(Support::bitVectorIndexOf(block->stopBitVector, areaIndex, true)); + uint32_t areaSize = areaLast - areaIndex + 1; + + // Update the search region and statistics. + block->searchStart = Support::min(block->searchStart, areaIndex); + block->searchEnd = Support::max(block->searchEnd, areaLast + 1); + block->addFlags(JitAllocatorBlock::kFlagDirty); + block->decreaseUsedArea(areaSize); + + // Clear all occupied bits and also the sentinel. + Support::bitVectorClear(block->usedBitVector, areaIndex, areaSize); + Support::bitVectorSetBit(block->stopBitVector, areaLast, false); + + // Fill the released memory if the secure mode is enabled. + if (impl->options & kOptionFillUnusedMemory) + JitAllocatorImpl_fillPattern(block->rwPtr() + areaIndex * pool->granularity, impl->fillPattern, areaSize * pool->granularity); + + // Release the whole block if it became empty. + if (block->areaUsed == 0) { + if (pool->emptyBlockCount || (impl->options & kOptionImmediateRelease)) { + JitAllocatorImpl_removeBlock(impl, block); + JitAllocatorImpl_deleteBlock(impl, block); + } + else { + pool->emptyBlockCount++; + block->largestUnusedArea = areaSize; + block->searchStart = 0; + block->searchEnd = areaSize; + block->addFlags(JitAllocatorBlock::kFlagEmpty); + block->clearFlags(JitAllocatorBlock::kFlagDirty); + } + } + + return kErrorOk; +} + +Error JitAllocator::shrink(void* ro, size_t newSize) noexcept { + if (ASMJIT_UNLIKELY(_impl == &JitAllocatorImpl_none)) + return DebugUtils::errored(kErrorNotInitialized); + + if (ASMJIT_UNLIKELY(!ro)) + return DebugUtils::errored(kErrorInvalidArgument); + + if (ASMJIT_UNLIKELY(newSize == 0)) + return release(ro); + + JitAllocatorPrivateImpl* impl = static_cast(_impl); + LockGuard guard(impl->lock); + JitAllocatorBlock* block = impl->tree.get(static_cast(ro)); + + if (ASMJIT_UNLIKELY(!block)) + return DebugUtils::errored(kErrorInvalidArgument); + + // Offset relative to the start of the block. + JitAllocatorPool* pool = block->pool; + size_t offset = (size_t)((uint8_t*)ro - block->roPtr()); + + // The first bit representing the allocated area and its size. + uint32_t areaIndex = uint32_t(offset >> pool->granularityLog2); + uint32_t areaOldSize = uint32_t(Support::bitVectorIndexOf(block->stopBitVector, areaIndex, true)) + 1 - areaIndex; + uint32_t areaNewSize = pool->areaSizeFromByteSize(newSize); + + if (ASMJIT_UNLIKELY(areaNewSize > areaOldSize)) + return DebugUtils::errored(kErrorInvalidState); + + uint32_t areaDiff = areaOldSize - areaNewSize; + if (!areaDiff) + return kErrorOk; + + // Update the search region and statistics. + block->searchStart = Support::min(block->searchStart, areaIndex + areaNewSize); + block->searchEnd = Support::max(block->searchEnd, areaIndex + areaOldSize); + block->addFlags(JitAllocatorBlock::kFlagDirty); + block->decreaseUsedArea(areaDiff); + + // Unmark the released space and move the sentinel. + Support::bitVectorClear(block->usedBitVector, areaIndex + areaNewSize, areaDiff); + Support::bitVectorSetBit(block->stopBitVector, areaIndex + areaOldSize - 1, false); + Support::bitVectorSetBit(block->stopBitVector, areaIndex + areaNewSize - 1, true); + + // Fill released memory if the secure mode is enabled. + if (impl->options & kOptionFillUnusedMemory) + JitAllocatorImpl_fillPattern( + block->rwPtr() + (areaIndex + areaOldSize) * pool->granularity, + fillPattern(), + areaDiff * pool->granularity); + + return kErrorOk; +} + +// ============================================================================ +// [asmjit::JitAllocator - Unit] +// ============================================================================ + +#if defined(ASMJIT_TEST) +// A pseudo random number generator based on a paper by Sebastiano Vigna: +// http://vigna.di.unimi.it/ftp/papers/xorshiftplus.pdf +class Random { +public: + // Constants suggested as `23/18/5`. + enum Steps : uint32_t { + kStep1_SHL = 23, + kStep2_SHR = 18, + kStep3_SHR = 5 + }; + + inline explicit Random(uint64_t seed = 0) noexcept { reset(seed); } + inline Random(const Random& other) noexcept = default; + + inline void reset(uint64_t seed = 0) noexcept { + // The number is arbitrary, it means nothing. + constexpr uint64_t kZeroSeed = 0x1F0A2BE71D163FA0u; + + // Generate the state data by using splitmix64. + for (uint32_t i = 0; i < 2; i++) { + seed += 0x9E3779B97F4A7C15u; + uint64_t x = seed; + x = (x ^ (x >> 30)) * 0xBF58476D1CE4E5B9u; + x = (x ^ (x >> 27)) * 0x94D049BB133111EBu; + x = (x ^ (x >> 31)); + _state[i] = x != 0 ? x : kZeroSeed; + } + } + + inline uint32_t nextUInt32() noexcept { + return uint32_t(nextUInt64() >> 32); + } + + inline uint64_t nextUInt64() noexcept { + uint64_t x = _state[0]; + uint64_t y = _state[1]; + + x ^= x << kStep1_SHL; + y ^= y >> kStep3_SHR; + x ^= x >> kStep2_SHR; + x ^= y; + + _state[0] = y; + _state[1] = x; + return x + y; + } + + uint64_t _state[2]; +}; + +// Helper class to verify that JitAllocator doesn't return addresses that overlap. +class JitAllocatorWrapper { +public: + explicit inline JitAllocatorWrapper(const JitAllocator::CreateParams* params) noexcept + : _zone(1024 * 1024), + _heap(&_zone), + _allocator(params) {} + + // Address to a memory region of a given size. + class Range { + public: + inline Range(uint8_t* addr, size_t size) noexcept + : addr(addr), + size(size) {} + uint8_t* addr; + size_t size; + }; + + // Based on JitAllocator::Block, serves our purpose well... + class Record : public ZoneTreeNodeT, + public Range { + public: + inline Record(uint8_t* addr, size_t size) + : ZoneTreeNodeT(), + Range(addr, size) {} + + inline bool operator<(const Record& other) const noexcept { return addr < other.addr; } + inline bool operator>(const Record& other) const noexcept { return addr > other.addr; } + + inline bool operator<(const uint8_t* key) const noexcept { return addr + size <= key; } + inline bool operator>(const uint8_t* key) const noexcept { return addr > key; } + }; + + void _insert(void* p_, size_t size) noexcept { + uint8_t* p = static_cast(p_); + uint8_t* pEnd = p + size - 1; + + Record* record; + + record = _records.get(p); + if (record) + EXPECT(record == nullptr, + "Address [%p:%p] collides with a newly allocated [%p:%p]\n", record->addr, record->addr + record->size, p, p + size); + + record = _records.get(pEnd); + if (record) + EXPECT(record == nullptr, + "Address [%p:%p] collides with a newly allocated [%p:%p]\n", record->addr, record->addr + record->size, p, p + size); + + record = _heap.newT(p, size); + EXPECT(record != nullptr, + "Out of memory, cannot allocate 'Record'"); + + _records.insert(record); + } + + void _remove(void* p) noexcept { + Record* record = _records.get(static_cast(p)); + EXPECT(record != nullptr, + "Address [%p] doesn't exist\n", p); + + _records.remove(record); + _heap.release(record, sizeof(Record)); + } + + void* alloc(size_t size) noexcept { + void* roPtr; + void* rwPtr; + + Error err = _allocator.alloc(&roPtr, &rwPtr, size); + EXPECT(err == kErrorOk, + "JitAllocator failed to allocate '%u' bytes\n", unsigned(size)); + + _insert(roPtr, size); + return roPtr; + } + + void release(void* p) noexcept { + _remove(p); + EXPECT(_allocator.release(p) == kErrorOk, + "JitAllocator failed to release '%p'\n", p); + } + + Zone _zone; + ZoneAllocator _heap; + ZoneTree _records; + JitAllocator _allocator; +}; + +static void JitAllocatorTest_shuffle(void** ptrArray, size_t count, Random& prng) noexcept { + for (size_t i = 0; i < count; ++i) + std::swap(ptrArray[i], ptrArray[size_t(prng.nextUInt32() % count)]); +} + +static void JitAllocatorTest_usage(JitAllocator& allocator) noexcept { + JitAllocator::Statistics stats = allocator.statistics(); + INFO(" Block Count : %9llu [Blocks]" , (unsigned long long)(stats.blockCount())); + INFO(" Reserved (VirtMem): %9llu [Bytes]" , (unsigned long long)(stats.reservedSize())); + INFO(" Used (VirtMem): %9llu [Bytes] (%.1f%%)", (unsigned long long)(stats.usedSize()), stats.usedSizeAsPercent()); + INFO(" Overhead (HeapMem): %9llu [Bytes] (%.1f%%)", (unsigned long long)(stats.overheadSize()), stats.overheadSizeAsPercent()); +} + +UNIT(jit_allocator) { + size_t kCount = BrokenAPI::hasArg("--quick") ? 1000 : 100000; + + struct TestParams { + const char* name; + uint32_t options; + uint32_t blockSize; + uint32_t granularity; + }; + + #define OPT(OPTION) JitAllocator::OPTION + static TestParams testParams[] = { + { "Default", 0, 0, 0 }, + { "16MB blocks", 0, 16 * 1024 * 1024, 0 }, + { "256B granularity", 0, 0, 256 }, + { "kOptionUseDualMapping", OPT(kOptionUseDualMapping), 0, 0 }, + { "kOptionUseMultiplePools", OPT(kOptionUseMultiplePools), 0, 0 }, + { "kOptionFillUnusedMemory", OPT(kOptionFillUnusedMemory), 0, 0 }, + { "kOptionImmediateRelease", OPT(kOptionImmediateRelease), 0, 0 }, + { "kOptionUseDualMapping | kOptionFillUnusedMemory", OPT(kOptionUseDualMapping) | OPT(kOptionFillUnusedMemory), 0, 0 } + }; + #undef OPT + + INFO("BitFlipIterator"); + { + static const uint32_t bits[] = { 0x80000000u, 0x80000000u, 0x00000000u, 0x80000000u }; + BitFlipIterator it(bits, ASMJIT_ARRAY_SIZE(bits)); + + EXPECT(it.hasNext()); + EXPECT(it.nextAndFlip() == 31); + EXPECT(it.hasNext()); + EXPECT(it.nextAndFlip() == 32); + EXPECT(it.hasNext()); + EXPECT(it.nextAndFlip() == 63); + EXPECT(it.hasNext()); + EXPECT(it.nextAndFlip() == 64); + EXPECT(it.hasNext()); + EXPECT(it.nextAndFlip() == 127); + EXPECT(!it.hasNext()); + } + + INFO("BitFlipIterator"); + { + static const uint64_t bits[] = { 0xFFFFFFFFFFFFFFFFu, 0xFFFFFFFFFFFFFFFF, 0, 0 }; + BitFlipIterator it(bits, ASMJIT_ARRAY_SIZE(bits)); + + EXPECT(it.hasNext()); + EXPECT(it.nextAndFlip() == 0); + EXPECT(it.hasNext()); + EXPECT(it.nextAndFlip() == 128); + EXPECT(!it.hasNext()); + } + + for (uint32_t testId = 0; testId < ASMJIT_ARRAY_SIZE(testParams); testId++) { + INFO("Testing JitAllocator: %s", testParams[testId].name); + + JitAllocator::CreateParams params {}; + params.options = testParams[testId].options; + params.blockSize = testParams[testId].blockSize; + params.granularity = testParams[testId].granularity; + + JitAllocatorWrapper wrapper(¶ms); + Random prng(100); + + size_t i; + + INFO(" Memory alloc/release test - %d allocations", kCount); + + void** ptrArray = (void**)::malloc(sizeof(void*) * size_t(kCount)); + EXPECT(ptrArray != nullptr, + "Couldn't allocate '%u' bytes for pointer-array", unsigned(sizeof(void*) * size_t(kCount))); + + INFO(" Allocating virtual memory..."); + for (i = 0; i < kCount; i++) + ptrArray[i] = wrapper.alloc((prng.nextUInt32() % 1024) + 8); + JitAllocatorTest_usage(wrapper._allocator); + + INFO(" Releasing virtual memory..."); + for (i = 0; i < kCount; i++) + wrapper.release(ptrArray[i]); + JitAllocatorTest_usage(wrapper._allocator); + + INFO(" Allocating virtual memory...", kCount); + for (i = 0; i < kCount; i++) + ptrArray[i] = wrapper.alloc((prng.nextUInt32() % 1024) + 8); + JitAllocatorTest_usage(wrapper._allocator); + + INFO(" Shuffling..."); + JitAllocatorTest_shuffle(ptrArray, unsigned(kCount), prng); + + INFO(" Releasing 50%% blocks..."); + for (i = 0; i < kCount / 2; i++) + wrapper.release(ptrArray[i]); + JitAllocatorTest_usage(wrapper._allocator); + + INFO(" Allocating 50%% blocks again..."); + for (i = 0; i < kCount / 2; i++) + ptrArray[i] = wrapper.alloc((prng.nextUInt32() % 1024) + 8); + JitAllocatorTest_usage(wrapper._allocator); + + INFO(" Releasing virtual memory..."); + for (i = 0; i < kCount; i++) + wrapper.release(ptrArray[i]); + JitAllocatorTest_usage(wrapper._allocator); + + ::free(ptrArray); + } +} +#endif + +ASMJIT_END_NAMESPACE + +#endif diff --git a/3rdparty/asmjit/src/asmjit/core/jitallocator.h b/3rdparty/asmjit/src/asmjit/core/jitallocator.h new file mode 100644 index 00000000000..111716ed59e --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/jitallocator.h @@ -0,0 +1,278 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_JITALLOCATOR_H_INCLUDED +#define ASMJIT_CORE_JITALLOCATOR_H_INCLUDED + +#include "../core/api-config.h" +#ifndef ASMJIT_NO_JIT + +#include "../core/globals.h" +#include "../core/virtmem.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_jit +//! \{ + +// ============================================================================ +// [asmjit::JitAllocator] +// ============================================================================ + +//! A simple implementation of memory manager that uses `asmjit::VirtMem` +//! functions to manage virtual memory for JIT compiled code. +//! +//! Implementation notes: +//! +//! - Granularity of allocated blocks is different than granularity for a typical +//! C malloc. In addition, the allocator can use several memory pools having a +//! different granularity to minimize the maintenance overhead. Multiple pools +//! feature requires `kFlagUseMultiplePools` flag to be set. +//! +//! - The allocator doesn't store any information in executable memory, instead, +//! the implementation uses two bit-vectors to manage allocated memory of each +//! allocator-block. The first bit-vector called 'used' is used to track used +//! memory (where each bit represents memory size defined by granularity) and +//! the second bit vector called 'stop' is used as a sentinel to mark where +//! the allocated area ends. +//! +//! - Internally, the allocator also uses RB tree to keep track of all blocks +//! across all pools. Each inserted block is added to the tree so it can be +//! matched fast during `release()` and `shrink()`. +class JitAllocator { +public: + ASMJIT_NONCOPYABLE(JitAllocator) + + struct Impl { + //! Allocator options, see \ref JitAllocator::Options. + uint32_t options; + //! Base block size (0 if the allocator is not initialized). + uint32_t blockSize; + //! Base granularity (0 if the allocator is not initialized). + uint32_t granularity; + //! A pattern that is used to fill unused memory if secure mode is enabled. + uint32_t fillPattern; + }; + + //! Allocator implementation (private). + Impl* _impl; + + enum Options : uint32_t { + //! Enables the use of an anonymous memory-mapped memory that is mapped into + //! two buffers having a different pointer. The first buffer has read and + //! execute permissions and the second buffer has read+write permissions. + //! + //! See \ref VirtMem::allocDualMapping() for more details about this feature. + kOptionUseDualMapping = 0x00000001u, + + //! Enables the use of multiple pools with increasing granularity instead of + //! a single pool. This flag would enable 3 internal pools in total having + //! 64, 128, and 256 bytes granularity. + //! + //! This feature is only recommended for users that generate a lot of code + //! and would like to minimize the overhead of `JitAllocator` itself by + //! having blocks of different allocation granularities. Using this feature + //! only for few allocations won't pay off as the allocator may need to + //! create more blocks initially before it can take the advantage of + //! variable block granularity. + kOptionUseMultiplePools = 0x00000002u, + + //! Always fill reserved memory by a fill-pattern. + //! + //! Causes a new block to be cleared by the fill pattern and freshly + //! released memory to be cleared before making it ready for another use. + kOptionFillUnusedMemory = 0x00000004u, + + //! When this flag is set the allocator would immediately release unused + //! blocks during `release()` or `reset()`. When this flag is not set the + //! allocator would keep one empty block in each pool to prevent excessive + //! virtual memory allocations and deallocations in border cases, which + //! involve constantly allocating and deallocating a single block caused + //! by repetitive calling `alloc()` and `release()` when the allocator has + //! either no blocks or have all blocks fully occupied. + kOptionImmediateRelease = 0x00000008u, + + //! Use a custom fill pattern, must be combined with `kFlagFillUnusedMemory`. + kOptionCustomFillPattern = 0x10000000u + }; + + //! \name Construction & Destruction + //! \{ + + //! Parameters that can be passed to `JitAllocator` constructor. + //! + //! Use it like this: + //! + //! ``` + //! // Zero initialize (zero means the default value) and change what you need. + //! JitAllocator::CreateParams params {}; + //! params.blockSize = 1024 * 1024; + //! + //! // Create the allocator. + //! JitAllocator allocator(¶ms); + //! ``` + struct CreateParams { + // Reset the content of `CreateParams`. + inline void reset() noexcept { memset(this, 0, sizeof(*this)); } + + //! Allocator options, see \ref JitAllocator::Options. + //! + //! No options are used by default. + uint32_t options; + + //! Base size of a single block in bytes (default 64kB). + //! + //! \remarks Block size must be equal or greater to page size and must be + //! power of 2. If the input is not valid then the default block size will + //! be used instead. + uint32_t blockSize; + + //! Base granularity (and also natural alignment) of allocations in bytes + //! (default 64). + //! + //! Since the `JitAllocator` uses bit-arrays to mark used memory the + //! granularity also specifies how many bytes correspond to a single bit in + //! such bit-array. Higher granularity means more waste of virtual memory + //! (as it increases the natural alignment), but smaller bit-arrays as less + //! bits would be required per a single block. + uint32_t granularity; + + //! Patter to use to fill unused memory. + //! + //! Only used if \ref kOptionCustomFillPattern is set. + uint32_t fillPattern; + }; + + //! Creates a `JitAllocator` instance. + explicit ASMJIT_API JitAllocator(const CreateParams* params = nullptr) noexcept; + //! Destroys the `JitAllocator` instance and release all blocks held. + ASMJIT_API ~JitAllocator() noexcept; + + inline bool isInitialized() const noexcept { return _impl->blockSize == 0; } + + //! Free all allocated memory - makes all pointers returned by `alloc()` invalid. + //! + //! \remarks This function is not thread-safe as it's designed to be used when + //! nobody else is using allocator. The reason is that there is no point of + //1 calling `reset()` when the allocator is still in use. + ASMJIT_API void reset(uint32_t resetPolicy = Globals::kResetSoft) noexcept; + + //! \} + + //! \name Accessors + //! \{ + + //! Returns allocator options, see `Flags`. + inline uint32_t options() const noexcept { return _impl->options; } + //! Tests whether the allocator has the given `option` set. + inline bool hasOption(uint32_t option) const noexcept { return (_impl->options & option) != 0; } + + //! Returns a base block size (a minimum size of block that the allocator would allocate). + inline uint32_t blockSize() const noexcept { return _impl->blockSize; } + //! Returns granularity of the allocator. + inline uint32_t granularity() const noexcept { return _impl->granularity; } + //! Returns pattern that is used to fill unused memory if `kFlagUseFillPattern` is set. + inline uint32_t fillPattern() const noexcept { return _impl->fillPattern; } + + //! \} + + //! \name Alloc & Release + //! \{ + + //! Allocate `size` bytes of virtual memory. + //! + //! \remarks This function is thread-safe. + ASMJIT_API Error alloc(void** roPtrOut, void** rwPtrOut, size_t size) noexcept; + + //! Release a memory returned by `alloc()`. + //! + //! \remarks This function is thread-safe. + ASMJIT_API Error release(void* ro) noexcept; + + //! Free extra memory allocated with `p` by restricting it to `newSize` size. + //! + //! \remarks This function is thread-safe. + ASMJIT_API Error shrink(void* ro, size_t newSize) noexcept; + + //! \} + + //! \name Statistics + //! \{ + + //! Statistics about `JitAllocator`. + struct Statistics { + inline void reset() noexcept { + _blockCount = 0; + _usedSize = 0; + _reservedSize = 0; + _overheadSize = 0; + } + + //! Returns count of blocks managed by `JitAllocator` at the moment. + inline size_t blockCount() const noexcept { return _blockCount; } + + //! Returns how many bytes are currently used. + inline size_t usedSize() const noexcept { return _usedSize; } + //! Returns the number of bytes unused by the allocator at the moment. + inline size_t unusedSize() const noexcept { return _reservedSize - _usedSize; } + //! Returns the total number of bytes bytes reserved by the allocator (sum of sizes of all blocks). + inline size_t reservedSize() const noexcept { return _reservedSize; } + //! Returns the number of bytes the allocator needs to manage the allocated memory. + inline size_t overheadSize() const noexcept { return _overheadSize; } + + inline double usedSizeAsPercent() const noexcept { + return (double(usedSize()) / (double(reservedSize()) + 1e-16)) * 100.0; + } + + inline double unusedSizeAsPercent() const noexcept { + return (double(unusedSize()) / (double(reservedSize()) + 1e-16)) * 100.0; + } + + inline double overheadSizeAsPercent() const noexcept { + return (double(overheadSize()) / (double(reservedSize()) + 1e-16)) * 100.0; + } + + //! Number of blocks `JitAllocator` maintains. + size_t _blockCount; + //! How many bytes are currently used / allocated. + size_t _usedSize; + //! How many bytes are currently reserved by the allocator. + size_t _reservedSize; + //! Allocation overhead (in bytes) required to maintain all blocks. + size_t _overheadSize; + }; + + //! Returns JIT allocator statistics. + //! + //! \remarks This function is thread-safe. + ASMJIT_API Statistics statistics() const noexcept; + + //! \} +}; + +//! \} + +ASMJIT_END_NAMESPACE + +#endif +#endif diff --git a/3rdparty/asmjit/src/asmjit/core/jitruntime.cpp b/3rdparty/asmjit/src/asmjit/core/jitruntime.cpp new file mode 100644 index 00000000000..625cc3d2f51 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/jitruntime.cpp @@ -0,0 +1,156 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#ifndef ASMJIT_NO_JIT + +#include "../core/cpuinfo.h" +#include "../core/jitruntime.h" + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::JitRuntime - Utilities] +// ============================================================================ + +// Only useful on non-x86 architectures. +static inline void JitRuntime_flushInstructionCache(const void* p, size_t size) noexcept { +#if defined(_WIN32) && !ASMJIT_ARCH_X86 + // Windows has a built-in support in `kernel32.dll`. + ::FlushInstructionCache(::GetCurrentProcess(), p, size); +#else + DebugUtils::unused(p, size); +#endif +} + +// X86 Target +// ---------- +// +// - 32-bit - Linux, OSX, BSD, and apparently also Haiku guarantee 16-byte +// stack alignment. Other operating systems are assumed to have +// 4-byte alignment by default for safety reasons. +// - 64-bit - stack must be aligned to 16 bytes. +// +// ARM Target +// ---------- +// +// - 32-bit - Stack must be aligned to 8 bytes. +// - 64-bit - Stack must be aligned to 16 bytes (hardware requirement). +static inline uint32_t JitRuntime_detectNaturalStackAlignment() noexcept { +#if ASMJIT_ARCH_BITS == 64 || \ + defined(__APPLE__ ) || \ + defined(__DragonFly__) || \ + defined(__HAIKU__ ) || \ + defined(__FreeBSD__ ) || \ + defined(__NetBSD__ ) || \ + defined(__OpenBSD__ ) || \ + defined(__bsdi__ ) || \ + defined(__linux__ ) + return 16; +#elif ASMJIT_ARCH_ARM + return 8; +#else + return uint32_t(sizeof(uintptr_t)); +#endif +} + +// ============================================================================ +// [asmjit::JitRuntime - Construction / Destruction] +// ============================================================================ + +JitRuntime::JitRuntime(const JitAllocator::CreateParams* params) noexcept + : _allocator(params) { + + // Setup target properties. + _targetType = kTargetJit; + _codeInfo._archInfo = CpuInfo::host().archInfo(); + _codeInfo._stackAlignment = uint8_t(JitRuntime_detectNaturalStackAlignment()); + _codeInfo._cdeclCallConv = CallConv::kIdHostCDecl; + _codeInfo._stdCallConv = CallConv::kIdHostStdCall; + _codeInfo._fastCallConv = CallConv::kIdHostFastCall; +} +JitRuntime::~JitRuntime() noexcept {} + +// ============================================================================ +// [asmjit::JitRuntime - Interface] +// ============================================================================ + +Error JitRuntime::_add(void** dst, CodeHolder* code) noexcept { + *dst = nullptr; + + ASMJIT_PROPAGATE(code->flatten()); + ASMJIT_PROPAGATE(code->resolveUnresolvedLinks()); + + size_t estimatedCodeSize = code->codeSize(); + if (ASMJIT_UNLIKELY(estimatedCodeSize == 0)) + return DebugUtils::errored(kErrorNoCodeGenerated); + + uint8_t* ro; + uint8_t* rw; + ASMJIT_PROPAGATE(_allocator.alloc((void**)&ro, (void**)&rw, estimatedCodeSize)); + + // Relocate the code. + Error err = code->relocateToBase(uintptr_t((void*)ro)); + if (ASMJIT_UNLIKELY(err)) { + _allocator.release(ro); + return err; + } + + // Recalculate the final code size and shrink the memory we allocated for it + // in case that some relocations didn't require records in an address table. + size_t codeSize = code->codeSize(); + + for (Section* section : code->_sections) { + size_t offset = size_t(section->offset()); + size_t bufferSize = size_t(section->bufferSize()); + size_t virtualSize = size_t(section->virtualSize()); + + ASMJIT_ASSERT(offset + bufferSize <= codeSize); + memcpy(rw + offset, section->data(), bufferSize); + + if (virtualSize > bufferSize) { + ASMJIT_ASSERT(offset + virtualSize <= codeSize); + memset(rw + offset + bufferSize, 0, virtualSize - bufferSize); + } + } + + if (codeSize < estimatedCodeSize) + _allocator.shrink(ro, codeSize); + + flush(ro, codeSize); + *dst = ro; + + return kErrorOk; +} + +Error JitRuntime::_release(void* p) noexcept { + return _allocator.release(p); +} + +void JitRuntime::flush(const void* p, size_t size) noexcept { + JitRuntime_flushInstructionCache(p, size); +} + +ASMJIT_END_NAMESPACE + +#endif diff --git a/3rdparty/asmjit/src/asmjit/core/jitruntime.h b/3rdparty/asmjit/src/asmjit/core/jitruntime.h new file mode 100644 index 00000000000..97f26e7a6c1 --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/jitruntime.h @@ -0,0 +1,126 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_JITRUNTIME_H_INCLUDED +#define ASMJIT_CORE_JITRUNTIME_H_INCLUDED + +#include "../core/api-config.h" +#ifndef ASMJIT_NO_JIT + +#include "../core/codeholder.h" +#include "../core/jitallocator.h" +#include "../core/target.h" + +ASMJIT_BEGIN_NAMESPACE + +class CodeHolder; + +//! \addtogroup asmjit_jit +//! \{ + +// ============================================================================ +// [asmjit::JitRuntime] +// ============================================================================ + +//! JIT execution runtime is a special `Target` that is designed to store and +//! execute the generated code. +class ASMJIT_VIRTAPI JitRuntime : public Target { +public: + ASMJIT_NONCOPYABLE(JitRuntime) + + //! Virtual memory allocator. + JitAllocator _allocator; + + //! \name Construction & Destruction + //! \{ + + //! Creates a `JitRuntime` instance. + explicit ASMJIT_API JitRuntime(const JitAllocator::CreateParams* params = nullptr) noexcept; + //! Destroys the `JitRuntime` instance. + ASMJIT_API virtual ~JitRuntime() noexcept; + + inline void reset(uint32_t resetPolicy = Globals::kResetSoft) noexcept { + _allocator.reset(resetPolicy); + } + + //! \} + + //! \name Accessors + //! \{ + + //! Returns the associated `JitAllocator`. + inline JitAllocator* allocator() const noexcept { return const_cast(&_allocator); } + + //! \} + + //! \name Utilities + //! \{ + + // NOTE: To allow passing function pointers to `add()` and `release()` the + // virtual methods are prefixed with `_` and called from templates instead. + + //! Allocates memory needed for a code stored in the `CodeHolder` and relocates + //! the code to the pointer allocated. + //! + //! The beginning of the memory allocated for the function is returned in `dst`. + //! If failed `Error` code is returned and `dst` is explicitly set to `nullptr` + //! (this means that you don't have to set it to null before calling `add()`). + template + inline Error add(Func* dst, CodeHolder* code) noexcept { + return _add(Support::ptr_cast_impl(dst), code); + } + + //! Releases `p` which was obtained by calling `add()`. + template + inline Error release(Func p) noexcept { + return _release(Support::ptr_cast_impl(p)); + } + + //! Type-unsafe version of `add()`. + ASMJIT_API virtual Error _add(void** dst, CodeHolder* code) noexcept; + + //! Type-unsafe version of `release()`. + ASMJIT_API virtual Error _release(void* p) noexcept; + + //! Flushes an instruction cache. + //! + //! This member function is called after the code has been copied to the + //! destination buffer. It is only useful for JIT code generation as it + //! causes a flush of the processor's cache. + //! + //! Flushing is basically a NOP under X86, but is needed by architectures + //! that do not have a transparent instruction cache like ARM. + //! + //! This function can also be overridden to improve compatibility with tools + //! such as Valgrind, however, it's not an official part of AsmJit. + ASMJIT_API virtual void flush(const void* p, size_t size) noexcept; + + //! \} +}; + +//! \} + +ASMJIT_END_NAMESPACE + +#endif +#endif diff --git a/3rdparty/asmjit/src/asmjit/core/logging.cpp b/3rdparty/asmjit/src/asmjit/core/logging.cpp new file mode 100644 index 00000000000..7e10af27c2d --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/logging.cpp @@ -0,0 +1,535 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#ifndef ASMJIT_NO_LOGGING + +#include "../core/builder.h" +#include "../core/codeholder.h" +#include "../core/compiler.h" +#include "../core/emitter.h" +#include "../core/logging.h" +#include "../core/string.h" +#include "../core/support.h" +#include "../core/type.h" + +#ifdef ASMJIT_BUILD_X86 + #include "../x86/x86logging_p.h" +#endif + +#ifdef ASMJIT_BUILD_ARM + #include "../arm/armlogging_p.h" +#endif + +ASMJIT_BEGIN_NAMESPACE + +#if defined(ASMJIT_NO_COMPILER) +class VirtReg; +#endif + +// ============================================================================ +// [asmjit::Logger - Construction / Destruction] +// ============================================================================ + +Logger::Logger() noexcept + : _options() {} +Logger::~Logger() noexcept {} + +// ============================================================================ +// [asmjit::Logger - Logging] +// ============================================================================ + +Error Logger::logf(const char* fmt, ...) noexcept { + Error err; + va_list ap; + + va_start(ap, fmt); + err = logv(fmt, ap); + va_end(ap); + + return err; +} + +Error Logger::logv(const char* fmt, va_list ap) noexcept { + StringTmp<2048> sb; + ASMJIT_PROPAGATE(sb.appendVFormat(fmt, ap)); + return log(sb); +} + +Error Logger::logBinary(const void* data, size_t size) noexcept { + static const char prefix[] = "db "; + + StringTmp<256> sb; + sb.appendString(prefix, ASMJIT_ARRAY_SIZE(prefix) - 1); + + size_t i = size; + const uint8_t* s = static_cast(data); + + while (i) { + uint32_t n = uint32_t(Support::min(i, 16)); + sb.truncate(ASMJIT_ARRAY_SIZE(prefix) - 1); + sb.appendHex(s, n); + sb.appendChar('\n'); + ASMJIT_PROPAGATE(log(sb)); + s += n; + i -= n; + } + + return kErrorOk; +} + +// ============================================================================ +// [asmjit::FileLogger - Construction / Destruction] +// ============================================================================ + +FileLogger::FileLogger(FILE* file) noexcept + : _file(nullptr) { setFile(file); } +FileLogger::~FileLogger() noexcept {} + +// ============================================================================ +// [asmjit::FileLogger - Logging] +// ============================================================================ + +Error FileLogger::_log(const char* data, size_t size) noexcept { + if (!_file) + return kErrorOk; + + if (size == SIZE_MAX) + size = strlen(data); + + fwrite(data, 1, size, _file); + return kErrorOk; +} + +// ============================================================================ +// [asmjit::StringLogger - Construction / Destruction] +// ============================================================================ + +StringLogger::StringLogger() noexcept {} +StringLogger::~StringLogger() noexcept {} + +// ============================================================================ +// [asmjit::StringLogger - Logging] +// ============================================================================ + +Error StringLogger::_log(const char* data, size_t size) noexcept { + return _content.appendString(data, size); +} + +// ============================================================================ +// [asmjit::Logging] +// ============================================================================ + +Error Logging::formatLabel( + String& sb, + uint32_t flags, + const BaseEmitter* emitter, + uint32_t labelId) noexcept { + + DebugUtils::unused(flags); + + const LabelEntry* le = emitter->code()->labelEntry(labelId); + if (ASMJIT_UNLIKELY(!le)) + return sb.appendFormat("InvalidLabel[Id=%u]", labelId); + + if (le->hasName()) { + if (le->hasParent()) { + uint32_t parentId = le->parentId(); + const LabelEntry* pe = emitter->code()->labelEntry(parentId); + + if (ASMJIT_UNLIKELY(!pe)) + ASMJIT_PROPAGATE(sb.appendFormat("InvalidLabel[Id=%u]", labelId)); + else if (ASMJIT_UNLIKELY(!pe->hasName())) + ASMJIT_PROPAGATE(sb.appendFormat("L%u", parentId)); + else + ASMJIT_PROPAGATE(sb.appendString(pe->name())); + + ASMJIT_PROPAGATE(sb.appendChar('.')); + } + return sb.appendString(le->name()); + } + else { + return sb.appendFormat("L%u", labelId); + } +} + +Error Logging::formatRegister( + String& sb, + uint32_t flags, + const BaseEmitter* emitter, + uint32_t archId, + uint32_t regType, + uint32_t regId) noexcept { + +#ifdef ASMJIT_BUILD_X86 + if (ArchInfo::isX86Family(archId)) + return x86::LoggingInternal::formatRegister(sb, flags, emitter, archId, regType, regId); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (ArchInfo::isArmFamily(archId)) + return arm::LoggingInternal::formatRegister(sb, flags, emitter, archId, regType, regId); +#endif + + return kErrorInvalidArch; +} + +Error Logging::formatOperand( + String& sb, + uint32_t flags, + const BaseEmitter* emitter, + uint32_t archId, + const Operand_& op) noexcept { + +#ifdef ASMJIT_BUILD_X86 + if (ArchInfo::isX86Family(archId)) + return x86::LoggingInternal::formatOperand(sb, flags, emitter, archId, op); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (ArchInfo::isArmFamily(archId)) + return arm::LoggingInternal::formatOperand(sb, flags, emitter, archId, op); +#endif + + return kErrorInvalidArch; +} + +Error Logging::formatInstruction( + String& sb, + uint32_t flags, + const BaseEmitter* emitter, + uint32_t archId, + const BaseInst& inst, const Operand_* operands, uint32_t opCount) noexcept { + +#ifdef ASMJIT_BUILD_X86 + if (ArchInfo::isX86Family(archId)) + return x86::LoggingInternal::formatInstruction(sb, flags, emitter, archId, inst, operands, opCount); +#endif + +#ifdef ASMJIT_BUILD_ARM + if (ArchInfo::isArmFamily(archId)) + return arm::LoggingInternal::formatInstruction(sb, flags, emitter, archId, inst, operands, opCount); +#endif + + return kErrorInvalidArch; +} + +Error Logging::formatTypeId(String& sb, uint32_t typeId) noexcept { + if (typeId == Type::kIdVoid) + return sb.appendString("void"); + + if (!Type::isValid(typeId)) + return sb.appendString("unknown"); + + const char* typeName = "unknown"; + uint32_t typeSize = Type::sizeOf(typeId); + + uint32_t baseId = Type::baseOf(typeId); + switch (baseId) { + case Type::kIdIntPtr : typeName = "iptr" ; break; + case Type::kIdUIntPtr: typeName = "uptr" ; break; + case Type::kIdI8 : typeName = "i8" ; break; + case Type::kIdU8 : typeName = "u8" ; break; + case Type::kIdI16 : typeName = "i16" ; break; + case Type::kIdU16 : typeName = "u16" ; break; + case Type::kIdI32 : typeName = "i32" ; break; + case Type::kIdU32 : typeName = "u32" ; break; + case Type::kIdI64 : typeName = "i64" ; break; + case Type::kIdU64 : typeName = "u64" ; break; + case Type::kIdF32 : typeName = "f32" ; break; + case Type::kIdF64 : typeName = "f64" ; break; + case Type::kIdF80 : typeName = "f80" ; break; + case Type::kIdMask8 : typeName = "mask8" ; break; + case Type::kIdMask16 : typeName = "mask16"; break; + case Type::kIdMask32 : typeName = "mask32"; break; + case Type::kIdMask64 : typeName = "mask64"; break; + case Type::kIdMmx32 : typeName = "mmx32" ; break; + case Type::kIdMmx64 : typeName = "mmx64" ; break; + } + + uint32_t baseSize = Type::sizeOf(baseId); + if (typeSize > baseSize) { + uint32_t count = typeSize / baseSize; + return sb.appendFormat("%sx%u", typeName, unsigned(count)); + } + else { + return sb.appendString(typeName); + } + +} + +#ifndef ASMJIT_NO_BUILDER +static Error formatFuncValue(String& sb, uint32_t flags, const BaseEmitter* emitter, FuncValue value) noexcept { + uint32_t typeId = value.typeId(); + ASMJIT_PROPAGATE(Logging::formatTypeId(sb, typeId)); + + if (value.isReg()) { + ASMJIT_PROPAGATE(sb.appendChar('@')); + ASMJIT_PROPAGATE(Logging::formatRegister(sb, flags, emitter, emitter->archId(), value.regType(), value.regId())); + } + + if (value.isStack()) { + ASMJIT_PROPAGATE(sb.appendFormat("@[%d]", int(value.stackOffset()))); + } + + return kErrorOk; +} + +static Error formatFuncRets( + String& sb, + uint32_t flags, + const BaseEmitter* emitter, + const FuncDetail& fd, + VirtReg* const* vRegs) noexcept { + + if (!fd.hasRet()) + return sb.appendString("void"); + + for (uint32_t i = 0; i < fd.retCount(); i++) { + if (i) ASMJIT_PROPAGATE(sb.appendString(", ")); + ASMJIT_PROPAGATE(formatFuncValue(sb, flags, emitter, fd.ret(i))); + +#ifndef ASMJIT_NO_COMPILER + if (vRegs) { + static const char nullRet[] = ""; + ASMJIT_PROPAGATE(sb.appendFormat(" %s", vRegs[i] ? vRegs[i]->name() : nullRet)); + } +#else + DebugUtils::unused(vRegs); +#endif + } + + return kErrorOk; +} + +static Error formatFuncArgs( + String& sb, + uint32_t flags, + const BaseEmitter* emitter, + const FuncDetail& fd, + VirtReg* const* vRegs) noexcept { + + uint32_t count = fd.argCount(); + if (!count) + return sb.appendString("void"); + + for (uint32_t i = 0; i < count; i++) { + if (i) ASMJIT_PROPAGATE(sb.appendString(", ")); + ASMJIT_PROPAGATE(formatFuncValue(sb, flags, emitter, fd.arg(i))); + +#ifndef ASMJIT_NO_COMPILER + if (vRegs) { + static const char nullArg[] = ""; + ASMJIT_PROPAGATE(sb.appendFormat(" %s", vRegs[i] ? vRegs[i]->name() : nullArg)); + } +#else + DebugUtils::unused(vRegs); +#endif + } + + return kErrorOk; +} + +Error Logging::formatNode( + String& sb, + uint32_t flags, + const BaseBuilder* cb, + const BaseNode* node_) noexcept { + + if (node_->hasPosition() && (flags & FormatOptions::kFlagPositions) != 0) + ASMJIT_PROPAGATE(sb.appendFormat("<%05u> ", node_->position())); + + switch (node_->type()) { + case BaseNode::kNodeInst: + case BaseNode::kNodeJump: { + const InstNode* node = node_->as(); + ASMJIT_PROPAGATE( + Logging::formatInstruction(sb, flags, cb, + cb->archId(), + node->baseInst(), node->operands(), node->opCount())); + break; + } + + case BaseNode::kNodeSection: { + const SectionNode* node = node_->as(); + if (cb->_code->isSectionValid(node->id())) { + const Section* section = cb->_code->sectionById(node->id()); + ASMJIT_PROPAGATE(sb.appendFormat(".section %s", section->name())); + } + break; + } + + case BaseNode::kNodeLabel: { + const LabelNode* node = node_->as(); + ASMJIT_PROPAGATE(formatLabel(sb, flags, cb, node->id())); + ASMJIT_PROPAGATE(sb.appendString(":")); + break; + } + + case BaseNode::kNodeAlign: { + const AlignNode* node = node_->as(); + ASMJIT_PROPAGATE( + sb.appendFormat(".align %u (%s)", + node->alignment(), + node->alignMode() == kAlignCode ? "code" : "data")); + break; + } + + case BaseNode::kNodeEmbedData: { + const EmbedDataNode* node = node_->as(); + ASMJIT_PROPAGATE(sb.appendFormat(".embed (%u bytes)", node->size())); + break; + } + + case BaseNode::kNodeEmbedLabel: { + const EmbedLabelNode* node = node_->as(); + ASMJIT_PROPAGATE(sb.appendString(".label ")); + ASMJIT_PROPAGATE(formatLabel(sb, flags, cb, node->id())); + break; + } + + case BaseNode::kNodeEmbedLabelDelta: { + const EmbedLabelDeltaNode* node = node_->as(); + ASMJIT_PROPAGATE(sb.appendString(".label (")); + ASMJIT_PROPAGATE(formatLabel(sb, flags, cb, node->id())); + ASMJIT_PROPAGATE(sb.appendString(" - ")); + ASMJIT_PROPAGATE(formatLabel(sb, flags, cb, node->baseId())); + ASMJIT_PROPAGATE(sb.appendString(")")); + break; + } + + case BaseNode::kNodeComment: { + const CommentNode* node = node_->as(); + ASMJIT_PROPAGATE(sb.appendFormat("; %s", node->inlineComment())); + break; + } + + case BaseNode::kNodeSentinel: { + const SentinelNode* node = node_->as(); + const char* sentinelName = nullptr; + + switch (node->sentinelType()) { + case SentinelNode::kSentinelFuncEnd: + sentinelName = "[FuncEnd]"; + break; + + default: + sentinelName = "[Sentinel]"; + break; + } + + ASMJIT_PROPAGATE(sb.appendString(sentinelName)); + break; + } + +#ifndef ASMJIT_NO_COMPILER + case BaseNode::kNodeFunc: { + const FuncNode* node = node_->as(); + + ASMJIT_PROPAGATE(formatLabel(sb, flags, cb, node->id())); + ASMJIT_PROPAGATE(sb.appendString(": ")); + + ASMJIT_PROPAGATE(formatFuncRets(sb, flags, cb, node->detail(), nullptr)); + ASMJIT_PROPAGATE(sb.appendString(" Func(")); + ASMJIT_PROPAGATE(formatFuncArgs(sb, flags, cb, node->detail(), node->args())); + ASMJIT_PROPAGATE(sb.appendString(")")); + break; + } + + case BaseNode::kNodeFuncRet: { + const FuncRetNode* node = node_->as(); + ASMJIT_PROPAGATE(sb.appendString("[FuncRet]")); + + for (uint32_t i = 0; i < 2; i++) { + const Operand_& op = node->_opArray[i]; + if (!op.isNone()) { + ASMJIT_PROPAGATE(sb.appendString(i == 0 ? " " : ", ")); + ASMJIT_PROPAGATE(formatOperand(sb, flags, cb, cb->archId(), op)); + } + } + break; + } + + case BaseNode::kNodeFuncCall: { + const FuncCallNode* node = node_->as(); + ASMJIT_PROPAGATE( + Logging::formatInstruction(sb, flags, cb, + cb->archId(), + node->baseInst(), node->operands(), node->opCount())); + break; + } +#endif + + default: { + ASMJIT_PROPAGATE(sb.appendFormat("[User:%u]", node_->type())); + break; + } + } + + return kErrorOk; +} +#endif + +Error Logging::formatLine(String& sb, const uint8_t* binData, size_t binSize, size_t dispSize, size_t immSize, const char* comment) noexcept { + size_t currentSize = sb.size(); + size_t commentSize = comment ? Support::strLen(comment, Globals::kMaxCommentSize) : 0; + + ASMJIT_ASSERT(binSize >= dispSize); + const size_t kNoBinSize = std::numeric_limits::max(); + + if ((binSize != 0 && binSize != kNoBinSize) || commentSize) { + size_t align = kMaxInstLineSize; + char sep = ';'; + + for (size_t i = (binSize == kNoBinSize); i < 2; i++) { + size_t begin = sb.size(); + ASMJIT_PROPAGATE(sb.padEnd(align)); + + if (sep) { + ASMJIT_PROPAGATE(sb.appendChar(sep)); + ASMJIT_PROPAGATE(sb.appendChar(' ')); + } + + // Append binary data or comment. + if (i == 0) { + ASMJIT_PROPAGATE(sb.appendHex(binData, binSize - dispSize - immSize)); + ASMJIT_PROPAGATE(sb.appendChars('.', dispSize * 2)); + ASMJIT_PROPAGATE(sb.appendHex(binData + binSize - immSize, immSize)); + if (commentSize == 0) break; + } + else { + ASMJIT_PROPAGATE(sb.appendString(comment, commentSize)); + } + + currentSize += sb.size() - begin; + align += kMaxBinarySize; + sep = '|'; + } + } + + return sb.appendChar('\n'); +} + +ASMJIT_END_NAMESPACE + +#endif diff --git a/3rdparty/asmjit/src/asmjit/core/logging.h b/3rdparty/asmjit/src/asmjit/core/logging.h new file mode 100644 index 00000000000..468e3a1ba2b --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/logging.h @@ -0,0 +1,355 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_LOGGING_H_INCLUDED +#define ASMJIT_CORE_LOGGING_H_INCLUDED + +#include "../core/inst.h" +#include "../core/string.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_core +//! \{ + +#ifndef ASMJIT_NO_LOGGING + +// ============================================================================ +// [Forward Declarations] +// ============================================================================ + +class BaseEmitter; +class BaseReg; +class Logger; +struct Operand_; + +#ifndef ASMJIT_NO_BUILDER +class BaseBuilder; +class BaseNode; +#endif + +// ============================================================================ +// [asmjit::FormatOptions] +// ============================================================================ + +class FormatOptions { +public: + uint32_t _flags; + uint8_t _indentation[4]; + + enum Flags : uint32_t { + //! Show also binary form of each logged instruction (assembler). + kFlagMachineCode = 0x00000001u, + //! Show a text explanation of some immediate values. + kFlagExplainImms = 0x00000002u, + //! Use hexadecimal notation of immediate values. + kFlagHexImms = 0x00000004u, + //! Use hexadecimal notation of address offsets. + kFlagHexOffsets = 0x00000008u, + //! Show casts between virtual register types (compiler). + kFlagRegCasts = 0x00000010u, + //! Show positions associated with nodes (compiler). + kFlagPositions = 0x00000020u, + //! Annotate nodes that are lowered by passes. + kFlagAnnotations = 0x00000040u, + + // TODO: These must go, keep this only for formatting. + //! Show an additional output from passes. + kFlagDebugPasses = 0x00000080u, + //! Show an additional output from RA. + kFlagDebugRA = 0x00000100u + }; + + enum IndentationType : uint32_t { + //! Indentation used for instructions and directives. + kIndentationCode = 0u, + //! Indentation used for labels and function nodes. + kIndentationLabel = 1u, + //! Indentation used for comments (not inline comments). + kIndentationComment = 2u, + kIndentationReserved = 3u + }; + + //! \name Construction & Destruction + //! \{ + + constexpr FormatOptions() noexcept + : _flags(0), + _indentation { 0, 0, 0, 0 } {} + + constexpr FormatOptions(const FormatOptions& other) noexcept = default; + inline FormatOptions& operator=(const FormatOptions& other) noexcept = default; + + inline void reset() noexcept { + _flags = 0; + _indentation[0] = 0; + _indentation[1] = 0; + _indentation[2] = 0; + _indentation[3] = 0; + } + + //! \} + + //! \name Accessors + //! \{ + + constexpr uint32_t flags() const noexcept { return _flags; } + constexpr bool hasFlag(uint32_t flag) const noexcept { return (_flags & flag) != 0; } + inline void setFlags(uint32_t flags) noexcept { _flags = flags; } + inline void addFlags(uint32_t flags) noexcept { _flags |= flags; } + inline void clearFlags(uint32_t flags) noexcept { _flags &= ~flags; } + + constexpr uint8_t indentation(uint32_t type) const noexcept { return _indentation[type]; } + inline void setIndentation(uint32_t type, uint32_t n) noexcept { _indentation[type] = uint8_t(n); } + inline void resetIndentation(uint32_t type) noexcept { _indentation[type] = uint8_t(0); } + + //! \} +}; + +// ============================================================================ +// [asmjit::Logger] +// ============================================================================ + +//! Abstract logging interface and helpers. +//! +//! This class can be inherited and reimplemented to fit into your logging +//! subsystem. When reimplementing use `Logger::_log()` method to log into +//! a custom stream. +//! +//! There are two `Logger` implementations offered by AsmJit: +//! - `FileLogger` - allows to log into `FILE*`. +//! - `StringLogger` - logs into a `String`. +class ASMJIT_VIRTAPI Logger { +public: + ASMJIT_BASE_CLASS(Logger) + ASMJIT_NONCOPYABLE(Logger) + + //! Format options. + FormatOptions _options; + + //! \name Construction & Destruction + //! \{ + + //! Creates a `Logger` instance. + ASMJIT_API Logger() noexcept; + //! Destroys the `Logger` instance. + ASMJIT_API virtual ~Logger() noexcept; + + //! \} + + //! \name Format Options + //! \{ + + inline FormatOptions& options() noexcept { return _options; } + inline const FormatOptions& options() const noexcept { return _options; } + + inline uint32_t flags() const noexcept { return _options.flags(); } + inline bool hasFlag(uint32_t flag) const noexcept { return _options.hasFlag(flag); } + inline void setFlags(uint32_t flags) noexcept { _options.setFlags(flags); } + inline void addFlags(uint32_t flags) noexcept { _options.addFlags(flags); } + inline void clearFlags(uint32_t flags) noexcept { _options.clearFlags(flags); } + + inline uint32_t indentation(uint32_t type) const noexcept { return _options.indentation(type); } + inline void setIndentation(uint32_t type, uint32_t n) noexcept { _options.setIndentation(type, n); } + inline void resetIndentation(uint32_t type) noexcept { _options.resetIndentation(type); } + + //! \} + + //! \name Logging Interface + //! \{ + + //! Logs `str` - must be reimplemented. + virtual Error _log(const char* data, size_t size) noexcept = 0; + + //! Logs string `str`, which is either null terminated or having size `size`. + inline Error log(const char* data, size_t size = SIZE_MAX) noexcept { return _log(data, size); } + //! Logs content of a string `str`. + inline Error log(const String& str) noexcept { return _log(str.data(), str.size()); } + + //! Formats the message by using `snprintf()` and then sends the result + //! to `log()`. + ASMJIT_API Error logf(const char* fmt, ...) noexcept; + + //! Formats the message by using `vsnprintf()` and then sends the result + //! to `log()`. + ASMJIT_API Error logv(const char* fmt, va_list ap) noexcept; + + //! Logs binary data. + ASMJIT_API Error logBinary(const void* data, size_t size) noexcept; + + //! \} +}; + +// ============================================================================ +// [asmjit::FileLogger] +// ============================================================================ + +//! Logger that can log to a `FILE*`. +class ASMJIT_VIRTAPI FileLogger : public Logger { +public: + ASMJIT_NONCOPYABLE(FileLogger) + + FILE* _file; + + //! \name Construction & Destruction + //! \{ + + //! Creates a new `FileLogger` that logs to `FILE*`. + ASMJIT_API FileLogger(FILE* file = nullptr) noexcept; + //! Destroys the `FileLogger`. + ASMJIT_API virtual ~FileLogger() noexcept; + + //! \} + + //! \name Accessors + //! \{ + + //! Returns the logging output stream or null if the logger has no output + //! stream. + inline FILE* file() const noexcept { return _file; } + + //! Sets the logging output stream to `stream` or null. + //! + //! \note If the `file` is null the logging will be disabled. When a logger + //! is attached to `CodeHolder` or any emitter the logging API will always + //! be called regardless of the output file. This means that if you really + //! want to disable logging at emitter level you must not attach a logger + //! to it. + inline void setFile(FILE* file) noexcept { _file = file; } + + //! \} + + ASMJIT_API Error _log(const char* data, size_t size = SIZE_MAX) noexcept override; +}; + +// ============================================================================ +// [asmjit::StringLogger] +// ============================================================================ + +//! Logger that stores everything in an internal string buffer. +class ASMJIT_VIRTAPI StringLogger : public Logger { +public: + ASMJIT_NONCOPYABLE(StringLogger) + + //! Logger data as string. + String _content; + + //! \name Construction & Destruction + //! \{ + + //! Create new `StringLogger`. + ASMJIT_API StringLogger() noexcept; + //! Destroys the `StringLogger`. + ASMJIT_API virtual ~StringLogger() noexcept; + + //! \} + + //! \name Logger Data Accessors + //! \{ + + //! Returns aggregated logger data as `char*` pointer. + //! + //! The pointer is owned by `StringLogger`, it can't be modified or freed. + inline const char* data() const noexcept { return _content.data(); } + //! Returns size of the data returned by `data()`. + inline size_t dataSize() const noexcept { return _content.size(); } + + //! \} + + //! \name Logger Data Manipulation + //! \{ + + //! Clears the accumulated logger data. + inline void clear() noexcept { _content.clear(); } + + //! \} + + ASMJIT_API Error _log(const char* data, size_t size = SIZE_MAX) noexcept override; +}; + +// ============================================================================ +// [asmjit::Logging] +// ============================================================================ + +struct Logging { + ASMJIT_API static Error formatRegister( + String& sb, + uint32_t flags, + const BaseEmitter* emitter, + uint32_t archId, + uint32_t regType, + uint32_t regId) noexcept; + + ASMJIT_API static Error formatLabel( + String& sb, + uint32_t flags, + const BaseEmitter* emitter, + uint32_t labelId) noexcept; + + ASMJIT_API static Error formatOperand( + String& sb, + uint32_t flags, + const BaseEmitter* emitter, + uint32_t archId, + const Operand_& op) noexcept; + + ASMJIT_API static Error formatInstruction( + String& sb, + uint32_t flags, + const BaseEmitter* emitter, + uint32_t archId, + const BaseInst& inst, const Operand_* operands, uint32_t opCount) noexcept; + + ASMJIT_API static Error formatTypeId( + String& sb, + uint32_t typeId) noexcept; + +#ifndef ASMJIT_NO_BUILDER + ASMJIT_API static Error formatNode( + String& sb, + uint32_t flags, + const BaseBuilder* cb, + const BaseNode* node_) noexcept; +#endif + + // Only used by AsmJit internals, not available to users. +#ifdef ASMJIT_EXPORTS + enum { + // Has to be big to be able to hold all metadata compiler can assign to a + // single instruction. + kMaxInstLineSize = 44, + kMaxBinarySize = 26 + }; + + static Error formatLine( + String& sb, + const uint8_t* binData, size_t binSize, size_t dispSize, size_t immSize, const char* comment) noexcept; +#endif +}; +#endif + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_LOGGER_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/misc_p.h b/3rdparty/asmjit/src/asmjit/core/misc_p.h new file mode 100644 index 00000000000..916ca9db67c --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/misc_p.h @@ -0,0 +1,49 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_MISC_P_H_INCLUDED +#define ASMJIT_CORE_MISC_P_H_INCLUDED + +#include "../core/api-config.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \cond INTERNAL +//! \addtogroup asmjit_support +//! \{ + +#define ASMJIT_LOOKUP_TABLE_8(T, I) T((I)), T((I+1)), T((I+2)), T((I+3)), T((I+4)), T((I+5)), T((I+6)), T((I+7)) +#define ASMJIT_LOOKUP_TABLE_16(T, I) ASMJIT_LOOKUP_TABLE_8(T, I), ASMJIT_LOOKUP_TABLE_8(T, I + 8) +#define ASMJIT_LOOKUP_TABLE_32(T, I) ASMJIT_LOOKUP_TABLE_16(T, I), ASMJIT_LOOKUP_TABLE_16(T, I + 16) +#define ASMJIT_LOOKUP_TABLE_64(T, I) ASMJIT_LOOKUP_TABLE_32(T, I), ASMJIT_LOOKUP_TABLE_32(T, I + 32) +#define ASMJIT_LOOKUP_TABLE_128(T, I) ASMJIT_LOOKUP_TABLE_64(T, I), ASMJIT_LOOKUP_TABLE_64(T, I + 64) +#define ASMJIT_LOOKUP_TABLE_256(T, I) ASMJIT_LOOKUP_TABLE_128(T, I), ASMJIT_LOOKUP_TABLE_128(T, I + 128) +#define ASMJIT_LOOKUP_TABLE_512(T, I) ASMJIT_LOOKUP_TABLE_256(T, I), ASMJIT_LOOKUP_TABLE_256(T, I + 256) +#define ASMJIT_LOOKUP_TABLE_1024(T, I) ASMJIT_LOOKUP_TABLE_512(T, I), ASMJIT_LOOKUP_TABLE_512(T, I + 512) + +//! \} +//! \endcond + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_MISC_P_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/operand.cpp b/3rdparty/asmjit/src/asmjit/core/operand.cpp new file mode 100644 index 00000000000..9d11f3f6ddc --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/operand.cpp @@ -0,0 +1,136 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#include "../core/operand.h" + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::Operand - Unit] +// ============================================================================ + +#if defined(ASMJIT_TEST) +UNIT(operand) { + INFO("Checking operand sizes"); + EXPECT(sizeof(Operand) == 16); + EXPECT(sizeof(BaseReg) == 16); + EXPECT(sizeof(BaseMem) == 16); + EXPECT(sizeof(Imm) == 16); + EXPECT(sizeof(Label) == 16); + + INFO("Checking basic functionality of Operand"); + Operand a, b; + Operand dummy; + + EXPECT(a.isNone() == true); + EXPECT(a.isReg() == false); + EXPECT(a.isMem() == false); + EXPECT(a.isImm() == false); + EXPECT(a.isLabel() == false); + EXPECT(a == b); + EXPECT(a._data[0] == 0); + EXPECT(a._data[1] == 0); + + INFO("Checking basic functionality of Label"); + Label label; + EXPECT(label.isValid() == false); + EXPECT(label.id() == Globals::kInvalidId); + + INFO("Checking basic functionality of BaseReg"); + EXPECT(BaseReg().isReg() == true); + EXPECT(BaseReg().isValid() == false); + EXPECT(BaseReg()._data[0] == 0); + EXPECT(BaseReg()._data[1] == 0); + EXPECT(dummy.as().isValid() == false); + + // Create some register (not specific to any architecture). + uint32_t rSig = Operand::kOpReg | (1 << Operand::kSignatureRegTypeShift ) | + (2 << Operand::kSignatureRegGroupShift) | + (8 << Operand::kSignatureSizeShift ) ; + BaseReg r1(rSig, 5); + + EXPECT(r1.isValid() == true); + EXPECT(r1.isReg() == true); + EXPECT(r1.isReg(1) == true); + EXPECT(r1.isPhysReg() == true); + EXPECT(r1.isVirtReg() == false); + EXPECT(r1.signature() == rSig); + EXPECT(r1.type() == 1); + EXPECT(r1.group() == 2); + EXPECT(r1.size() == 8); + EXPECT(r1.id() == 5); + EXPECT(r1.isReg(1, 5) == true); // RegType and Id. + EXPECT(r1._data[0] == 0); + EXPECT(r1._data[1] == 0); + + // The same type of register having different id. + BaseReg r2(r1, 6); + EXPECT(r2.isValid() == true); + EXPECT(r2.isReg() == true); + EXPECT(r2.isReg(1) == true); + EXPECT(r2.isPhysReg() == true); + EXPECT(r2.isVirtReg() == false); + EXPECT(r2.signature() == rSig); + EXPECT(r2.type() == r1.type()); + EXPECT(r2.group() == r1.group()); + EXPECT(r2.size() == r1.size()); + EXPECT(r2.id() == 6); + EXPECT(r2.isReg(1, 6) == true); + + r1.reset(); + EXPECT(!r1.isReg()); + EXPECT(!r1.isValid()); + + INFO("Checking basic functionality of BaseMem"); + BaseMem m; + EXPECT(m.isMem()); + EXPECT(m == BaseMem()); + EXPECT(m.hasBase() == false); + EXPECT(m.hasIndex() == false); + EXPECT(m.hasOffset() == false); + EXPECT(m.isOffset64Bit() == true); + EXPECT(m.offset() == 0); + + m.setOffset(-1); + EXPECT(m.offsetLo32() == -1); + EXPECT(m.offset() == -1); + + int64_t x = int64_t(0xFF00FF0000000001u); + int32_t xHi = int32_t(0xFF00FF00u); + + m.setOffset(x); + EXPECT(m.offset() == x); + EXPECT(m.offsetLo32() == 1); + EXPECT(m.offsetHi32() == xHi); + + INFO("Checking basic functionality of Imm"); + Imm immValue(-42); + EXPECT(Imm(-1).i64() == int64_t(-1)); + EXPECT(imm(-1).i64() == int64_t(-1)); + EXPECT(immValue.i64() == int64_t(-42)); + EXPECT(imm(0xFFFFFFFF).i64() == int64_t(0xFFFFFFFF)); +} +#endif + +ASMJIT_END_NAMESPACE diff --git a/3rdparty/asmjit/src/asmjit/core/operand.h b/3rdparty/asmjit/src/asmjit/core/operand.h new file mode 100644 index 00000000000..eee1af4244e --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/operand.h @@ -0,0 +1,1337 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_OPERAND_H_INCLUDED +#define ASMJIT_CORE_OPERAND_H_INCLUDED + +#include "../core/support.h" + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [Macros] +// ============================================================================ + +//! Adds a template specialization for `REG_TYPE` into the local `RegTraits`. +#define ASMJIT_DEFINE_REG_TRAITS(REG, REG_TYPE, GROUP, SIZE, COUNT, TYPE_ID) \ +template<> \ +struct RegTraits { \ + typedef REG RegT; \ + \ + static constexpr uint32_t kValid = 1; \ + static constexpr uint32_t kCount = COUNT; \ + static constexpr uint32_t kTypeId = TYPE_ID; \ + \ + static constexpr uint32_t kType = REG_TYPE; \ + static constexpr uint32_t kGroup = GROUP; \ + static constexpr uint32_t kSize = SIZE; \ + \ + static constexpr uint32_t kSignature = \ + (Operand::kOpReg << Operand::kSignatureOpShift ) | \ + (kType << Operand::kSignatureRegTypeShift ) | \ + (kGroup << Operand::kSignatureRegGroupShift) | \ + (kSize << Operand::kSignatureSizeShift ) ; \ +} + +//! Adds constructors and member functions to a class that implements abstract +//! register. Abstract register is register that doesn't have type or signature +//! yet, it's a base class like `x86::Reg` or `arm::Reg`. +#define ASMJIT_DEFINE_ABSTRACT_REG(REG, BASE) \ +public: \ + /*! Default constructor that only setups basics. */ \ + constexpr REG() noexcept \ + : BASE(kSignature, kIdBad) {} \ + \ + /*! Makes a copy of the `other` register operand. */ \ + constexpr REG(const REG& other) noexcept \ + : BASE(other) {} \ + \ + /*! Makes a copy of the `other` register having id set to `rId` */ \ + constexpr REG(const BaseReg& other, uint32_t rId) noexcept \ + : BASE(other, rId) {} \ + \ + /*! Creates a register based on `signature` and `rId`. */ \ + constexpr REG(uint32_t signature, uint32_t rId) noexcept \ + : BASE(signature, rId) {} \ + \ + /*! Creates a completely uninitialized REG register operand (garbage). */ \ + inline explicit REG(Globals::NoInit_) noexcept \ + : BASE(Globals::NoInit) {} \ + \ + /*! Creates a new register from register type and id. */ \ + static inline REG fromTypeAndId(uint32_t rType, uint32_t rId) noexcept { \ + return REG(signatureOf(rType), rId); \ + } \ + \ + /*! Clones the register operand. */ \ + constexpr REG clone() const noexcept { return REG(*this); } \ + \ + inline REG& operator=(const REG& other) noexcept = default; + +//! Adds constructors and member functions to a class that implements final +//! register. Final registers MUST HAVE a valid signature. +#define ASMJIT_DEFINE_FINAL_REG(REG, BASE, TRAITS) \ +public: \ + static constexpr uint32_t kThisType = TRAITS::kType; \ + static constexpr uint32_t kThisGroup = TRAITS::kGroup; \ + static constexpr uint32_t kThisSize = TRAITS::kSize; \ + static constexpr uint32_t kSignature = TRAITS::kSignature; \ + \ + ASMJIT_DEFINE_ABSTRACT_REG(REG, BASE) \ + \ + /*! Creates a register operand having its id set to `rId`. */ \ + constexpr explicit REG(uint32_t rId) noexcept \ + : BASE(kSignature, rId) {} + +//! \addtogroup asmjit_core +//! \{ + +// ============================================================================ +// [asmjit::Operand_] +// ============================================================================ + +//! Constructor-less `Operand`. +//! +//! Contains no initialization code and can be used safely to define an array +//! of operands that won't be initialized. This is an `Operand` compatible +//! data structure designed to be statically initialized, static const, or to +//! be used by the user to define an array of operands without having them +//! default initialized. +//! +//! The key difference between `Operand` and `Operand_`: +//! +//! ``` +//! Operand_ xArray[10]; // Not initialized, contains garbage. +//! Operand yArray[10]; // All operands initialized to none. +//! ``` +struct Operand_ { + //! Operand's signature that provides operand type and additional information. + uint32_t _signature; + //! Either base id as used by memory operand or any id as used by others. + uint32_t _baseId; + + //! Data specific to the operand type. + //! + //! The reason we don't use union is that we have `constexpr` constructors that + //! construct operands and other `constexpr` functions that return wither another + //! Operand or something else. These cannot generally work with unions so we also + //! cannot use `union` if we want to be standard compliant. + uint32_t _data[2]; + + //! Indexes to `_data` array. + enum DataIndex : uint32_t { + kDataMemIndexId = 0, + kDataMemOffsetLo = 1, + + kDataImmValueLo = ASMJIT_ARCH_LE ? 0 : 1, + kDataImmValueHi = ASMJIT_ARCH_LE ? 1 : 0 + }; + + //! Operand types that can be encoded in `Operand`. + enum OpType : uint32_t { + //! Not an operand or not initialized. + kOpNone = 0, + //! Operand is a register. + kOpReg = 1, + //! Operand is a memory. + kOpMem = 2, + //! Operand is an immediate value. + kOpImm = 3, + //! Operand is a label. + kOpLabel = 4 + }; + static_assert(kOpMem == kOpReg + 1, "asmjit::Operand requires `kOpMem` to be `kOpReg+1`."); + + // \cond INTERNAL + enum SignatureBits : uint32_t { + // Operand type (3 least significant bits). + // |........|........|........|.....XXX| + kSignatureOpShift = 0, + kSignatureOpMask = 0x07u << kSignatureOpShift, + + // Register type (5 bits). + // |........|........|........|XXXXX...| + kSignatureRegTypeShift = 3, + kSignatureRegTypeMask = 0x1Fu << kSignatureRegTypeShift, + + // Register group (4 bits). + // |........|........|....XXXX|........| + kSignatureRegGroupShift = 8, + kSignatureRegGroupMask = 0x0Fu << kSignatureRegGroupShift, + + // Memory base type (5 bits). + // |........|........|........|XXXXX...| + kSignatureMemBaseTypeShift = 3, + kSignatureMemBaseTypeMask = 0x1Fu << kSignatureMemBaseTypeShift, + + // Memory index type (5 bits). + // |........|........|...XXXXX|........| + kSignatureMemIndexTypeShift = 8, + kSignatureMemIndexTypeMask = 0x1Fu << kSignatureMemIndexTypeShift, + + // Memory base+index combined (10 bits). + // |........|........|...XXXXX|XXXXX...| + kSignatureMemBaseIndexShift = 3, + kSignatureMemBaseIndexMask = 0x3FFu << kSignatureMemBaseIndexShift, + + // Memory address type (2 bits). + // |........|........|.XX.....|........| + kSignatureMemAddrTypeShift = 13, + kSignatureMemAddrTypeMask = 0x03u << kSignatureMemAddrTypeShift, + + // This memory operand represents a home-slot or stack (BaseCompiler). + // |........|........|X.......|........| + kSignatureMemRegHomeShift = 15, + kSignatureMemRegHomeFlag = 0x01u << kSignatureMemRegHomeShift, + + // Operand size (8 most significant bits). + // |XXXXXXXX|........|........|........| + kSignatureSizeShift = 24, + kSignatureSizeMask = 0xFFu << kSignatureSizeShift + }; + //! \endcond + + //! \cond INTERNAL + //! Constants useful for VirtId <-> Index translation. + enum VirtIdConstants : uint32_t { + //! Minimum valid packed-id. + kVirtIdMin = 256, + //! Maximum valid packed-id, excludes Globals::kInvalidId. + kVirtIdMax = Globals::kInvalidId - 1, + //! Count of valid packed-ids. + kVirtIdCount = uint32_t(kVirtIdMax - kVirtIdMin + 1) + }; + + //! Tests whether the given `id` is a valid virtual register id. Since AsmJit + //! supports both physical and virtual registers it must be able to distinguish + //! between these two. The idea is that physical registers are always limited + //! in size, so virtual identifiers start from `kVirtIdMin` and end at + //! `kVirtIdMax`. + static ASMJIT_INLINE bool isVirtId(uint32_t id) noexcept { return id - kVirtIdMin < uint32_t(kVirtIdCount); } + //! Converts a real-id into a packed-id that can be stored in Operand. + static ASMJIT_INLINE uint32_t indexToVirtId(uint32_t id) noexcept { return id + kVirtIdMin; } + //! Converts a packed-id back to real-id. + static ASMJIT_INLINE uint32_t virtIdToIndex(uint32_t id) noexcept { return id - kVirtIdMin; } + //! \endcond + + //! \name Construction & Destruction + //! \{ + + //! \cond INTERNAL + //! Initializes a `BaseReg` operand from `signature` and register `id`. + inline void _initReg(uint32_t signature, uint32_t id) noexcept { + _signature = signature; + _baseId = id; + _data[0] = 0; + _data[1] = 0; + } + + //! Initializes the operand from `other` (used by operator overloads). + inline void copyFrom(const Operand_& other) noexcept { memcpy(this, &other, sizeof(Operand_)); } + //! \endcond + + //! Resets the `Operand` to none. + //! + //! None operand is defined the following way: + //! - Its signature is zero (kOpNone, and the rest zero as well). + //! - Its id is `0`. + //! - The reserved8_4 field is set to `0`. + //! - The reserved12_4 field is set to zero. + //! + //! In other words, reset operands have all members set to zero. Reset operand + //! must match the Operand state right after its construction. Alternatively, + //! if you have an array of operands, you can simply use `memset()`. + //! + //! ``` + //! using namespace asmjit; + //! + //! Operand a; + //! Operand b; + //! assert(a == b); + //! + //! b = x86::eax; + //! assert(a != b); + //! + //! b.reset(); + //! assert(a == b); + //! + //! memset(&b, 0, sizeof(Operand)); + //! assert(a == b); + //! ``` + inline void reset() noexcept { + _signature = 0; + _baseId = 0; + _data[0] = 0; + _data[1] = 0; + } + + //! \} + + //! \name Operator Overloads + //! \{ + + constexpr bool operator==(const Operand_& other) const noexcept { return isEqual(other); } + constexpr bool operator!=(const Operand_& other) const noexcept { return !isEqual(other); } + + //! \} + + //! \name Cast + //! \{ + + //! Casts this operand to `T` type. + template + inline T& as() noexcept { return static_cast(*this); } + + //! Casts this operand to `T` type (const). + template + inline const T& as() const noexcept { return static_cast(*this); } + + //! \} + + //! \name Accessors + //! \{ + + //! Tests whether the operand matches the given signature `sign`. + constexpr bool hasSignature(uint32_t signature) const noexcept { return _signature == signature; } + //! Tests whether the operand matches the signature of the `other` operand. + constexpr bool hasSignature(const Operand_& other) const noexcept { return _signature == other.signature(); } + + //! Returns operand signature as unsigned 32-bit integer. + //! + //! Signature is first 4 bytes of the operand data. It's used mostly for + //! operand checking as it's much faster to check 4 bytes at once than having + //! to check these bytes individually. + constexpr uint32_t signature() const noexcept { return _signature; } + + //! Sets the operand signature, see `signature()`. + //! + //! \note Improper use of `setSignature()` can lead to hard-to-debug errors. + inline void setSignature(uint32_t signature) noexcept { _signature = signature; } + + //! \cond INTERNAL + template + constexpr bool _hasSignaturePart() const noexcept { + return (_signature & mask) != 0; + } + + template + constexpr uint32_t _getSignaturePart() const noexcept { + return (_signature >> Support::constCtz(mask)) & (mask >> Support::constCtz(mask)); + } + + template + inline void _setSignaturePart(uint32_t value) noexcept { + ASMJIT_ASSERT((value & ~(mask >> Support::constCtz(mask))) == 0); + _signature = (_signature & ~mask) | (value << Support::constCtz(mask)); + } + //! \endcond + + //! Returns the type of the operand, see `OpType`. + constexpr uint32_t opType() const noexcept { return _getSignaturePart(); } + //! Tests whether the operand is none (`kOpNone`). + constexpr bool isNone() const noexcept { return _signature == 0; } + //! Tests whether the operand is a register (`kOpReg`). + constexpr bool isReg() const noexcept { return opType() == kOpReg; } + //! Tests whether the operand is a memory location (`kOpMem`). + constexpr bool isMem() const noexcept { return opType() == kOpMem; } + //! Tests whether the operand is an immediate (`kOpImm`). + constexpr bool isImm() const noexcept { return opType() == kOpImm; } + //! Tests whether the operand is a label (`kOpLabel`). + constexpr bool isLabel() const noexcept { return opType() == kOpLabel; } + + //! Tests whether the operand is a physical register. + constexpr bool isPhysReg() const noexcept { return isReg() && _baseId < 0xFFu; } + //! Tests whether the operand is a virtual register. + constexpr bool isVirtReg() const noexcept { return isReg() && _baseId > 0xFFu; } + + //! Tests whether the operand specifies a size (i.e. the size is not zero). + constexpr bool hasSize() const noexcept { return _hasSignaturePart(); } + //! Tests whether the size of the operand matches `size`. + constexpr bool hasSize(uint32_t s) const noexcept { return size() == s; } + + //! Returns the size of the operand in bytes. + //! + //! The value returned depends on the operand type: + //! * None - Should always return zero size. + //! * Reg - Should always return the size of the register. If the register + //! size depends on architecture (like `x86::CReg` and `x86::DReg`) + //! the size returned should be the greatest possible (so it should + //! return 64-bit size in such case). + //! * Mem - Size is optional and will be in most cases zero. + //! * Imm - Should always return zero size. + //! * Label - Should always return zero size. + constexpr uint32_t size() const noexcept { return _getSignaturePart(); } + + //! Returns the operand id. + //! + //! The value returned should be interpreted accordingly to the operand type: + //! * None - Should be `0`. + //! * Reg - Physical or virtual register id. + //! * Mem - Multiple meanings - BASE address (register or label id), or + //! high value of a 64-bit absolute address. + //! * Imm - Should be `0`. + //! * Label - Label id if it was created by using `newLabel()` or + //! `Globals::kInvalidId` if the label is invalid or not + //! initialized. + constexpr uint32_t id() const noexcept { return _baseId; } + + //! Tests whether the operand is 100% equal to `other`. + constexpr bool isEqual(const Operand_& other) const noexcept { + return (_signature == other._signature) & + (_baseId == other._baseId ) & + (_data[0] == other._data[0] ) & + (_data[1] == other._data[1] ) ; + } + + //! Tests whether the operand is a register matching `rType`. + constexpr bool isReg(uint32_t rType) const noexcept { + return (_signature & (kSignatureOpMask | kSignatureRegTypeMask)) == + ((kOpReg << kSignatureOpShift) | (rType << kSignatureRegTypeShift)); + } + + //! Tests whether the operand is register and of `rType` and `rId`. + constexpr bool isReg(uint32_t rType, uint32_t rId) const noexcept { + return isReg(rType) && id() == rId; + } + + //! Tests whether the operand is a register or memory. + constexpr bool isRegOrMem() const noexcept { + return Support::isBetween(opType(), kOpReg, kOpMem); + } + + //! \} +}; + +// ============================================================================ +// [asmjit::Operand] +// ============================================================================ + +//! Operand can contain register, memory location, immediate, or label. +class Operand : public Operand_ { +public: + //! \name Construction & Destruction + //! \{ + + //! Creates `kOpNone` operand having all members initialized to zero. + constexpr Operand() noexcept + : Operand_{ kOpNone, 0u, { 0u, 0u }} {} + + //! Creates a cloned `other` operand. + constexpr Operand(const Operand& other) noexcept = default; + + //! Creates a cloned `other` operand. + constexpr explicit Operand(const Operand_& other) + : Operand_(other) {} + + //! Creates an operand initialized to raw `[u0, u1, u2, u3]` values. + constexpr Operand(Globals::Init_, uint32_t u0, uint32_t u1, uint32_t u2, uint32_t u3) noexcept + : Operand_{ u0, u1, { u2, u3 }} {} + + //! Creates an uninitialized operand (dangerous). + inline explicit Operand(Globals::NoInit_) noexcept {} + + //! \} + + //! \name Operator Overloads + //! \{ + + inline Operand& operator=(const Operand& other) noexcept = default; + inline Operand& operator=(const Operand_& other) noexcept { return operator=(static_cast(other)); } + + //! \} + + //! \name Utilities + //! \{ + + //! Clones this operand and returns its copy. + constexpr Operand clone() const noexcept { return Operand(*this); } + + //! \} +}; + +static_assert(sizeof(Operand) == 16, "asmjit::Operand must be exactly 16 bytes long"); + +namespace Globals { + //! A default-constructed operand of `Operand_::kOpNone` type. + static constexpr const Operand none; +} + +// ============================================================================ +// [asmjit::Label] +// ============================================================================ + +//! Label (jump target or data location). +//! +//! Label represents a location in code typically used as a jump target, but +//! may be also a reference to some data or a static variable. Label has to be +//! explicitly created by BaseEmitter. +//! +//! Example of using labels: +//! +//! ``` +//! // Create some emitter (for example x86::Assembler). +//! x86::Assembler a; +//! +//! // Create Label instance. +//! Label L1 = a.newLabel(); +//! +//! // ... your code ... +//! +//! // Using label. +//! a.jump(L1); +//! +//! // ... your code ... +//! +//! // Bind label to the current position, see `BaseEmitter::bind()`. +//! a.bind(L1); +//! ``` +class Label : public Operand { +public: + //! Type of the Label. + enum LabelType : uint32_t { + //! Anonymous (unnamed) label. + kTypeAnonymous = 0, + //! Local label (always has parentId). + kTypeLocal = 1, + //! Global label (never has parentId). + kTypeGlobal = 2, + //! Number of label types. + kTypeCount = 3 + }; + + // TODO: Find a better place, find a better name. + enum { + //! Label tag is used as a sub-type, forming a unique signature across all + //! operand types as 0x1 is never associated with any register (reg-type). + //! This means that a memory operand's BASE register can be constructed + //! from virtually any operand (register vs. label) by just assigning its + //! type (reg type or label-tag) and operand id. + kLabelTag = 0x1 + }; + + //! \name Construction & Destruction + //! \{ + + //! Creates a label operand without ID (you must set the ID to make it valid). + constexpr Label() noexcept + : Operand(Globals::Init, kOpLabel, Globals::kInvalidId, 0, 0) {} + + //! Creates a cloned label operand of `other` . + constexpr Label(const Label& other) noexcept + : Operand(other) {} + + //! Creates a label operand of the given `id`. + constexpr explicit Label(uint32_t id) noexcept + : Operand(Globals::Init, kOpLabel, id, 0, 0) {} + + inline explicit Label(Globals::NoInit_) noexcept + : Operand(Globals::NoInit) {} + + //! Resets the label, will reset all properties and set its ID to `Globals::kInvalidId`. + inline void reset() noexcept { + _signature = kOpLabel; + _baseId = Globals::kInvalidId; + _data[0] = 0; + _data[1] = 0; + } + + //! \} + + //! \name Overloaded Operators + //! \{ + + inline Label& operator=(const Label& other) noexcept = default; + + //! \} + + //! \name Accessors + //! \{ + + //! Tests whether the label was created by CodeHolder and/or an attached emitter. + constexpr bool isValid() const noexcept { return _baseId != Globals::kInvalidId; } + //! Sets the label `id`. + inline void setId(uint32_t id) noexcept { _baseId = id; } + + //! \} +}; + +// ============================================================================ +// [asmjit::BaseRegTraits] +// ============================================================================ + +//! \cond INTERNAL +//! Default register traits. +struct BaseRegTraits { + //! RegType is not valid by default. + static constexpr uint32_t kValid = 0; + //! Count of registers (0 if none). + static constexpr uint32_t kCount = 0; + //! Everything is void by default. + static constexpr uint32_t kTypeId = 0; + + //! Zero type by default. + static constexpr uint32_t kType = 0; + //! Zero group by default. + static constexpr uint32_t kGroup = 0; + //! No size by default. + static constexpr uint32_t kSize = 0; + + //! Empty signature by default. + static constexpr uint32_t kSignature = Operand::kOpReg; +}; +//! \endcond + +// ============================================================================ +// [asmjit::BaseReg] +// ============================================================================ + +//! Structure that allows to extract a register information based on the signature. +//! +//! This information is compatible with operand's signature (32-bit integer) +//! and `RegInfo` just provides easy way to access it. +struct RegInfo { + inline void reset() noexcept { _signature = 0; } + inline void setSignature(uint32_t signature) noexcept { _signature = signature; } + + template + constexpr uint32_t _getSignaturePart() const noexcept { + return (_signature >> Support::constCtz(mask)) & (mask >> Support::constCtz(mask)); + } + + constexpr bool isValid() const noexcept { return _signature != 0; } + constexpr uint32_t signature() const noexcept { return _signature; } + constexpr uint32_t opType() const noexcept { return _getSignaturePart(); } + constexpr uint32_t group() const noexcept { return _getSignaturePart(); } + constexpr uint32_t type() const noexcept { return _getSignaturePart(); } + constexpr uint32_t size() const noexcept { return _getSignaturePart(); } + + uint32_t _signature; +}; + +//! Physical/Virtual register operand. +class BaseReg : public Operand { +public: + //! Architecture neutral register types. + //! + //! These must be reused by any platform that contains that types. All GP + //! and VEC registers are also allowed by design to be part of a BASE|INDEX + //! of a memory operand. + enum RegType : uint32_t { + //! No register - unused, invalid, multiple meanings. + kTypeNone = 0, + + // (1 is used as a LabelTag) + + //! 8-bit low general purpose register (X86). + kTypeGp8Lo = 2, + //! 8-bit high general purpose register (X86). + kTypeGp8Hi = 3, + //! 16-bit general purpose register (X86). + kTypeGp16 = 4, + //! 32-bit general purpose register (X86|ARM). + kTypeGp32 = 5, + //! 64-bit general purpose register (X86|ARM). + kTypeGp64 = 6, + //! 32-bit view of a vector register (ARM). + kTypeVec32 = 7, + //! 64-bit view of a vector register (ARM). + kTypeVec64 = 8, + //! 128-bit view of a vector register (X86|ARM). + kTypeVec128 = 9, + //! 256-bit view of a vector register (X86). + kTypeVec256 = 10, + //! 512-bit view of a vector register (X86). + kTypeVec512 = 11, + //! 1024-bit view of a vector register (future). + kTypeVec1024 = 12, + //! Other0 register, should match `kOther0` group. + kTypeOther0 = 13, + //! Other1 register, should match `kOther1` group. + kTypeOther1 = 14, + //! Universal id of IP/PC register (if separate). + kTypeIP = 15, + //! Start of platform dependent register types (must be honored). + kTypeCustom = 16, + //! Maximum possible register id of all architectures. + kTypeMax = 31 + }; + + //! Register group (architecture neutral), and some limits. + enum RegGroup : uint32_t { + //! General purpose register group compatible with all backends. + kGroupGp = 0, + //! Vector register group compatible with all backends. + kGroupVec = 1, + //! Group that is architecture dependent. + kGroupOther0 = 2, + //! Group that is architecture dependent. + kGroupOther1 = 3, + //! Count of register groups used by virtual registers. + kGroupVirt = 4, + //! Count of register groups used by physical registers. + kGroupCount = 16 + }; + + enum Id : uint32_t { + //! None or any register (mostly internal). + kIdBad = 0xFFu + }; + + static constexpr uint32_t kSignature = kOpReg; + + //! \name Construction & Destruction + //! \{ + + //! Creates a dummy register operand. + constexpr BaseReg() noexcept + : Operand(Globals::Init, kSignature, kIdBad, 0, 0) {} + + //! Creates a new register operand which is the same as `other` . + constexpr BaseReg(const BaseReg& other) noexcept + : Operand(other) {} + + //! Creates a new register operand compatible with `other`, but with a different `rId`. + constexpr BaseReg(const BaseReg& other, uint32_t rId) noexcept + : Operand(Globals::Init, other._signature, rId, 0, 0) {} + + //! Creates a register initialized to `signature` and `rId`. + constexpr BaseReg(uint32_t signature, uint32_t rId) noexcept + : Operand(Globals::Init, signature, rId, 0, 0) {} + + inline explicit BaseReg(Globals::NoInit_) noexcept + : Operand(Globals::NoInit) {} + + //! \} + + //! \name Overloaded Operators + //! \{ + + inline BaseReg& operator=(const BaseReg& other) noexcept = default; + + //! \} + + //! \name Accessors + //! \{ + + //! Tests whether this register is the same as `other`. + //! + //! This is just an optimization. Registers by default only use the first + //! 8 bytes of the Operand, so this method takes advantage of this knowledge + //! and only compares these 8 bytes. If both operands were created correctly + //! then `isEqual()` and `isSame()` should give the same answer, however, if + //! some one of the two operand contains a garbage or other metadata in the + //! upper 8 bytes then `isSame()` may return `true` in cases where `isEqual()` + //! returns false. + constexpr bool isSame(const BaseReg& other) const noexcept { + return (_signature == other._signature) & + (_baseId == other._baseId ) ; + } + + //! Tests whether the register is valid (either virtual or physical). + constexpr bool isValid() const noexcept { return (_signature != 0) & (_baseId != kIdBad); } + + //! Tests whether this is a physical register. + constexpr bool isPhysReg() const noexcept { return _baseId < kIdBad; } + //! Tests whether this is a virtual register. + constexpr bool isVirtReg() const noexcept { return _baseId > kIdBad; } + + //! Tests whether the register type matches `type` - same as `isReg(type)`, provided for convenience. + constexpr bool isType(uint32_t type) const noexcept { return (_signature & kSignatureRegTypeMask) == (type << kSignatureRegTypeShift); } + //! Tests whether the register group matches `group`. + constexpr bool isGroup(uint32_t group) const noexcept { return (_signature & kSignatureRegGroupMask) == (group << kSignatureRegGroupShift); } + + //! Tests whether the register is a general purpose register (any size). + constexpr bool isGp() const noexcept { return isGroup(kGroupGp); } + //! Tests whether the register is a vector register. + constexpr bool isVec() const noexcept { return isGroup(kGroupVec); } + + using Operand_::isReg; + + //! Same as `isType()`, provided for convenience. + constexpr bool isReg(uint32_t rType) const noexcept { return isType(rType); } + //! Tests whether the register type matches `type` and register id matches `rId`. + constexpr bool isReg(uint32_t rType, uint32_t rId) const noexcept { return isType(rType) && id() == rId; } + + //! Returns the type of the register. + constexpr uint32_t type() const noexcept { return _getSignaturePart(); } + //! Returns the register group. + constexpr uint32_t group() const noexcept { return _getSignaturePart(); } + + //! Clones the register operand. + constexpr BaseReg clone() const noexcept { return BaseReg(*this); } + + //! Casts this register to `RegT` by also changing its signature. + //! + //! \note Improper use of `cloneAs()` can lead to hard-to-debug errors. + template + constexpr RegT cloneAs() const noexcept { return RegT(RegT::kSignature, id()); } + + //! Casts this register to `other` by also changing its signature. + //! + //! \note Improper use of `cloneAs()` can lead to hard-to-debug errors. + template + constexpr RegT cloneAs(const RegT& other) const noexcept { return RegT(other.signature(), id()); } + + //! Sets the register id to `rId`. + inline void setId(uint32_t rId) noexcept { _baseId = rId; } + + //! Sets a 32-bit operand signature based on traits of `RegT`. + template + inline void setSignatureT() noexcept { _signature = RegT::kSignature; } + + //! Sets the register `signature` and `rId`. + inline void setSignatureAndId(uint32_t signature, uint32_t rId) noexcept { + _signature = signature; + _baseId = rId; + } + + //! \} + + //! \name Static Functions + //! \{ + + static inline bool isGp(const Operand_& op) noexcept { + // Check operand type and register group. Not interested in register type and size. + const uint32_t kSgn = (kOpReg << kSignatureOpShift ) | + (kGroupGp << kSignatureRegGroupShift) ; + return (op.signature() & (kSignatureOpMask | kSignatureRegGroupMask)) == kSgn; + } + + //! Tests whether the `op` operand is either a low or high 8-bit GPB register. + static inline bool isVec(const Operand_& op) noexcept { + // Check operand type and register group. Not interested in register type and size. + const uint32_t kSgn = (kOpReg << kSignatureOpShift ) | + (kGroupVec << kSignatureRegGroupShift) ; + return (op.signature() & (kSignatureOpMask | kSignatureRegGroupMask)) == kSgn; + } + + static inline bool isGp(const Operand_& op, uint32_t rId) noexcept { return isGp(op) & (op.id() == rId); } + static inline bool isVec(const Operand_& op, uint32_t rId) noexcept { return isVec(op) & (op.id() == rId); } + + //! \} +}; + +// ============================================================================ +// [asmjit::RegOnly] +// ============================================================================ + +//! RegOnly is 8-byte version of `BaseReg` that allows to store either register +//! or nothing. +//! +//! This class was designed to decrease the space consumed by each extra "operand" +//! in `BaseEmitter` and `InstNode` classes. +struct RegOnly { + //! Type of the operand, either `kOpNone` or `kOpReg`. + uint32_t _signature; + //! Physical or virtual register id. + uint32_t _id; + + //! \name Construction & Destruction + //! \{ + + //! Initializes the `RegOnly` instance to hold register `signature` and `id`. + inline void init(uint32_t signature, uint32_t id) noexcept { + _signature = signature; + _id = id; + } + + inline void init(const BaseReg& reg) noexcept { init(reg.signature(), reg.id()); } + inline void init(const RegOnly& reg) noexcept { init(reg.signature(), reg.id()); } + + //! Resets the `RegOnly` members to zeros (none). + inline void reset() noexcept { init(0, 0); } + + //! \} + + //! \name Accessors + //! \{ + + //! Tests whether this ExtraReg is none (same as calling `Operand_::isNone()`). + constexpr bool isNone() const noexcept { return _signature == 0; } + //! Tests whether the register is valid (either virtual or physical). + constexpr bool isReg() const noexcept { return _signature != 0; } + + //! Tests whether this is a physical register. + constexpr bool isPhysReg() const noexcept { return _id < BaseReg::kIdBad; } + //! Tests whether this is a virtual register (used by `BaseCompiler`). + constexpr bool isVirtReg() const noexcept { return _id > BaseReg::kIdBad; } + + //! Returns the register signature or 0 if no register is assigned. + constexpr uint32_t signature() const noexcept { return _signature; } + //! Returns the register id. + //! + //! \note Always check whether the register is assigned before using the + //! returned identifier as non-assigned `RegOnly` instance would return + //! zero id, which is still a valid register id. + constexpr uint32_t id() const noexcept { return _id; } + + //! Sets the register id. + inline void setId(uint32_t id) noexcept { _id = id; } + + //! \cond INTERNAL + //! + //! Extracts information from operand's signature. + template + constexpr uint32_t _getSignaturePart() const noexcept { + return (_signature >> Support::constCtz(mask)) & (mask >> Support::constCtz(mask)); + } + //! \endcond + + //! Returns the type of the register. + constexpr uint32_t type() const noexcept { return _getSignaturePart(); } + //! Returns the register group. + constexpr uint32_t group() const noexcept { return _getSignaturePart(); } + + //! \} + + //! \name Utilities + //! \{ + + //! Converts this ExtraReg to a real `RegT` operand. + template + constexpr RegT toReg() const noexcept { return RegT(_signature, _id); } + + //! \} +}; + +// ============================================================================ +// [asmjit::BaseMem] +// ============================================================================ + +//! Base class for all memory operands. +//! +//! \note It's tricky to pack all possible cases that define a memory operand +//! into just 16 bytes. The `BaseMem` splits data into the following parts: +//! +//! BASE - Base register or label - requires 36 bits total. 4 bits are used to +//! encode the type of the BASE operand (label vs. register type) and +//! the remaining 32 bits define the BASE id, which can be a physical or +//! virtual register index. If BASE type is zero, which is never used as +//! a register-type and label doesn't use it as well then BASE field +//! contains a high DWORD of a possible 64-bit absolute address, which is +//! possible on X64. +//! +//! INDEX - Index register (or theoretically Label, which doesn't make sense). +//! Encoding is similar to BASE - it also requires 36 bits and splits +//! the encoding to INDEX type (4 bits defining the register type) and +//! id (32-bits). +//! +//! OFFSET - A relative offset of the address. Basically if BASE is specified +//! the relative displacement adjusts BASE and an optional INDEX. if +//! BASE is not specified then the OFFSET should be considered as ABSOLUTE +//! address (at least on X86). In that case its low 32 bits are stored in +//! DISPLACEMENT field and the remaining high 32 bits are stored in BASE. +//! +//! OTHER - There is rest 8 bits that can be used for whatever purpose. The +//! x86::Mem operand uses these bits to store segment override prefix and +//! index shift (scale). +class BaseMem : public Operand { +public: + enum AddrType : uint32_t { + kAddrTypeDefault = 0, + kAddrTypeAbs = 1, + kAddrTypeRel = 2 + }; + + // Shortcuts. + enum SignatureMem : uint32_t { + kSignatureMemAbs = kAddrTypeAbs << kSignatureMemAddrTypeShift, + kSignatureMemRel = kAddrTypeRel << kSignatureMemAddrTypeShift + }; + + //! \cond INTERNAL + //! Used internally to construct `BaseMem` operand from decomposed data. + struct Decomposed { + uint32_t baseType; + uint32_t baseId; + uint32_t indexType; + uint32_t indexId; + int32_t offset; + uint32_t size; + uint32_t flags; + }; + //! \endcond + + //! \name Construction & Destruction + //! \{ + + //! Creates a default `BaseMem` operand, that points to [0]. + constexpr BaseMem() noexcept + : Operand(Globals::Init, kOpMem, 0, 0, 0) {} + + //! Creates a `BaseMem` operand that is a clone of `other`. + constexpr BaseMem(const BaseMem& other) noexcept + : Operand(other) {} + + //! \cond INTERNAL + + //! Creates a `BaseMem` operand from 4 integers as used by `Operand_` struct. + constexpr BaseMem(Globals::Init_, uint32_t u0, uint32_t u1, uint32_t u2, uint32_t u3) noexcept + : Operand(Globals::Init, u0, u1, u2, u3) {} + + constexpr BaseMem(const Decomposed& d) noexcept + : Operand(Globals::Init, + kOpMem | (d.baseType << kSignatureMemBaseTypeShift ) + | (d.indexType << kSignatureMemIndexTypeShift) + | (d.size << kSignatureSizeShift ) + | d.flags, + d.baseId, + d.indexId, + uint32_t(d.offset)) {} + + //! \endcond + + //! Creates a completely uninitialized `BaseMem` operand. + inline explicit BaseMem(Globals::NoInit_) noexcept + : Operand(Globals::NoInit) {} + + //! Resets the memory operand - after the reset the memory points to [0]. + inline void reset() noexcept { + _signature = kOpMem; + _baseId = 0; + _data[0] = 0; + _data[1] = 0; + } + + //! \} + + //! \name Overloaded Operators + //! \{ + + inline BaseMem& operator=(const BaseMem& other) noexcept { copyFrom(other); return *this; } + + //! \} + + //! \name Accessors + //! \{ + + //! Clones the memory operand. + constexpr BaseMem clone() const noexcept { return BaseMem(*this); } + + constexpr uint32_t addrType() const noexcept { return _getSignaturePart(); } + inline void setAddrType(uint32_t addrType) noexcept { _setSignaturePart(addrType); } + inline void resetAddrType() noexcept { _setSignaturePart(0); } + + constexpr bool isAbs() const noexcept { return addrType() == kAddrTypeAbs; } + inline void setAbs() noexcept { setAddrType(kAddrTypeAbs); } + + constexpr bool isRel() const noexcept { return addrType() == kAddrTypeRel; } + inline void setRel() noexcept { setAddrType(kAddrTypeRel); } + + constexpr bool isRegHome() const noexcept { return _hasSignaturePart(); } + inline void setRegHome() noexcept { _signature |= kSignatureMemRegHomeFlag; } + inline void clearRegHome() noexcept { _signature &= ~kSignatureMemRegHomeFlag; } + + //! Tests whether the memory operand has a BASE register or label specified. + constexpr bool hasBase() const noexcept { return (_signature & kSignatureMemBaseTypeMask) != 0; } + //! Tests whether the memory operand has an INDEX register specified. + constexpr bool hasIndex() const noexcept { return (_signature & kSignatureMemIndexTypeMask) != 0; } + //! Tests whether the memory operand has BASE and INDEX register. + constexpr bool hasBaseOrIndex() const noexcept { return (_signature & kSignatureMemBaseIndexMask) != 0; } + //! Tests whether the memory operand has BASE and INDEX register. + constexpr bool hasBaseAndIndex() const noexcept { return (_signature & kSignatureMemBaseTypeMask) != 0 && (_signature & kSignatureMemIndexTypeMask) != 0; } + + //! Tests whether the BASE operand is a register (registers start after `kLabelTag`). + constexpr bool hasBaseReg() const noexcept { return (_signature & kSignatureMemBaseTypeMask) > (Label::kLabelTag << kSignatureMemBaseTypeShift); } + //! Tests whether the BASE operand is a label. + constexpr bool hasBaseLabel() const noexcept { return (_signature & kSignatureMemBaseTypeMask) == (Label::kLabelTag << kSignatureMemBaseTypeShift); } + //! Tests whether the INDEX operand is a register (registers start after `kLabelTag`). + constexpr bool hasIndexReg() const noexcept { return (_signature & kSignatureMemIndexTypeMask) > (Label::kLabelTag << kSignatureMemIndexTypeShift); } + + //! Returns the type of the BASE register (0 if this memory operand doesn't + //! use the BASE register). + //! + //! \note If the returned type is one (a value never associated to a register + //! type) the BASE is not register, but it's a label. One equals to `kLabelTag`. + //! You should always check `hasBaseLabel()` before using `baseId()` result. + constexpr uint32_t baseType() const noexcept { return _getSignaturePart(); } + + //! Returns the type of an INDEX register (0 if this memory operand doesn't + //! use the INDEX register). + constexpr uint32_t indexType() const noexcept { return _getSignaturePart(); } + + //! This is used internally for BASE+INDEX validation. + constexpr uint32_t baseAndIndexTypes() const noexcept { return _getSignaturePart(); } + + //! Returns both BASE (4:0 bits) and INDEX (9:5 bits) types combined into a + //! single value. + //! + //! \remarks Returns id of the BASE register or label (if the BASE was + //! specified as label). + constexpr uint32_t baseId() const noexcept { return _baseId; } + + //! Returns the id of the INDEX register. + constexpr uint32_t indexId() const noexcept { return _data[kDataMemIndexId]; } + + //! Sets the id of the BASE register (without modifying its type). + inline void setBaseId(uint32_t rId) noexcept { _baseId = rId; } + //! Sets the id of the INDEX register (without modifying its type). + inline void setIndexId(uint32_t rId) noexcept { _data[kDataMemIndexId] = rId; } + + //! Sets the base register to type and id of the given `base` operand. + inline void setBase(const BaseReg& base) noexcept { return _setBase(base.type(), base.id()); } + //! Sets the index register to type and id of the given `index` operand. + inline void setIndex(const BaseReg& index) noexcept { return _setIndex(index.type(), index.id()); } + + inline void _setBase(uint32_t rType, uint32_t rId) noexcept { + _setSignaturePart(rType); + _baseId = rId; + } + + inline void _setIndex(uint32_t rType, uint32_t rId) noexcept { + _setSignaturePart(rType); + _data[kDataMemIndexId] = rId; + } + + //! Resets the memory operand's BASE register or label. + inline void resetBase() noexcept { _setBase(0, 0); } + //! Resets the memory operand's INDEX register. + inline void resetIndex() noexcept { _setIndex(0, 0); } + + //! Sets the memory operand size (in bytes). + inline void setSize(uint32_t size) noexcept { _setSignaturePart(size); } + + //! Tests whether the memory operand has a 64-bit offset or absolute address. + //! + //! If this is true then `hasBase()` must always report false. + constexpr bool isOffset64Bit() const noexcept { return baseType() == 0; } + + //! Tests whether the memory operand has a non-zero offset or absolute address. + constexpr bool hasOffset() const noexcept { + return (_data[kDataMemOffsetLo] | uint32_t(_baseId & Support::bitMaskFromBool(isOffset64Bit()))) != 0; + } + + //! Returns either relative offset or absolute address as 64-bit integer. + constexpr int64_t offset() const noexcept { + return isOffset64Bit() ? int64_t(uint64_t(_data[kDataMemOffsetLo]) | (uint64_t(_baseId) << 32)) + : int64_t(int32_t(_data[kDataMemOffsetLo])); // Sign extend 32-bit offset. + } + + //! Returns a 32-bit low part of a 64-bit offset or absolute address. + constexpr int32_t offsetLo32() const noexcept { return int32_t(_data[kDataMemOffsetLo]); } + //! Returns a 32-but high part of a 64-bit offset or absolute address. + //! + //! \note This function is UNSAFE and returns garbage if `isOffset64Bit()` + //! returns false. Never use it blindly without checking it first. + constexpr int32_t offsetHi32() const noexcept { return int32_t(_baseId); } + + //! Sets a 64-bit offset or an absolute address to `offset`. + //! + //! \note This functions attempts to set both high and low parts of a 64-bit + //! offset, however, if the operand has a BASE register it will store only the + //! low 32 bits of the offset / address as there is no way to store both BASE + //! and 64-bit offset, and there is currently no architecture that has such + //! capability targeted by AsmJit. + inline void setOffset(int64_t offset) noexcept { + uint32_t lo = uint32_t(uint64_t(offset) & 0xFFFFFFFFu); + uint32_t hi = uint32_t(uint64_t(offset) >> 32); + uint32_t hiMsk = Support::bitMaskFromBool(isOffset64Bit()); + + _data[kDataMemOffsetLo] = lo; + _baseId = (hi & hiMsk) | (_baseId & ~hiMsk); + } + //! Sets a low 32-bit offset to `offset` (don't use without knowing how BaseMem works). + inline void setOffsetLo32(int32_t offset) noexcept { _data[kDataMemOffsetLo] = uint32_t(offset); } + + //! Adjusts the offset by `offset`. + //! + //! \note This is a fast function that doesn't use the HI 32-bits of a + //! 64-bit offset. Use it only if you know that there is a BASE register + //! and the offset is only 32 bits anyway. + + //! Adjusts the offset by a 64-bit `offset`. + inline void addOffset(int64_t offset) noexcept { + if (isOffset64Bit()) { + int64_t result = offset + int64_t(uint64_t(_data[kDataMemOffsetLo]) | (uint64_t(_baseId) << 32)); + _data[kDataMemOffsetLo] = uint32_t(uint64_t(result) & 0xFFFFFFFFu); + _baseId = uint32_t(uint64_t(result) >> 32); + } + else { + _data[kDataMemOffsetLo] += uint32_t(uint64_t(offset) & 0xFFFFFFFFu); + } + } + + //! Adds `offset` to a low 32-bit offset part (don't use without knowing how + //! BaseMem works). + inline void addOffsetLo32(int32_t offset) noexcept { _data[kDataMemOffsetLo] += uint32_t(offset); } + + //! Resets the memory offset to zero. + inline void resetOffset() noexcept { setOffset(0); } + + //! Resets the lo part of the memory offset to zero (don't use without knowing + //! how BaseMem works). + inline void resetOffsetLo32() noexcept { setOffsetLo32(0); } + + //! \} +}; + +// ============================================================================ +// [asmjit::Imm] +// ============================================================================ + +//! Immediate operand. +//! +//! Immediate operand is usually part of instruction itself. It's inlined after +//! or before the instruction opcode. Immediates can be only signed or unsigned +//! integers. +//! +//! To create an immediate operand use `asmjit::imm()` helper, which can be used +//! with any type, not just the default 64-bit int. +class Imm : public Operand { +public: + //! \name Construction & Destruction + //! \{ + + //! Creates a new immediate value (initial value is 0). + constexpr Imm() noexcept + : Operand(Globals::Init, kOpImm, 0, 0, 0) {} + + //! Creates a new immediate value from `other`. + constexpr Imm(const Imm& other) noexcept + : Operand(other) {} + + //! Creates a new signed immediate value, assigning the value to `val`. + constexpr explicit Imm(int64_t val) noexcept + : Operand(Globals::Init, kOpImm, 0, Support::unpackU32At0(val), Support::unpackU32At1(val)) {} + + inline explicit Imm(Globals::NoInit_) noexcept + : Operand(Globals::NoInit) {} + + //! \} + + //! \name Overloaded Operators + //! \{ + + //! Assigns the value of the `other` operand to this immediate. + inline Imm& operator=(const Imm& other) noexcept { copyFrom(other); return *this; } + + //! \} + + //! \name Accessors + //! \{ + + //! Returns immediate value as 8-bit signed integer, possibly cropped. + constexpr int8_t i8() const noexcept { return int8_t(_data[kDataImmValueLo] & 0xFFu); } + //! Returns immediate value as 8-bit unsigned integer, possibly cropped. + constexpr uint8_t u8() const noexcept { return uint8_t(_data[kDataImmValueLo] & 0xFFu); } + //! Returns immediate value as 16-bit signed integer, possibly cropped. + constexpr int16_t i16() const noexcept { return int16_t(_data[kDataImmValueLo] & 0xFFFFu);} + //! Returns immediate value as 16-bit unsigned integer, possibly cropped. + constexpr uint16_t u16() const noexcept { return uint16_t(_data[kDataImmValueLo] & 0xFFFFu);} + //! Returns immediate value as 32-bit signed integer, possibly cropped. + constexpr int32_t i32() const noexcept { return int32_t(_data[kDataImmValueLo]); } + //! Returns low 32-bit signed integer. + constexpr int32_t i32Lo() const noexcept { return int32_t(_data[kDataImmValueLo]); } + //! Returns high 32-bit signed integer. + constexpr int32_t i32Hi() const noexcept { return int32_t(_data[kDataImmValueHi]); } + //! Returns immediate value as 32-bit unsigned integer, possibly cropped. + constexpr uint32_t u32() const noexcept { return _data[kDataImmValueLo]; } + //! Returns low 32-bit signed integer. + constexpr uint32_t u32Lo() const noexcept { return _data[kDataImmValueLo]; } + //! Returns high 32-bit signed integer. + constexpr uint32_t u32Hi() const noexcept { return _data[kDataImmValueHi]; } + //! Returns immediate value as 64-bit signed integer. + constexpr int64_t i64() const noexcept { return int64_t((uint64_t(_data[kDataImmValueHi]) << 32) | _data[kDataImmValueLo]); } + //! Returns immediate value as 64-bit unsigned integer. + constexpr uint64_t u64() const noexcept { return uint64_t(i64()); } + //! Returns immediate value as `intptr_t`, possibly cropped if size of `intptr_t` is 32 bits. + constexpr intptr_t iptr() const noexcept { return (sizeof(intptr_t) == sizeof(int64_t)) ? intptr_t(i64()) : intptr_t(i32()); } + //! Returns immediate value as `uintptr_t`, possibly cropped if size of `uintptr_t` is 32 bits. + constexpr uintptr_t uptr() const noexcept { return (sizeof(uintptr_t) == sizeof(uint64_t)) ? uintptr_t(u64()) : uintptr_t(u32()); } + + //! Tests whether the immediate can be casted to 8-bit signed integer. + constexpr bool isInt8() const noexcept { return Support::isInt8(i64()); } + //! Tests whether the immediate can be casted to 8-bit unsigned integer. + constexpr bool isUInt8() const noexcept { return Support::isUInt8(i64()); } + //! Tests whether the immediate can be casted to 16-bit signed integer. + constexpr bool isInt16() const noexcept { return Support::isInt16(i64()); } + //! Tests whether the immediate can be casted to 16-bit unsigned integer. + constexpr bool isUInt16() const noexcept { return Support::isUInt16(i64()); } + //! Tests whether the immediate can be casted to 32-bit signed integer. + constexpr bool isInt32() const noexcept { return Support::isInt32(i64()); } + //! Tests whether the immediate can be casted to 32-bit unsigned integer. + constexpr bool isUInt32() const noexcept { return _data[kDataImmValueHi] == 0; } + + //! Sets immediate value to 8-bit signed integer `val`. + inline void setI8(int8_t val) noexcept { setI64(val); } + //! Sets immediate value to 8-bit unsigned integer `val`. + inline void setU8(uint8_t val) noexcept { setU64(val); } + //! Sets immediate value to 16-bit signed integer `val`. + inline void setI16(int16_t val) noexcept { setI64(val); } + //! Sets immediate value to 16-bit unsigned integer `val`. + inline void setU16(uint16_t val) noexcept { setU64(val); } + //! Sets immediate value to 32-bit signed integer `val`. + inline void setI32(int32_t val) noexcept { setI64(val); } + //! Sets immediate value to 32-bit unsigned integer `val`. + inline void setU32(uint32_t val) noexcept { setU64(val); } + //! Sets immediate value to 64-bit signed integer `val`. + inline void setI64(int64_t val) noexcept { + _data[kDataImmValueHi] = uint32_t(uint64_t(val) >> 32); + _data[kDataImmValueLo] = uint32_t(uint64_t(val) & 0xFFFFFFFFu); + } + //! Sets immediate value to 64-bit unsigned integer `val`. + inline void setU64(uint64_t val) noexcept { setI64(int64_t(val)); } + //! Sets immediate value to intptr_t `val`. + inline void setIPtr(intptr_t val) noexcept { setI64(val); } + //! Sets immediate value to uintptr_t `val`. + inline void setUPtr(uintptr_t val) noexcept { setU64(val); } + + //! Sets immediate value to `val`. + template + inline void setValue(T val) noexcept { setI64(int64_t(Support::asNormalized(val))); } + + inline void setDouble(double d) noexcept { setU64(Support::bitCast(d)); } + + //! \} + + //! \name Utilities + //! \{ + + //! Clones the immediate operand. + constexpr Imm clone() const noexcept { return Imm(*this); } + + inline void signExtend8Bits() noexcept { setI64(int64_t(i8())); } + inline void signExtend16Bits() noexcept { setI64(int64_t(i16())); } + inline void signExtend32Bits() noexcept { setI64(int64_t(i32())); } + + inline void zeroExtend8Bits() noexcept { setU64(u8()); } + inline void zeroExtend16Bits() noexcept { setU64(u16()); } + inline void zeroExtend32Bits() noexcept { _data[kDataImmValueHi] = 0u; } + + //! \} +}; + +//! Creates a new immediate operand. +//! +//! Using `imm(x)` is much nicer than using `Imm(x)` as this is a template +//! which can accept any integer including pointers and function pointers. +template +static constexpr Imm imm(T val) noexcept { + return Imm(std::is_signed::value ? int64_t(val) : int64_t(uint64_t(val))); +} + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_OPERAND_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/osutils.cpp b/3rdparty/asmjit/src/asmjit/core/osutils.cpp new file mode 100644 index 00000000000..e2f34efb33e --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/osutils.cpp @@ -0,0 +1,106 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#include "../core/api-build_p.h" +#include "../core/osutils.h" +#include "../core/support.h" + +#if defined(_WIN32) + #include +#elif defined(__APPLE__) + #include +#else + #include + #include +#endif + +ASMJIT_BEGIN_NAMESPACE + +// ============================================================================ +// [asmjit::OSUtils - GetTickCount] +// ============================================================================ + +uint32_t OSUtils::getTickCount() noexcept { +#if defined(_WIN32) + enum HiResStatus : uint32_t { + kHiResUnknown = 0, + kHiResAvailable = 1, + kHiResNotAvailable = 2 + }; + + static std::atomic _hiResStatus(kHiResUnknown); + static volatile double _hiResFreq(0); + + uint32_t status = _hiResStatus.load(); + LARGE_INTEGER now, qpf; + + if (status != kHiResNotAvailable && ::QueryPerformanceCounter(&now)) { + double freq = _hiResFreq; + if (status == kHiResUnknown) { + // Detects the availability of high resolution counter. + if (::QueryPerformanceFrequency(&qpf)) { + freq = double(qpf.QuadPart) / 1000.0; + _hiResFreq = freq; + _hiResStatus.compare_exchange_strong(status, kHiResAvailable); + status = kHiResAvailable; + } + else { + // High resolution not available. + _hiResStatus.compare_exchange_strong(status, kHiResNotAvailable); + } + } + + if (status == kHiResAvailable) + return uint32_t(uint64_t(int64_t(double(now.QuadPart) / freq)) & 0xFFFFFFFFu); + } + + // Bail to `GetTickCount()` if we cannot use high resolution. + return ::GetTickCount(); +#elif defined(__APPLE__) + // See Apple's QA1398. + static mach_timebase_info_data_t _machTime; + + uint32_t denom = _machTime.denom; + if (ASMJIT_UNLIKELY(!denom)) { + if (mach_timebase_info(&_machTime) != KERN_SUCCESS || !(denom = _machTime.denom)) + return 0; + } + + // `mach_absolute_time()` returns nanoseconds, we want milliseconds. + uint64_t t = mach_absolute_time() / 1000000u; + t = (t * _machTime.numer) / _machTime.denom; + return uint32_t(t & 0xFFFFFFFFu); +#elif defined(_POSIX_MONOTONIC_CLOCK) && _POSIX_MONOTONIC_CLOCK >= 0 + struct timespec ts; + if (ASMJIT_UNLIKELY(clock_gettime(CLOCK_MONOTONIC, &ts) != 0)) + return 0; + + uint64_t t = (uint64_t(ts.tv_sec ) * 1000u) + (uint64_t(ts.tv_nsec) / 1000000u); + return uint32_t(t & 0xFFFFFFFFu); +#else + #pragma message("asmjit::OSUtils::getTickCount() doesn't have implementation for the target OS.") + return 0; +#endif +} + +ASMJIT_END_NAMESPACE diff --git a/3rdparty/asmjit/src/asmjit/core/osutils.h b/3rdparty/asmjit/src/asmjit/core/osutils.h new file mode 100644 index 00000000000..b9a2df4ad8f --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/osutils.h @@ -0,0 +1,139 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_OSUTILS_H_INCLUDED +#define ASMJIT_CORE_OSUTILS_H_INCLUDED + +#include "../core/globals.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \addtogroup asmjit_support +//! \{ + +// ============================================================================ +// [asmjit::OSUtils] +// ============================================================================ + +//! Operating system utilities. +namespace OSUtils { + //! Gets the current CPU tick count, used for benchmarking (1ms resolution). + ASMJIT_API uint32_t getTickCount() noexcept; +}; + +// ============================================================================ +// [asmjit::Lock] +// ============================================================================ + +//! \cond INTERNAL + +//! Lock. +//! +//! Lock is internal, it cannot be used outside of AsmJit, however, its internal +//! layout is exposed as it's used by some other public classes. +class Lock { +public: + ASMJIT_NONCOPYABLE(Lock) + +#if defined(_WIN32) +#pragma pack(push, 8) + struct ASMJIT_MAY_ALIAS Handle { + void* DebugInfo; + long LockCount; + long RecursionCount; + void* OwningThread; + void* LockSemaphore; + unsigned long* SpinCount; + }; + Handle _handle; +#pragma pack(pop) +#elif !defined(__EMSCRIPTEN__) + typedef pthread_mutex_t Handle; + Handle _handle; +#endif + + inline Lock() noexcept; + inline ~Lock() noexcept; + + inline void lock() noexcept; + inline void unlock() noexcept; +}; + +#ifdef ASMJIT_EXPORTS +#if defined(_WIN32) + +// Win32 implementation. +static_assert(sizeof(Lock::Handle) == sizeof(CRITICAL_SECTION), "asmjit::Lock::Handle layout must match CRITICAL_SECTION"); +static_assert(alignof(Lock::Handle) == alignof(CRITICAL_SECTION), "asmjit::Lock::Handle alignment must match CRITICAL_SECTION"); + +inline Lock::Lock() noexcept { InitializeCriticalSection(reinterpret_cast(&_handle)); } +inline Lock::~Lock() noexcept { DeleteCriticalSection(reinterpret_cast(&_handle)); } +inline void Lock::lock() noexcept { EnterCriticalSection(reinterpret_cast(&_handle)); } +inline void Lock::unlock() noexcept { LeaveCriticalSection(reinterpret_cast(&_handle)); } + +#elif !defined(__EMSCRIPTEN__) + +// PThread implementation. +inline Lock::Lock() noexcept { pthread_mutex_init(&_handle, nullptr); } +inline Lock::~Lock() noexcept { pthread_mutex_destroy(&_handle); } +inline void Lock::lock() noexcept { pthread_mutex_lock(&_handle); } +inline void Lock::unlock() noexcept { pthread_mutex_unlock(&_handle); } + +#else + +// Dummy implementation - Emscripten or other unsupported platform. +inline Lock::Lock() noexcept {} +inline Lock::~Lock() noexcept {} +inline void Lock::lock() noexcept {} +inline void Lock::unlock() noexcept {} + +#endif +#endif + +//! \endcond + +// ============================================================================ +// [asmjit::LockGuard] +// ============================================================================ + +#ifdef ASMJIT_EXPORTS +//! \cond INTERNAL + +//! Scoped lock. +struct LockGuard { + ASMJIT_NONCOPYABLE(LockGuard) + + Lock& _target; + + inline LockGuard(Lock& target) noexcept : _target(target) { _target.lock(); } + inline ~LockGuard() noexcept { _target.unlock(); } +}; + +//! \endcond +#endif + +//! \} + +ASMJIT_END_NAMESPACE + +#endif // ASMJIT_CORE_OSUTILS_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/raassignment_p.h b/3rdparty/asmjit/src/asmjit/core/raassignment_p.h new file mode 100644 index 00000000000..2618afd0ece --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/raassignment_p.h @@ -0,0 +1,399 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_RAASSIGNMENT_P_H_INCLUDED +#define ASMJIT_CORE_RAASSIGNMENT_P_H_INCLUDED + +#include "../core/api-config.h" +#ifndef ASMJIT_NO_COMPILER + +#include "../core/radefs_p.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \cond INTERNAL +//! \addtogroup asmjit_ra +//! \{ + +// ============================================================================ +// [asmjit::RAAssignment] +// ============================================================================ + +class RAAssignment { + ASMJIT_NONCOPYABLE(RAAssignment) + +public: + enum Ids : uint32_t { + kPhysNone = 0xFF, + kWorkNone = RAWorkReg::kIdNone + }; + + enum DirtyBit : uint32_t { + kClean = 0, + kDirty = 1 + }; + + struct Layout { + inline void reset() noexcept { + physIndex.reset(); + physCount.reset(); + physTotal = 0; + workCount = 0; + workRegs = nullptr; + } + + RARegIndex physIndex; //!< Index of architecture registers per group. + RARegCount physCount; //!< Count of architecture registers per group. + uint32_t physTotal; //!< Count of physical registers of all groups. + uint32_t workCount; //!< Count of work registers. + const RAWorkRegs* workRegs; //!< WorkRegs data (vector). + }; + + struct PhysToWorkMap { + static inline size_t sizeOf(uint32_t count) noexcept { + return sizeof(PhysToWorkMap) - sizeof(uint32_t) + size_t(count) * sizeof(uint32_t); + } + + inline void reset(uint32_t count) noexcept { + assigned.reset(); + dirty.reset(); + + for (uint32_t i = 0; i < count; i++) + workIds[i] = kWorkNone; + } + + inline void copyFrom(const PhysToWorkMap* other, uint32_t count) noexcept { + size_t size = sizeOf(count); + memcpy(this, other, size); + } + + RARegMask assigned; //!< Assigned registers (each bit represents one physical reg). + RARegMask dirty; //!< Dirty registers (spill slot out of sync or no spill slot). + uint32_t workIds[1 /* ... */]; //!< PhysReg to WorkReg mapping. + }; + + struct WorkToPhysMap { + static inline size_t sizeOf(uint32_t count) noexcept { + return size_t(count) * sizeof(uint8_t); + } + + inline void reset(uint32_t count) noexcept { + for (uint32_t i = 0; i < count; i++) + physIds[i] = kPhysNone; + } + + inline void copyFrom(const WorkToPhysMap* other, uint32_t count) noexcept { + size_t size = sizeOf(count); + if (ASMJIT_LIKELY(size)) + memcpy(this, other, size); + } + + uint8_t physIds[1 /* ... */]; //!< WorkReg to PhysReg mapping + }; + + //! Physical registers layout. + Layout _layout; + //! WorkReg to PhysReg mapping. + WorkToPhysMap* _workToPhysMap; + //! PhysReg to WorkReg mapping and assigned/dirty bits. + PhysToWorkMap* _physToWorkMap; + //! Optimization to translate PhysRegs to WorkRegs faster. + uint32_t* _physToWorkIds[BaseReg::kGroupVirt]; + + //! \name Construction & Destruction + //! \{ + + inline RAAssignment() noexcept { + _layout.reset(); + resetMaps(); + } + + inline void initLayout(const RARegCount& physCount, const RAWorkRegs& workRegs) noexcept { + // Layout must be initialized before data. + ASMJIT_ASSERT(_physToWorkMap == nullptr); + ASMJIT_ASSERT(_workToPhysMap == nullptr); + + _layout.physIndex.buildIndexes(physCount); + _layout.physCount = physCount; + _layout.physTotal = uint32_t(_layout.physIndex[BaseReg::kGroupVirt - 1]) + + uint32_t(_layout.physCount[BaseReg::kGroupVirt - 1]) ; + _layout.workCount = workRegs.size(); + _layout.workRegs = &workRegs; + } + + inline void initMaps(PhysToWorkMap* physToWorkMap, WorkToPhysMap* workToPhysMap) noexcept { + _physToWorkMap = physToWorkMap; + _workToPhysMap = workToPhysMap; + for (uint32_t group = 0; group < BaseReg::kGroupVirt; group++) + _physToWorkIds[group] = physToWorkMap->workIds + _layout.physIndex.get(group); + } + + inline void resetMaps() noexcept { + _physToWorkMap = nullptr; + _workToPhysMap = nullptr; + for (uint32_t group = 0; group < BaseReg::kGroupVirt; group++) + _physToWorkIds[group] = nullptr; + } + + //! \} + + //! \name Accessors + //! \{ + + inline PhysToWorkMap* physToWorkMap() const noexcept { return _physToWorkMap; } + inline WorkToPhysMap* workToPhysMap() const noexcept { return _workToPhysMap; } + + inline RARegMask& assigned() noexcept { return _physToWorkMap->assigned; } + inline const RARegMask& assigned() const noexcept { return _physToWorkMap->assigned; } + inline uint32_t assigned(uint32_t group) const noexcept { return _physToWorkMap->assigned[group]; } + + inline RARegMask& dirty() noexcept { return _physToWorkMap->dirty; } + inline const RARegMask& dirty() const noexcept { return _physToWorkMap->dirty; } + inline uint32_t dirty(uint32_t group) const noexcept { return _physToWorkMap->dirty[group]; } + + inline uint32_t workToPhysId(uint32_t group, uint32_t workId) const noexcept { + DebugUtils::unused(group); + ASMJIT_ASSERT(workId != kWorkNone); + ASMJIT_ASSERT(workId < _layout.workCount); + return _workToPhysMap->physIds[workId]; + } + + inline uint32_t physToWorkId(uint32_t group, uint32_t physId) const noexcept { + ASMJIT_ASSERT(physId < Globals::kMaxPhysRegs); + return _physToWorkIds[group][physId]; + } + + inline bool isPhysAssigned(uint32_t group, uint32_t physId) const noexcept { + ASMJIT_ASSERT(physId < Globals::kMaxPhysRegs); + return Support::bitTest(_physToWorkMap->assigned[group], physId); + } + + inline bool isPhysDirty(uint32_t group, uint32_t physId) const noexcept { + ASMJIT_ASSERT(physId < Globals::kMaxPhysRegs); + return Support::bitTest(_physToWorkMap->dirty[group], physId); + } + + //! \} + + //! \name Assignment + //! \{ + + // These are low-level allocation helpers that are used to update the current + // mappings between physical and virt/work registers and also to update masks + // that represent allocated and dirty registers. These functions don't emit + // any code; they are only used to update and keep all mappings in sync. + + //! Assign [VirtReg/WorkReg] to a physical register. + ASMJIT_INLINE void assign(uint32_t group, uint32_t workId, uint32_t physId, uint32_t dirty) noexcept { + ASMJIT_ASSERT(workToPhysId(group, workId) == kPhysNone); + ASMJIT_ASSERT(physToWorkId(group, physId) == kWorkNone); + ASMJIT_ASSERT(!isPhysAssigned(group, physId)); + ASMJIT_ASSERT(!isPhysDirty(group, physId)); + + _workToPhysMap->physIds[workId] = uint8_t(physId); + _physToWorkIds[group][physId] = workId; + + uint32_t regMask = Support::bitMask(physId); + _physToWorkMap->assigned[group] |= regMask; + _physToWorkMap->dirty[group] |= regMask & Support::bitMaskFromBool(dirty); + + verify(); + } + + //! Reassign [VirtReg/WorkReg] to `dstPhysId` from `srcPhysId`. + ASMJIT_INLINE void reassign(uint32_t group, uint32_t workId, uint32_t dstPhysId, uint32_t srcPhysId) noexcept { + ASMJIT_ASSERT(dstPhysId != srcPhysId); + ASMJIT_ASSERT(workToPhysId(group, workId) == srcPhysId); + ASMJIT_ASSERT(physToWorkId(group, srcPhysId) == workId); + ASMJIT_ASSERT(isPhysAssigned(group, srcPhysId) == true); + ASMJIT_ASSERT(isPhysAssigned(group, dstPhysId) == false); + + _workToPhysMap->physIds[workId] = uint8_t(dstPhysId); + _physToWorkIds[group][srcPhysId] = kWorkNone; + _physToWorkIds[group][dstPhysId] = workId; + + uint32_t srcMask = Support::bitMask(srcPhysId); + uint32_t dstMask = Support::bitMask(dstPhysId); + + uint32_t dirty = (_physToWorkMap->dirty[group] & srcMask) != 0; + uint32_t regMask = dstMask | srcMask; + + _physToWorkMap->assigned[group] ^= regMask; + _physToWorkMap->dirty[group] ^= regMask & Support::bitMaskFromBool(dirty); + + verify(); + } + + ASMJIT_INLINE void swap(uint32_t group, uint32_t aWorkId, uint32_t aPhysId, uint32_t bWorkId, uint32_t bPhysId) noexcept { + ASMJIT_ASSERT(aPhysId != bPhysId); + ASMJIT_ASSERT(workToPhysId(group, aWorkId) == aPhysId); + ASMJIT_ASSERT(workToPhysId(group, bWorkId) == bPhysId); + ASMJIT_ASSERT(physToWorkId(group, aPhysId) == aWorkId); + ASMJIT_ASSERT(physToWorkId(group, bPhysId) == bWorkId); + ASMJIT_ASSERT(isPhysAssigned(group, aPhysId)); + ASMJIT_ASSERT(isPhysAssigned(group, bPhysId)); + + _workToPhysMap->physIds[aWorkId] = uint8_t(bPhysId); + _workToPhysMap->physIds[bWorkId] = uint8_t(aPhysId); + _physToWorkIds[group][aPhysId] = bWorkId; + _physToWorkIds[group][bPhysId] = aWorkId; + + uint32_t aMask = Support::bitMask(aPhysId); + uint32_t bMask = Support::bitMask(bPhysId); + + uint32_t flipMask = Support::bitMaskFromBool( + ((_physToWorkMap->dirty[group] & aMask) != 0) ^ + ((_physToWorkMap->dirty[group] & bMask) != 0)); + + uint32_t regMask = aMask | bMask; + _physToWorkMap->dirty[group] ^= regMask & flipMask; + + verify(); + } + + //! Unassign [VirtReg/WorkReg] from a physical register. + ASMJIT_INLINE void unassign(uint32_t group, uint32_t workId, uint32_t physId) noexcept { + ASMJIT_ASSERT(physId < Globals::kMaxPhysRegs); + ASMJIT_ASSERT(workToPhysId(group, workId) == physId); + ASMJIT_ASSERT(physToWorkId(group, physId) == workId); + ASMJIT_ASSERT(isPhysAssigned(group, physId)); + + _workToPhysMap->physIds[workId] = kPhysNone; + _physToWorkIds[group][physId] = kWorkNone; + + uint32_t regMask = Support::bitMask(physId); + _physToWorkMap->assigned[group] &= ~regMask; + _physToWorkMap->dirty[group] &= ~regMask; + + verify(); + } + + inline void makeClean(uint32_t group, uint32_t workId, uint32_t physId) noexcept { + DebugUtils::unused(workId); + uint32_t regMask = Support::bitMask(physId); + _physToWorkMap->dirty[group] &= ~regMask; + } + + inline void makeDirty(uint32_t group, uint32_t workId, uint32_t physId) noexcept { + DebugUtils::unused(workId); + uint32_t regMask = Support::bitMask(physId); + _physToWorkMap->dirty[group] |= regMask; + } + + //! \} + + //! \name Utilities + //! \{ + + inline void swap(RAAssignment& other) noexcept { + std::swap(_workToPhysMap, other._workToPhysMap); + std::swap(_physToWorkMap, other._physToWorkMap); + + for (uint32_t group = 0; group < BaseReg::kGroupVirt; group++) + std::swap(_physToWorkIds[group], other._physToWorkIds[group]); + } + + inline void copyFrom(const PhysToWorkMap* physToWorkMap, const WorkToPhysMap* workToPhysMap) noexcept { + memcpy(_physToWorkMap, physToWorkMap, PhysToWorkMap::sizeOf(_layout.physTotal)); + memcpy(_workToPhysMap, workToPhysMap, WorkToPhysMap::sizeOf(_layout.workCount)); + } + + inline void copyFrom(const RAAssignment& other) noexcept { + copyFrom(other.physToWorkMap(), other.workToPhysMap()); + } + + // Not really useful outside of debugging. + bool equals(const RAAssignment& other) const noexcept { + // Layout should always match. + if (_layout.physIndex != other._layout.physIndex || + _layout.physCount != other._layout.physCount || + _layout.physTotal != other._layout.physTotal || + _layout.workCount != other._layout.workCount || + _layout.workRegs != other._layout.workRegs) + return false; + + uint32_t physTotal = _layout.physTotal; + uint32_t workCount = _layout.workCount; + + for (uint32_t physId = 0; physId < physTotal; physId++) { + uint32_t thisWorkId = _physToWorkMap->workIds[physId]; + uint32_t otherWorkId = other._physToWorkMap->workIds[physId]; + if (thisWorkId != otherWorkId) + return false; + } + + for (uint32_t workId = 0; workId < workCount; workId++) { + uint32_t thisPhysId = _workToPhysMap->physIds[workId]; + uint32_t otherPhysId = other._workToPhysMap->physIds[workId]; + if (thisPhysId != otherPhysId) + return false; + } + + if (_physToWorkMap->assigned != other._physToWorkMap->assigned || + _physToWorkMap->dirty != other._physToWorkMap->dirty ) + return false; + + return true; + } + +#if defined(ASMJIT_BUILD_DEBUG) + ASMJIT_NOINLINE void verify() noexcept { + // Verify WorkToPhysMap. + { + for (uint32_t workId = 0; workId < _layout.workCount; workId++) { + uint32_t physId = _workToPhysMap->physIds[workId]; + if (physId != kPhysNone) { + const RAWorkReg* workReg = _layout.workRegs->at(workId); + uint32_t group = workReg->group(); + ASMJIT_ASSERT(_physToWorkIds[group][physId] == workId); + } + } + } + + // Verify PhysToWorkMap. + { + for (uint32_t group = 0; group < BaseReg::kGroupVirt; group++) { + uint32_t physCount = _layout.physCount[group]; + for (uint32_t physId = 0; physId < physCount; physId++) { + uint32_t workId = _physToWorkIds[group][physId]; + if (workId != kWorkNone) { + ASMJIT_ASSERT(_workToPhysMap->physIds[workId] == physId); + } + } + } + } + } +#else + inline void verify() noexcept {} +#endif + + //! \} +}; + +//! \} +//! \endcond + +ASMJIT_END_NAMESPACE + +#endif // !ASMJIT_NO_COMPILER +#endif // ASMJIT_CORE_RAASSIGNMENT_P_H_INCLUDED diff --git a/3rdparty/asmjit/src/asmjit/core/rabuilders_p.h b/3rdparty/asmjit/src/asmjit/core/rabuilders_p.h new file mode 100644 index 00000000000..6f400ad1c3a --- /dev/null +++ b/3rdparty/asmjit/src/asmjit/core/rabuilders_p.h @@ -0,0 +1,632 @@ +// AsmJit - Machine code generation for C++ +// +// * Official AsmJit Home Page: https://asmjit.com +// * Official Github Repository: https://github.com/asmjit/asmjit +// +// Copyright (c) 2008-2020 The AsmJit Authors +// +// This software is provided 'as-is', without any express or implied +// warranty. In no event will the authors be held liable for any damages +// arising from the use of this software. +// +// Permission is granted to anyone to use this software for any purpose, +// including commercial applications, and to alter it and redistribute it +// freely, subject to the following restrictions: +// +// 1. The origin of this software must not be misrepresented; you must not +// claim that you wrote the original software. If you use this software +// in a product, an acknowledgment in the product documentation would be +// appreciated but is not required. +// 2. Altered source versions must be plainly marked as such, and must not be +// misrepresented as being the original software. +// 3. This notice may not be removed or altered from any source distribution. + +#ifndef ASMJIT_CORE_RABUILDERS_P_H_INCLUDED +#define ASMJIT_CORE_RABUILDERS_P_H_INCLUDED + +#include "../core/api-config.h" +#ifndef ASMJIT_NO_COMPILER + +#include "../core/rapass_p.h" + +ASMJIT_BEGIN_NAMESPACE + +//! \cond INTERNAL +//! \addtogroup asmjit_ra +//! \{ + +// ============================================================================ +// [asmjit::RACFGBuilder] +// ============================================================================ + +template +class RACFGBuilder { +public: + RAPass* _pass; + BaseCompiler* _cc; + + RABlock* _curBlock; + RABlock* _retBlock; + FuncNode* _funcNode; + RARegsStats _blockRegStats; + uint32_t _exitLabelId; + ZoneVector _sharedAssignmentsMap; + + // Only used by logging, it's fine to be here to prevent more #ifdefs... + bool _hasCode; + RABlock* _lastLoggedBlock; + +#ifndef ASMJIT_NO_LOGGING + Logger* _logger; + uint32_t _logFlags; + StringTmp<512> _sb; +#endif + + static constexpr uint32_t kRootIndentation = 2; + static constexpr uint32_t kCodeIndentation = 4; + + // NOTE: This is a bit hacky. There are some nodes which are processed twice + // (see `onBeforeCall()` and `onBeforeRet()`) as they can insert some nodes + // around them. Since we don't have any flags to mark these we just use their + // position that is [at that time] unassigned. + static constexpr uint32_t kNodePositionDidOnBefore = 0xFFFFFFFFu; + + inline RACFGBuilder(RAPass* pass) noexcept + : _pass(pass), + _cc(pass->cc()), + _curBlock(nullptr), + _retBlock(nullptr), + _funcNode(nullptr), + _blockRegStats{}, + _exitLabelId(Globals::kInvalidId), + _hasCode(false), + _lastLoggedBlock(nullptr) { +#ifndef ASMJIT_NO_LOGGING + _logger = _pass->debugLogger(); + _logFlags = FormatOptions::kFlagPositions; + + if (_logger) + _logFlags |= _logger->flags(); +#endif + } + + inline BaseCompiler* cc() const noexcept { return _cc; } + + // -------------------------------------------------------------------------- + // [Run] + // -------------------------------------------------------------------------- + + //! Called per function by an architecture-specific CFG builder. + Error run() noexcept { + log("[RAPass::BuildCFG]\n"); + ASMJIT_PROPAGATE(prepare()); + + logNode(_funcNode, kRootIndentation); + logBlock(_curBlock, kRootIndentation); + + BaseNode* node = _funcNode->next(); + if (ASMJIT_UNLIKELY(!node)) + return DebugUtils::errored(kErrorInvalidState); + + _curBlock->setFirst(node); + _curBlock->setLast(node); + + RAInstBuilder ib; + ZoneVector blocksWithUnknownJumps; + + for (;;) { + BaseNode* next = node->next(); + ASMJIT_ASSERT(node->position() == 0 || node->position() == kNodePositionDidOnBefore); + + if (node->isInst()) { + // Instruction | Jump | Invoke | Return + // ------------------------------------ + + // Handle `InstNode`, `FuncCallNode`, and `FuncRetNode`. All of them + // share the same interface that provides operands that have read/write + // semantics. + if (ASMJIT_UNLIKELY(!_curBlock)) { + // Unreachable code has to be removed, we cannot allocate registers + // in such code as we cannot do proper liveness analysis in such case. + removeNode(node); + node = next; + continue; + } + + _hasCode = true; + + if (node->isFuncCall() || node->isFuncRet()) { + if (node->position() != kNodePositionDidOnBefore) { + // Call and Reg are complicated as they may insert some surrounding + // code around them. The simplest approach is to get the previous + // node, call the `onBefore()` handlers and then check whether + // anything changed and restart if so. By restart we mean that the + // current `node` would go back to the first possible inserted node + // by `onBeforeCall()` or `onBeforeRet()`. + BaseNode* prev = node->prev(); + + if (node->type() == BaseNode::kNodeFuncCall) + ASMJIT_PROPAGATE(static_cast(this)->onBeforeCall(node->as())); + else + ASMJIT_PROPAGATE(static_cast(this)->onBeforeRet(node->as())); + + if (prev != node->prev()) { + // If this was the first node in the block and something was + // inserted before it then we have to update the first block. + if (_curBlock->first() == node) + _curBlock->setFirst(prev->next()); + + node->setPosition(kNodePositionDidOnBefore); + node = prev->next(); + + // `onBeforeCall()` and `onBeforeRet()` can only insert instructions. + ASMJIT_ASSERT(node->isInst()); + } + + // Necessary if something was inserted after `node`, but nothing before. + next = node->next(); + } + else { + // Change the position back to its original value. + node->setPosition(0); + } + } + + InstNode* inst = node->as(); + logNode(inst, kCodeIndentation); + + uint32_t controlType = BaseInst::kControlNone; + ib.reset(); + ASMJIT_PROPAGATE(static_cast(this)->onInst(inst, controlType, ib)); + + if (node->isFuncCall()) { + ASMJIT_PROPAGATE(static_cast(this)->onCall(inst->as(), ib)); + } + + if (node->isFuncRet()) { + ASMJIT_PROPAGATE(static_cast(this)->onRet(inst->as(), ib)); + controlType = BaseInst::kControlReturn; + } + + if (controlType == BaseInst::kControlJump) { + uint32_t fixedRegCount = 0; + for (RATiedReg& tiedReg : ib) { + RAWorkReg* workReg = _pass->workRegById(tiedReg.workId()); + if (workReg->group() == BaseReg::kGroupGp) { + uint32_t useId = tiedReg.useId(); + if (useId == BaseReg::kIdBad) { + useId = _pass->_scratchRegIndexes[fixedRegCount++]; + tiedReg.setUseId(useId); + } + _curBlock->addExitScratchGpRegs(Support::bitMask(useId)); + } + } + } + + ASMJIT_PROPAGATE(_pass->assignRAInst(inst, _curBlock, ib)); + _blockRegStats.combineWith(ib._stats); + + if (controlType != BaseInst::kControlNone) { + // Support for conditional and unconditional jumps. + if (controlType == BaseInst::kControlJump || controlType == BaseInst::kControlBranch) { + _curBlock->setLast(node); + _curBlock->addFlags(RABlock::kFlagHasTerminator); + _curBlock->makeConstructed(_blockRegStats); + + if (!(inst->instOptions() & BaseInst::kOptionUnfollow)) { + // Jmp/Jcc/Call/Loop/etc... + uint32_t opCount = inst->opCount(); + const Operand* opArray = inst->operands(); + + // Cannot jump anywhere without operands. + if (ASMJIT_UNLIKELY(!opCount)) + return DebugUtils::errored(kErrorInvalidState); + + if (opArray[opCount - 1].isLabel()) { + // Labels are easy for constructing the control flow. + LabelNode* labelNode; + ASMJIT_PROPAGATE(cc()->labelNodeOf(&labelNode, opArray[opCount - 1].as